From f981682bdc0ca0235d04629c358643be610a860d Mon Sep 17 00:00:00 2001 From: Massimiliano Culpo Date: Thu, 18 Nov 2021 15:08:59 +0100 Subject: Allow recent pytest versions to be used with Spack (#25371) Currently Spack vendors `pytest` at a version which is three major versions behind the latest (3.2.5 vs. 6.2.4). We do that since v3.2.5 is the latest version supporting Python 2.6. Remaining so much behind the currently supported versions though might introduce some incompatibilities and is surely a technical debt. This PR modifies Spack to: - Use the vendored `pytest@3.2.5` only as a fallback solution, if the Python interpreter used for Spack doesn't provide a newer one - Be able to parse `pytest --collect-only` in all the different output formats from v3.2.5 to v6.2.4 and use it consistently for `spack unit-test --list-*` - Updating the unit tests in Github Actions to use a more recent `pytest` version --- .github/workflows/unit_tests.yaml | 8 +- lib/spack/docs/conf.py | 1 + lib/spack/external/_pytest/LICENSE | 21 - lib/spack/external/_pytest/__init__.py | 8 - lib/spack/external/_pytest/_argcomplete.py | 106 -- lib/spack/external/_pytest/_code/__init__.py | 10 - lib/spack/external/_pytest/_code/_py2traceback.py | 85 -- lib/spack/external/_pytest/_code/code.py | 908 ------------- lib/spack/external/_pytest/_code/source.py | 416 ------ lib/spack/external/_pytest/_pluggy.py | 11 - lib/spack/external/_pytest/_version.py | 4 - lib/spack/external/_pytest/assertion/__init__.py | 148 --- lib/spack/external/_pytest/assertion/rewrite.py | 952 ------------- lib/spack/external/_pytest/assertion/truncate.py | 102 -- lib/spack/external/_pytest/assertion/util.py | 310 ----- lib/spack/external/_pytest/cacheprovider.py | 260 ---- lib/spack/external/_pytest/capture.py | 577 -------- lib/spack/external/_pytest/compat.py | 326 ----- lib/spack/external/_pytest/config.py | 1398 -------------------- lib/spack/external/_pytest/debugging.py | 123 -- lib/spack/external/_pytest/deprecated.py | 42 - lib/spack/external/_pytest/doctest.py | 362 ----- lib/spack/external/_pytest/fixtures.py | 1137 ---------------- lib/spack/external/_pytest/freeze_support.py | 43 - lib/spack/external/_pytest/helpconfig.py | 184 --- lib/spack/external/_pytest/hookspec.py | 423 ------ lib/spack/external/_pytest/junitxml.py | 453 ------- lib/spack/external/_pytest/main.py | 838 ------------ lib/spack/external/_pytest/mark.py | 465 ------- lib/spack/external/_pytest/monkeypatch.py | 259 ---- lib/spack/external/_pytest/nodes.py | 37 - lib/spack/external/_pytest/nose.py | 73 - lib/spack/external/_pytest/outcomes.py | 140 -- lib/spack/external/_pytest/pastebin.py | 100 -- lib/spack/external/_pytest/pytester.py | 1167 ---------------- lib/spack/external/_pytest/python.py | 1173 ---------------- lib/spack/external/_pytest/python_api.py | 629 --------- lib/spack/external/_pytest/recwarn.py | 205 --- lib/spack/external/_pytest/resultlog.py | 113 -- lib/spack/external/_pytest/runner.py | 508 ------- lib/spack/external/_pytest/setuponly.py | 74 -- lib/spack/external/_pytest/setupplan.py | 25 - lib/spack/external/_pytest/skipping.py | 372 ------ lib/spack/external/_pytest/terminal.py | 650 --------- lib/spack/external/_pytest/tmpdir.py | 126 -- lib/spack/external/_pytest/unittest.py | 239 ---- .../external/_pytest/vendored_packages/README.md | 13 - .../external/_pytest/vendored_packages/__init__.py | 0 .../pluggy-0.4.0.dist-info/DESCRIPTION.rst | 11 - .../pluggy-0.4.0.dist-info/INSTALLER | 1 - .../pluggy-0.4.0.dist-info/LICENSE.txt | 22 - .../pluggy-0.4.0.dist-info/METADATA | 40 - .../pluggy-0.4.0.dist-info/RECORD | 9 - .../vendored_packages/pluggy-0.4.0.dist-info/WHEEL | 6 - .../pluggy-0.4.0.dist-info/metadata.json | 1 - .../pluggy-0.4.0.dist-info/top_level.txt | 1 - .../external/_pytest/vendored_packages/pluggy.py | 782 ----------- lib/spack/external/_pytest/warnings.py | 94 -- lib/spack/external/py/__init__.py | 152 --- lib/spack/external/py/__metainfo.py | 2 - lib/spack/external/py/_apipkg.py | 181 --- lib/spack/external/py/_builtin.py | 248 ---- lib/spack/external/py/_code/__init__.py | 1 - lib/spack/external/py/_code/_assertionnew.py | 339 ----- lib/spack/external/py/_code/_assertionold.py | 555 -------- lib/spack/external/py/_code/_py2traceback.py | 79 -- lib/spack/external/py/_code/assertion.py | 94 -- lib/spack/external/py/_code/code.py | 787 ----------- lib/spack/external/py/_code/source.py | 411 ------ lib/spack/external/py/_error.py | 89 -- lib/spack/external/py/_iniconfig.py | 162 --- lib/spack/external/py/_io/__init__.py | 1 - lib/spack/external/py/_io/capture.py | 371 ------ lib/spack/external/py/_io/saferepr.py | 71 - lib/spack/external/py/_io/terminalwriter.py | 357 ----- lib/spack/external/py/_log/__init__.py | 2 - lib/spack/external/py/_log/log.py | 186 --- lib/spack/external/py/_log/warning.py | 76 -- lib/spack/external/py/_path/__init__.py | 1 - lib/spack/external/py/_path/cacheutil.py | 114 -- lib/spack/external/py/_path/common.py | 445 ------- lib/spack/external/py/_path/local.py | 930 ------------- lib/spack/external/py/_path/svnurl.py | 380 ------ lib/spack/external/py/_path/svnwc.py | 1240 ----------------- lib/spack/external/py/_process/__init__.py | 1 - lib/spack/external/py/_process/cmdexec.py | 49 - lib/spack/external/py/_process/forkedfunc.py | 120 -- lib/spack/external/py/_process/killproc.py | 23 - lib/spack/external/py/_std.py | 18 - lib/spack/external/py/_xmlgen.py | 255 ---- lib/spack/external/py/test.py | 10 - lib/spack/external/pytest-fallback/_pytest/LICENSE | 21 + .../external/pytest-fallback/_pytest/__init__.py | 8 + .../pytest-fallback/_pytest/_argcomplete.py | 106 ++ .../pytest-fallback/_pytest/_code/__init__.py | 10 + .../pytest-fallback/_pytest/_code/_py2traceback.py | 85 ++ .../external/pytest-fallback/_pytest/_code/code.py | 908 +++++++++++++ .../pytest-fallback/_pytest/_code/source.py | 416 ++++++ .../external/pytest-fallback/_pytest/_pluggy.py | 11 + .../external/pytest-fallback/_pytest/_version.py | 4 + .../pytest-fallback/_pytest/assertion/__init__.py | 148 +++ .../pytest-fallback/_pytest/assertion/rewrite.py | 952 +++++++++++++ .../pytest-fallback/_pytest/assertion/truncate.py | 102 ++ .../pytest-fallback/_pytest/assertion/util.py | 310 +++++ .../pytest-fallback/_pytest/cacheprovider.py | 260 ++++ .../external/pytest-fallback/_pytest/capture.py | 577 ++++++++ .../external/pytest-fallback/_pytest/compat.py | 326 +++++ .../external/pytest-fallback/_pytest/config.py | 1398 ++++++++++++++++++++ .../external/pytest-fallback/_pytest/debugging.py | 123 ++ .../external/pytest-fallback/_pytest/deprecated.py | 42 + .../external/pytest-fallback/_pytest/doctest.py | 362 +++++ .../external/pytest-fallback/_pytest/fixtures.py | 1137 ++++++++++++++++ .../pytest-fallback/_pytest/freeze_support.py | 43 + .../external/pytest-fallback/_pytest/helpconfig.py | 184 +++ .../external/pytest-fallback/_pytest/hookspec.py | 423 ++++++ .../external/pytest-fallback/_pytest/junitxml.py | 453 +++++++ lib/spack/external/pytest-fallback/_pytest/main.py | 838 ++++++++++++ lib/spack/external/pytest-fallback/_pytest/mark.py | 465 +++++++ .../pytest-fallback/_pytest/monkeypatch.py | 259 ++++ .../external/pytest-fallback/_pytest/nodes.py | 37 + lib/spack/external/pytest-fallback/_pytest/nose.py | 73 + .../external/pytest-fallback/_pytest/outcomes.py | 140 ++ .../external/pytest-fallback/_pytest/pastebin.py | 100 ++ .../external/pytest-fallback/_pytest/pytester.py | 1167 ++++++++++++++++ .../external/pytest-fallback/_pytest/python.py | 1173 ++++++++++++++++ .../external/pytest-fallback/_pytest/python_api.py | 629 +++++++++ .../external/pytest-fallback/_pytest/recwarn.py | 205 +++ .../external/pytest-fallback/_pytest/resultlog.py | 113 ++ .../external/pytest-fallback/_pytest/runner.py | 508 +++++++ .../external/pytest-fallback/_pytest/setuponly.py | 74 ++ .../external/pytest-fallback/_pytest/setupplan.py | 25 + .../external/pytest-fallback/_pytest/skipping.py | 372 ++++++ .../external/pytest-fallback/_pytest/terminal.py | 650 +++++++++ .../external/pytest-fallback/_pytest/tmpdir.py | 126 ++ .../external/pytest-fallback/_pytest/unittest.py | 239 ++++ .../_pytest/vendored_packages/README.md | 13 + .../_pytest/vendored_packages/__init__.py | 0 .../pluggy-0.4.0.dist-info/DESCRIPTION.rst | 11 + .../pluggy-0.4.0.dist-info/INSTALLER | 1 + .../pluggy-0.4.0.dist-info/LICENSE.txt | 22 + .../pluggy-0.4.0.dist-info/METADATA | 40 + .../pluggy-0.4.0.dist-info/RECORD | 9 + .../vendored_packages/pluggy-0.4.0.dist-info/WHEEL | 6 + .../pluggy-0.4.0.dist-info/metadata.json | 1 + .../pluggy-0.4.0.dist-info/top_level.txt | 1 + .../_pytest/vendored_packages/pluggy.py | 782 +++++++++++ .../external/pytest-fallback/_pytest/warnings.py | 94 ++ lib/spack/external/pytest-fallback/py/__init__.py | 152 +++ .../external/pytest-fallback/py/__metainfo.py | 2 + lib/spack/external/pytest-fallback/py/_apipkg.py | 181 +++ lib/spack/external/pytest-fallback/py/_builtin.py | 248 ++++ .../external/pytest-fallback/py/_code/__init__.py | 1 + .../pytest-fallback/py/_code/_assertionnew.py | 339 +++++ .../pytest-fallback/py/_code/_assertionold.py | 555 ++++++++ .../pytest-fallback/py/_code/_py2traceback.py | 79 ++ .../external/pytest-fallback/py/_code/assertion.py | 94 ++ .../external/pytest-fallback/py/_code/code.py | 787 +++++++++++ .../external/pytest-fallback/py/_code/source.py | 411 ++++++ lib/spack/external/pytest-fallback/py/_error.py | 89 ++ .../external/pytest-fallback/py/_iniconfig.py | 162 +++ .../external/pytest-fallback/py/_io/__init__.py | 1 + .../external/pytest-fallback/py/_io/capture.py | 371 ++++++ .../external/pytest-fallback/py/_io/saferepr.py | 71 + .../pytest-fallback/py/_io/terminalwriter.py | 357 +++++ .../external/pytest-fallback/py/_log/__init__.py | 2 + lib/spack/external/pytest-fallback/py/_log/log.py | 186 +++ .../external/pytest-fallback/py/_log/warning.py | 76 ++ .../external/pytest-fallback/py/_path/__init__.py | 1 + .../external/pytest-fallback/py/_path/cacheutil.py | 114 ++ .../external/pytest-fallback/py/_path/common.py | 445 +++++++ .../external/pytest-fallback/py/_path/local.py | 930 +++++++++++++ .../external/pytest-fallback/py/_path/svnurl.py | 380 ++++++ .../external/pytest-fallback/py/_path/svnwc.py | 1240 +++++++++++++++++ .../pytest-fallback/py/_process/__init__.py | 1 + .../pytest-fallback/py/_process/cmdexec.py | 49 + .../pytest-fallback/py/_process/forkedfunc.py | 120 ++ .../pytest-fallback/py/_process/killproc.py | 23 + lib/spack/external/pytest-fallback/py/_std.py | 18 + lib/spack/external/pytest-fallback/py/_xmlgen.py | 255 ++++ lib/spack/external/pytest-fallback/py/test.py | 10 + lib/spack/external/pytest-fallback/pytest.py | 100 ++ lib/spack/external/pytest.py | 100 -- lib/spack/spack/cmd/unit_test.py | 86 +- lib/spack/spack/test/cmd/unit_test.py | 5 +- lib/spack/spack/test/conftest.py | 12 +- 185 files changed, 24512 insertions(+), 24464 deletions(-) delete mode 100644 lib/spack/external/_pytest/LICENSE delete mode 100644 lib/spack/external/_pytest/__init__.py delete mode 100644 lib/spack/external/_pytest/_argcomplete.py delete mode 100644 lib/spack/external/_pytest/_code/__init__.py delete mode 100644 lib/spack/external/_pytest/_code/_py2traceback.py delete mode 100644 lib/spack/external/_pytest/_code/code.py delete mode 100644 lib/spack/external/_pytest/_code/source.py delete mode 100644 lib/spack/external/_pytest/_pluggy.py delete mode 100644 lib/spack/external/_pytest/_version.py delete mode 100644 lib/spack/external/_pytest/assertion/__init__.py delete mode 100644 lib/spack/external/_pytest/assertion/rewrite.py delete mode 100644 lib/spack/external/_pytest/assertion/truncate.py delete mode 100644 lib/spack/external/_pytest/assertion/util.py delete mode 100755 lib/spack/external/_pytest/cacheprovider.py delete mode 100644 lib/spack/external/_pytest/capture.py delete mode 100644 lib/spack/external/_pytest/compat.py delete mode 100644 lib/spack/external/_pytest/config.py delete mode 100644 lib/spack/external/_pytest/debugging.py delete mode 100644 lib/spack/external/_pytest/deprecated.py delete mode 100644 lib/spack/external/_pytest/doctest.py delete mode 100644 lib/spack/external/_pytest/fixtures.py delete mode 100644 lib/spack/external/_pytest/freeze_support.py delete mode 100644 lib/spack/external/_pytest/helpconfig.py delete mode 100644 lib/spack/external/_pytest/hookspec.py delete mode 100644 lib/spack/external/_pytest/junitxml.py delete mode 100644 lib/spack/external/_pytest/main.py delete mode 100644 lib/spack/external/_pytest/mark.py delete mode 100644 lib/spack/external/_pytest/monkeypatch.py delete mode 100644 lib/spack/external/_pytest/nodes.py delete mode 100644 lib/spack/external/_pytest/nose.py delete mode 100644 lib/spack/external/_pytest/outcomes.py delete mode 100644 lib/spack/external/_pytest/pastebin.py delete mode 100644 lib/spack/external/_pytest/pytester.py delete mode 100644 lib/spack/external/_pytest/python.py delete mode 100644 lib/spack/external/_pytest/python_api.py delete mode 100644 lib/spack/external/_pytest/recwarn.py delete mode 100644 lib/spack/external/_pytest/resultlog.py delete mode 100644 lib/spack/external/_pytest/runner.py delete mode 100644 lib/spack/external/_pytest/setuponly.py delete mode 100644 lib/spack/external/_pytest/setupplan.py delete mode 100644 lib/spack/external/_pytest/skipping.py delete mode 100644 lib/spack/external/_pytest/terminal.py delete mode 100644 lib/spack/external/_pytest/tmpdir.py delete mode 100644 lib/spack/external/_pytest/unittest.py delete mode 100644 lib/spack/external/_pytest/vendored_packages/README.md delete mode 100644 lib/spack/external/_pytest/vendored_packages/__init__.py delete mode 100644 lib/spack/external/_pytest/vendored_packages/pluggy-0.4.0.dist-info/DESCRIPTION.rst delete mode 100644 lib/spack/external/_pytest/vendored_packages/pluggy-0.4.0.dist-info/INSTALLER delete mode 100644 lib/spack/external/_pytest/vendored_packages/pluggy-0.4.0.dist-info/LICENSE.txt delete mode 100644 lib/spack/external/_pytest/vendored_packages/pluggy-0.4.0.dist-info/METADATA delete mode 100644 lib/spack/external/_pytest/vendored_packages/pluggy-0.4.0.dist-info/RECORD delete mode 100644 lib/spack/external/_pytest/vendored_packages/pluggy-0.4.0.dist-info/WHEEL delete mode 100644 lib/spack/external/_pytest/vendored_packages/pluggy-0.4.0.dist-info/metadata.json delete mode 100644 lib/spack/external/_pytest/vendored_packages/pluggy-0.4.0.dist-info/top_level.txt delete mode 100644 lib/spack/external/_pytest/vendored_packages/pluggy.py delete mode 100644 lib/spack/external/_pytest/warnings.py delete mode 100644 lib/spack/external/py/__init__.py delete mode 100644 lib/spack/external/py/__metainfo.py delete mode 100644 lib/spack/external/py/_apipkg.py delete mode 100644 lib/spack/external/py/_builtin.py delete mode 100644 lib/spack/external/py/_code/__init__.py delete mode 100644 lib/spack/external/py/_code/_assertionnew.py delete mode 100644 lib/spack/external/py/_code/_assertionold.py delete mode 100644 lib/spack/external/py/_code/_py2traceback.py delete mode 100644 lib/spack/external/py/_code/assertion.py delete mode 100644 lib/spack/external/py/_code/code.py delete mode 100644 lib/spack/external/py/_code/source.py delete mode 100644 lib/spack/external/py/_error.py delete mode 100644 lib/spack/external/py/_iniconfig.py delete mode 100644 lib/spack/external/py/_io/__init__.py delete mode 100644 lib/spack/external/py/_io/capture.py delete mode 100644 lib/spack/external/py/_io/saferepr.py delete mode 100644 lib/spack/external/py/_io/terminalwriter.py delete mode 100644 lib/spack/external/py/_log/__init__.py delete mode 100644 lib/spack/external/py/_log/log.py delete mode 100644 lib/spack/external/py/_log/warning.py delete mode 100644 lib/spack/external/py/_path/__init__.py delete mode 100644 lib/spack/external/py/_path/cacheutil.py delete mode 100644 lib/spack/external/py/_path/common.py delete mode 100644 lib/spack/external/py/_path/local.py delete mode 100644 lib/spack/external/py/_path/svnurl.py delete mode 100644 lib/spack/external/py/_path/svnwc.py delete mode 100644 lib/spack/external/py/_process/__init__.py delete mode 100644 lib/spack/external/py/_process/cmdexec.py delete mode 100644 lib/spack/external/py/_process/forkedfunc.py delete mode 100644 lib/spack/external/py/_process/killproc.py delete mode 100644 lib/spack/external/py/_std.py delete mode 100644 lib/spack/external/py/_xmlgen.py delete mode 100644 lib/spack/external/py/test.py create mode 100644 lib/spack/external/pytest-fallback/_pytest/LICENSE create mode 100644 lib/spack/external/pytest-fallback/_pytest/__init__.py create mode 100644 lib/spack/external/pytest-fallback/_pytest/_argcomplete.py create mode 100644 lib/spack/external/pytest-fallback/_pytest/_code/__init__.py create mode 100644 lib/spack/external/pytest-fallback/_pytest/_code/_py2traceback.py create mode 100644 lib/spack/external/pytest-fallback/_pytest/_code/code.py create mode 100644 lib/spack/external/pytest-fallback/_pytest/_code/source.py create mode 100644 lib/spack/external/pytest-fallback/_pytest/_pluggy.py create mode 100644 lib/spack/external/pytest-fallback/_pytest/_version.py create mode 100644 lib/spack/external/pytest-fallback/_pytest/assertion/__init__.py create mode 100644 lib/spack/external/pytest-fallback/_pytest/assertion/rewrite.py create mode 100644 lib/spack/external/pytest-fallback/_pytest/assertion/truncate.py create mode 100644 lib/spack/external/pytest-fallback/_pytest/assertion/util.py create mode 100755 lib/spack/external/pytest-fallback/_pytest/cacheprovider.py create mode 100644 lib/spack/external/pytest-fallback/_pytest/capture.py create mode 100644 lib/spack/external/pytest-fallback/_pytest/compat.py create mode 100644 lib/spack/external/pytest-fallback/_pytest/config.py create mode 100644 lib/spack/external/pytest-fallback/_pytest/debugging.py create mode 100644 lib/spack/external/pytest-fallback/_pytest/deprecated.py create mode 100644 lib/spack/external/pytest-fallback/_pytest/doctest.py create mode 100644 lib/spack/external/pytest-fallback/_pytest/fixtures.py create mode 100644 lib/spack/external/pytest-fallback/_pytest/freeze_support.py create mode 100644 lib/spack/external/pytest-fallback/_pytest/helpconfig.py create mode 100644 lib/spack/external/pytest-fallback/_pytest/hookspec.py create mode 100644 lib/spack/external/pytest-fallback/_pytest/junitxml.py create mode 100644 lib/spack/external/pytest-fallback/_pytest/main.py create mode 100644 lib/spack/external/pytest-fallback/_pytest/mark.py create mode 100644 lib/spack/external/pytest-fallback/_pytest/monkeypatch.py create mode 100644 lib/spack/external/pytest-fallback/_pytest/nodes.py create mode 100644 lib/spack/external/pytest-fallback/_pytest/nose.py create mode 100644 lib/spack/external/pytest-fallback/_pytest/outcomes.py create mode 100644 lib/spack/external/pytest-fallback/_pytest/pastebin.py create mode 100644 lib/spack/external/pytest-fallback/_pytest/pytester.py create mode 100644 lib/spack/external/pytest-fallback/_pytest/python.py create mode 100644 lib/spack/external/pytest-fallback/_pytest/python_api.py create mode 100644 lib/spack/external/pytest-fallback/_pytest/recwarn.py create mode 100644 lib/spack/external/pytest-fallback/_pytest/resultlog.py create mode 100644 lib/spack/external/pytest-fallback/_pytest/runner.py create mode 100644 lib/spack/external/pytest-fallback/_pytest/setuponly.py create mode 100644 lib/spack/external/pytest-fallback/_pytest/setupplan.py create mode 100644 lib/spack/external/pytest-fallback/_pytest/skipping.py create mode 100644 lib/spack/external/pytest-fallback/_pytest/terminal.py create mode 100644 lib/spack/external/pytest-fallback/_pytest/tmpdir.py create mode 100644 lib/spack/external/pytest-fallback/_pytest/unittest.py create mode 100644 lib/spack/external/pytest-fallback/_pytest/vendored_packages/README.md create mode 100644 lib/spack/external/pytest-fallback/_pytest/vendored_packages/__init__.py create mode 100644 lib/spack/external/pytest-fallback/_pytest/vendored_packages/pluggy-0.4.0.dist-info/DESCRIPTION.rst create mode 100644 lib/spack/external/pytest-fallback/_pytest/vendored_packages/pluggy-0.4.0.dist-info/INSTALLER create mode 100644 lib/spack/external/pytest-fallback/_pytest/vendored_packages/pluggy-0.4.0.dist-info/LICENSE.txt create mode 100644 lib/spack/external/pytest-fallback/_pytest/vendored_packages/pluggy-0.4.0.dist-info/METADATA create mode 100644 lib/spack/external/pytest-fallback/_pytest/vendored_packages/pluggy-0.4.0.dist-info/RECORD create mode 100644 lib/spack/external/pytest-fallback/_pytest/vendored_packages/pluggy-0.4.0.dist-info/WHEEL create mode 100644 lib/spack/external/pytest-fallback/_pytest/vendored_packages/pluggy-0.4.0.dist-info/metadata.json create mode 100644 lib/spack/external/pytest-fallback/_pytest/vendored_packages/pluggy-0.4.0.dist-info/top_level.txt create mode 100644 lib/spack/external/pytest-fallback/_pytest/vendored_packages/pluggy.py create mode 100644 lib/spack/external/pytest-fallback/_pytest/warnings.py create mode 100644 lib/spack/external/pytest-fallback/py/__init__.py create mode 100644 lib/spack/external/pytest-fallback/py/__metainfo.py create mode 100644 lib/spack/external/pytest-fallback/py/_apipkg.py create mode 100644 lib/spack/external/pytest-fallback/py/_builtin.py create mode 100644 lib/spack/external/pytest-fallback/py/_code/__init__.py create mode 100644 lib/spack/external/pytest-fallback/py/_code/_assertionnew.py create mode 100644 lib/spack/external/pytest-fallback/py/_code/_assertionold.py create mode 100644 lib/spack/external/pytest-fallback/py/_code/_py2traceback.py create mode 100644 lib/spack/external/pytest-fallback/py/_code/assertion.py create mode 100644 lib/spack/external/pytest-fallback/py/_code/code.py create mode 100644 lib/spack/external/pytest-fallback/py/_code/source.py create mode 100644 lib/spack/external/pytest-fallback/py/_error.py create mode 100644 lib/spack/external/pytest-fallback/py/_iniconfig.py create mode 100644 lib/spack/external/pytest-fallback/py/_io/__init__.py create mode 100644 lib/spack/external/pytest-fallback/py/_io/capture.py create mode 100644 lib/spack/external/pytest-fallback/py/_io/saferepr.py create mode 100644 lib/spack/external/pytest-fallback/py/_io/terminalwriter.py create mode 100644 lib/spack/external/pytest-fallback/py/_log/__init__.py create mode 100644 lib/spack/external/pytest-fallback/py/_log/log.py create mode 100644 lib/spack/external/pytest-fallback/py/_log/warning.py create mode 100644 lib/spack/external/pytest-fallback/py/_path/__init__.py create mode 100644 lib/spack/external/pytest-fallback/py/_path/cacheutil.py create mode 100644 lib/spack/external/pytest-fallback/py/_path/common.py create mode 100644 lib/spack/external/pytest-fallback/py/_path/local.py create mode 100644 lib/spack/external/pytest-fallback/py/_path/svnurl.py create mode 100644 lib/spack/external/pytest-fallback/py/_path/svnwc.py create mode 100644 lib/spack/external/pytest-fallback/py/_process/__init__.py create mode 100644 lib/spack/external/pytest-fallback/py/_process/cmdexec.py create mode 100644 lib/spack/external/pytest-fallback/py/_process/forkedfunc.py create mode 100644 lib/spack/external/pytest-fallback/py/_process/killproc.py create mode 100644 lib/spack/external/pytest-fallback/py/_std.py create mode 100644 lib/spack/external/pytest-fallback/py/_xmlgen.py create mode 100644 lib/spack/external/pytest-fallback/py/test.py create mode 100644 lib/spack/external/pytest-fallback/pytest.py delete mode 100644 lib/spack/external/pytest.py diff --git a/.github/workflows/unit_tests.yaml b/.github/workflows/unit_tests.yaml index 764a9cdcf0..2e8f9deef6 100644 --- a/.github/workflows/unit_tests.yaml +++ b/.github/workflows/unit_tests.yaml @@ -114,7 +114,7 @@ jobs: patchelf cmake bison libbison-dev kcov - name: Install Python packages run: | - pip install --upgrade pip six setuptools codecov coverage[toml] + pip install --upgrade pip six setuptools pytest codecov coverage[toml] # ensure style checks are not skipped in unit tests for python >= 3.6 # note that true/false (i.e., 1/0) are opposite in conditions in python and bash if python -c 'import sys; sys.exit(not sys.version_info >= (3, 6))'; then @@ -173,7 +173,7 @@ jobs: sudo apt-get install -y coreutils kcov csh zsh tcsh fish dash bash - name: Install Python packages run: | - pip install --upgrade pip six setuptools codecov coverage[toml] + pip install --upgrade pip six setuptools pytest codecov coverage[toml] - name: Setup git configuration run: | # Need this for the git tests to succeed. @@ -274,7 +274,7 @@ jobs: patchelf kcov - name: Install Python packages run: | - pip install --upgrade pip six setuptools codecov coverage[toml] clingo + pip install --upgrade pip six setuptools pytest codecov coverage[toml] clingo - name: Setup git configuration run: | # Need this for the git tests to succeed. @@ -317,7 +317,7 @@ jobs: - name: Install Python packages run: | pip install --upgrade pip six setuptools - pip install --upgrade codecov coverage[toml] + pip install --upgrade pytest codecov coverage[toml] - name: Setup Homebrew packages run: | brew install dash fish gcc gnupg2 kcov diff --git a/lib/spack/docs/conf.py b/lib/spack/docs/conf.py index 2b58223e1d..d0a2bb9e33 100644 --- a/lib/spack/docs/conf.py +++ b/lib/spack/docs/conf.py @@ -30,6 +30,7 @@ from sphinx.ext.apidoc import main as sphinx_apidoc # add these directories to sys.path here. If the directory is relative to the # documentation root, use os.path.abspath to make it absolute, like shown here. sys.path.insert(0, os.path.abspath('_spack_root/lib/spack/external')) +sys.path.insert(0, os.path.abspath('_spack_root/lib/spack/external/pytest-fallback')) if sys.version_info[0] < 3: sys.path.insert( diff --git a/lib/spack/external/_pytest/LICENSE b/lib/spack/external/_pytest/LICENSE deleted file mode 100644 index 629df45ac4..0000000000 --- a/lib/spack/external/_pytest/LICENSE +++ /dev/null @@ -1,21 +0,0 @@ -The MIT License (MIT) - -Copyright (c) 2004-2017 Holger Krekel and others - -Permission is hereby granted, free of charge, to any person obtaining a copy of -this software and associated documentation files (the "Software"), to deal in -the Software without restriction, including without limitation the rights to -use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies -of the Software, and to permit persons to whom the Software is furnished to do -so, subject to the following conditions: - -The above copyright notice and this permission notice shall be included in all -copies or substantial portions of the Software. - -THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR -IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, -FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE -AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER -LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, -OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE -SOFTWARE. diff --git a/lib/spack/external/_pytest/__init__.py b/lib/spack/external/_pytest/__init__.py deleted file mode 100644 index 6e41f0504e..0000000000 --- a/lib/spack/external/_pytest/__init__.py +++ /dev/null @@ -1,8 +0,0 @@ -__all__ = ['__version__'] - -try: - from ._version import version as __version__ -except ImportError: - # broken installation, we don't even try - # unknown only works because we do poor mans version compare - __version__ = 'unknown' diff --git a/lib/spack/external/_pytest/_argcomplete.py b/lib/spack/external/_pytest/_argcomplete.py deleted file mode 100644 index 965ec79513..0000000000 --- a/lib/spack/external/_pytest/_argcomplete.py +++ /dev/null @@ -1,106 +0,0 @@ - -"""allow bash-completion for argparse with argcomplete if installed -needs argcomplete>=0.5.6 for python 3.2/3.3 (older versions fail -to find the magic string, so _ARGCOMPLETE env. var is never set, and -this does not need special code. - -argcomplete does not support python 2.5 (although the changes for that -are minor). - -Function try_argcomplete(parser) should be called directly before -the call to ArgumentParser.parse_args(). - -The filescompleter is what you normally would use on the positional -arguments specification, in order to get "dirname/" after "dirn" -instead of the default "dirname ": - - optparser.add_argument(Config._file_or_dir, nargs='*' - ).completer=filescompleter - -Other, application specific, completers should go in the file -doing the add_argument calls as they need to be specified as .completer -attributes as well. (If argcomplete is not installed, the function the -attribute points to will not be used). - -SPEEDUP -======= -The generic argcomplete script for bash-completion -(/etc/bash_completion.d/python-argcomplete.sh ) -uses a python program to determine startup script generated by pip. -You can speed up completion somewhat by changing this script to include - # PYTHON_ARGCOMPLETE_OK -so the the python-argcomplete-check-easy-install-script does not -need to be called to find the entry point of the code and see if that is -marked with PYTHON_ARGCOMPLETE_OK - -INSTALL/DEBUGGING -================= -To include this support in another application that has setup.py generated -scripts: -- add the line: - # PYTHON_ARGCOMPLETE_OK - near the top of the main python entry point -- include in the file calling parse_args(): - from _argcomplete import try_argcomplete, filescompleter - , call try_argcomplete just before parse_args(), and optionally add - filescompleter to the positional arguments' add_argument() -If things do not work right away: -- switch on argcomplete debugging with (also helpful when doing custom - completers): - export _ARC_DEBUG=1 -- run: - python-argcomplete-check-easy-install-script $(which appname) - echo $? - will echo 0 if the magic line has been found, 1 if not -- sometimes it helps to find early on errors using: - _ARGCOMPLETE=1 _ARC_DEBUG=1 appname - which should throw a KeyError: 'COMPLINE' (which is properly set by the - global argcomplete script). -""" -from __future__ import absolute_import, division, print_function -import sys -import os -from glob import glob - - -class FastFilesCompleter: - 'Fast file completer class' - - def __init__(self, directories=True): - self.directories = directories - - def __call__(self, prefix, **kwargs): - """only called on non option completions""" - if os.path.sep in prefix[1:]: - prefix_dir = len(os.path.dirname(prefix) + os.path.sep) - else: - prefix_dir = 0 - completion = [] - globbed = [] - if '*' not in prefix and '?' not in prefix: - # we are on unix, otherwise no bash - if not prefix or prefix[-1] == os.path.sep: - globbed.extend(glob(prefix + '.*')) - prefix += '*' - globbed.extend(glob(prefix)) - for x in sorted(globbed): - if os.path.isdir(x): - x += '/' - # append stripping the prefix (like bash, not like compgen) - completion.append(x[prefix_dir:]) - return completion - - -if os.environ.get('_ARGCOMPLETE'): - try: - import argcomplete.completers - except ImportError: - sys.exit(-1) - filescompleter = FastFilesCompleter() - - def try_argcomplete(parser): - argcomplete.autocomplete(parser, always_complete_options=False) -else: - def try_argcomplete(parser): - pass - filescompleter = None diff --git a/lib/spack/external/_pytest/_code/__init__.py b/lib/spack/external/_pytest/_code/__init__.py deleted file mode 100644 index 815c13b42c..0000000000 --- a/lib/spack/external/_pytest/_code/__init__.py +++ /dev/null @@ -1,10 +0,0 @@ -""" python inspection/code generation API """ -from __future__ import absolute_import, division, print_function -from .code import Code # noqa -from .code import ExceptionInfo # noqa -from .code import Frame # noqa -from .code import Traceback # noqa -from .code import getrawcode # noqa -from .source import Source # noqa -from .source import compile_ as compile # noqa -from .source import getfslineno # noqa diff --git a/lib/spack/external/_pytest/_code/_py2traceback.py b/lib/spack/external/_pytest/_code/_py2traceback.py deleted file mode 100644 index 5aacf0a428..0000000000 --- a/lib/spack/external/_pytest/_code/_py2traceback.py +++ /dev/null @@ -1,85 +0,0 @@ -# copied from python-2.7.3's traceback.py -# CHANGES: -# - some_str is replaced, trying to create unicode strings -# -from __future__ import absolute_import, division, print_function -import types - - -def format_exception_only(etype, value): - """Format the exception part of a traceback. - - The arguments are the exception type and value such as given by - sys.last_type and sys.last_value. The return value is a list of - strings, each ending in a newline. - - Normally, the list contains a single string; however, for - SyntaxError exceptions, it contains several lines that (when - printed) display detailed information about where the syntax - error occurred. - - The message indicating which exception occurred is always the last - string in the list. - - """ - - # An instance should not have a meaningful value parameter, but - # sometimes does, particularly for string exceptions, such as - # >>> raise string1, string2 # deprecated - # - # Clear these out first because issubtype(string1, SyntaxError) - # would throw another exception and mask the original problem. - if (isinstance(etype, BaseException) or - isinstance(etype, types.InstanceType) or - etype is None or type(etype) is str): - return [_format_final_exc_line(etype, value)] - - stype = etype.__name__ - - if not issubclass(etype, SyntaxError): - return [_format_final_exc_line(stype, value)] - - # It was a syntax error; show exactly where the problem was found. - lines = [] - try: - msg, (filename, lineno, offset, badline) = value.args - except Exception: - pass - else: - filename = filename or "" - lines.append(' File "%s", line %d\n' % (filename, lineno)) - if badline is not None: - if isinstance(badline, bytes): # python 2 only - badline = badline.decode('utf-8', 'replace') - lines.append(u' %s\n' % badline.strip()) - if offset is not None: - caretspace = badline.rstrip('\n')[:offset].lstrip() - # non-space whitespace (likes tabs) must be kept for alignment - caretspace = ((c.isspace() and c or ' ') for c in caretspace) - # only three spaces to account for offset1 == pos 0 - lines.append(' %s^\n' % ''.join(caretspace)) - value = msg - - lines.append(_format_final_exc_line(stype, value)) - return lines - - -def _format_final_exc_line(etype, value): - """Return a list of a single line -- normal case for format_exception_only""" - valuestr = _some_str(value) - if value is None or not valuestr: - line = "%s\n" % etype - else: - line = "%s: %s\n" % (etype, valuestr) - return line - - -def _some_str(value): - try: - return unicode(value) - except Exception: - try: - return str(value) - except Exception: - pass - return '' % type(value).__name__ diff --git a/lib/spack/external/_pytest/_code/code.py b/lib/spack/external/_pytest/_code/code.py deleted file mode 100644 index f3b7eedfce..0000000000 --- a/lib/spack/external/_pytest/_code/code.py +++ /dev/null @@ -1,908 +0,0 @@ -from __future__ import absolute_import, division, print_function -import sys -from inspect import CO_VARARGS, CO_VARKEYWORDS -import re -from weakref import ref -from _pytest.compat import _PY2, _PY3, PY35, safe_str - -import py -builtin_repr = repr - -reprlib = py.builtin._tryimport('repr', 'reprlib') - -if _PY3: - from traceback import format_exception_only -else: - from ._py2traceback import format_exception_only - - -class Code(object): - """ wrapper around Python code objects """ - - def __init__(self, rawcode): - if not hasattr(rawcode, "co_filename"): - rawcode = getrawcode(rawcode) - try: - self.filename = rawcode.co_filename - self.firstlineno = rawcode.co_firstlineno - 1 - self.name = rawcode.co_name - except AttributeError: - raise TypeError("not a code object: %r" % (rawcode,)) - self.raw = rawcode - - def __eq__(self, other): - return self.raw == other.raw - - __hash__ = None - - def __ne__(self, other): - return not self == other - - @property - def path(self): - """ return a path object pointing to source code (note that it - might not point to an actually existing file). """ - try: - p = py.path.local(self.raw.co_filename) - # maybe don't try this checking - if not p.check(): - raise OSError("py.path check failed.") - except OSError: - # XXX maybe try harder like the weird logic - # in the standard lib [linecache.updatecache] does? - p = self.raw.co_filename - - return p - - @property - def fullsource(self): - """ return a _pytest._code.Source object for the full source file of the code - """ - from _pytest._code import source - full, _ = source.findsource(self.raw) - return full - - def source(self): - """ return a _pytest._code.Source object for the code object's source only - """ - # return source only for that part of code - import _pytest._code - return _pytest._code.Source(self.raw) - - def getargs(self, var=False): - """ return a tuple with the argument names for the code object - - if 'var' is set True also return the names of the variable and - keyword arguments when present - """ - # handfull shortcut for getting args - raw = self.raw - argcount = raw.co_argcount - if var: - argcount += raw.co_flags & CO_VARARGS - argcount += raw.co_flags & CO_VARKEYWORDS - return raw.co_varnames[:argcount] - - -class Frame(object): - """Wrapper around a Python frame holding f_locals and f_globals - in which expressions can be evaluated.""" - - def __init__(self, frame): - self.lineno = frame.f_lineno - 1 - self.f_globals = frame.f_globals - self.f_locals = frame.f_locals - self.raw = frame - self.code = Code(frame.f_code) - - @property - def statement(self): - """ statement this frame is at """ - import _pytest._code - if self.code.fullsource is None: - return _pytest._code.Source("") - return self.code.fullsource.getstatement(self.lineno) - - def eval(self, code, **vars): - """ evaluate 'code' in the frame - - 'vars' are optional additional local variables - - returns the result of the evaluation - """ - f_locals = self.f_locals.copy() - f_locals.update(vars) - return eval(code, self.f_globals, f_locals) - - def exec_(self, code, **vars): - """ exec 'code' in the frame - - 'vars' are optiona; additional local variables - """ - f_locals = self.f_locals.copy() - f_locals.update(vars) - py.builtin.exec_(code, self.f_globals, f_locals) - - def repr(self, object): - """ return a 'safe' (non-recursive, one-line) string repr for 'object' - """ - return py.io.saferepr(object) - - def is_true(self, object): - return object - - def getargs(self, var=False): - """ return a list of tuples (name, value) for all arguments - - if 'var' is set True also include the variable and keyword - arguments when present - """ - retval = [] - for arg in self.code.getargs(var): - try: - retval.append((arg, self.f_locals[arg])) - except KeyError: - pass # this can occur when using Psyco - return retval - - -class TracebackEntry(object): - """ a single entry in a traceback """ - - _repr_style = None - exprinfo = None - - def __init__(self, rawentry, excinfo=None): - self._excinfo = excinfo - self._rawentry = rawentry - self.lineno = rawentry.tb_lineno - 1 - - def set_repr_style(self, mode): - assert mode in ("short", "long") - self._repr_style = mode - - @property - def frame(self): - import _pytest._code - return _pytest._code.Frame(self._rawentry.tb_frame) - - @property - def relline(self): - return self.lineno - self.frame.code.firstlineno - - def __repr__(self): - return "" % (self.frame.code.path, self.lineno + 1) - - @property - def statement(self): - """ _pytest._code.Source object for the current statement """ - source = self.frame.code.fullsource - return source.getstatement(self.lineno) - - @property - def path(self): - """ path to the source code """ - return self.frame.code.path - - def getlocals(self): - return self.frame.f_locals - locals = property(getlocals, None, None, "locals of underlaying frame") - - def getfirstlinesource(self): - # on Jython this firstlineno can be -1 apparently - return max(self.frame.code.firstlineno, 0) - - def getsource(self, astcache=None): - """ return failing source code. """ - # we use the passed in astcache to not reparse asttrees - # within exception info printing - from _pytest._code.source import getstatementrange_ast - source = self.frame.code.fullsource - if source is None: - return None - key = astnode = None - if astcache is not None: - key = self.frame.code.path - if key is not None: - astnode = astcache.get(key, None) - start = self.getfirstlinesource() - try: - astnode, _, end = getstatementrange_ast(self.lineno, source, - astnode=astnode) - except SyntaxError: - end = self.lineno + 1 - else: - if key is not None: - astcache[key] = astnode - return source[start:end] - - source = property(getsource) - - def ishidden(self): - """ return True if the current frame has a var __tracebackhide__ - resolving to True - - If __tracebackhide__ is a callable, it gets called with the - ExceptionInfo instance and can decide whether to hide the traceback. - - mostly for internal use - """ - try: - tbh = self.frame.f_locals['__tracebackhide__'] - except KeyError: - try: - tbh = self.frame.f_globals['__tracebackhide__'] - except KeyError: - return False - - if py.builtin.callable(tbh): - return tbh(None if self._excinfo is None else self._excinfo()) - else: - return tbh - - def __str__(self): - try: - fn = str(self.path) - except py.error.Error: - fn = '???' - name = self.frame.code.name - try: - line = str(self.statement).lstrip() - except KeyboardInterrupt: - raise - except: # noqa - line = "???" - return " File %r:%d in %s\n %s\n" % (fn, self.lineno + 1, name, line) - - def name(self): - return self.frame.code.raw.co_name - name = property(name, None, None, "co_name of underlaying code") - - -class Traceback(list): - """ Traceback objects encapsulate and offer higher level - access to Traceback entries. - """ - Entry = TracebackEntry - - def __init__(self, tb, excinfo=None): - """ initialize from given python traceback object and ExceptionInfo """ - self._excinfo = excinfo - if hasattr(tb, 'tb_next'): - def f(cur): - while cur is not None: - yield self.Entry(cur, excinfo=excinfo) - cur = cur.tb_next - list.__init__(self, f(tb)) - else: - list.__init__(self, tb) - - def cut(self, path=None, lineno=None, firstlineno=None, excludepath=None): - """ return a Traceback instance wrapping part of this Traceback - - by provding any combination of path, lineno and firstlineno, the - first frame to start the to-be-returned traceback is determined - - this allows cutting the first part of a Traceback instance e.g. - for formatting reasons (removing some uninteresting bits that deal - with handling of the exception/traceback) - """ - for x in self: - code = x.frame.code - codepath = code.path - if ((path is None or codepath == path) and - (excludepath is None or not hasattr(codepath, 'relto') or - not codepath.relto(excludepath)) and - (lineno is None or x.lineno == lineno) and - (firstlineno is None or x.frame.code.firstlineno == firstlineno)): - return Traceback(x._rawentry, self._excinfo) - return self - - def __getitem__(self, key): - val = super(Traceback, self).__getitem__(key) - if isinstance(key, type(slice(0))): - val = self.__class__(val) - return val - - def filter(self, fn=lambda x: not x.ishidden()): - """ return a Traceback instance with certain items removed - - fn is a function that gets a single argument, a TracebackEntry - instance, and should return True when the item should be added - to the Traceback, False when not - - by default this removes all the TracebackEntries which are hidden - (see ishidden() above) - """ - return Traceback(filter(fn, self), self._excinfo) - - def getcrashentry(self): - """ return last non-hidden traceback entry that lead - to the exception of a traceback. - """ - for i in range(-1, -len(self) - 1, -1): - entry = self[i] - if not entry.ishidden(): - return entry - return self[-1] - - def recursionindex(self): - """ return the index of the frame/TracebackEntry where recursion - originates if appropriate, None if no recursion occurred - """ - cache = {} - for i, entry in enumerate(self): - # id for the code.raw is needed to work around - # the strange metaprogramming in the decorator lib from pypi - # which generates code objects that have hash/value equality - # XXX needs a test - key = entry.frame.code.path, id(entry.frame.code.raw), entry.lineno - # print "checking for recursion at", key - values = cache.setdefault(key, []) - if values: - f = entry.frame - loc = f.f_locals - for otherloc in values: - if f.is_true(f.eval(co_equal, - __recursioncache_locals_1=loc, - __recursioncache_locals_2=otherloc)): - return i - values.append(entry.frame.f_locals) - return None - - -co_equal = compile('__recursioncache_locals_1 == __recursioncache_locals_2', - '?', 'eval') - - -class ExceptionInfo(object): - """ wraps sys.exc_info() objects and offers - help for navigating the traceback. - """ - _striptext = '' - _assert_start_repr = "AssertionError(u\'assert " if _PY2 else "AssertionError(\'assert " - - def __init__(self, tup=None, exprinfo=None): - import _pytest._code - if tup is None: - tup = sys.exc_info() - if exprinfo is None and isinstance(tup[1], AssertionError): - exprinfo = getattr(tup[1], 'msg', None) - if exprinfo is None: - exprinfo = py.io.saferepr(tup[1]) - if exprinfo and exprinfo.startswith(self._assert_start_repr): - self._striptext = 'AssertionError: ' - self._excinfo = tup - #: the exception class - self.type = tup[0] - #: the exception instance - self.value = tup[1] - #: the exception raw traceback - self.tb = tup[2] - #: the exception type name - self.typename = self.type.__name__ - #: the exception traceback (_pytest._code.Traceback instance) - self.traceback = _pytest._code.Traceback(self.tb, excinfo=ref(self)) - - def __repr__(self): - return "" % (self.typename, len(self.traceback)) - - def exconly(self, tryshort=False): - """ return the exception as a string - - when 'tryshort' resolves to True, and the exception is a - _pytest._code._AssertionError, only the actual exception part of - the exception representation is returned (so 'AssertionError: ' is - removed from the beginning) - """ - lines = format_exception_only(self.type, self.value) - text = ''.join(lines) - text = text.rstrip() - if tryshort: - if text.startswith(self._striptext): - text = text[len(self._striptext):] - return text - - def errisinstance(self, exc): - """ return True if the exception is an instance of exc """ - return isinstance(self.value, exc) - - def _getreprcrash(self): - exconly = self.exconly(tryshort=True) - entry = self.traceback.getcrashentry() - path, lineno = entry.frame.code.raw.co_filename, entry.lineno - return ReprFileLocation(path, lineno + 1, exconly) - - def getrepr(self, showlocals=False, style="long", - abspath=False, tbfilter=True, funcargs=False): - """ return str()able representation of this exception info. - showlocals: show locals per traceback entry - style: long|short|no|native traceback style - tbfilter: hide entries (where __tracebackhide__ is true) - - in case of style==native, tbfilter and showlocals is ignored. - """ - if style == 'native': - return ReprExceptionInfo(ReprTracebackNative( - py.std.traceback.format_exception( - self.type, - self.value, - self.traceback[0]._rawentry, - )), self._getreprcrash()) - - fmt = FormattedExcinfo(showlocals=showlocals, style=style, - abspath=abspath, tbfilter=tbfilter, funcargs=funcargs) - return fmt.repr_excinfo(self) - - def __str__(self): - entry = self.traceback[-1] - loc = ReprFileLocation(entry.path, entry.lineno + 1, self.exconly()) - return str(loc) - - def __unicode__(self): - entry = self.traceback[-1] - loc = ReprFileLocation(entry.path, entry.lineno + 1, self.exconly()) - return unicode(loc) - - def match(self, regexp): - """ - Match the regular expression 'regexp' on the string representation of - the exception. If it matches then True is returned (so that it is - possible to write 'assert excinfo.match()'). If it doesn't match an - AssertionError is raised. - """ - __tracebackhide__ = True - if not re.search(regexp, str(self.value)): - assert 0, "Pattern '{0!s}' not found in '{1!s}'".format( - regexp, self.value) - return True - - -class FormattedExcinfo(object): - """ presenting information about failing Functions and Generators. """ - # for traceback entries - flow_marker = ">" - fail_marker = "E" - - def __init__(self, showlocals=False, style="long", abspath=True, tbfilter=True, funcargs=False): - self.showlocals = showlocals - self.style = style - self.tbfilter = tbfilter - self.funcargs = funcargs - self.abspath = abspath - self.astcache = {} - - def _getindent(self, source): - # figure out indent for given source - try: - s = str(source.getstatement(len(source) - 1)) - except KeyboardInterrupt: - raise - except: # noqa - try: - s = str(source[-1]) - except KeyboardInterrupt: - raise - except: # noqa - return 0 - return 4 + (len(s) - len(s.lstrip())) - - def _getentrysource(self, entry): - source = entry.getsource(self.astcache) - if source is not None: - source = source.deindent() - return source - - def _saferepr(self, obj): - return py.io.saferepr(obj) - - def repr_args(self, entry): - if self.funcargs: - args = [] - for argname, argvalue in entry.frame.getargs(var=True): - args.append((argname, self._saferepr(argvalue))) - return ReprFuncArgs(args) - - def get_source(self, source, line_index=-1, excinfo=None, short=False): - """ return formatted and marked up source lines. """ - import _pytest._code - lines = [] - if source is None or line_index >= len(source.lines): - source = _pytest._code.Source("???") - line_index = 0 - if line_index < 0: - line_index += len(source) - space_prefix = " " - if short: - lines.append(space_prefix + source.lines[line_index].strip()) - else: - for line in source.lines[:line_index]: - lines.append(space_prefix + line) - lines.append(self.flow_marker + " " + source.lines[line_index]) - for line in source.lines[line_index + 1:]: - lines.append(space_prefix + line) - if excinfo is not None: - indent = 4 if short else self._getindent(source) - lines.extend(self.get_exconly(excinfo, indent=indent, markall=True)) - return lines - - def get_exconly(self, excinfo, indent=4, markall=False): - lines = [] - indent = " " * indent - # get the real exception information out - exlines = excinfo.exconly(tryshort=True).split('\n') - failindent = self.fail_marker + indent[1:] - for line in exlines: - lines.append(failindent + line) - if not markall: - failindent = indent - return lines - - def repr_locals(self, locals): - if self.showlocals: - lines = [] - keys = [loc for loc in locals if loc[0] != "@"] - keys.sort() - for name in keys: - value = locals[name] - if name == '__builtins__': - lines.append("__builtins__ = ") - else: - # This formatting could all be handled by the - # _repr() function, which is only reprlib.Repr in - # disguise, so is very configurable. - str_repr = self._saferepr(value) - # if len(str_repr) < 70 or not isinstance(value, - # (list, tuple, dict)): - lines.append("%-10s = %s" % (name, str_repr)) - # else: - # self._line("%-10s =\\" % (name,)) - # # XXX - # py.std.pprint.pprint(value, stream=self.excinfowriter) - return ReprLocals(lines) - - def repr_traceback_entry(self, entry, excinfo=None): - import _pytest._code - source = self._getentrysource(entry) - if source is None: - source = _pytest._code.Source("???") - line_index = 0 - else: - # entry.getfirstlinesource() can be -1, should be 0 on jython - line_index = entry.lineno - max(entry.getfirstlinesource(), 0) - - lines = [] - style = entry._repr_style - if style is None: - style = self.style - if style in ("short", "long"): - short = style == "short" - reprargs = self.repr_args(entry) if not short else None - s = self.get_source(source, line_index, excinfo, short=short) - lines.extend(s) - if short: - message = "in %s" % (entry.name) - else: - message = excinfo and excinfo.typename or "" - path = self._makepath(entry.path) - filelocrepr = ReprFileLocation(path, entry.lineno + 1, message) - localsrepr = None - if not short: - localsrepr = self.repr_locals(entry.locals) - return ReprEntry(lines, reprargs, localsrepr, filelocrepr, style) - if excinfo: - lines.extend(self.get_exconly(excinfo, indent=4)) - return ReprEntry(lines, None, None, None, style) - - def _makepath(self, path): - if not self.abspath: - try: - np = py.path.local().bestrelpath(path) - except OSError: - return path - if len(np) < len(str(path)): - path = np - return path - - def repr_traceback(self, excinfo): - traceback = excinfo.traceback - if self.tbfilter: - traceback = traceback.filter() - - if is_recursion_error(excinfo): - traceback, extraline = self._truncate_recursive_traceback(traceback) - else: - extraline = None - - last = traceback[-1] - entries = [] - for index, entry in enumerate(traceback): - einfo = (last == entry) and excinfo or None - reprentry = self.repr_traceback_entry(entry, einfo) - entries.append(reprentry) - return ReprTraceback(entries, extraline, style=self.style) - - def _truncate_recursive_traceback(self, traceback): - """ - Truncate the given recursive traceback trying to find the starting point - of the recursion. - - The detection is done by going through each traceback entry and finding the - point in which the locals of the frame are equal to the locals of a previous frame (see ``recursionindex()``. - - Handle the situation where the recursion process might raise an exception (for example - comparing numpy arrays using equality raises a TypeError), in which case we do our best to - warn the user of the error and show a limited traceback. - """ - try: - recursionindex = traceback.recursionindex() - except Exception as e: - max_frames = 10 - extraline = ( - '!!! Recursion error detected, but an error occurred locating the origin of recursion.\n' - ' The following exception happened when comparing locals in the stack frame:\n' - ' {exc_type}: {exc_msg}\n' - ' Displaying first and last {max_frames} stack frames out of {total}.' - ).format(exc_type=type(e).__name__, exc_msg=safe_str(e), max_frames=max_frames, total=len(traceback)) - traceback = traceback[:max_frames] + traceback[-max_frames:] - else: - if recursionindex is not None: - extraline = "!!! Recursion detected (same locals & position)" - traceback = traceback[:recursionindex + 1] - else: - extraline = None - - return traceback, extraline - - def repr_excinfo(self, excinfo): - if _PY2: - reprtraceback = self.repr_traceback(excinfo) - reprcrash = excinfo._getreprcrash() - - return ReprExceptionInfo(reprtraceback, reprcrash) - else: - repr_chain = [] - e = excinfo.value - descr = None - while e is not None: - if excinfo: - reprtraceback = self.repr_traceback(excinfo) - reprcrash = excinfo._getreprcrash() - else: - # fallback to native repr if the exception doesn't have a traceback: - # ExceptionInfo objects require a full traceback to work - reprtraceback = ReprTracebackNative(py.std.traceback.format_exception(type(e), e, None)) - reprcrash = None - - repr_chain += [(reprtraceback, reprcrash, descr)] - if e.__cause__ is not None: - e = e.__cause__ - excinfo = ExceptionInfo((type(e), e, e.__traceback__)) if e.__traceback__ else None - descr = 'The above exception was the direct cause of the following exception:' - elif (e.__context__ is not None and not e.__suppress_context__): - e = e.__context__ - excinfo = ExceptionInfo((type(e), e, e.__traceback__)) if e.__traceback__ else None - descr = 'During handling of the above exception, another exception occurred:' - else: - e = None - repr_chain.reverse() - return ExceptionChainRepr(repr_chain) - - -class TerminalRepr(object): - def __str__(self): - s = self.__unicode__() - if _PY2: - s = s.encode('utf-8') - return s - - def __unicode__(self): - # FYI this is called from pytest-xdist's serialization of exception - # information. - io = py.io.TextIO() - tw = py.io.TerminalWriter(file=io) - self.toterminal(tw) - return io.getvalue().strip() - - def __repr__(self): - return "<%s instance at %0x>" % (self.__class__, id(self)) - - -class ExceptionRepr(TerminalRepr): - def __init__(self): - self.sections = [] - - def addsection(self, name, content, sep="-"): - self.sections.append((name, content, sep)) - - def toterminal(self, tw): - for name, content, sep in self.sections: - tw.sep(sep, name) - tw.line(content) - - -class ExceptionChainRepr(ExceptionRepr): - def __init__(self, chain): - super(ExceptionChainRepr, self).__init__() - self.chain = chain - # reprcrash and reprtraceback of the outermost (the newest) exception - # in the chain - self.reprtraceback = chain[-1][0] - self.reprcrash = chain[-1][1] - - def toterminal(self, tw): - for element in self.chain: - element[0].toterminal(tw) - if element[2] is not None: - tw.line("") - tw.line(element[2], yellow=True) - super(ExceptionChainRepr, self).toterminal(tw) - - -class ReprExceptionInfo(ExceptionRepr): - def __init__(self, reprtraceback, reprcrash): - super(ReprExceptionInfo, self).__init__() - self.reprtraceback = reprtraceback - self.reprcrash = reprcrash - - def toterminal(self, tw): - self.reprtraceback.toterminal(tw) - super(ReprExceptionInfo, self).toterminal(tw) - - -class ReprTraceback(TerminalRepr): - entrysep = "_ " - - def __init__(self, reprentries, extraline, style): - self.reprentries = reprentries - self.extraline = extraline - self.style = style - - def toterminal(self, tw): - # the entries might have different styles - for i, entry in enumerate(self.reprentries): - if entry.style == "long": - tw.line("") - entry.toterminal(tw) - if i < len(self.reprentries) - 1: - next_entry = self.reprentries[i + 1] - if entry.style == "long" or \ - entry.style == "short" and next_entry.style == "long": - tw.sep(self.entrysep) - - if self.extraline: - tw.line(self.extraline) - - -class ReprTracebackNative(ReprTraceback): - def __init__(self, tblines): - self.style = "native" - self.reprentries = [ReprEntryNative(tblines)] - self.extraline = None - - -class ReprEntryNative(TerminalRepr): - style = "native" - - def __init__(self, tblines): - self.lines = tblines - - def toterminal(self, tw): - tw.write("".join(self.lines)) - - -class ReprEntry(TerminalRepr): - localssep = "_ " - - def __init__(self, lines, reprfuncargs, reprlocals, filelocrepr, style): - self.lines = lines - self.reprfuncargs = reprfuncargs - self.reprlocals = reprlocals - self.reprfileloc = filelocrepr - self.style = style - - def toterminal(self, tw): - if self.style == "short": - self.reprfileloc.toterminal(tw) - for line in self.lines: - red = line.startswith("E ") - tw.line(line, bold=True, red=red) - # tw.line("") - return - if self.reprfuncargs: - self.reprfuncargs.toterminal(tw) - for line in self.lines: - red = line.startswith("E ") - tw.line(line, bold=True, red=red) - if self.reprlocals: - # tw.sep(self.localssep, "Locals") - tw.line("") - self.reprlocals.toterminal(tw) - if self.reprfileloc: - if self.lines: - tw.line("") - self.reprfileloc.toterminal(tw) - - def __str__(self): - return "%s\n%s\n%s" % ("\n".join(self.lines), - self.reprlocals, - self.reprfileloc) - - -class ReprFileLocation(TerminalRepr): - def __init__(self, path, lineno, message): - self.path = str(path) - self.lineno = lineno - self.message = message - - def toterminal(self, tw): - # filename and lineno output for each entry, - # using an output format that most editors unterstand - msg = self.message - i = msg.find("\n") - if i != -1: - msg = msg[:i] - tw.write(self.path, bold=True, red=True) - tw.line(":%s: %s" % (self.lineno, msg)) - - -class ReprLocals(TerminalRepr): - def __init__(self, lines): - self.lines = lines - - def toterminal(self, tw): - for line in self.lines: - tw.line(line) - - -class ReprFuncArgs(TerminalRepr): - def __init__(self, args): - self.args = args - - def toterminal(self, tw): - if self.args: - linesofar = "" - for name, value in self.args: - ns = "%s = %s" % (safe_str(name), safe_str(value)) - if len(ns) + len(linesofar) + 2 > tw.fullwidth: - if linesofar: - tw.line(linesofar) - linesofar = ns - else: - if linesofar: - linesofar += ", " + ns - else: - linesofar = ns - if linesofar: - tw.line(linesofar) - tw.line("") - - -def getrawcode(obj, trycall=True): - """ return code object for given function. """ - try: - return obj.__code__ - except AttributeError: - obj = getattr(obj, 'im_func', obj) - obj = getattr(obj, 'func_code', obj) - obj = getattr(obj, 'f_code', obj) - obj = getattr(obj, '__code__', obj) - if trycall and not hasattr(obj, 'co_firstlineno'): - if hasattr(obj, '__call__') and not py.std.inspect.isclass(obj): - x = getrawcode(obj.__call__, trycall=False) - if hasattr(x, 'co_firstlineno'): - return x - return obj - - -if PY35: # RecursionError introduced in 3.5 - def is_recursion_error(excinfo): - return excinfo.errisinstance(RecursionError) # noqa -else: - def is_recursion_error(excinfo): - if not excinfo.errisinstance(RuntimeError): - return False - try: - return "maximum recursion depth exceeded" in str(excinfo.value) - except UnicodeError: - return False diff --git a/lib/spack/external/_pytest/_code/source.py b/lib/spack/external/_pytest/_code/source.py deleted file mode 100644 index fc41712649..0000000000 --- a/lib/spack/external/_pytest/_code/source.py +++ /dev/null @@ -1,416 +0,0 @@ -from __future__ import absolute_import, division, generators, print_function - -from bisect import bisect_right -import sys -import inspect -import tokenize -import py -cpy_compile = compile - -try: - import _ast - from _ast import PyCF_ONLY_AST as _AST_FLAG -except ImportError: - _AST_FLAG = 0 - _ast = None - - -class Source(object): - """ a immutable object holding a source code fragment, - possibly deindenting it. - """ - _compilecounter = 0 - - def __init__(self, *parts, **kwargs): - self.lines = lines = [] - de = kwargs.get('deindent', True) - rstrip = kwargs.get('rstrip', True) - for part in parts: - if not part: - partlines = [] - if isinstance(part, Source): - partlines = part.lines - elif isinstance(part, (tuple, list)): - partlines = [x.rstrip("\n") for x in part] - elif isinstance(part, py.builtin._basestring): - partlines = part.split('\n') - if rstrip: - while partlines: - if partlines[-1].strip(): - break - partlines.pop() - else: - partlines = getsource(part, deindent=de).lines - if de: - partlines = deindent(partlines) - lines.extend(partlines) - - def __eq__(self, other): - try: - return self.lines == other.lines - except AttributeError: - if isinstance(other, str): - return str(self) == other - return False - - __hash__ = None - - def __getitem__(self, key): - if isinstance(key, int): - return self.lines[key] - else: - if key.step not in (None, 1): - raise IndexError("cannot slice a Source with a step") - newsource = Source() - newsource.lines = self.lines[key.start:key.stop] - return newsource - - def __len__(self): - return len(self.lines) - - def strip(self): - """ return new source object with trailing - and leading blank lines removed. - """ - start, end = 0, len(self) - while start < end and not self.lines[start].strip(): - start += 1 - while end > start and not self.lines[end - 1].strip(): - end -= 1 - source = Source() - source.lines[:] = self.lines[start:end] - return source - - def putaround(self, before='', after='', indent=' ' * 4): - """ return a copy of the source object with - 'before' and 'after' wrapped around it. - """ - before = Source(before) - after = Source(after) - newsource = Source() - lines = [(indent + line) for line in self.lines] - newsource.lines = before.lines + lines + after.lines - return newsource - - def indent(self, indent=' ' * 4): - """ return a copy of the source object with - all lines indented by the given indent-string. - """ - newsource = Source() - newsource.lines = [(indent + line) for line in self.lines] - return newsource - - def getstatement(self, lineno, assertion=False): - """ return Source statement which contains the - given linenumber (counted from 0). - """ - start, end = self.getstatementrange(lineno, assertion) - return self[start:end] - - def getstatementrange(self, lineno, assertion=False): - """ return (start, end) tuple which spans the minimal - statement region which containing the given lineno. - """ - if not (0 <= lineno < len(self)): - raise IndexError("lineno out of range") - ast, start, end = getstatementrange_ast(lineno, self) - return start, end - - def deindent(self, offset=None): - """ return a new source object deindented by offset. - If offset is None then guess an indentation offset from - the first non-blank line. Subsequent lines which have a - lower indentation offset will be copied verbatim as - they are assumed to be part of multilines. - """ - # XXX maybe use the tokenizer to properly handle multiline - # strings etc.pp? - newsource = Source() - newsource.lines[:] = deindent(self.lines, offset) - return newsource - - def isparseable(self, deindent=True): - """ return True if source is parseable, heuristically - deindenting it by default. - """ - try: - import parser - except ImportError: - def syntax_checker(x): - return compile(x, 'asd', 'exec') - else: - syntax_checker = parser.suite - - if deindent: - source = str(self.deindent()) - else: - source = str(self) - try: - # compile(source+'\n', "x", "exec") - syntax_checker(source + '\n') - except KeyboardInterrupt: - raise - except Exception: - return False - else: - return True - - def __str__(self): - return "\n".join(self.lines) - - def compile(self, filename=None, mode='exec', - flag=generators.compiler_flag, - dont_inherit=0, _genframe=None): - """ return compiled code object. if filename is None - invent an artificial filename which displays - the source/line position of the caller frame. - """ - if not filename or py.path.local(filename).check(file=0): - if _genframe is None: - _genframe = sys._getframe(1) # the caller - fn, lineno = _genframe.f_code.co_filename, _genframe.f_lineno - base = "<%d-codegen " % self._compilecounter - self.__class__._compilecounter += 1 - if not filename: - filename = base + '%s:%d>' % (fn, lineno) - else: - filename = base + '%r %s:%d>' % (filename, fn, lineno) - source = "\n".join(self.lines) + '\n' - try: - co = cpy_compile(source, filename, mode, flag) - except SyntaxError: - ex = sys.exc_info()[1] - # re-represent syntax errors from parsing python strings - msglines = self.lines[:ex.lineno] - if ex.offset: - msglines.append(" " * ex.offset + '^') - msglines.append("(code was compiled probably from here: %s)" % filename) - newex = SyntaxError('\n'.join(msglines)) - newex.offset = ex.offset - newex.lineno = ex.lineno - newex.text = ex.text - raise newex - else: - if flag & _AST_FLAG: - return co - lines = [(x + "\n") for x in self.lines] - py.std.linecache.cache[filename] = (1, None, lines, filename) - return co - -# -# public API shortcut functions -# - - -def compile_(source, filename=None, mode='exec', flags=generators.compiler_flag, dont_inherit=0): - """ compile the given source to a raw code object, - and maintain an internal cache which allows later - retrieval of the source code for the code object - and any recursively created code objects. - """ - if _ast is not None and isinstance(source, _ast.AST): - # XXX should Source support having AST? - return cpy_compile(source, filename, mode, flags, dont_inherit) - _genframe = sys._getframe(1) # the caller - s = Source(source) - co = s.compile(filename, mode, flags, _genframe=_genframe) - return co - - -def getfslineno(obj): - """ Return source location (path, lineno) for the given object. - If the source cannot be determined return ("", -1) - """ - import _pytest._code - try: - code = _pytest._code.Code(obj) - except TypeError: - try: - fn = (py.std.inspect.getsourcefile(obj) or - py.std.inspect.getfile(obj)) - except TypeError: - return "", -1 - - fspath = fn and py.path.local(fn) or None - lineno = -1 - if fspath: - try: - _, lineno = findsource(obj) - except IOError: - pass - else: - fspath = code.path - lineno = code.firstlineno - assert isinstance(lineno, int) - return fspath, lineno - -# -# helper functions -# - - -def findsource(obj): - try: - sourcelines, lineno = py.std.inspect.findsource(obj) - except py.builtin._sysex: - raise - except: # noqa - return None, -1 - source = Source() - source.lines = [line.rstrip() for line in sourcelines] - return source, lineno - - -def getsource(obj, **kwargs): - import _pytest._code - obj = _pytest._code.getrawcode(obj) - try: - strsrc = inspect.getsource(obj) - except IndentationError: - strsrc = "\"Buggy python version consider upgrading, cannot get source\"" - assert isinstance(strsrc, str) - return Source(strsrc, **kwargs) - - -def deindent(lines, offset=None): - if offset is None: - for line in lines: - line = line.expandtabs() - s = line.lstrip() - if s: - offset = len(line) - len(s) - break - else: - offset = 0 - if offset == 0: - return list(lines) - newlines = [] - - def readline_generator(lines): - for line in lines: - yield line + '\n' - while True: - yield '' - - it = readline_generator(lines) - - try: - for _, _, (sline, _), (eline, _), _ in tokenize.generate_tokens(lambda: next(it)): - if sline > len(lines): - break # End of input reached - if sline > len(newlines): - line = lines[sline - 1].expandtabs() - if line.lstrip() and line[:offset].isspace(): - line = line[offset:] # Deindent - newlines.append(line) - - for i in range(sline, eline): - # Don't deindent continuing lines of - # multiline tokens (i.e. multiline strings) - newlines.append(lines[i]) - except (IndentationError, tokenize.TokenError): - pass - # Add any lines we didn't see. E.g. if an exception was raised. - newlines.extend(lines[len(newlines):]) - return newlines - - -def get_statement_startend2(lineno, node): - import ast - # flatten all statements and except handlers into one lineno-list - # AST's line numbers start indexing at 1 - values = [] - for x in ast.walk(node): - if isinstance(x, _ast.stmt) or isinstance(x, _ast.ExceptHandler): - values.append(x.lineno - 1) - for name in "finalbody", "orelse": - val = getattr(x, name, None) - if val: - # treat the finally/orelse part as its own statement - values.append(val[0].lineno - 1 - 1) - values.sort() - insert_index = bisect_right(values, lineno) - start = values[insert_index - 1] - if insert_index >= len(values): - end = None - else: - end = values[insert_index] - return start, end - - -def getstatementrange_ast(lineno, source, assertion=False, astnode=None): - if astnode is None: - content = str(source) - if sys.version_info < (2, 7): - content += "\n" - try: - astnode = compile(content, "source", "exec", 1024) # 1024 for AST - except ValueError: - start, end = getstatementrange_old(lineno, source, assertion) - return None, start, end - start, end = get_statement_startend2(lineno, astnode) - # we need to correct the end: - # - ast-parsing strips comments - # - there might be empty lines - # - we might have lesser indented code blocks at the end - if end is None: - end = len(source.lines) - - if end > start + 1: - # make sure we don't span differently indented code blocks - # by using the BlockFinder helper used which inspect.getsource() uses itself - block_finder = inspect.BlockFinder() - # if we start with an indented line, put blockfinder to "started" mode - block_finder.started = source.lines[start][0].isspace() - it = ((x + "\n") for x in source.lines[start:end]) - try: - for tok in tokenize.generate_tokens(lambda: next(it)): - block_finder.tokeneater(*tok) - except (inspect.EndOfBlock, IndentationError): - end = block_finder.last + start - except Exception: - pass - - # the end might still point to a comment or empty line, correct it - while end: - line = source.lines[end - 1].lstrip() - if line.startswith("#") or not line: - end -= 1 - else: - break - return astnode, start, end - - -def getstatementrange_old(lineno, source, assertion=False): - """ return (start, end) tuple which spans the minimal - statement region which containing the given lineno. - raise an IndexError if no such statementrange can be found. - """ - # XXX this logic is only used on python2.4 and below - # 1. find the start of the statement - from codeop import compile_command - for start in range(lineno, -1, -1): - if assertion: - line = source.lines[start] - # the following lines are not fully tested, change with care - if 'super' in line and 'self' in line and '__init__' in line: - raise IndexError("likely a subclass") - if "assert" not in line and "raise" not in line: - continue - trylines = source.lines[start:lineno + 1] - # quick hack to prepare parsing an indented line with - # compile_command() (which errors on "return" outside defs) - trylines.insert(0, 'def xxx():') - trysource = '\n '.join(trylines) - # ^ space here - try: - compile_command(trysource) - except (SyntaxError, OverflowError, ValueError): - continue - - # 2. find the end of the statement - for end in range(lineno + 1, len(source) + 1): - trysource = source[start:end] - if trysource.isparseable(): - return start, end - raise SyntaxError("no valid source range around line %d " % (lineno,)) diff --git a/lib/spack/external/_pytest/_pluggy.py b/lib/spack/external/_pytest/_pluggy.py deleted file mode 100644 index 6cc1d3d54a..0000000000 --- a/lib/spack/external/_pytest/_pluggy.py +++ /dev/null @@ -1,11 +0,0 @@ -""" -imports symbols from vendored "pluggy" if available, otherwise -falls back to importing "pluggy" from the default namespace. -""" -from __future__ import absolute_import, division, print_function -try: - from _pytest.vendored_packages.pluggy import * # noqa - from _pytest.vendored_packages.pluggy import __version__ # noqa -except ImportError: - from pluggy import * # noqa - from pluggy import __version__ # noqa diff --git a/lib/spack/external/_pytest/_version.py b/lib/spack/external/_pytest/_version.py deleted file mode 100644 index 3edb7da9ad..0000000000 --- a/lib/spack/external/_pytest/_version.py +++ /dev/null @@ -1,4 +0,0 @@ -# coding: utf-8 -# file generated by setuptools_scm -# don't change, don't track in version control -version = '3.2.5' diff --git a/lib/spack/external/_pytest/assertion/__init__.py b/lib/spack/external/_pytest/assertion/__init__.py deleted file mode 100644 index b0ef667d56..0000000000 --- a/lib/spack/external/_pytest/assertion/__init__.py +++ /dev/null @@ -1,148 +0,0 @@ -""" -support for presenting detailed information in failing assertions. -""" -from __future__ import absolute_import, division, print_function -import py -import sys - -from _pytest.assertion import util -from _pytest.assertion import rewrite -from _pytest.assertion import truncate - - -def pytest_addoption(parser): - group = parser.getgroup("debugconfig") - group.addoption('--assert', - action="store", - dest="assertmode", - choices=("rewrite", "plain",), - default="rewrite", - metavar="MODE", - help="""Control assertion debugging tools. 'plain' - performs no assertion debugging. 'rewrite' - (the default) rewrites assert statements in - test modules on import to provide assert - expression information.""") - - -def register_assert_rewrite(*names): - """Register one or more module names to be rewritten on import. - - This function will make sure that this module or all modules inside - the package will get their assert statements rewritten. - Thus you should make sure to call this before the module is - actually imported, usually in your __init__.py if you are a plugin - using a package. - - :raise TypeError: if the given module names are not strings. - """ - for name in names: - if not isinstance(name, str): - msg = 'expected module names as *args, got {0} instead' - raise TypeError(msg.format(repr(names))) - for hook in sys.meta_path: - if isinstance(hook, rewrite.AssertionRewritingHook): - importhook = hook - break - else: - importhook = DummyRewriteHook() - importhook.mark_rewrite(*names) - - -class DummyRewriteHook(object): - """A no-op import hook for when rewriting is disabled.""" - - def mark_rewrite(self, *names): - pass - - -class AssertionState: - """State for the assertion plugin.""" - - def __init__(self, config, mode): - self.mode = mode - self.trace = config.trace.root.get("assertion") - self.hook = None - - -def install_importhook(config): - """Try to install the rewrite hook, raise SystemError if it fails.""" - # Both Jython and CPython 2.6.0 have AST bugs that make the - # assertion rewriting hook malfunction. - if (sys.platform.startswith('java') or - sys.version_info[:3] == (2, 6, 0)): - raise SystemError('rewrite not supported') - - config._assertstate = AssertionState(config, 'rewrite') - config._assertstate.hook = hook = rewrite.AssertionRewritingHook(config) - sys.meta_path.insert(0, hook) - config._assertstate.trace('installed rewrite import hook') - - def undo(): - hook = config._assertstate.hook - if hook is not None and hook in sys.meta_path: - sys.meta_path.remove(hook) - - config.add_cleanup(undo) - return hook - - -def pytest_collection(session): - # this hook is only called when test modules are collected - # so for example not in the master process of pytest-xdist - # (which does not collect test modules) - assertstate = getattr(session.config, '_assertstate', None) - if assertstate: - if assertstate.hook is not None: - assertstate.hook.set_session(session) - - -def pytest_runtest_setup(item): - """Setup the pytest_assertrepr_compare hook - - The newinterpret and rewrite modules will use util._reprcompare if - it exists to use custom reporting via the - pytest_assertrepr_compare hook. This sets up this custom - comparison for the test. - """ - def callbinrepr(op, left, right): - """Call the pytest_assertrepr_compare hook and prepare the result - - This uses the first result from the hook and then ensures the - following: - * Overly verbose explanations are truncated unless configured otherwise - (eg. if running in verbose mode). - * Embedded newlines are escaped to help util.format_explanation() - later. - * If the rewrite mode is used embedded %-characters are replaced - to protect later % formatting. - - The result can be formatted by util.format_explanation() for - pretty printing. - """ - hook_result = item.ihook.pytest_assertrepr_compare( - config=item.config, op=op, left=left, right=right) - for new_expl in hook_result: - if new_expl: - new_expl = truncate.truncate_if_required(new_expl, item) - new_expl = [line.replace("\n", "\\n") for line in new_expl] - res = py.builtin._totext("\n~").join(new_expl) - if item.config.getvalue("assertmode") == "rewrite": - res = res.replace("%", "%%") - return res - util._reprcompare = callbinrepr - - -def pytest_runtest_teardown(item): - util._reprcompare = None - - -def pytest_sessionfinish(session): - assertstate = getattr(session.config, '_assertstate', None) - if assertstate: - if assertstate.hook is not None: - assertstate.hook.set_session(None) - - -# Expose this plugin's implementation for the pytest_assertrepr_compare hook -pytest_assertrepr_compare = util.assertrepr_compare diff --git a/lib/spack/external/_pytest/assertion/rewrite.py b/lib/spack/external/_pytest/assertion/rewrite.py deleted file mode 100644 index d48b6648fb..0000000000 --- a/lib/spack/external/_pytest/assertion/rewrite.py +++ /dev/null @@ -1,952 +0,0 @@ -"""Rewrite assertion AST to produce nice error messages""" -from __future__ import absolute_import, division, print_function -import ast -import _ast -import errno -import itertools -import imp -import marshal -import os -import re -import struct -import sys -import types - -import py -from _pytest.assertion import util - - -# pytest caches rewritten pycs in __pycache__. -if hasattr(imp, "get_tag"): - PYTEST_TAG = imp.get_tag() + "-PYTEST" -else: - if hasattr(sys, "pypy_version_info"): - impl = "pypy" - elif sys.platform == "java": - impl = "jython" - else: - impl = "cpython" - ver = sys.version_info - PYTEST_TAG = "%s-%s%s-PYTEST" % (impl, ver[0], ver[1]) - del ver, impl - -PYC_EXT = ".py" + (__debug__ and "c" or "o") -PYC_TAIL = "." + PYTEST_TAG + PYC_EXT - -REWRITE_NEWLINES = sys.version_info[:2] != (2, 7) and sys.version_info < (3, 2) -ASCII_IS_DEFAULT_ENCODING = sys.version_info[0] < 3 - -if sys.version_info >= (3, 5): - ast_Call = ast.Call -else: - def ast_Call(a, b, c): - return ast.Call(a, b, c, None, None) - - -class AssertionRewritingHook(object): - """PEP302 Import hook which rewrites asserts.""" - - def __init__(self, config): - self.config = config - self.fnpats = config.getini("python_files") - self.session = None - self.modules = {} - self._rewritten_names = set() - self._register_with_pkg_resources() - self._must_rewrite = set() - - def set_session(self, session): - self.session = session - - def find_module(self, name, path=None): - state = self.config._assertstate - state.trace("find_module called for: %s" % name) - names = name.rsplit(".", 1) - lastname = names[-1] - pth = None - if path is not None: - # Starting with Python 3.3, path is a _NamespacePath(), which - # causes problems if not converted to list. - path = list(path) - if len(path) == 1: - pth = path[0] - if pth is None: - try: - fd, fn, desc = imp.find_module(lastname, path) - except ImportError: - return None - if fd is not None: - fd.close() - tp = desc[2] - if tp == imp.PY_COMPILED: - if hasattr(imp, "source_from_cache"): - try: - fn = imp.source_from_cache(fn) - except ValueError: - # Python 3 doesn't like orphaned but still-importable - # .pyc files. - fn = fn[:-1] - else: - fn = fn[:-1] - elif tp != imp.PY_SOURCE: - # Don't know what this is. - return None - else: - fn = os.path.join(pth, name.rpartition(".")[2] + ".py") - - fn_pypath = py.path.local(fn) - if not self._should_rewrite(name, fn_pypath, state): - return None - - self._rewritten_names.add(name) - - # The requested module looks like a test file, so rewrite it. This is - # the most magical part of the process: load the source, rewrite the - # asserts, and load the rewritten source. We also cache the rewritten - # module code in a special pyc. We must be aware of the possibility of - # concurrent pytest processes rewriting and loading pycs. To avoid - # tricky race conditions, we maintain the following invariant: The - # cached pyc is always a complete, valid pyc. Operations on it must be - # atomic. POSIX's atomic rename comes in handy. - write = not sys.dont_write_bytecode - cache_dir = os.path.join(fn_pypath.dirname, "__pycache__") - if write: - try: - os.mkdir(cache_dir) - except OSError: - e = sys.exc_info()[1].errno - if e == errno.EEXIST: - # Either the __pycache__ directory already exists (the - # common case) or it's blocked by a non-dir node. In the - # latter case, we'll ignore it in _write_pyc. - pass - elif e in [errno.ENOENT, errno.ENOTDIR]: - # One of the path components was not a directory, likely - # because we're in a zip file. - write = False - elif e in [errno.EACCES, errno.EROFS, errno.EPERM]: - state.trace("read only directory: %r" % fn_pypath.dirname) - write = False - else: - raise - cache_name = fn_pypath.basename[:-3] + PYC_TAIL - pyc = os.path.join(cache_dir, cache_name) - # Notice that even if we're in a read-only directory, I'm going - # to check for a cached pyc. This may not be optimal... - co = _read_pyc(fn_pypath, pyc, state.trace) - if co is None: - state.trace("rewriting %r" % (fn,)) - source_stat, co = _rewrite_test(self.config, fn_pypath) - if co is None: - # Probably a SyntaxError in the test. - return None - if write: - _make_rewritten_pyc(state, source_stat, pyc, co) - else: - state.trace("found cached rewritten pyc for %r" % (fn,)) - self.modules[name] = co, pyc - return self - - def _should_rewrite(self, name, fn_pypath, state): - # always rewrite conftest files - fn = str(fn_pypath) - if fn_pypath.basename == 'conftest.py': - state.trace("rewriting conftest file: %r" % (fn,)) - return True - - if self.session is not None: - if self.session.isinitpath(fn): - state.trace("matched test file (was specified on cmdline): %r" % - (fn,)) - return True - - # modules not passed explicitly on the command line are only - # rewritten if they match the naming convention for test files - for pat in self.fnpats: - if fn_pypath.fnmatch(pat): - state.trace("matched test file %r" % (fn,)) - return True - - for marked in self._must_rewrite: - if name.startswith(marked): - state.trace("matched marked file %r (from %r)" % (name, marked)) - return True - - return False - - def mark_rewrite(self, *names): - """Mark import names as needing to be re-written. - - The named module or package as well as any nested modules will - be re-written on import. - """ - already_imported = set(names).intersection(set(sys.modules)) - if already_imported: - for name in already_imported: - if name not in self._rewritten_names: - self._warn_already_imported(name) - self._must_rewrite.update(names) - - def _warn_already_imported(self, name): - self.config.warn( - 'P1', - 'Module already imported so can not be re-written: %s' % name) - - def load_module(self, name): - # If there is an existing module object named 'fullname' in - # sys.modules, the loader must use that existing module. (Otherwise, - # the reload() builtin will not work correctly.) - if name in sys.modules: - return sys.modules[name] - - co, pyc = self.modules.pop(name) - # I wish I could just call imp.load_compiled here, but __file__ has to - # be set properly. In Python 3.2+, this all would be handled correctly - # by load_compiled. - mod = sys.modules[name] = imp.new_module(name) - try: - mod.__file__ = co.co_filename - # Normally, this attribute is 3.2+. - mod.__cached__ = pyc - mod.__loader__ = self - py.builtin.exec_(co, mod.__dict__) - except: # noqa - if name in sys.modules: - del sys.modules[name] - raise - return sys.modules[name] - - def is_package(self, name): - try: - fd, fn, desc = imp.find_module(name) - except ImportError: - return False - if fd is not None: - fd.close() - tp = desc[2] - return tp == imp.PKG_DIRECTORY - - @classmethod - def _register_with_pkg_resources(cls): - """ - Ensure package resources can be loaded from this loader. May be called - multiple times, as the operation is idempotent. - """ - try: - import pkg_resources - # access an attribute in case a deferred importer is present - pkg_resources.__name__ - except ImportError: - return - - # Since pytest tests are always located in the file system, the - # DefaultProvider is appropriate. - pkg_resources.register_loader_type(cls, pkg_resources.DefaultProvider) - - def get_data(self, pathname): - """Optional PEP302 get_data API. - """ - with open(pathname, 'rb') as f: - return f.read() - - -def _write_pyc(state, co, source_stat, pyc): - # Technically, we don't have to have the same pyc format as - # (C)Python, since these "pycs" should never be seen by builtin - # import. However, there's little reason deviate, and I hope - # sometime to be able to use imp.load_compiled to load them. (See - # the comment in load_module above.) - try: - fp = open(pyc, "wb") - except IOError: - err = sys.exc_info()[1].errno - state.trace("error writing pyc file at %s: errno=%s" % (pyc, err)) - # we ignore any failure to write the cache file - # there are many reasons, permission-denied, __pycache__ being a - # file etc. - return False - try: - fp.write(imp.get_magic()) - mtime = int(source_stat.mtime) - size = source_stat.size & 0xFFFFFFFF - fp.write(struct.pack(">", - ast.Add: "+", - ast.Sub: "-", - ast.Mult: "*", - ast.Div: "/", - ast.FloorDiv: "//", - ast.Mod: "%%", # escaped for string formatting - ast.Eq: "==", - ast.NotEq: "!=", - ast.Lt: "<", - ast.LtE: "<=", - ast.Gt: ">", - ast.GtE: ">=", - ast.Pow: "**", - ast.Is: "is", - ast.IsNot: "is not", - ast.In: "in", - ast.NotIn: "not in" -} -# Python 3.5+ compatibility -try: - binop_map[ast.MatMult] = "@" -except AttributeError: - pass - -# Python 3.4+ compatibility -if hasattr(ast, "NameConstant"): - _NameConstant = ast.NameConstant -else: - def _NameConstant(c): - return ast.Name(str(c), ast.Load()) - - -def set_location(node, lineno, col_offset): - """Set node location information recursively.""" - def _fix(node, lineno, col_offset): - if "lineno" in node._attributes: - node.lineno = lineno - if "col_offset" in node._attributes: - node.col_offset = col_offset - for child in ast.iter_child_nodes(node): - _fix(child, lineno, col_offset) - _fix(node, lineno, col_offset) - return node - - -class AssertionRewriter(ast.NodeVisitor): - """Assertion rewriting implementation. - - The main entrypoint is to call .run() with an ast.Module instance, - this will then find all the assert statements and re-write them to - provide intermediate values and a detailed assertion error. See - http://pybites.blogspot.be/2011/07/behind-scenes-of-pytests-new-assertion.html - for an overview of how this works. - - The entry point here is .run() which will iterate over all the - statements in an ast.Module and for each ast.Assert statement it - finds call .visit() with it. Then .visit_Assert() takes over and - is responsible for creating new ast statements to replace the - original assert statement: it re-writes the test of an assertion - to provide intermediate values and replace it with an if statement - which raises an assertion error with a detailed explanation in - case the expression is false. - - For this .visit_Assert() uses the visitor pattern to visit all the - AST nodes of the ast.Assert.test field, each visit call returning - an AST node and the corresponding explanation string. During this - state is kept in several instance attributes: - - :statements: All the AST statements which will replace the assert - statement. - - :variables: This is populated by .variable() with each variable - used by the statements so that they can all be set to None at - the end of the statements. - - :variable_counter: Counter to create new unique variables needed - by statements. Variables are created using .variable() and - have the form of "@py_assert0". - - :on_failure: The AST statements which will be executed if the - assertion test fails. This is the code which will construct - the failure message and raises the AssertionError. - - :explanation_specifiers: A dict filled by .explanation_param() - with %-formatting placeholders and their corresponding - expressions to use in the building of an assertion message. - This is used by .pop_format_context() to build a message. - - :stack: A stack of the explanation_specifiers dicts maintained by - .push_format_context() and .pop_format_context() which allows - to build another %-formatted string while already building one. - - This state is reset on every new assert statement visited and used - by the other visitors. - - """ - - def __init__(self, module_path, config): - super(AssertionRewriter, self).__init__() - self.module_path = module_path - self.config = config - - def run(self, mod): - """Find all assert statements in *mod* and rewrite them.""" - if not mod.body: - # Nothing to do. - return - # Insert some special imports at the top of the module but after any - # docstrings and __future__ imports. - aliases = [ast.alias(py.builtin.builtins.__name__, "@py_builtins"), - ast.alias("_pytest.assertion.rewrite", "@pytest_ar")] - doc = getattr(mod, "docstring", None) - expect_docstring = doc is None - if doc is not None and self.is_rewrite_disabled(doc): - return - pos = 0 - lineno = 1 - for item in mod.body: - if (expect_docstring and isinstance(item, ast.Expr) and - isinstance(item.value, ast.Str)): - doc = item.value.s - if self.is_rewrite_disabled(doc): - return - expect_docstring = False - elif (not isinstance(item, ast.ImportFrom) or item.level > 0 or - item.module != "__future__"): - lineno = item.lineno - break - pos += 1 - else: - lineno = item.lineno - imports = [ast.Import([alias], lineno=lineno, col_offset=0) - for alias in aliases] - mod.body[pos:pos] = imports - # Collect asserts. - nodes = [mod] - while nodes: - node = nodes.pop() - for name, field in ast.iter_fields(node): - if isinstance(field, list): - new = [] - for i, child in enumerate(field): - if isinstance(child, ast.Assert): - # Transform assert. - new.extend(self.visit(child)) - else: - new.append(child) - if isinstance(child, ast.AST): - nodes.append(child) - setattr(node, name, new) - elif (isinstance(field, ast.AST) and - # Don't recurse into expressions as they can't contain - # asserts. - not isinstance(field, ast.expr)): - nodes.append(field) - - def is_rewrite_disabled(self, docstring): - return "PYTEST_DONT_REWRITE" in docstring - - def variable(self): - """Get a new variable.""" - # Use a character invalid in python identifiers to avoid clashing. - name = "@py_assert" + str(next(self.variable_counter)) - self.variables.append(name) - return name - - def assign(self, expr): - """Give *expr* a name.""" - name = self.variable() - self.statements.append(ast.Assign([ast.Name(name, ast.Store())], expr)) - return ast.Name(name, ast.Load()) - - def display(self, expr): - """Call py.io.saferepr on the expression.""" - return self.helper("saferepr", expr) - - def helper(self, name, *args): - """Call a helper in this module.""" - py_name = ast.Name("@pytest_ar", ast.Load()) - attr = ast.Attribute(py_name, "_" + name, ast.Load()) - return ast_Call(attr, list(args), []) - - def builtin(self, name): - """Return the builtin called *name*.""" - builtin_name = ast.Name("@py_builtins", ast.Load()) - return ast.Attribute(builtin_name, name, ast.Load()) - - def explanation_param(self, expr): - """Return a new named %-formatting placeholder for expr. - - This creates a %-formatting placeholder for expr in the - current formatting context, e.g. ``%(py0)s``. The placeholder - and expr are placed in the current format context so that it - can be used on the next call to .pop_format_context(). - - """ - specifier = "py" + str(next(self.variable_counter)) - self.explanation_specifiers[specifier] = expr - return "%(" + specifier + ")s" - - def push_format_context(self): - """Create a new formatting context. - - The format context is used for when an explanation wants to - have a variable value formatted in the assertion message. In - this case the value required can be added using - .explanation_param(). Finally .pop_format_context() is used - to format a string of %-formatted values as added by - .explanation_param(). - - """ - self.explanation_specifiers = {} - self.stack.append(self.explanation_specifiers) - - def pop_format_context(self, expl_expr): - """Format the %-formatted string with current format context. - - The expl_expr should be an ast.Str instance constructed from - the %-placeholders created by .explanation_param(). This will - add the required code to format said string to .on_failure and - return the ast.Name instance of the formatted string. - - """ - current = self.stack.pop() - if self.stack: - self.explanation_specifiers = self.stack[-1] - keys = [ast.Str(key) for key in current.keys()] - format_dict = ast.Dict(keys, list(current.values())) - form = ast.BinOp(expl_expr, ast.Mod(), format_dict) - name = "@py_format" + str(next(self.variable_counter)) - self.on_failure.append(ast.Assign([ast.Name(name, ast.Store())], form)) - return ast.Name(name, ast.Load()) - - def generic_visit(self, node): - """Handle expressions we don't have custom code for.""" - assert isinstance(node, ast.expr) - res = self.assign(node) - return res, self.explanation_param(self.display(res)) - - def visit_Assert(self, assert_): - """Return the AST statements to replace the ast.Assert instance. - - This re-writes the test of an assertion to provide - intermediate values and replace it with an if statement which - raises an assertion error with a detailed explanation in case - the expression is false. - - """ - if isinstance(assert_.test, ast.Tuple) and self.config is not None: - fslocation = (self.module_path, assert_.lineno) - self.config.warn('R1', 'assertion is always true, perhaps ' - 'remove parentheses?', fslocation=fslocation) - self.statements = [] - self.variables = [] - self.variable_counter = itertools.count() - self.stack = [] - self.on_failure = [] - self.push_format_context() - # Rewrite assert into a bunch of statements. - top_condition, explanation = self.visit(assert_.test) - # Create failure message. - body = self.on_failure - negation = ast.UnaryOp(ast.Not(), top_condition) - self.statements.append(ast.If(negation, body, [])) - if assert_.msg: - assertmsg = self.helper('format_assertmsg', assert_.msg) - explanation = "\n>assert " + explanation - else: - assertmsg = ast.Str("") - explanation = "assert " + explanation - template = ast.BinOp(assertmsg, ast.Add(), ast.Str(explanation)) - msg = self.pop_format_context(template) - fmt = self.helper("format_explanation", msg) - err_name = ast.Name("AssertionError", ast.Load()) - exc = ast_Call(err_name, [fmt], []) - if sys.version_info[0] >= 3: - raise_ = ast.Raise(exc, None) - else: - raise_ = ast.Raise(exc, None, None) - body.append(raise_) - # Clear temporary variables by setting them to None. - if self.variables: - variables = [ast.Name(name, ast.Store()) - for name in self.variables] - clear = ast.Assign(variables, _NameConstant(None)) - self.statements.append(clear) - # Fix line numbers. - for stmt in self.statements: - set_location(stmt, assert_.lineno, assert_.col_offset) - return self.statements - - def visit_Name(self, name): - # Display the repr of the name if it's a local variable or - # _should_repr_global_name() thinks it's acceptable. - locs = ast_Call(self.builtin("locals"), [], []) - inlocs = ast.Compare(ast.Str(name.id), [ast.In()], [locs]) - dorepr = self.helper("should_repr_global_name", name) - test = ast.BoolOp(ast.Or(), [inlocs, dorepr]) - expr = ast.IfExp(test, self.display(name), ast.Str(name.id)) - return name, self.explanation_param(expr) - - def visit_BoolOp(self, boolop): - res_var = self.variable() - expl_list = self.assign(ast.List([], ast.Load())) - app = ast.Attribute(expl_list, "append", ast.Load()) - is_or = int(isinstance(boolop.op, ast.Or)) - body = save = self.statements - fail_save = self.on_failure - levels = len(boolop.values) - 1 - self.push_format_context() - # Process each operand, short-circuting if needed. - for i, v in enumerate(boolop.values): - if i: - fail_inner = [] - # cond is set in a prior loop iteration below - self.on_failure.append(ast.If(cond, fail_inner, [])) # noqa - self.on_failure = fail_inner - self.push_format_context() - res, expl = self.visit(v) - body.append(ast.Assign([ast.Name(res_var, ast.Store())], res)) - expl_format = self.pop_format_context(ast.Str(expl)) - call = ast_Call(app, [expl_format], []) - self.on_failure.append(ast.Expr(call)) - if i < levels: - cond = res - if is_or: - cond = ast.UnaryOp(ast.Not(), cond) - inner = [] - self.statements.append(ast.If(cond, inner, [])) - self.statements = body = inner - self.statements = save - self.on_failure = fail_save - expl_template = self.helper("format_boolop", expl_list, ast.Num(is_or)) - expl = self.pop_format_context(expl_template) - return ast.Name(res_var, ast.Load()), self.explanation_param(expl) - - def visit_UnaryOp(self, unary): - pattern = unary_map[unary.op.__class__] - operand_res, operand_expl = self.visit(unary.operand) - res = self.assign(ast.UnaryOp(unary.op, operand_res)) - return res, pattern % (operand_expl,) - - def visit_BinOp(self, binop): - symbol = binop_map[binop.op.__class__] - left_expr, left_expl = self.visit(binop.left) - right_expr, right_expl = self.visit(binop.right) - explanation = "(%s %s %s)" % (left_expl, symbol, right_expl) - res = self.assign(ast.BinOp(left_expr, binop.op, right_expr)) - return res, explanation - - def visit_Call_35(self, call): - """ - visit `ast.Call` nodes on Python3.5 and after - """ - new_func, func_expl = self.visit(call.func) - arg_expls = [] - new_args = [] - new_kwargs = [] - for arg in call.args: - res, expl = self.visit(arg) - arg_expls.append(expl) - new_args.append(res) - for keyword in call.keywords: - res, expl = self.visit(keyword.value) - new_kwargs.append(ast.keyword(keyword.arg, res)) - if keyword.arg: - arg_expls.append(keyword.arg + "=" + expl) - else: # **args have `arg` keywords with an .arg of None - arg_expls.append("**" + expl) - - expl = "%s(%s)" % (func_expl, ', '.join(arg_expls)) - new_call = ast.Call(new_func, new_args, new_kwargs) - res = self.assign(new_call) - res_expl = self.explanation_param(self.display(res)) - outer_expl = "%s\n{%s = %s\n}" % (res_expl, res_expl, expl) - return res, outer_expl - - def visit_Starred(self, starred): - # From Python 3.5, a Starred node can appear in a function call - res, expl = self.visit(starred.value) - return starred, '*' + expl - - def visit_Call_legacy(self, call): - """ - visit `ast.Call nodes on 3.4 and below` - """ - new_func, func_expl = self.visit(call.func) - arg_expls = [] - new_args = [] - new_kwargs = [] - new_star = new_kwarg = None - for arg in call.args: - res, expl = self.visit(arg) - new_args.append(res) - arg_expls.append(expl) - for keyword in call.keywords: - res, expl = self.visit(keyword.value) - new_kwargs.append(ast.keyword(keyword.arg, res)) - arg_expls.append(keyword.arg + "=" + expl) - if call.starargs: - new_star, expl = self.visit(call.starargs) - arg_expls.append("*" + expl) - if call.kwargs: - new_kwarg, expl = self.visit(call.kwargs) - arg_expls.append("**" + expl) - expl = "%s(%s)" % (func_expl, ', '.join(arg_expls)) - new_call = ast.Call(new_func, new_args, new_kwargs, - new_star, new_kwarg) - res = self.assign(new_call) - res_expl = self.explanation_param(self.display(res)) - outer_expl = "%s\n{%s = %s\n}" % (res_expl, res_expl, expl) - return res, outer_expl - - # ast.Call signature changed on 3.5, - # conditionally change which methods is named - # visit_Call depending on Python version - if sys.version_info >= (3, 5): - visit_Call = visit_Call_35 - else: - visit_Call = visit_Call_legacy - - def visit_Attribute(self, attr): - if not isinstance(attr.ctx, ast.Load): - return self.generic_visit(attr) - value, value_expl = self.visit(attr.value) - res = self.assign(ast.Attribute(value, attr.attr, ast.Load())) - res_expl = self.explanation_param(self.display(res)) - pat = "%s\n{%s = %s.%s\n}" - expl = pat % (res_expl, res_expl, value_expl, attr.attr) - return res, expl - - def visit_Compare(self, comp): - self.push_format_context() - left_res, left_expl = self.visit(comp.left) - if isinstance(comp.left, (_ast.Compare, _ast.BoolOp)): - left_expl = "({0})".format(left_expl) - res_variables = [self.variable() for i in range(len(comp.ops))] - load_names = [ast.Name(v, ast.Load()) for v in res_variables] - store_names = [ast.Name(v, ast.Store()) for v in res_variables] - it = zip(range(len(comp.ops)), comp.ops, comp.comparators) - expls = [] - syms = [] - results = [left_res] - for i, op, next_operand in it: - next_res, next_expl = self.visit(next_operand) - if isinstance(next_operand, (_ast.Compare, _ast.BoolOp)): - next_expl = "({0})".format(next_expl) - results.append(next_res) - sym = binop_map[op.__class__] - syms.append(ast.Str(sym)) - expl = "%s %s %s" % (left_expl, sym, next_expl) - expls.append(ast.Str(expl)) - res_expr = ast.Compare(left_res, [op], [next_res]) - self.statements.append(ast.Assign([store_names[i]], res_expr)) - left_res, left_expl = next_res, next_expl - # Use pytest.assertion.util._reprcompare if that's available. - expl_call = self.helper("call_reprcompare", - ast.Tuple(syms, ast.Load()), - ast.Tuple(load_names, ast.Load()), - ast.Tuple(expls, ast.Load()), - ast.Tuple(results, ast.Load())) - if len(comp.ops) > 1: - res = ast.BoolOp(ast.And(), load_names) - else: - res = load_names[0] - return res, self.explanation_param(self.pop_format_context(expl_call)) diff --git a/lib/spack/external/_pytest/assertion/truncate.py b/lib/spack/external/_pytest/assertion/truncate.py deleted file mode 100644 index 1e13063569..0000000000 --- a/lib/spack/external/_pytest/assertion/truncate.py +++ /dev/null @@ -1,102 +0,0 @@ -""" -Utilities for truncating assertion output. - -Current default behaviour is to truncate assertion explanations at -~8 terminal lines, unless running in "-vv" mode or running on CI. -""" -from __future__ import absolute_import, division, print_function -import os - -import py - - -DEFAULT_MAX_LINES = 8 -DEFAULT_MAX_CHARS = 8 * 80 -USAGE_MSG = "use '-vv' to show" - - -def truncate_if_required(explanation, item, max_length=None): - """ - Truncate this assertion explanation if the given test item is eligible. - """ - if _should_truncate_item(item): - return _truncate_explanation(explanation) - return explanation - - -def _should_truncate_item(item): - """ - Whether or not this test item is eligible for truncation. - """ - verbose = item.config.option.verbose - return verbose < 2 and not _running_on_ci() - - -def _running_on_ci(): - """Check if we're currently running on a CI system.""" - env_vars = ['CI', 'BUILD_NUMBER'] - return any(var in os.environ for var in env_vars) - - -def _truncate_explanation(input_lines, max_lines=None, max_chars=None): - """ - Truncate given list of strings that makes up the assertion explanation. - - Truncates to either 8 lines, or 640 characters - whichever the input reaches - first. The remaining lines will be replaced by a usage message. - """ - - if max_lines is None: - max_lines = DEFAULT_MAX_LINES - if max_chars is None: - max_chars = DEFAULT_MAX_CHARS - - # Check if truncation required - input_char_count = len("".join(input_lines)) - if len(input_lines) <= max_lines and input_char_count <= max_chars: - return input_lines - - # Truncate first to max_lines, and then truncate to max_chars if max_chars - # is exceeded. - truncated_explanation = input_lines[:max_lines] - truncated_explanation = _truncate_by_char_count(truncated_explanation, max_chars) - - # Add ellipsis to final line - truncated_explanation[-1] = truncated_explanation[-1] + "..." - - # Append useful message to explanation - truncated_line_count = len(input_lines) - len(truncated_explanation) - truncated_line_count += 1 # Account for the part-truncated final line - msg = '...Full output truncated' - if truncated_line_count == 1: - msg += ' ({0} line hidden)'.format(truncated_line_count) - else: - msg += ' ({0} lines hidden)'.format(truncated_line_count) - msg += ", {0}" .format(USAGE_MSG) - truncated_explanation.extend([ - py.builtin._totext(""), - py.builtin._totext(msg), - ]) - return truncated_explanation - - -def _truncate_by_char_count(input_lines, max_chars): - # Check if truncation required - if len("".join(input_lines)) <= max_chars: - return input_lines - - # Find point at which input length exceeds total allowed length - iterated_char_count = 0 - for iterated_index, input_line in enumerate(input_lines): - if iterated_char_count + len(input_line) > max_chars: - break - iterated_char_count += len(input_line) - - # Create truncated explanation with modified final line - truncated_result = input_lines[:iterated_index] - final_line = input_lines[iterated_index] - if final_line: - final_line_truncate_point = max_chars - iterated_char_count - final_line = final_line[:final_line_truncate_point] - truncated_result.append(final_line) - return truncated_result diff --git a/lib/spack/external/_pytest/assertion/util.py b/lib/spack/external/_pytest/assertion/util.py deleted file mode 100644 index c09eff06b0..0000000000 --- a/lib/spack/external/_pytest/assertion/util.py +++ /dev/null @@ -1,310 +0,0 @@ -"""Utilities for assertion debugging""" -from __future__ import absolute_import, division, print_function -import pprint - -import _pytest._code -import py -try: - from collections.abc import Sequence -except ImportError: - try: - from collections import Sequence - except ImportError: - Sequence = list - - -u = py.builtin._totext - -# The _reprcompare attribute on the util module is used by the new assertion -# interpretation code and assertion rewriter to detect this plugin was -# loaded and in turn call the hooks defined here as part of the -# DebugInterpreter. -_reprcompare = None - - -# the re-encoding is needed for python2 repr -# with non-ascii characters (see issue 877 and 1379) -def ecu(s): - try: - return u(s, 'utf-8', 'replace') - except TypeError: - return s - - -def format_explanation(explanation): - """This formats an explanation - - Normally all embedded newlines are escaped, however there are - three exceptions: \n{, \n} and \n~. The first two are intended - cover nested explanations, see function and attribute explanations - for examples (.visit_Call(), visit_Attribute()). The last one is - for when one explanation needs to span multiple lines, e.g. when - displaying diffs. - """ - explanation = ecu(explanation) - lines = _split_explanation(explanation) - result = _format_lines(lines) - return u('\n').join(result) - - -def _split_explanation(explanation): - """Return a list of individual lines in the explanation - - This will return a list of lines split on '\n{', '\n}' and '\n~'. - Any other newlines will be escaped and appear in the line as the - literal '\n' characters. - """ - raw_lines = (explanation or u('')).split('\n') - lines = [raw_lines[0]] - for values in raw_lines[1:]: - if values and values[0] in ['{', '}', '~', '>']: - lines.append(values) - else: - lines[-1] += '\\n' + values - return lines - - -def _format_lines(lines): - """Format the individual lines - - This will replace the '{', '}' and '~' characters of our mini - formatting language with the proper 'where ...', 'and ...' and ' + - ...' text, taking care of indentation along the way. - - Return a list of formatted lines. - """ - result = lines[:1] - stack = [0] - stackcnt = [0] - for line in lines[1:]: - if line.startswith('{'): - if stackcnt[-1]: - s = u('and ') - else: - s = u('where ') - stack.append(len(result)) - stackcnt[-1] += 1 - stackcnt.append(0) - result.append(u(' +') + u(' ') * (len(stack) - 1) + s + line[1:]) - elif line.startswith('}'): - stack.pop() - stackcnt.pop() - result[stack[-1]] += line[1:] - else: - assert line[0] in ['~', '>'] - stack[-1] += 1 - indent = len(stack) if line.startswith('~') else len(stack) - 1 - result.append(u(' ') * indent + line[1:]) - assert len(stack) == 1 - return result - - -# Provide basestring in python3 -try: - basestring = basestring -except NameError: - basestring = str - - -def assertrepr_compare(config, op, left, right): - """Return specialised explanations for some operators/operands""" - width = 80 - 15 - len(op) - 2 # 15 chars indentation, 1 space around op - left_repr = py.io.saferepr(left, maxsize=int(width // 2)) - right_repr = py.io.saferepr(right, maxsize=width - len(left_repr)) - - summary = u('%s %s %s') % (ecu(left_repr), op, ecu(right_repr)) - - def issequence(x): - return (isinstance(x, (list, tuple, Sequence)) and not isinstance(x, basestring)) - - def istext(x): - return isinstance(x, basestring) - - def isdict(x): - return isinstance(x, dict) - - def isset(x): - return isinstance(x, (set, frozenset)) - - def isiterable(obj): - try: - iter(obj) - return not istext(obj) - except TypeError: - return False - - verbose = config.getoption('verbose') - explanation = None - try: - if op == '==': - if istext(left) and istext(right): - explanation = _diff_text(left, right, verbose) - else: - if issequence(left) and issequence(right): - explanation = _compare_eq_sequence(left, right, verbose) - elif isset(left) and isset(right): - explanation = _compare_eq_set(left, right, verbose) - elif isdict(left) and isdict(right): - explanation = _compare_eq_dict(left, right, verbose) - if isiterable(left) and isiterable(right): - expl = _compare_eq_iterable(left, right, verbose) - if explanation is not None: - explanation.extend(expl) - else: - explanation = expl - elif op == 'not in': - if istext(left) and istext(right): - explanation = _notin_text(left, right, verbose) - except Exception: - explanation = [ - u('(pytest_assertion plugin: representation of details failed. ' - 'Probably an object has a faulty __repr__.)'), - u(_pytest._code.ExceptionInfo())] - - if not explanation: - return None - - return [summary] + explanation - - -def _diff_text(left, right, verbose=False): - """Return the explanation for the diff between text or bytes - - Unless --verbose is used this will skip leading and trailing - characters which are identical to keep the diff minimal. - - If the input are bytes they will be safely converted to text. - """ - from difflib import ndiff - explanation = [] - if isinstance(left, py.builtin.bytes): - left = u(repr(left)[1:-1]).replace(r'\n', '\n') - if isinstance(right, py.builtin.bytes): - right = u(repr(right)[1:-1]).replace(r'\n', '\n') - if not verbose: - i = 0 # just in case left or right has zero length - for i in range(min(len(left), len(right))): - if left[i] != right[i]: - break - if i > 42: - i -= 10 # Provide some context - explanation = [u('Skipping %s identical leading ' - 'characters in diff, use -v to show') % i] - left = left[i:] - right = right[i:] - if len(left) == len(right): - for i in range(len(left)): - if left[-i] != right[-i]: - break - if i > 42: - i -= 10 # Provide some context - explanation += [u('Skipping %s identical trailing ' - 'characters in diff, use -v to show') % i] - left = left[:-i] - right = right[:-i] - keepends = True - explanation += [line.strip('\n') - for line in ndiff(left.splitlines(keepends), - right.splitlines(keepends))] - return explanation - - -def _compare_eq_iterable(left, right, verbose=False): - if not verbose: - return [u('Use -v to get the full diff')] - # dynamic import to speedup pytest - import difflib - - try: - left_formatting = pprint.pformat(left).splitlines() - right_formatting = pprint.pformat(right).splitlines() - explanation = [u('Full diff:')] - except Exception: - # hack: PrettyPrinter.pformat() in python 2 fails when formatting items that can't be sorted(), ie, calling - # sorted() on a list would raise. See issue #718. - # As a workaround, the full diff is generated by using the repr() string of each item of each container. - left_formatting = sorted(repr(x) for x in left) - right_formatting = sorted(repr(x) for x in right) - explanation = [u('Full diff (fallback to calling repr on each item):')] - explanation.extend(line.strip() for line in difflib.ndiff(left_formatting, right_formatting)) - return explanation - - -def _compare_eq_sequence(left, right, verbose=False): - explanation = [] - for i in range(min(len(left), len(right))): - if left[i] != right[i]: - explanation += [u('At index %s diff: %r != %r') - % (i, left[i], right[i])] - break - if len(left) > len(right): - explanation += [u('Left contains more items, first extra item: %s') - % py.io.saferepr(left[len(right)],)] - elif len(left) < len(right): - explanation += [ - u('Right contains more items, first extra item: %s') % - py.io.saferepr(right[len(left)],)] - return explanation - - -def _compare_eq_set(left, right, verbose=False): - explanation = [] - diff_left = left - right - diff_right = right - left - if diff_left: - explanation.append(u('Extra items in the left set:')) - for item in diff_left: - explanation.append(py.io.saferepr(item)) - if diff_right: - explanation.append(u('Extra items in the right set:')) - for item in diff_right: - explanation.append(py.io.saferepr(item)) - return explanation - - -def _compare_eq_dict(left, right, verbose=False): - explanation = [] - common = set(left).intersection(set(right)) - same = dict((k, left[k]) for k in common if left[k] == right[k]) - if same and verbose < 2: - explanation += [u('Omitting %s identical items, use -vv to show') % - len(same)] - elif same: - explanation += [u('Common items:')] - explanation += pprint.pformat(same).splitlines() - diff = set(k for k in common if left[k] != right[k]) - if diff: - explanation += [u('Differing items:')] - for k in diff: - explanation += [py.io.saferepr({k: left[k]}) + ' != ' + - py.io.saferepr({k: right[k]})] - extra_left = set(left) - set(right) - if extra_left: - explanation.append(u('Left contains more items:')) - explanation.extend(pprint.pformat( - dict((k, left[k]) for k in extra_left)).splitlines()) - extra_right = set(right) - set(left) - if extra_right: - explanation.append(u('Right contains more items:')) - explanation.extend(pprint.pformat( - dict((k, right[k]) for k in extra_right)).splitlines()) - return explanation - - -def _notin_text(term, text, verbose=False): - index = text.find(term) - head = text[:index] - tail = text[index + len(term):] - correct_text = head + tail - diff = _diff_text(correct_text, text, verbose) - newdiff = [u('%s is contained here:') % py.io.saferepr(term, maxsize=42)] - for line in diff: - if line.startswith(u('Skipping')): - continue - if line.startswith(u('- ')): - continue - if line.startswith(u('+ ')): - newdiff.append(u(' ') + line[2:]) - else: - newdiff.append(line) - return newdiff diff --git a/lib/spack/external/_pytest/cacheprovider.py b/lib/spack/external/_pytest/cacheprovider.py deleted file mode 100755 index c537c14472..0000000000 --- a/lib/spack/external/_pytest/cacheprovider.py +++ /dev/null @@ -1,260 +0,0 @@ -""" -merged implementation of the cache provider - -the name cache was not chosen to ensure pluggy automatically -ignores the external pytest-cache -""" -from __future__ import absolute_import, division, print_function -import py -import pytest -import json -import os -from os.path import sep as _sep, altsep as _altsep - - -class Cache(object): - def __init__(self, config): - self.config = config - self._cachedir = Cache.cache_dir_from_config(config) - self.trace = config.trace.root.get("cache") - if config.getvalue("cacheclear"): - self.trace("clearing cachedir") - if self._cachedir.check(): - self._cachedir.remove() - self._cachedir.mkdir() - - @staticmethod - def cache_dir_from_config(config): - cache_dir = config.getini("cache_dir") - cache_dir = os.path.expanduser(cache_dir) - cache_dir = os.path.expandvars(cache_dir) - if os.path.isabs(cache_dir): - return py.path.local(cache_dir) - else: - return config.rootdir.join(cache_dir) - - def makedir(self, name): - """ return a directory path object with the given name. If the - directory does not yet exist, it will be created. You can use it - to manage files likes e. g. store/retrieve database - dumps across test sessions. - - :param name: must be a string not containing a ``/`` separator. - Make sure the name contains your plugin or application - identifiers to prevent clashes with other cache users. - """ - if _sep in name or _altsep is not None and _altsep in name: - raise ValueError("name is not allowed to contain path separators") - return self._cachedir.ensure_dir("d", name) - - def _getvaluepath(self, key): - return self._cachedir.join('v', *key.split('/')) - - def get(self, key, default): - """ return cached value for the given key. If no value - was yet cached or the value cannot be read, the specified - default is returned. - - :param key: must be a ``/`` separated value. Usually the first - name is the name of your plugin or your application. - :param default: must be provided in case of a cache-miss or - invalid cache values. - - """ - path = self._getvaluepath(key) - if path.check(): - try: - with path.open("r") as f: - return json.load(f) - except ValueError: - self.trace("cache-invalid at %s" % (path,)) - return default - - def set(self, key, value): - """ save value for the given key. - - :param key: must be a ``/`` separated value. Usually the first - name is the name of your plugin or your application. - :param value: must be of any combination of basic - python types, including nested types - like e. g. lists of dictionaries. - """ - path = self._getvaluepath(key) - try: - path.dirpath().ensure_dir() - except (py.error.EEXIST, py.error.EACCES): - self.config.warn( - code='I9', message='could not create cache path %s' % (path,) - ) - return - try: - f = path.open('w') - except py.error.ENOTDIR: - self.config.warn( - code='I9', message='cache could not write path %s' % (path,)) - else: - with f: - self.trace("cache-write %s: %r" % (key, value,)) - json.dump(value, f, indent=2, sort_keys=True) - - -class LFPlugin: - """ Plugin which implements the --lf (run last-failing) option """ - - def __init__(self, config): - self.config = config - active_keys = 'lf', 'failedfirst' - self.active = any(config.getvalue(key) for key in active_keys) - self.lastfailed = config.cache.get("cache/lastfailed", {}) - self._previously_failed_count = None - - def pytest_report_collectionfinish(self): - if self.active: - if not self._previously_failed_count: - mode = "run all (no recorded failures)" - else: - noun = 'failure' if self._previously_failed_count == 1 else 'failures' - suffix = " first" if self.config.getvalue("failedfirst") else "" - mode = "rerun previous {count} {noun}{suffix}".format( - count=self._previously_failed_count, suffix=suffix, noun=noun - ) - return "run-last-failure: %s" % mode - - def pytest_runtest_logreport(self, report): - if (report.when == 'call' and report.passed) or report.skipped: - self.lastfailed.pop(report.nodeid, None) - elif report.failed: - self.lastfailed[report.nodeid] = True - - def pytest_collectreport(self, report): - passed = report.outcome in ('passed', 'skipped') - if passed: - if report.nodeid in self.lastfailed: - self.lastfailed.pop(report.nodeid) - self.lastfailed.update( - (item.nodeid, True) - for item in report.result) - else: - self.lastfailed[report.nodeid] = True - - def pytest_collection_modifyitems(self, session, config, items): - if self.active and self.lastfailed: - previously_failed = [] - previously_passed = [] - for item in items: - if item.nodeid in self.lastfailed: - previously_failed.append(item) - else: - previously_passed.append(item) - self._previously_failed_count = len(previously_failed) - if not previously_failed: - # running a subset of all tests with recorded failures outside - # of the set of tests currently executing - return - if self.config.getvalue("lf"): - items[:] = previously_failed - config.hook.pytest_deselected(items=previously_passed) - else: - items[:] = previously_failed + previously_passed - - def pytest_sessionfinish(self, session): - config = self.config - if config.getvalue("cacheshow") or hasattr(config, "slaveinput"): - return - - saved_lastfailed = config.cache.get("cache/lastfailed", {}) - if saved_lastfailed != self.lastfailed: - config.cache.set("cache/lastfailed", self.lastfailed) - - -def pytest_addoption(parser): - group = parser.getgroup("general") - group.addoption( - '--lf', '--last-failed', action='store_true', dest="lf", - help="rerun only the tests that failed " - "at the last run (or all if none failed)") - group.addoption( - '--ff', '--failed-first', action='store_true', dest="failedfirst", - help="run all tests but run the last failures first. " - "This may re-order tests and thus lead to " - "repeated fixture setup/teardown") - group.addoption( - '--cache-show', action='store_true', dest="cacheshow", - help="show cache contents, don't perform collection or tests") - group.addoption( - '--cache-clear', action='store_true', dest="cacheclear", - help="remove all cache contents at start of test run.") - parser.addini( - "cache_dir", default='.cache', - help="cache directory path.") - - -def pytest_cmdline_main(config): - if config.option.cacheshow: - from _pytest.main import wrap_session - return wrap_session(config, cacheshow) - - -@pytest.hookimpl(tryfirst=True) -def pytest_configure(config): - config.cache = Cache(config) - config.pluginmanager.register(LFPlugin(config), "lfplugin") - - -@pytest.fixture -def cache(request): - """ - Return a cache object that can persist state between testing sessions. - - cache.get(key, default) - cache.set(key, value) - - Keys must be a ``/`` separated value, where the first part is usually the - name of your plugin or application to avoid clashes with other cache users. - - Values can be any object handled by the json stdlib module. - """ - return request.config.cache - - -def pytest_report_header(config): - if config.option.verbose: - relpath = py.path.local().bestrelpath(config.cache._cachedir) - return "cachedir: %s" % relpath - - -def cacheshow(config, session): - from pprint import pprint - tw = py.io.TerminalWriter() - tw.line("cachedir: " + str(config.cache._cachedir)) - if not config.cache._cachedir.check(): - tw.line("cache is empty") - return 0 - dummy = object() - basedir = config.cache._cachedir - vdir = basedir.join("v") - tw.sep("-", "cache values") - for valpath in sorted(vdir.visit(lambda x: x.isfile())): - key = valpath.relto(vdir).replace(valpath.sep, "/") - val = config.cache.get(key, dummy) - if val is dummy: - tw.line("%s contains unreadable content, " - "will be ignored" % key) - else: - tw.line("%s contains:" % key) - stream = py.io.TextIO() - pprint(val, stream=stream) - for line in stream.getvalue().splitlines(): - tw.line(" " + line) - - ddir = basedir.join("d") - if ddir.isdir() and ddir.listdir(): - tw.sep("-", "cache directories") - for p in sorted(basedir.join("d").visit()): - # if p.check(dir=1): - # print("%s/" % p.relto(basedir)) - if p.isfile(): - key = p.relto(basedir) - tw.line("%s is a file of length %d" % ( - key, p.size())) - return 0 diff --git a/lib/spack/external/_pytest/capture.py b/lib/spack/external/_pytest/capture.py deleted file mode 100644 index cb5af6fcb3..0000000000 --- a/lib/spack/external/_pytest/capture.py +++ /dev/null @@ -1,577 +0,0 @@ -""" -per-test stdout/stderr capturing mechanism. - -""" -from __future__ import absolute_import, division, print_function - -import contextlib -import sys -import os -import io -from io import UnsupportedOperation -from tempfile import TemporaryFile - -import py -import pytest -from _pytest.compat import CaptureIO - -unicode = py.builtin.text - -patchsysdict = {0: 'stdin', 1: 'stdout', 2: 'stderr'} - - -def pytest_addoption(parser): - group = parser.getgroup("general") - group._addoption( - '--capture', action="store", - default="fd" if hasattr(os, "dup") else "sys", - metavar="method", choices=['fd', 'sys', 'no'], - help="per-test capturing method: one of fd|sys|no.") - group._addoption( - '-s', action="store_const", const="no", dest="capture", - help="shortcut for --capture=no.") - - -@pytest.hookimpl(hookwrapper=True) -def pytest_load_initial_conftests(early_config, parser, args): - ns = early_config.known_args_namespace - if ns.capture == "fd": - _py36_windowsconsoleio_workaround(sys.stdout) - _colorama_workaround() - _readline_workaround() - pluginmanager = early_config.pluginmanager - capman = CaptureManager(ns.capture) - pluginmanager.register(capman, "capturemanager") - - # make sure that capturemanager is properly reset at final shutdown - early_config.add_cleanup(capman.reset_capturings) - - # make sure logging does not raise exceptions at the end - def silence_logging_at_shutdown(): - if "logging" in sys.modules: - sys.modules["logging"].raiseExceptions = False - early_config.add_cleanup(silence_logging_at_shutdown) - - # finally trigger conftest loading but while capturing (issue93) - capman.init_capturings() - outcome = yield - out, err = capman.suspendcapture() - if outcome.excinfo is not None: - sys.stdout.write(out) - sys.stderr.write(err) - - -class CaptureManager: - def __init__(self, method): - self._method = method - - def _getcapture(self, method): - if method == "fd": - return MultiCapture(out=True, err=True, Capture=FDCapture) - elif method == "sys": - return MultiCapture(out=True, err=True, Capture=SysCapture) - elif method == "no": - return MultiCapture(out=False, err=False, in_=False) - else: - raise ValueError("unknown capturing method: %r" % method) - - def init_capturings(self): - assert not hasattr(self, "_capturing") - self._capturing = self._getcapture(self._method) - self._capturing.start_capturing() - - def reset_capturings(self): - cap = self.__dict__.pop("_capturing", None) - if cap is not None: - cap.pop_outerr_to_orig() - cap.stop_capturing() - - def resumecapture(self): - self._capturing.resume_capturing() - - def suspendcapture(self, in_=False): - self.deactivate_funcargs() - cap = getattr(self, "_capturing", None) - if cap is not None: - try: - outerr = cap.readouterr() - finally: - cap.suspend_capturing(in_=in_) - return outerr - - def activate_funcargs(self, pyfuncitem): - capfuncarg = pyfuncitem.__dict__.pop("_capfuncarg", None) - if capfuncarg is not None: - capfuncarg._start() - self._capfuncarg = capfuncarg - - def deactivate_funcargs(self): - capfuncarg = self.__dict__.pop("_capfuncarg", None) - if capfuncarg is not None: - capfuncarg.close() - - @pytest.hookimpl(hookwrapper=True) - def pytest_make_collect_report(self, collector): - if isinstance(collector, pytest.File): - self.resumecapture() - outcome = yield - out, err = self.suspendcapture() - rep = outcome.get_result() - if out: - rep.sections.append(("Captured stdout", out)) - if err: - rep.sections.append(("Captured stderr", err)) - else: - yield - - @pytest.hookimpl(hookwrapper=True) - def pytest_runtest_setup(self, item): - self.resumecapture() - yield - self.suspendcapture_item(item, "setup") - - @pytest.hookimpl(hookwrapper=True) - def pytest_runtest_call(self, item): - self.resumecapture() - self.activate_funcargs(item) - yield - # self.deactivate_funcargs() called from suspendcapture() - self.suspendcapture_item(item, "call") - - @pytest.hookimpl(hookwrapper=True) - def pytest_runtest_teardown(self, item): - self.resumecapture() - yield - self.suspendcapture_item(item, "teardown") - - @pytest.hookimpl(tryfirst=True) - def pytest_keyboard_interrupt(self, excinfo): - self.reset_capturings() - - @pytest.hookimpl(tryfirst=True) - def pytest_internalerror(self, excinfo): - self.reset_capturings() - - def suspendcapture_item(self, item, when, in_=False): - out, err = self.suspendcapture(in_=in_) - item.add_report_section(when, "stdout", out) - item.add_report_section(when, "stderr", err) - - -error_capsysfderror = "cannot use capsys and capfd at the same time" - - -@pytest.fixture -def capsys(request): - """Enable capturing of writes to sys.stdout/sys.stderr and make - captured output available via ``capsys.readouterr()`` method calls - which return a ``(out, err)`` tuple. - """ - if "capfd" in request.fixturenames: - raise request.raiseerror(error_capsysfderror) - request.node._capfuncarg = c = CaptureFixture(SysCapture, request) - return c - - -@pytest.fixture -def capfd(request): - """Enable capturing of writes to file descriptors 1 and 2 and make - captured output available via ``capfd.readouterr()`` method calls - which return a ``(out, err)`` tuple. - """ - if "capsys" in request.fixturenames: - request.raiseerror(error_capsysfderror) - if not hasattr(os, 'dup'): - pytest.skip("capfd funcarg needs os.dup") - request.node._capfuncarg = c = CaptureFixture(FDCapture, request) - return c - - -class CaptureFixture: - def __init__(self, captureclass, request): - self.captureclass = captureclass - self.request = request - - def _start(self): - self._capture = MultiCapture(out=True, err=True, in_=False, - Capture=self.captureclass) - self._capture.start_capturing() - - def close(self): - cap = self.__dict__.pop("_capture", None) - if cap is not None: - self._outerr = cap.pop_outerr_to_orig() - cap.stop_capturing() - - def readouterr(self): - try: - return self._capture.readouterr() - except AttributeError: - return self._outerr - - @contextlib.contextmanager - def disabled(self): - capmanager = self.request.config.pluginmanager.getplugin('capturemanager') - capmanager.suspendcapture_item(self.request.node, "call", in_=True) - try: - yield - finally: - capmanager.resumecapture() - - -def safe_text_dupfile(f, mode, default_encoding="UTF8"): - """ return a open text file object that's a duplicate of f on the - FD-level if possible. - """ - encoding = getattr(f, "encoding", None) - try: - fd = f.fileno() - except Exception: - if "b" not in getattr(f, "mode", "") and hasattr(f, "encoding"): - # we seem to have a text stream, let's just use it - return f - else: - newfd = os.dup(fd) - if "b" not in mode: - mode += "b" - f = os.fdopen(newfd, mode, 0) # no buffering - return EncodedFile(f, encoding or default_encoding) - - -class EncodedFile(object): - errors = "strict" # possibly needed by py3 code (issue555) - - def __init__(self, buffer, encoding): - self.buffer = buffer - self.encoding = encoding - - def write(self, obj): - if isinstance(obj, unicode): - obj = obj.encode(self.encoding, "replace") - self.buffer.write(obj) - - def writelines(self, linelist): - data = ''.join(linelist) - self.write(data) - - @property - def name(self): - """Ensure that file.name is a string.""" - return repr(self.buffer) - - def __getattr__(self, name): - return getattr(object.__getattribute__(self, "buffer"), name) - - -class MultiCapture(object): - out = err = in_ = None - - def __init__(self, out=True, err=True, in_=True, Capture=None): - if in_: - self.in_ = Capture(0) - if out: - self.out = Capture(1) - if err: - self.err = Capture(2) - - def start_capturing(self): - if self.in_: - self.in_.start() - if self.out: - self.out.start() - if self.err: - self.err.start() - - def pop_outerr_to_orig(self): - """ pop current snapshot out/err capture and flush to orig streams. """ - out, err = self.readouterr() - if out: - self.out.writeorg(out) - if err: - self.err.writeorg(err) - return out, err - - def suspend_capturing(self, in_=False): - if self.out: - self.out.suspend() - if self.err: - self.err.suspend() - if in_ and self.in_: - self.in_.suspend() - self._in_suspended = True - - def resume_capturing(self): - if self.out: - self.out.resume() - if self.err: - self.err.resume() - if hasattr(self, "_in_suspended"): - self.in_.resume() - del self._in_suspended - - def stop_capturing(self): - """ stop capturing and reset capturing streams """ - if hasattr(self, '_reset'): - raise ValueError("was already stopped") - self._reset = True - if self.out: - self.out.done() - if self.err: - self.err.done() - if self.in_: - self.in_.done() - - def readouterr(self): - """ return snapshot unicode value of stdout/stderr capturings. """ - return (self.out.snap() if self.out is not None else "", - self.err.snap() if self.err is not None else "") - - -class NoCapture: - __init__ = start = done = suspend = resume = lambda *args: None - - -class FDCapture: - """ Capture IO to/from a given os-level filedescriptor. """ - - def __init__(self, targetfd, tmpfile=None): - self.targetfd = targetfd - try: - self.targetfd_save = os.dup(self.targetfd) - except OSError: - self.start = lambda: None - self.done = lambda: None - else: - if targetfd == 0: - assert not tmpfile, "cannot set tmpfile with stdin" - tmpfile = open(os.devnull, "r") - self.syscapture = SysCapture(targetfd) - else: - if tmpfile is None: - f = TemporaryFile() - with f: - tmpfile = safe_text_dupfile(f, mode="wb+") - if targetfd in patchsysdict: - self.syscapture = SysCapture(targetfd, tmpfile) - else: - self.syscapture = NoCapture() - self.tmpfile = tmpfile - self.tmpfile_fd = tmpfile.fileno() - - def __repr__(self): - return "" % (self.targetfd, self.targetfd_save) - - def start(self): - """ Start capturing on targetfd using memorized tmpfile. """ - try: - os.fstat(self.targetfd_save) - except (AttributeError, OSError): - raise ValueError("saved filedescriptor not valid anymore") - os.dup2(self.tmpfile_fd, self.targetfd) - self.syscapture.start() - - def snap(self): - f = self.tmpfile - f.seek(0) - res = f.read() - if res: - enc = getattr(f, "encoding", None) - if enc and isinstance(res, bytes): - res = py.builtin._totext(res, enc, "replace") - f.truncate(0) - f.seek(0) - return res - return '' - - def done(self): - """ stop capturing, restore streams, return original capture file, - seeked to position zero. """ - targetfd_save = self.__dict__.pop("targetfd_save") - os.dup2(targetfd_save, self.targetfd) - os.close(targetfd_save) - self.syscapture.done() - self.tmpfile.close() - - def suspend(self): - self.syscapture.suspend() - os.dup2(self.targetfd_save, self.targetfd) - - def resume(self): - self.syscapture.resume() - os.dup2(self.tmpfile_fd, self.targetfd) - - def writeorg(self, data): - """ write to original file descriptor. """ - if py.builtin._istext(data): - data = data.encode("utf8") # XXX use encoding of original stream - os.write(self.targetfd_save, data) - - -class SysCapture: - def __init__(self, fd, tmpfile=None): - name = patchsysdict[fd] - self._old = getattr(sys, name) - self.name = name - if tmpfile is None: - if name == "stdin": - tmpfile = DontReadFromInput() - else: - tmpfile = CaptureIO() - self.tmpfile = tmpfile - - def start(self): - setattr(sys, self.name, self.tmpfile) - - def snap(self): - f = self.tmpfile - res = f.getvalue() - f.truncate(0) - f.seek(0) - return res - - def done(self): - setattr(sys, self.name, self._old) - del self._old - self.tmpfile.close() - - def suspend(self): - setattr(sys, self.name, self._old) - - def resume(self): - setattr(sys, self.name, self.tmpfile) - - def writeorg(self, data): - self._old.write(data) - self._old.flush() - - -class DontReadFromInput: - """Temporary stub class. Ideally when stdin is accessed, the - capturing should be turned off, with possibly all data captured - so far sent to the screen. This should be configurable, though, - because in automated test runs it is better to crash than - hang indefinitely. - """ - - encoding = None - - def read(self, *args): - raise IOError("reading from stdin while output is captured") - readline = read - readlines = read - __iter__ = read - - def fileno(self): - raise UnsupportedOperation("redirected stdin is pseudofile, " - "has no fileno()") - - def isatty(self): - return False - - def close(self): - pass - - @property - def buffer(self): - if sys.version_info >= (3, 0): - return self - else: - raise AttributeError('redirected stdin has no attribute buffer') - - -def _colorama_workaround(): - """ - Ensure colorama is imported so that it attaches to the correct stdio - handles on Windows. - - colorama uses the terminal on import time. So if something does the - first import of colorama while I/O capture is active, colorama will - fail in various ways. - """ - - if not sys.platform.startswith('win32'): - return - try: - import colorama # noqa - except ImportError: - pass - - -def _readline_workaround(): - """ - Ensure readline is imported so that it attaches to the correct stdio - handles on Windows. - - Pdb uses readline support where available--when not running from the Python - prompt, the readline module is not imported until running the pdb REPL. If - running pytest with the --pdb option this means the readline module is not - imported until after I/O capture has been started. - - This is a problem for pyreadline, which is often used to implement readline - support on Windows, as it does not attach to the correct handles for stdout - and/or stdin if they have been redirected by the FDCapture mechanism. This - workaround ensures that readline is imported before I/O capture is setup so - that it can attach to the actual stdin/out for the console. - - See https://github.com/pytest-dev/pytest/pull/1281 - """ - - if not sys.platform.startswith('win32'): - return - try: - import readline # noqa - except ImportError: - pass - - -def _py36_windowsconsoleio_workaround(stream): - """ - Python 3.6 implemented unicode console handling for Windows. This works - by reading/writing to the raw console handle using - ``{Read,Write}ConsoleW``. - - The problem is that we are going to ``dup2`` over the stdio file - descriptors when doing ``FDCapture`` and this will ``CloseHandle`` the - handles used by Python to write to the console. Though there is still some - weirdness and the console handle seems to only be closed randomly and not - on the first call to ``CloseHandle``, or maybe it gets reopened with the - same handle value when we suspend capturing. - - The workaround in this case will reopen stdio with a different fd which - also means a different handle by replicating the logic in - "Py_lifecycle.c:initstdio/create_stdio". - - :param stream: in practice ``sys.stdout`` or ``sys.stderr``, but given - here as parameter for unittesting purposes. - - See https://github.com/pytest-dev/py/issues/103 - """ - if not sys.platform.startswith('win32') or sys.version_info[:2] < (3, 6): - return - - # bail out if ``stream`` doesn't seem like a proper ``io`` stream (#2666) - if not hasattr(stream, 'buffer'): - return - - buffered = hasattr(stream.buffer, 'raw') - raw_stdout = stream.buffer.raw if buffered else stream.buffer - - if not isinstance(raw_stdout, io._WindowsConsoleIO): - return - - def _reopen_stdio(f, mode): - if not buffered and mode[0] == 'w': - buffering = 0 - else: - buffering = -1 - - return io.TextIOWrapper( - open(os.dup(f.fileno()), mode, buffering), - f.encoding, - f.errors, - f.newlines, - f.line_buffering) - - sys.__stdin__ = sys.stdin = _reopen_stdio(sys.stdin, 'rb') - sys.__stdout__ = sys.stdout = _reopen_stdio(sys.stdout, 'wb') - sys.__stderr__ = sys.stderr = _reopen_stdio(sys.stderr, 'wb') diff --git a/lib/spack/external/_pytest/compat.py b/lib/spack/external/_pytest/compat.py deleted file mode 100644 index 255f69ce0d..0000000000 --- a/lib/spack/external/_pytest/compat.py +++ /dev/null @@ -1,326 +0,0 @@ -""" -python version compatibility code -""" -from __future__ import absolute_import, division, print_function -import sys -import inspect -import types -import re -import functools - -import py - -import _pytest -from _pytest.outcomes import TEST_OUTCOME - - -try: - import enum -except ImportError: # pragma: no cover - # Only available in Python 3.4+ or as a backport - enum = None - - -_PY3 = sys.version_info > (3, 0) -_PY2 = not _PY3 - - -NoneType = type(None) -NOTSET = object() - -PY35 = sys.version_info[:2] >= (3, 5) -PY36 = sys.version_info[:2] >= (3, 6) -MODULE_NOT_FOUND_ERROR = 'ModuleNotFoundError' if PY36 else 'ImportError' - -if hasattr(inspect, 'signature'): - def _format_args(func): - return str(inspect.signature(func)) -else: - def _format_args(func): - return inspect.formatargspec(*inspect.getargspec(func)) - -isfunction = inspect.isfunction -isclass = inspect.isclass -# used to work around a python2 exception info leak -exc_clear = getattr(sys, 'exc_clear', lambda: None) -# The type of re.compile objects is not exposed in Python. -REGEX_TYPE = type(re.compile('')) - - -def is_generator(func): - genfunc = inspect.isgeneratorfunction(func) - return genfunc and not iscoroutinefunction(func) - - -def iscoroutinefunction(func): - """Return True if func is a decorated coroutine function. - - Note: copied and modified from Python 3.5's builtin couroutines.py to avoid import asyncio directly, - which in turns also initializes the "logging" module as side-effect (see issue #8). - """ - return (getattr(func, '_is_coroutine', False) or - (hasattr(inspect, 'iscoroutinefunction') and inspect.iscoroutinefunction(func))) - - -def getlocation(function, curdir): - import inspect - fn = py.path.local(inspect.getfile(function)) - lineno = py.builtin._getcode(function).co_firstlineno - if fn.relto(curdir): - fn = fn.relto(curdir) - return "%s:%d" % (fn, lineno + 1) - - -def num_mock_patch_args(function): - """ return number of arguments used up by mock arguments (if any) """ - patchings = getattr(function, "patchings", None) - if not patchings: - return 0 - mock = sys.modules.get("mock", sys.modules.get("unittest.mock", None)) - if mock is not None: - return len([p for p in patchings - if not p.attribute_name and p.new is mock.DEFAULT]) - return len(patchings) - - -def getfuncargnames(function, startindex=None, cls=None): - """ - @RonnyPfannschmidt: This function should be refactored when we revisit fixtures. The - fixture mechanism should ask the node for the fixture names, and not try to obtain - directly from the function object well after collection has occurred. - """ - if startindex is None and cls is not None: - is_staticmethod = isinstance(cls.__dict__.get(function.__name__, None), staticmethod) - startindex = 0 if is_staticmethod else 1 - # XXX merge with main.py's varnames - # assert not isclass(function) - realfunction = function - while hasattr(realfunction, "__wrapped__"): - realfunction = realfunction.__wrapped__ - if startindex is None: - startindex = inspect.ismethod(function) and 1 or 0 - if realfunction != function: - startindex += num_mock_patch_args(function) - function = realfunction - if isinstance(function, functools.partial): - argnames = inspect.getargs(_pytest._code.getrawcode(function.func))[0] - partial = function - argnames = argnames[len(partial.args):] - if partial.keywords: - for kw in partial.keywords: - argnames.remove(kw) - else: - argnames = inspect.getargs(_pytest._code.getrawcode(function))[0] - defaults = getattr(function, 'func_defaults', - getattr(function, '__defaults__', None)) or () - numdefaults = len(defaults) - if numdefaults: - return tuple(argnames[startindex:-numdefaults]) - return tuple(argnames[startindex:]) - - -if sys.version_info[:2] == (2, 6): - def isclass(object): - """ Return true if the object is a class. Overrides inspect.isclass for - python 2.6 because it will return True for objects which always return - something on __getattr__ calls (see #1035). - Backport of https://hg.python.org/cpython/rev/35bf8f7a8edc - """ - return isinstance(object, (type, types.ClassType)) - - -if _PY3: - import codecs - imap = map - izip = zip - STRING_TYPES = bytes, str - UNICODE_TYPES = str, - - def _ascii_escaped(val): - """If val is pure ascii, returns it as a str(). Otherwise, escapes - bytes objects into a sequence of escaped bytes: - - b'\xc3\xb4\xc5\xd6' -> u'\\xc3\\xb4\\xc5\\xd6' - - and escapes unicode objects into a sequence of escaped unicode - ids, e.g.: - - '4\\nV\\U00043efa\\x0eMXWB\\x1e\\u3028\\u15fd\\xcd\\U0007d944' - - note: - the obvious "v.decode('unicode-escape')" will return - valid utf-8 unicode if it finds them in bytes, but we - want to return escaped bytes for any byte, even if they match - a utf-8 string. - - """ - if isinstance(val, bytes): - if val: - # source: http://goo.gl/bGsnwC - encoded_bytes, _ = codecs.escape_encode(val) - return encoded_bytes.decode('ascii') - else: - # empty bytes crashes codecs.escape_encode (#1087) - return '' - else: - return val.encode('unicode_escape').decode('ascii') -else: - STRING_TYPES = bytes, str, unicode - UNICODE_TYPES = unicode, - - from itertools import imap, izip # NOQA - - def _ascii_escaped(val): - """In py2 bytes and str are the same type, so return if it's a bytes - object, return it unchanged if it is a full ascii string, - otherwise escape it into its binary form. - - If it's a unicode string, change the unicode characters into - unicode escapes. - - """ - if isinstance(val, bytes): - try: - return val.encode('ascii') - except UnicodeDecodeError: - return val.encode('string-escape') - else: - return val.encode('unicode-escape') - - -def get_real_func(obj): - """ gets the real function object of the (possibly) wrapped object by - functools.wraps or functools.partial. - """ - start_obj = obj - for i in range(100): - new_obj = getattr(obj, '__wrapped__', None) - if new_obj is None: - break - obj = new_obj - else: - raise ValueError( - ("could not find real function of {start}" - "\nstopped at {current}").format( - start=py.io.saferepr(start_obj), - current=py.io.saferepr(obj))) - if isinstance(obj, functools.partial): - obj = obj.func - return obj - - -def getfslineno(obj): - # xxx let decorators etc specify a sane ordering - obj = get_real_func(obj) - if hasattr(obj, 'place_as'): - obj = obj.place_as - fslineno = _pytest._code.getfslineno(obj) - assert isinstance(fslineno[1], int), obj - return fslineno - - -def getimfunc(func): - try: - return func.__func__ - except AttributeError: - try: - return func.im_func - except AttributeError: - return func - - -def safe_getattr(object, name, default): - """ Like getattr but return default upon any Exception or any OutcomeException. - - Attribute access can potentially fail for 'evil' Python objects. - See issue #214. - It catches OutcomeException because of #2490 (issue #580), new outcomes are derived from BaseException - instead of Exception (for more details check #2707) - """ - try: - return getattr(object, name, default) - except TEST_OUTCOME: - return default - - -def _is_unittest_unexpected_success_a_failure(): - """Return if the test suite should fail if a @expectedFailure unittest test PASSES. - - From https://docs.python.org/3/library/unittest.html?highlight=unittest#unittest.TestResult.wasSuccessful: - Changed in version 3.4: Returns False if there were any - unexpectedSuccesses from tests marked with the expectedFailure() decorator. - """ - return sys.version_info >= (3, 4) - - -if _PY3: - def safe_str(v): - """returns v as string""" - return str(v) -else: - def safe_str(v): - """returns v as string, converting to ascii if necessary""" - try: - return str(v) - except UnicodeError: - if not isinstance(v, unicode): - v = unicode(v) - errors = 'replace' - return v.encode('utf-8', errors) - - -COLLECT_FAKEMODULE_ATTRIBUTES = ( - 'Collector', - 'Module', - 'Generator', - 'Function', - 'Instance', - 'Session', - 'Item', - 'Class', - 'File', - '_fillfuncargs', -) - - -def _setup_collect_fakemodule(): - from types import ModuleType - import pytest - pytest.collect = ModuleType('pytest.collect') - pytest.collect.__all__ = [] # used for setns - for attr in COLLECT_FAKEMODULE_ATTRIBUTES: - setattr(pytest.collect, attr, getattr(pytest, attr)) - - -if _PY2: - # Without this the test_dupfile_on_textio will fail, otherwise CaptureIO could directly inherit from StringIO. - from py.io import TextIO - - class CaptureIO(TextIO): - - @property - def encoding(self): - return getattr(self, '_encoding', 'UTF-8') - -else: - import io - - class CaptureIO(io.TextIOWrapper): - def __init__(self): - super(CaptureIO, self).__init__( - io.BytesIO(), - encoding='UTF-8', newline='', write_through=True, - ) - - def getvalue(self): - return self.buffer.getvalue().decode('UTF-8') - - -class FuncargnamesCompatAttr(object): - """ helper class so that Metafunc, Function and FixtureRequest - don't need to each define the "funcargnames" compatibility attribute. - """ - @property - def funcargnames(self): - """ alias attribute for ``fixturenames`` for pre-2.3 compatibility""" - return self.fixturenames diff --git a/lib/spack/external/_pytest/config.py b/lib/spack/external/_pytest/config.py deleted file mode 100644 index 513478a972..0000000000 --- a/lib/spack/external/_pytest/config.py +++ /dev/null @@ -1,1398 +0,0 @@ -""" command line options, ini-file and conftest.py processing. """ -from __future__ import absolute_import, division, print_function -import argparse -import shlex -import traceback -import types -import warnings - -import py -# DON't import pytest here because it causes import cycle troubles -import sys -import os -import _pytest._code -import _pytest.hookspec # the extension point definitions -import _pytest.assertion -from _pytest._pluggy import PluginManager, HookimplMarker, HookspecMarker -from _pytest.compat import safe_str - -hookimpl = HookimplMarker("pytest") -hookspec = HookspecMarker("pytest") - -# pytest startup -# - - -class ConftestImportFailure(Exception): - def __init__(self, path, excinfo): - Exception.__init__(self, path, excinfo) - self.path = path - self.excinfo = excinfo - - def __str__(self): - etype, evalue, etb = self.excinfo - formatted = traceback.format_tb(etb) - # The level of the tracebacks we want to print is hand crafted :( - return repr(evalue) + '\n' + ''.join(formatted[2:]) - - -def main(args=None, plugins=None): - """ return exit code, after performing an in-process test run. - - :arg args: list of command line arguments. - - :arg plugins: list of plugin objects to be auto-registered during - initialization. - """ - try: - try: - config = _prepareconfig(args, plugins) - except ConftestImportFailure as e: - tw = py.io.TerminalWriter(sys.stderr) - for line in traceback.format_exception(*e.excinfo): - tw.line(line.rstrip(), red=True) - tw.line("ERROR: could not load %s\n" % (e.path), red=True) - return 4 - else: - try: - return config.hook.pytest_cmdline_main(config=config) - finally: - config._ensure_unconfigure() - except UsageError as e: - for msg in e.args: - sys.stderr.write("ERROR: %s\n" % (msg,)) - return 4 - - -class cmdline: # compatibility namespace - main = staticmethod(main) - - -class UsageError(Exception): - """ error in pytest usage or invocation""" - - -class PrintHelp(Exception): - """Raised when pytest should print it's help to skip the rest of the - argument parsing and validation.""" - pass - - -def filename_arg(path, optname): - """ Argparse type validator for filename arguments. - - :path: path of filename - :optname: name of the option - """ - if os.path.isdir(path): - raise UsageError("{0} must be a filename, given: {1}".format(optname, path)) - return path - - -def directory_arg(path, optname): - """Argparse type validator for directory arguments. - - :path: path of directory - :optname: name of the option - """ - if not os.path.isdir(path): - raise UsageError("{0} must be a directory, given: {1}".format(optname, path)) - return path - - -_preinit = [] - -default_plugins = ( - "mark main terminal runner python fixtures debugging unittest capture skipping " - "tmpdir monkeypatch recwarn pastebin helpconfig nose assertion " - "junitxml resultlog doctest cacheprovider freeze_support " - "setuponly setupplan warnings").split() - - -builtin_plugins = set(default_plugins) -builtin_plugins.add("pytester") - - -def _preloadplugins(): - assert not _preinit - _preinit.append(get_config()) - - -def get_config(): - if _preinit: - return _preinit.pop(0) - # subsequent calls to main will create a fresh instance - pluginmanager = PytestPluginManager() - config = Config(pluginmanager) - for spec in default_plugins: - pluginmanager.import_plugin(spec) - return config - - -def get_plugin_manager(): - """ - Obtain a new instance of the - :py:class:`_pytest.config.PytestPluginManager`, with default plugins - already loaded. - - This function can be used by integration with other tools, like hooking - into pytest to run tests into an IDE. - """ - return get_config().pluginmanager - - -def _prepareconfig(args=None, plugins=None): - warning = None - if args is None: - args = sys.argv[1:] - elif isinstance(args, py.path.local): - args = [str(args)] - elif not isinstance(args, (tuple, list)): - if not isinstance(args, str): - raise ValueError("not a string or argument list: %r" % (args,)) - args = shlex.split(args, posix=sys.platform != "win32") - from _pytest import deprecated - warning = deprecated.MAIN_STR_ARGS - config = get_config() - pluginmanager = config.pluginmanager - try: - if plugins: - for plugin in plugins: - if isinstance(plugin, py.builtin._basestring): - pluginmanager.consider_pluginarg(plugin) - else: - pluginmanager.register(plugin) - if warning: - config.warn('C1', warning) - return pluginmanager.hook.pytest_cmdline_parse( - pluginmanager=pluginmanager, args=args) - except BaseException: - config._ensure_unconfigure() - raise - - -class PytestPluginManager(PluginManager): - """ - Overwrites :py:class:`pluggy.PluginManager <_pytest.vendored_packages.pluggy.PluginManager>` to add pytest-specific - functionality: - - * loading plugins from the command line, ``PYTEST_PLUGIN`` env variable and - ``pytest_plugins`` global variables found in plugins being loaded; - * ``conftest.py`` loading during start-up; - """ - - def __init__(self): - super(PytestPluginManager, self).__init__("pytest", implprefix="pytest_") - self._conftest_plugins = set() - - # state related to local conftest plugins - self._path2confmods = {} - self._conftestpath2mod = {} - self._confcutdir = None - self._noconftest = False - self._duplicatepaths = set() - - self.add_hookspecs(_pytest.hookspec) - self.register(self) - if os.environ.get('PYTEST_DEBUG'): - err = sys.stderr - encoding = getattr(err, 'encoding', 'utf8') - try: - err = py.io.dupfile(err, encoding=encoding) - except Exception: - pass - self.trace.root.setwriter(err.write) - self.enable_tracing() - - # Config._consider_importhook will set a real object if required. - self.rewrite_hook = _pytest.assertion.DummyRewriteHook() - - def addhooks(self, module_or_class): - """ - .. deprecated:: 2.8 - - Use :py:meth:`pluggy.PluginManager.add_hookspecs <_pytest.vendored_packages.pluggy.PluginManager.add_hookspecs>` - instead. - """ - warning = dict(code="I2", - fslocation=_pytest._code.getfslineno(sys._getframe(1)), - nodeid=None, - message="use pluginmanager.add_hookspecs instead of " - "deprecated addhooks() method.") - self._warn(warning) - return self.add_hookspecs(module_or_class) - - def parse_hookimpl_opts(self, plugin, name): - # pytest hooks are always prefixed with pytest_ - # so we avoid accessing possibly non-readable attributes - # (see issue #1073) - if not name.startswith("pytest_"): - return - # ignore some historic special names which can not be hooks anyway - if name == "pytest_plugins" or name.startswith("pytest_funcarg__"): - return - - method = getattr(plugin, name) - opts = super(PytestPluginManager, self).parse_hookimpl_opts(plugin, name) - if opts is not None: - for name in ("tryfirst", "trylast", "optionalhook", "hookwrapper"): - opts.setdefault(name, hasattr(method, name)) - return opts - - def parse_hookspec_opts(self, module_or_class, name): - opts = super(PytestPluginManager, self).parse_hookspec_opts( - module_or_class, name) - if opts is None: - method = getattr(module_or_class, name) - if name.startswith("pytest_"): - opts = {"firstresult": hasattr(method, "firstresult"), - "historic": hasattr(method, "historic")} - return opts - - def _verify_hook(self, hook, hookmethod): - super(PytestPluginManager, self)._verify_hook(hook, hookmethod) - if "__multicall__" in hookmethod.argnames: - fslineno = _pytest._code.getfslineno(hookmethod.function) - warning = dict(code="I1", - fslocation=fslineno, - nodeid=None, - message="%r hook uses deprecated __multicall__ " - "argument" % (hook.name)) - self._warn(warning) - - def register(self, plugin, name=None): - ret = super(PytestPluginManager, self).register(plugin, name) - if ret: - self.hook.pytest_plugin_registered.call_historic( - kwargs=dict(plugin=plugin, manager=self)) - - if isinstance(plugin, types.ModuleType): - self.consider_module(plugin) - return ret - - def getplugin(self, name): - # support deprecated naming because plugins (xdist e.g.) use it - return self.get_plugin(name) - - def hasplugin(self, name): - """Return True if the plugin with the given name is registered.""" - return bool(self.get_plugin(name)) - - def pytest_configure(self, config): - # XXX now that the pluginmanager exposes hookimpl(tryfirst...) - # we should remove tryfirst/trylast as markers - config.addinivalue_line("markers", - "tryfirst: mark a hook implementation function such that the " - "plugin machinery will try to call it first/as early as possible.") - config.addinivalue_line("markers", - "trylast: mark a hook implementation function such that the " - "plugin machinery will try to call it last/as late as possible.") - - def _warn(self, message): - kwargs = message if isinstance(message, dict) else { - 'code': 'I1', - 'message': message, - 'fslocation': None, - 'nodeid': None, - } - self.hook.pytest_logwarning.call_historic(kwargs=kwargs) - - # - # internal API for local conftest plugin handling - # - def _set_initial_conftests(self, namespace): - """ load initial conftest files given a preparsed "namespace". - As conftest files may add their own command line options - which have arguments ('--my-opt somepath') we might get some - false positives. All builtin and 3rd party plugins will have - been loaded, however, so common options will not confuse our logic - here. - """ - current = py.path.local() - self._confcutdir = current.join(namespace.confcutdir, abs=True) \ - if namespace.confcutdir else None - self._noconftest = namespace.noconftest - testpaths = namespace.file_or_dir - foundanchor = False - for path in testpaths: - path = str(path) - # remove node-id syntax - i = path.find("::") - if i != -1: - path = path[:i] - anchor = current.join(path, abs=1) - if exists(anchor): # we found some file object - self._try_load_conftest(anchor) - foundanchor = True - if not foundanchor: - self._try_load_conftest(current) - - def _try_load_conftest(self, anchor): - self._getconftestmodules(anchor) - # let's also consider test* subdirs - if anchor.check(dir=1): - for x in anchor.listdir("test*"): - if x.check(dir=1): - self._getconftestmodules(x) - - def _getconftestmodules(self, path): - if self._noconftest: - return [] - try: - return self._path2confmods[path] - except KeyError: - if path.isfile(): - clist = self._getconftestmodules(path.dirpath()) - else: - # XXX these days we may rather want to use config.rootdir - # and allow users to opt into looking into the rootdir parent - # directories instead of requiring to specify confcutdir - clist = [] - for parent in path.parts(): - if self._confcutdir and self._confcutdir.relto(parent): - continue - conftestpath = parent.join("conftest.py") - if conftestpath.isfile(): - mod = self._importconftest(conftestpath) - clist.append(mod) - - self._path2confmods[path] = clist - return clist - - def _rget_with_confmod(self, name, path): - modules = self._getconftestmodules(path) - for mod in reversed(modules): - try: - return mod, getattr(mod, name) - except AttributeError: - continue - raise KeyError(name) - - def _importconftest(self, conftestpath): - try: - return self._conftestpath2mod[conftestpath] - except KeyError: - pkgpath = conftestpath.pypkgpath() - if pkgpath is None: - _ensure_removed_sysmodule(conftestpath.purebasename) - try: - mod = conftestpath.pyimport() - except Exception: - raise ConftestImportFailure(conftestpath, sys.exc_info()) - - self._conftest_plugins.add(mod) - self._conftestpath2mod[conftestpath] = mod - dirpath = conftestpath.dirpath() - if dirpath in self._path2confmods: - for path, mods in self._path2confmods.items(): - if path and path.relto(dirpath) or path == dirpath: - assert mod not in mods - mods.append(mod) - self.trace("loaded conftestmodule %r" % (mod)) - self.consider_conftest(mod) - return mod - - # - # API for bootstrapping plugin loading - # - # - - def consider_preparse(self, args): - for opt1, opt2 in zip(args, args[1:]): - if opt1 == "-p": - self.consider_pluginarg(opt2) - - def consider_pluginarg(self, arg): - if arg.startswith("no:"): - name = arg[3:] - self.set_blocked(name) - if not name.startswith("pytest_"): - self.set_blocked("pytest_" + name) - else: - self.import_plugin(arg) - - def consider_conftest(self, conftestmodule): - self.register(conftestmodule, name=conftestmodule.__file__) - - def consider_env(self): - self._import_plugin_specs(os.environ.get("PYTEST_PLUGINS")) - - def consider_module(self, mod): - self._import_plugin_specs(getattr(mod, 'pytest_plugins', [])) - - def _import_plugin_specs(self, spec): - plugins = _get_plugin_specs_as_list(spec) - for import_spec in plugins: - self.import_plugin(import_spec) - - def import_plugin(self, modname): - # most often modname refers to builtin modules, e.g. "pytester", - # "terminal" or "capture". Those plugins are registered under their - # basename for historic purposes but must be imported with the - # _pytest prefix. - assert isinstance(modname, (py.builtin.text, str)), "module name as text required, got %r" % modname - modname = str(modname) - if self.get_plugin(modname) is not None: - return - if modname in builtin_plugins: - importspec = "_pytest." + modname - else: - importspec = modname - self.rewrite_hook.mark_rewrite(importspec) - try: - __import__(importspec) - except ImportError as e: - new_exc = ImportError('Error importing plugin "%s": %s' % (modname, safe_str(e.args[0]))) - # copy over name and path attributes - for attr in ('name', 'path'): - if hasattr(e, attr): - setattr(new_exc, attr, getattr(e, attr)) - raise new_exc - except Exception as e: - import pytest - if not hasattr(pytest, 'skip') or not isinstance(e, pytest.skip.Exception): - raise - self._warn("skipped plugin %r: %s" % ((modname, e.msg))) - else: - mod = sys.modules[importspec] - self.register(mod, modname) - - -def _get_plugin_specs_as_list(specs): - """ - Parses a list of "plugin specs" and returns a list of plugin names. - - Plugin specs can be given as a list of strings separated by "," or already as a list/tuple in - which case it is returned as a list. Specs can also be `None` in which case an - empty list is returned. - """ - if specs is not None: - if isinstance(specs, str): - specs = specs.split(',') if specs else [] - if not isinstance(specs, (list, tuple)): - raise UsageError("Plugin specs must be a ','-separated string or a " - "list/tuple of strings for plugin names. Given: %r" % specs) - return list(specs) - return [] - - -class Parser: - """ Parser for command line arguments and ini-file values. - - :ivar extra_info: dict of generic param -> value to display in case - there's an error processing the command line arguments. - """ - - def __init__(self, usage=None, processopt=None): - self._anonymous = OptionGroup("custom options", parser=self) - self._groups = [] - self._processopt = processopt - self._usage = usage - self._inidict = {} - self._ininames = [] - self.extra_info = {} - - def processoption(self, option): - if self._processopt: - if option.dest: - self._processopt(option) - - def getgroup(self, name, description="", after=None): - """ get (or create) a named option Group. - - :name: name of the option group. - :description: long description for --help output. - :after: name of other group, used for ordering --help output. - - The returned group object has an ``addoption`` method with the same - signature as :py:func:`parser.addoption - <_pytest.config.Parser.addoption>` but will be shown in the - respective group in the output of ``pytest. --help``. - """ - for group in self._groups: - if group.name == name: - return group - group = OptionGroup(name, description, parser=self) - i = 0 - for i, grp in enumerate(self._groups): - if grp.name == after: - break - self._groups.insert(i + 1, group) - return group - - def addoption(self, *opts, **attrs): - """ register a command line option. - - :opts: option names, can be short or long options. - :attrs: same attributes which the ``add_option()`` function of the - `argparse library - `_ - accepts. - - After command line parsing options are available on the pytest config - object via ``config.option.NAME`` where ``NAME`` is usually set - by passing a ``dest`` attribute, for example - ``addoption("--long", dest="NAME", ...)``. - """ - self._anonymous.addoption(*opts, **attrs) - - def parse(self, args, namespace=None): - from _pytest._argcomplete import try_argcomplete - self.optparser = self._getparser() - try_argcomplete(self.optparser) - return self.optparser.parse_args([str(x) for x in args], namespace=namespace) - - def _getparser(self): - from _pytest._argcomplete import filescompleter - optparser = MyOptionParser(self, self.extra_info) - groups = self._groups + [self._anonymous] - for group in groups: - if group.options: - desc = group.description or group.name - arggroup = optparser.add_argument_group(desc) - for option in group.options: - n = option.names() - a = option.attrs() - arggroup.add_argument(*n, **a) - # bash like autocompletion for dirs (appending '/') - optparser.add_argument(FILE_OR_DIR, nargs='*').completer = filescompleter - return optparser - - def parse_setoption(self, args, option, namespace=None): - parsedoption = self.parse(args, namespace=namespace) - for name, value in parsedoption.__dict__.items(): - setattr(option, name, value) - return getattr(parsedoption, FILE_OR_DIR) - - def parse_known_args(self, args, namespace=None): - """parses and returns a namespace object with known arguments at this - point. - """ - return self.parse_known_and_unknown_args(args, namespace=namespace)[0] - - def parse_known_and_unknown_args(self, args, namespace=None): - """parses and returns a namespace object with known arguments, and - the remaining arguments unknown at this point. - """ - optparser = self._getparser() - args = [str(x) for x in args] - return optparser.parse_known_args(args, namespace=namespace) - - def addini(self, name, help, type=None, default=None): - """ register an ini-file option. - - :name: name of the ini-variable - :type: type of the variable, can be ``pathlist``, ``args``, ``linelist`` - or ``bool``. - :default: default value if no ini-file option exists but is queried. - - The value of ini-variables can be retrieved via a call to - :py:func:`config.getini(name) <_pytest.config.Config.getini>`. - """ - assert type in (None, "pathlist", "args", "linelist", "bool") - self._inidict[name] = (help, type, default) - self._ininames.append(name) - - -class ArgumentError(Exception): - """ - Raised if an Argument instance is created with invalid or - inconsistent arguments. - """ - - def __init__(self, msg, option): - self.msg = msg - self.option_id = str(option) - - def __str__(self): - if self.option_id: - return "option %s: %s" % (self.option_id, self.msg) - else: - return self.msg - - -class Argument: - """class that mimics the necessary behaviour of optparse.Option - - its currently a least effort implementation - and ignoring choices and integer prefixes - https://docs.python.org/3/library/optparse.html#optparse-standard-option-types - """ - _typ_map = { - 'int': int, - 'string': str, - 'float': float, - 'complex': complex, - } - - def __init__(self, *names, **attrs): - """store parms in private vars for use in add_argument""" - self._attrs = attrs - self._short_opts = [] - self._long_opts = [] - self.dest = attrs.get('dest') - if '%default' in (attrs.get('help') or ''): - warnings.warn( - 'pytest now uses argparse. "%default" should be' - ' changed to "%(default)s" ', - DeprecationWarning, - stacklevel=3) - try: - typ = attrs['type'] - except KeyError: - pass - else: - # this might raise a keyerror as well, don't want to catch that - if isinstance(typ, py.builtin._basestring): - if typ == 'choice': - warnings.warn( - 'type argument to addoption() is a string %r.' - ' For parsearg this is optional and when supplied' - ' should be a type.' - ' (options: %s)' % (typ, names), - DeprecationWarning, - stacklevel=3) - # argparse expects a type here take it from - # the type of the first element - attrs['type'] = type(attrs['choices'][0]) - else: - warnings.warn( - 'type argument to addoption() is a string %r.' - ' For parsearg this should be a type.' - ' (options: %s)' % (typ, names), - DeprecationWarning, - stacklevel=3) - attrs['type'] = Argument._typ_map[typ] - # used in test_parseopt -> test_parse_defaultgetter - self.type = attrs['type'] - else: - self.type = typ - try: - # attribute existence is tested in Config._processopt - self.default = attrs['default'] - except KeyError: - pass - self._set_opt_strings(names) - if not self.dest: - if self._long_opts: - self.dest = self._long_opts[0][2:].replace('-', '_') - else: - try: - self.dest = self._short_opts[0][1:] - except IndexError: - raise ArgumentError( - 'need a long or short option', self) - - def names(self): - return self._short_opts + self._long_opts - - def attrs(self): - # update any attributes set by processopt - attrs = 'default dest help'.split() - if self.dest: - attrs.append(self.dest) - for attr in attrs: - try: - self._attrs[attr] = getattr(self, attr) - except AttributeError: - pass - if self._attrs.get('help'): - a = self._attrs['help'] - a = a.replace('%default', '%(default)s') - # a = a.replace('%prog', '%(prog)s') - self._attrs['help'] = a - return self._attrs - - def _set_opt_strings(self, opts): - """directly from optparse - - might not be necessary as this is passed to argparse later on""" - for opt in opts: - if len(opt) < 2: - raise ArgumentError( - "invalid option string %r: " - "must be at least two characters long" % opt, self) - elif len(opt) == 2: - if not (opt[0] == "-" and opt[1] != "-"): - raise ArgumentError( - "invalid short option string %r: " - "must be of the form -x, (x any non-dash char)" % opt, - self) - self._short_opts.append(opt) - else: - if not (opt[0:2] == "--" and opt[2] != "-"): - raise ArgumentError( - "invalid long option string %r: " - "must start with --, followed by non-dash" % opt, - self) - self._long_opts.append(opt) - - def __repr__(self): - args = [] - if self._short_opts: - args += ['_short_opts: ' + repr(self._short_opts)] - if self._long_opts: - args += ['_long_opts: ' + repr(self._long_opts)] - args += ['dest: ' + repr(self.dest)] - if hasattr(self, 'type'): - args += ['type: ' + repr(self.type)] - if hasattr(self, 'default'): - args += ['default: ' + repr(self.default)] - return 'Argument({0})'.format(', '.join(args)) - - -class OptionGroup: - def __init__(self, name, description="", parser=None): - self.name = name - self.description = description - self.options = [] - self.parser = parser - - def addoption(self, *optnames, **attrs): - """ add an option to this group. - - if a shortened version of a long option is specified it will - be suppressed in the help. addoption('--twowords', '--two-words') - results in help showing '--two-words' only, but --twowords gets - accepted **and** the automatic destination is in args.twowords - """ - conflict = set(optnames).intersection( - name for opt in self.options for name in opt.names()) - if conflict: - raise ValueError("option names %s already added" % conflict) - option = Argument(*optnames, **attrs) - self._addoption_instance(option, shortupper=False) - - def _addoption(self, *optnames, **attrs): - option = Argument(*optnames, **attrs) - self._addoption_instance(option, shortupper=True) - - def _addoption_instance(self, option, shortupper=False): - if not shortupper: - for opt in option._short_opts: - if opt[0] == '-' and opt[1].islower(): - raise ValueError("lowercase shortoptions reserved") - if self.parser: - self.parser.processoption(option) - self.options.append(option) - - -class MyOptionParser(argparse.ArgumentParser): - def __init__(self, parser, extra_info=None): - if not extra_info: - extra_info = {} - self._parser = parser - argparse.ArgumentParser.__init__(self, usage=parser._usage, - add_help=False, formatter_class=DropShorterLongHelpFormatter) - # extra_info is a dict of (param -> value) to display if there's - # an usage error to provide more contextual information to the user - self.extra_info = extra_info - - def parse_args(self, args=None, namespace=None): - """allow splitting of positional arguments""" - args, argv = self.parse_known_args(args, namespace) - if argv: - for arg in argv: - if arg and arg[0] == '-': - lines = ['unrecognized arguments: %s' % (' '.join(argv))] - for k, v in sorted(self.extra_info.items()): - lines.append(' %s: %s' % (k, v)) - self.error('\n'.join(lines)) - getattr(args, FILE_OR_DIR).extend(argv) - return args - - -class DropShorterLongHelpFormatter(argparse.HelpFormatter): - """shorten help for long options that differ only in extra hyphens - - - collapse **long** options that are the same except for extra hyphens - - special action attribute map_long_option allows surpressing additional - long options - - shortcut if there are only two options and one of them is a short one - - cache result on action object as this is called at least 2 times - """ - - def _format_action_invocation(self, action): - orgstr = argparse.HelpFormatter._format_action_invocation(self, action) - if orgstr and orgstr[0] != '-': # only optional arguments - return orgstr - res = getattr(action, '_formatted_action_invocation', None) - if res: - return res - options = orgstr.split(', ') - if len(options) == 2 and (len(options[0]) == 2 or len(options[1]) == 2): - # a shortcut for '-h, --help' or '--abc', '-a' - action._formatted_action_invocation = orgstr - return orgstr - return_list = [] - option_map = getattr(action, 'map_long_option', {}) - if option_map is None: - option_map = {} - short_long = {} - for option in options: - if len(option) == 2 or option[2] == ' ': - continue - if not option.startswith('--'): - raise ArgumentError('long optional argument without "--": [%s]' - % (option), self) - xxoption = option[2:] - if xxoption.split()[0] not in option_map: - shortened = xxoption.replace('-', '') - if shortened not in short_long or \ - len(short_long[shortened]) < len(xxoption): - short_long[shortened] = xxoption - # now short_long has been filled out to the longest with dashes - # **and** we keep the right option ordering from add_argument - for option in options: - if len(option) == 2 or option[2] == ' ': - return_list.append(option) - if option[2:] == short_long.get(option.replace('-', '')): - return_list.append(option.replace(' ', '=', 1)) - action._formatted_action_invocation = ', '.join(return_list) - return action._formatted_action_invocation - - -def _ensure_removed_sysmodule(modname): - try: - del sys.modules[modname] - except KeyError: - pass - - -class CmdOptions(object): - """ holds cmdline options as attributes.""" - - def __init__(self, values=()): - self.__dict__.update(values) - - def __repr__(self): - return "" % (self.__dict__,) - - def copy(self): - return CmdOptions(self.__dict__) - - -class Notset: - def __repr__(self): - return "" - - -notset = Notset() -FILE_OR_DIR = 'file_or_dir' - - -def _iter_rewritable_modules(package_files): - for fn in package_files: - is_simple_module = '/' not in fn and fn.endswith('.py') - is_package = fn.count('/') == 1 and fn.endswith('__init__.py') - if is_simple_module: - module_name, _ = os.path.splitext(fn) - yield module_name - elif is_package: - package_name = os.path.dirname(fn) - yield package_name - - -class Config(object): - """ access to configuration values, pluginmanager and plugin hooks. """ - - def __init__(self, pluginmanager): - #: access to command line option as attributes. - #: (deprecated), use :py:func:`getoption() <_pytest.config.Config.getoption>` instead - self.option = CmdOptions() - _a = FILE_OR_DIR - self._parser = Parser( - usage="%%(prog)s [options] [%s] [%s] [...]" % (_a, _a), - processopt=self._processopt, - ) - #: a pluginmanager instance - self.pluginmanager = pluginmanager - self.trace = self.pluginmanager.trace.root.get("config") - self.hook = self.pluginmanager.hook - self._inicache = {} - self._override_ini = () - self._opt2dest = {} - self._cleanup = [] - self._warn = self.pluginmanager._warn - self.pluginmanager.register(self, "pytestconfig") - self._configured = False - - def do_setns(dic): - import pytest - setns(pytest, dic) - - self.hook.pytest_namespace.call_historic(do_setns, {}) - self.hook.pytest_addoption.call_historic(kwargs=dict(parser=self._parser)) - - def add_cleanup(self, func): - """ Add a function to be called when the config object gets out of - use (usually coninciding with pytest_unconfigure).""" - self._cleanup.append(func) - - def _do_configure(self): - assert not self._configured - self._configured = True - self.hook.pytest_configure.call_historic(kwargs=dict(config=self)) - - def _ensure_unconfigure(self): - if self._configured: - self._configured = False - self.hook.pytest_unconfigure(config=self) - self.hook.pytest_configure._call_history = [] - while self._cleanup: - fin = self._cleanup.pop() - fin() - - def warn(self, code, message, fslocation=None, nodeid=None): - """ generate a warning for this test session. """ - self.hook.pytest_logwarning.call_historic(kwargs=dict( - code=code, message=message, - fslocation=fslocation, nodeid=nodeid)) - - def get_terminal_writer(self): - return self.pluginmanager.get_plugin("terminalreporter")._tw - - def pytest_cmdline_parse(self, pluginmanager, args): - # REF1 assert self == pluginmanager.config, (self, pluginmanager.config) - self.parse(args) - return self - - def notify_exception(self, excinfo, option=None): - if option and option.fulltrace: - style = "long" - else: - style = "native" - excrepr = excinfo.getrepr(funcargs=True, - showlocals=getattr(option, 'showlocals', False), - style=style, - ) - res = self.hook.pytest_internalerror(excrepr=excrepr, - excinfo=excinfo) - if not py.builtin.any(res): - for line in str(excrepr).split("\n"): - sys.stderr.write("INTERNALERROR> %s\n" % line) - sys.stderr.flush() - - def cwd_relative_nodeid(self, nodeid): - # nodeid's are relative to the rootpath, compute relative to cwd - if self.invocation_dir != self.rootdir: - fullpath = self.rootdir.join(nodeid) - nodeid = self.invocation_dir.bestrelpath(fullpath) - return nodeid - - @classmethod - def fromdictargs(cls, option_dict, args): - """ constructor useable for subprocesses. """ - config = get_config() - config.option.__dict__.update(option_dict) - config.parse(args, addopts=False) - for x in config.option.plugins: - config.pluginmanager.consider_pluginarg(x) - return config - - def _processopt(self, opt): - for name in opt._short_opts + opt._long_opts: - self._opt2dest[name] = opt.dest - - if hasattr(opt, 'default') and opt.dest: - if not hasattr(self.option, opt.dest): - setattr(self.option, opt.dest, opt.default) - - @hookimpl(trylast=True) - def pytest_load_initial_conftests(self, early_config): - self.pluginmanager._set_initial_conftests(early_config.known_args_namespace) - - def _initini(self, args): - ns, unknown_args = self._parser.parse_known_and_unknown_args(args, namespace=self.option.copy()) - r = determine_setup(ns.inifilename, ns.file_or_dir + unknown_args, warnfunc=self.warn) - self.rootdir, self.inifile, self.inicfg = r - self._parser.extra_info['rootdir'] = self.rootdir - self._parser.extra_info['inifile'] = self.inifile - self.invocation_dir = py.path.local() - self._parser.addini('addopts', 'extra command line options', 'args') - self._parser.addini('minversion', 'minimally required pytest version') - self._override_ini = ns.override_ini or () - - def _consider_importhook(self, args): - """Install the PEP 302 import hook if using assertion re-writing. - - Needs to parse the --assert= option from the commandline - and find all the installed plugins to mark them for re-writing - by the importhook. - """ - ns, unknown_args = self._parser.parse_known_and_unknown_args(args) - mode = ns.assertmode - if mode == 'rewrite': - try: - hook = _pytest.assertion.install_importhook(self) - except SystemError: - mode = 'plain' - else: - # REMOVED FOR SPACK: This routine imports `pkg_resources` from - # `setuptools`, but we do not need it for Spack. We have removed - # it from Spack to avoid a dependency on setuptools. - # self._mark_plugins_for_rewrite(hook) - pass - self._warn_about_missing_assertion(mode) - - def _warn_about_missing_assertion(self, mode): - try: - assert False - except AssertionError: - pass - else: - if mode == 'plain': - sys.stderr.write("WARNING: ASSERTIONS ARE NOT EXECUTED" - " and FAILING TESTS WILL PASS. Are you" - " using python -O?") - else: - sys.stderr.write("WARNING: assertions not in test modules or" - " plugins will be ignored" - " because assert statements are not executed " - "by the underlying Python interpreter " - "(are you using python -O?)\n") - - def _preparse(self, args, addopts=True): - self._initini(args) - if addopts: - args[:] = shlex.split(os.environ.get('PYTEST_ADDOPTS', '')) + args - args[:] = self.getini("addopts") + args - self._checkversion() - self._consider_importhook(args) - self.pluginmanager.consider_preparse(args) - - # REMOVED FOR SPACK: This routine imports `pkg_resources` from - # `setuptools`, but we do not need it for Spack. We have removed - # it from Spack to avoid a dependency on setuptools. - # self.pluginmanager.load_setuptools_entrypoints('pytest11') - - self.pluginmanager.consider_env() - self.known_args_namespace = ns = self._parser.parse_known_args(args, namespace=self.option.copy()) - if self.known_args_namespace.confcutdir is None and self.inifile: - confcutdir = py.path.local(self.inifile).dirname - self.known_args_namespace.confcutdir = confcutdir - try: - self.hook.pytest_load_initial_conftests(early_config=self, - args=args, parser=self._parser) - except ConftestImportFailure: - e = sys.exc_info()[1] - if ns.help or ns.version: - # we don't want to prevent --help/--version to work - # so just let is pass and print a warning at the end - self._warn("could not load initial conftests (%s)\n" % e.path) - else: - raise - - def _checkversion(self): - import pytest - minver = self.inicfg.get('minversion', None) - if minver: - ver = minver.split(".") - myver = pytest.__version__.split(".") - if myver < ver: - raise pytest.UsageError( - "%s:%d: requires pytest-%s, actual pytest-%s'" % ( - self.inicfg.config.path, self.inicfg.lineof('minversion'), - minver, pytest.__version__)) - - def parse(self, args, addopts=True): - # parse given cmdline arguments into this config object. - assert not hasattr(self, 'args'), ( - "can only parse cmdline args at most once per Config object") - self._origargs = args - self.hook.pytest_addhooks.call_historic( - kwargs=dict(pluginmanager=self.pluginmanager)) - self._preparse(args, addopts=addopts) - # XXX deprecated hook: - self.hook.pytest_cmdline_preparse(config=self, args=args) - self._parser.after_preparse = True - try: - args = self._parser.parse_setoption(args, self.option, namespace=self.option) - if not args: - cwd = os.getcwd() - if cwd == self.rootdir: - args = self.getini('testpaths') - if not args: - args = [cwd] - self.args = args - except PrintHelp: - pass - - def addinivalue_line(self, name, line): - """ add a line to an ini-file option. The option must have been - declared but might not yet be set in which case the line becomes the - the first line in its value. """ - x = self.getini(name) - assert isinstance(x, list) - x.append(line) # modifies the cached list inline - - def getini(self, name): - """ return configuration value from an :ref:`ini file `. If the - specified name hasn't been registered through a prior - :py:func:`parser.addini <_pytest.config.Parser.addini>` - call (usually from a plugin), a ValueError is raised. """ - try: - return self._inicache[name] - except KeyError: - self._inicache[name] = val = self._getini(name) - return val - - def _getini(self, name): - try: - description, type, default = self._parser._inidict[name] - except KeyError: - raise ValueError("unknown configuration value: %r" % (name,)) - value = self._get_override_ini_value(name) - if value is None: - try: - value = self.inicfg[name] - except KeyError: - if default is not None: - return default - if type is None: - return '' - return [] - if type == "pathlist": - dp = py.path.local(self.inicfg.config.path).dirpath() - values = [] - for relpath in shlex.split(value): - values.append(dp.join(relpath, abs=True)) - return values - elif type == "args": - return shlex.split(value) - elif type == "linelist": - return [t for t in map(lambda x: x.strip(), value.split("\n")) if t] - elif type == "bool": - return bool(_strtobool(value.strip())) - else: - assert type is None - return value - - def _getconftest_pathlist(self, name, path): - try: - mod, relroots = self.pluginmanager._rget_with_confmod(name, path) - except KeyError: - return None - modpath = py.path.local(mod.__file__).dirpath() - values = [] - for relroot in relroots: - if not isinstance(relroot, py.path.local): - relroot = relroot.replace("/", py.path.local.sep) - relroot = modpath.join(relroot, abs=True) - values.append(relroot) - return values - - def _get_override_ini_value(self, name): - value = None - # override_ini is a list of list, to support both -o foo1=bar1 foo2=bar2 and - # and -o foo1=bar1 -o foo2=bar2 options - # always use the last item if multiple value set for same ini-name, - # e.g. -o foo=bar1 -o foo=bar2 will set foo to bar2 - for ini_config_list in self._override_ini: - for ini_config in ini_config_list: - try: - (key, user_ini_value) = ini_config.split("=", 1) - except ValueError: - raise UsageError("-o/--override-ini expects option=value style.") - if key == name: - value = user_ini_value - return value - - def getoption(self, name, default=notset, skip=False): - """ return command line option value. - - :arg name: name of the option. You may also specify - the literal ``--OPT`` option instead of the "dest" option name. - :arg default: default value if no option of that name exists. - :arg skip: if True raise pytest.skip if option does not exists - or has a None value. - """ - name = self._opt2dest.get(name, name) - try: - val = getattr(self.option, name) - if val is None and skip: - raise AttributeError(name) - return val - except AttributeError: - if default is not notset: - return default - if skip: - import pytest - pytest.skip("no %r option found" % (name,)) - raise ValueError("no option named %r" % (name,)) - - def getvalue(self, name, path=None): - """ (deprecated, use getoption()) """ - return self.getoption(name) - - def getvalueorskip(self, name, path=None): - """ (deprecated, use getoption(skip=True)) """ - return self.getoption(name, skip=True) - - -def exists(path, ignore=EnvironmentError): - try: - return path.check() - except ignore: - return False - - -def getcfg(args, warnfunc=None): - """ - Search the list of arguments for a valid ini-file for pytest, - and return a tuple of (rootdir, inifile, cfg-dict). - - note: warnfunc is an optional function used to warn - about ini-files that use deprecated features. - This parameter should be removed when pytest - adopts standard deprecation warnings (#1804). - """ - from _pytest.deprecated import SETUP_CFG_PYTEST - inibasenames = ["pytest.ini", "tox.ini", "setup.cfg"] - args = [x for x in args if not str(x).startswith("-")] - if not args: - args = [py.path.local()] - for arg in args: - arg = py.path.local(arg) - for base in arg.parts(reverse=True): - for inibasename in inibasenames: - p = base.join(inibasename) - if exists(p): - iniconfig = py.iniconfig.IniConfig(p) - if 'pytest' in iniconfig.sections: - if inibasename == 'setup.cfg' and warnfunc: - warnfunc('C1', SETUP_CFG_PYTEST) - return base, p, iniconfig['pytest'] - if inibasename == 'setup.cfg' and 'tool:pytest' in iniconfig.sections: - return base, p, iniconfig['tool:pytest'] - elif inibasename == "pytest.ini": - # allowed to be empty - return base, p, {} - return None, None, None - - -def get_common_ancestor(paths): - common_ancestor = None - for path in paths: - if not path.exists(): - continue - if common_ancestor is None: - common_ancestor = path - else: - if path.relto(common_ancestor) or path == common_ancestor: - continue - elif common_ancestor.relto(path): - common_ancestor = path - else: - shared = path.common(common_ancestor) - if shared is not None: - common_ancestor = shared - if common_ancestor is None: - common_ancestor = py.path.local() - elif common_ancestor.isfile(): - common_ancestor = common_ancestor.dirpath() - return common_ancestor - - -def get_dirs_from_args(args): - def is_option(x): - return str(x).startswith('-') - - def get_file_part_from_node_id(x): - return str(x).split('::')[0] - - def get_dir_from_path(path): - if path.isdir(): - return path - return py.path.local(path.dirname) - - # These look like paths but may not exist - possible_paths = ( - py.path.local(get_file_part_from_node_id(arg)) - for arg in args - if not is_option(arg) - ) - - return [ - get_dir_from_path(path) - for path in possible_paths - if path.exists() - ] - - -def determine_setup(inifile, args, warnfunc=None): - dirs = get_dirs_from_args(args) - if inifile: - iniconfig = py.iniconfig.IniConfig(inifile) - try: - inicfg = iniconfig["pytest"] - except KeyError: - inicfg = None - rootdir = get_common_ancestor(dirs) - else: - ancestor = get_common_ancestor(dirs) - rootdir, inifile, inicfg = getcfg([ancestor], warnfunc=warnfunc) - if rootdir is None: - for rootdir in ancestor.parts(reverse=True): - if rootdir.join("setup.py").exists(): - break - else: - rootdir, inifile, inicfg = getcfg(dirs, warnfunc=warnfunc) - if rootdir is None: - rootdir = get_common_ancestor([py.path.local(), ancestor]) - is_fs_root = os.path.splitdrive(str(rootdir))[1] == '/' - if is_fs_root: - rootdir = ancestor - return rootdir, inifile, inicfg or {} - - -def setns(obj, dic): - import pytest - for name, value in dic.items(): - if isinstance(value, dict): - mod = getattr(obj, name, None) - if mod is None: - modname = "pytest.%s" % name - mod = types.ModuleType(modname) - sys.modules[modname] = mod - mod.__all__ = [] - setattr(obj, name, mod) - obj.__all__.append(name) - setns(mod, value) - else: - setattr(obj, name, value) - obj.__all__.append(name) - # if obj != pytest: - # pytest.__all__.append(name) - setattr(pytest, name, value) - - -def create_terminal_writer(config, *args, **kwargs): - """Create a TerminalWriter instance configured according to the options - in the config object. Every code which requires a TerminalWriter object - and has access to a config object should use this function. - """ - tw = py.io.TerminalWriter(*args, **kwargs) - if config.option.color == 'yes': - tw.hasmarkup = True - if config.option.color == 'no': - tw.hasmarkup = False - return tw - - -def _strtobool(val): - """Convert a string representation of truth to true (1) or false (0). - - True values are 'y', 'yes', 't', 'true', 'on', and '1'; false values - are 'n', 'no', 'f', 'false', 'off', and '0'. Raises ValueError if - 'val' is anything else. - - .. note:: copied from distutils.util - """ - val = val.lower() - if val in ('y', 'yes', 't', 'true', 'on', '1'): - return 1 - elif val in ('n', 'no', 'f', 'false', 'off', '0'): - return 0 - else: - raise ValueError("invalid truth value %r" % (val,)) diff --git a/lib/spack/external/_pytest/debugging.py b/lib/spack/external/_pytest/debugging.py deleted file mode 100644 index aa9c9a3863..0000000000 --- a/lib/spack/external/_pytest/debugging.py +++ /dev/null @@ -1,123 +0,0 @@ -""" interactive debugging with PDB, the Python Debugger. """ -from __future__ import absolute_import, division, print_function -import pdb -import sys - - -def pytest_addoption(parser): - group = parser.getgroup("general") - group._addoption( - '--pdb', dest="usepdb", action="store_true", - help="start the interactive Python debugger on errors.") - group._addoption( - '--pdbcls', dest="usepdb_cls", metavar="modulename:classname", - help="start a custom interactive Python debugger on errors. " - "For example: --pdbcls=IPython.terminal.debugger:TerminalPdb") - - -def pytest_configure(config): - if config.getvalue("usepdb_cls"): - modname, classname = config.getvalue("usepdb_cls").split(":") - __import__(modname) - pdb_cls = getattr(sys.modules[modname], classname) - else: - pdb_cls = pdb.Pdb - - if config.getvalue("usepdb"): - config.pluginmanager.register(PdbInvoke(), 'pdbinvoke') - - old = (pdb.set_trace, pytestPDB._pluginmanager) - - def fin(): - pdb.set_trace, pytestPDB._pluginmanager = old - pytestPDB._config = None - pytestPDB._pdb_cls = pdb.Pdb - - pdb.set_trace = pytestPDB.set_trace - pytestPDB._pluginmanager = config.pluginmanager - pytestPDB._config = config - pytestPDB._pdb_cls = pdb_cls - config._cleanup.append(fin) - - -class pytestPDB: - """ Pseudo PDB that defers to the real pdb. """ - _pluginmanager = None - _config = None - _pdb_cls = pdb.Pdb - - @classmethod - def set_trace(cls): - """ invoke PDB set_trace debugging, dropping any IO capturing. """ - import _pytest.config - frame = sys._getframe().f_back - if cls._pluginmanager is not None: - capman = cls._pluginmanager.getplugin("capturemanager") - if capman: - capman.suspendcapture(in_=True) - tw = _pytest.config.create_terminal_writer(cls._config) - tw.line() - tw.sep(">", "PDB set_trace (IO-capturing turned off)") - cls._pluginmanager.hook.pytest_enter_pdb(config=cls._config) - cls._pdb_cls().set_trace(frame) - - -class PdbInvoke: - def pytest_exception_interact(self, node, call, report): - capman = node.config.pluginmanager.getplugin("capturemanager") - if capman: - out, err = capman.suspendcapture(in_=True) - sys.stdout.write(out) - sys.stdout.write(err) - _enter_pdb(node, call.excinfo, report) - - def pytest_internalerror(self, excrepr, excinfo): - for line in str(excrepr).split("\n"): - sys.stderr.write("INTERNALERROR> %s\n" % line) - sys.stderr.flush() - tb = _postmortem_traceback(excinfo) - post_mortem(tb) - - -def _enter_pdb(node, excinfo, rep): - # XXX we re-use the TerminalReporter's terminalwriter - # because this seems to avoid some encoding related troubles - # for not completely clear reasons. - tw = node.config.pluginmanager.getplugin("terminalreporter")._tw - tw.line() - tw.sep(">", "traceback") - rep.toterminal(tw) - tw.sep(">", "entering PDB") - tb = _postmortem_traceback(excinfo) - post_mortem(tb) - rep._pdbshown = True - return rep - - -def _postmortem_traceback(excinfo): - # A doctest.UnexpectedException is not useful for post_mortem. - # Use the underlying exception instead: - from doctest import UnexpectedException - if isinstance(excinfo.value, UnexpectedException): - return excinfo.value.exc_info[2] - else: - return excinfo._excinfo[2] - - -def _find_last_non_hidden_frame(stack): - i = max(0, len(stack) - 1) - while i and stack[i][0].f_locals.get("__tracebackhide__", False): - i -= 1 - return i - - -def post_mortem(t): - class Pdb(pytestPDB._pdb_cls): - def get_stack(self, f, t): - stack, i = pdb.Pdb.get_stack(self, f, t) - if f is None: - i = _find_last_non_hidden_frame(stack) - return stack, i - p = Pdb() - p.reset() - p.interaction(None, t) diff --git a/lib/spack/external/_pytest/deprecated.py b/lib/spack/external/_pytest/deprecated.py deleted file mode 100644 index 38e9496778..0000000000 --- a/lib/spack/external/_pytest/deprecated.py +++ /dev/null @@ -1,42 +0,0 @@ -""" -This module contains deprecation messages and bits of code used elsewhere in the codebase -that is planned to be removed in the next pytest release. - -Keeping it in a central location makes it easy to track what is deprecated and should -be removed when the time comes. -""" -from __future__ import absolute_import, division, print_function - - -class RemovedInPytest4Warning(DeprecationWarning): - """warning class for features removed in pytest 4.0""" - - -MAIN_STR_ARGS = 'passing a string to pytest.main() is deprecated, ' \ - 'pass a list of arguments instead.' - -YIELD_TESTS = 'yield tests are deprecated, and scheduled to be removed in pytest 4.0' - -FUNCARG_PREFIX = ( - '{name}: declaring fixtures using "pytest_funcarg__" prefix is deprecated ' - 'and scheduled to be removed in pytest 4.0. ' - 'Please remove the prefix and use the @pytest.fixture decorator instead.') - -SETUP_CFG_PYTEST = '[pytest] section in setup.cfg files is deprecated, use [tool:pytest] instead.' - -GETFUNCARGVALUE = "use of getfuncargvalue is deprecated, use getfixturevalue" - -RESULT_LOG = ( - '--result-log is deprecated and scheduled for removal in pytest 4.0.\n' - 'See https://docs.pytest.org/en/latest/usage.html#creating-resultlog-format-files for more information.' -) - -MARK_INFO_ATTRIBUTE = RemovedInPytest4Warning( - "MarkInfo objects are deprecated as they contain the merged marks" -) - -MARK_PARAMETERSET_UNPACKING = RemovedInPytest4Warning( - "Applying marks directly to parameters is deprecated," - " please use pytest.param(..., marks=...) instead.\n" - "For more details, see: https://docs.pytest.org/en/latest/parametrize.html" -) diff --git a/lib/spack/external/_pytest/doctest.py b/lib/spack/external/_pytest/doctest.py deleted file mode 100644 index 4c05acddf7..0000000000 --- a/lib/spack/external/_pytest/doctest.py +++ /dev/null @@ -1,362 +0,0 @@ -""" discover and run doctests in modules and test files.""" -from __future__ import absolute_import, division, print_function - -import traceback - -import pytest -from _pytest._code.code import ExceptionInfo, ReprFileLocation, TerminalRepr -from _pytest.fixtures import FixtureRequest - - -DOCTEST_REPORT_CHOICE_NONE = 'none' -DOCTEST_REPORT_CHOICE_CDIFF = 'cdiff' -DOCTEST_REPORT_CHOICE_NDIFF = 'ndiff' -DOCTEST_REPORT_CHOICE_UDIFF = 'udiff' -DOCTEST_REPORT_CHOICE_ONLY_FIRST_FAILURE = 'only_first_failure' - -DOCTEST_REPORT_CHOICES = ( - DOCTEST_REPORT_CHOICE_NONE, - DOCTEST_REPORT_CHOICE_CDIFF, - DOCTEST_REPORT_CHOICE_NDIFF, - DOCTEST_REPORT_CHOICE_UDIFF, - DOCTEST_REPORT_CHOICE_ONLY_FIRST_FAILURE, -) - - -def pytest_addoption(parser): - parser.addini('doctest_optionflags', 'option flags for doctests', - type="args", default=["ELLIPSIS"]) - parser.addini("doctest_encoding", 'encoding used for doctest files', default="utf-8") - group = parser.getgroup("collect") - group.addoption("--doctest-modules", - action="store_true", default=False, - help="run doctests in all .py modules", - dest="doctestmodules") - group.addoption("--doctest-report", - type=str.lower, default="udiff", - help="choose another output format for diffs on doctest failure", - choices=DOCTEST_REPORT_CHOICES, - dest="doctestreport") - group.addoption("--doctest-glob", - action="append", default=[], metavar="pat", - help="doctests file matching pattern, default: test*.txt", - dest="doctestglob") - group.addoption("--doctest-ignore-import-errors", - action="store_true", default=False, - help="ignore doctest ImportErrors", - dest="doctest_ignore_import_errors") - - -def pytest_collect_file(path, parent): - config = parent.config - if path.ext == ".py": - if config.option.doctestmodules: - return DoctestModule(path, parent) - elif _is_doctest(config, path, parent): - return DoctestTextfile(path, parent) - - -def _is_doctest(config, path, parent): - if path.ext in ('.txt', '.rst') and parent.session.isinitpath(path): - return True - globs = config.getoption("doctestglob") or ['test*.txt'] - for glob in globs: - if path.check(fnmatch=glob): - return True - return False - - -class ReprFailDoctest(TerminalRepr): - - def __init__(self, reprlocation, lines): - self.reprlocation = reprlocation - self.lines = lines - - def toterminal(self, tw): - for line in self.lines: - tw.line(line) - self.reprlocation.toterminal(tw) - - -class DoctestItem(pytest.Item): - def __init__(self, name, parent, runner=None, dtest=None): - super(DoctestItem, self).__init__(name, parent) - self.runner = runner - self.dtest = dtest - self.obj = None - self.fixture_request = None - - def setup(self): - if self.dtest is not None: - self.fixture_request = _setup_fixtures(self) - globs = dict(getfixture=self.fixture_request.getfixturevalue) - for name, value in self.fixture_request.getfixturevalue('doctest_namespace').items(): - globs[name] = value - self.dtest.globs.update(globs) - - def runtest(self): - _check_all_skipped(self.dtest) - self.runner.run(self.dtest) - - def repr_failure(self, excinfo): - import doctest - if excinfo.errisinstance((doctest.DocTestFailure, - doctest.UnexpectedException)): - doctestfailure = excinfo.value - example = doctestfailure.example - test = doctestfailure.test - filename = test.filename - if test.lineno is None: - lineno = None - else: - lineno = test.lineno + example.lineno + 1 - message = excinfo.type.__name__ - reprlocation = ReprFileLocation(filename, lineno, message) - checker = _get_checker() - report_choice = _get_report_choice(self.config.getoption("doctestreport")) - if lineno is not None: - lines = doctestfailure.test.docstring.splitlines(False) - # add line numbers to the left of the error message - lines = ["%03d %s" % (i + test.lineno + 1, x) - for (i, x) in enumerate(lines)] - # trim docstring error lines to 10 - lines = lines[max(example.lineno - 9, 0):example.lineno + 1] - else: - lines = ['EXAMPLE LOCATION UNKNOWN, not showing all tests of that example'] - indent = '>>>' - for line in example.source.splitlines(): - lines.append('??? %s %s' % (indent, line)) - indent = '...' - if excinfo.errisinstance(doctest.DocTestFailure): - lines += checker.output_difference(example, - doctestfailure.got, report_choice).split("\n") - else: - inner_excinfo = ExceptionInfo(excinfo.value.exc_info) - lines += ["UNEXPECTED EXCEPTION: %s" % - repr(inner_excinfo.value)] - lines += traceback.format_exception(*excinfo.value.exc_info) - return ReprFailDoctest(reprlocation, lines) - else: - return super(DoctestItem, self).repr_failure(excinfo) - - def reportinfo(self): - return self.fspath, self.dtest.lineno, "[doctest] %s" % self.name - - -def _get_flag_lookup(): - import doctest - return dict(DONT_ACCEPT_TRUE_FOR_1=doctest.DONT_ACCEPT_TRUE_FOR_1, - DONT_ACCEPT_BLANKLINE=doctest.DONT_ACCEPT_BLANKLINE, - NORMALIZE_WHITESPACE=doctest.NORMALIZE_WHITESPACE, - ELLIPSIS=doctest.ELLIPSIS, - IGNORE_EXCEPTION_DETAIL=doctest.IGNORE_EXCEPTION_DETAIL, - COMPARISON_FLAGS=doctest.COMPARISON_FLAGS, - ALLOW_UNICODE=_get_allow_unicode_flag(), - ALLOW_BYTES=_get_allow_bytes_flag(), - ) - - -def get_optionflags(parent): - optionflags_str = parent.config.getini("doctest_optionflags") - flag_lookup_table = _get_flag_lookup() - flag_acc = 0 - for flag in optionflags_str: - flag_acc |= flag_lookup_table[flag] - return flag_acc - - -class DoctestTextfile(pytest.Module): - obj = None - - def collect(self): - import doctest - - # inspired by doctest.testfile; ideally we would use it directly, - # but it doesn't support passing a custom checker - encoding = self.config.getini("doctest_encoding") - text = self.fspath.read_text(encoding) - filename = str(self.fspath) - name = self.fspath.basename - globs = {'__name__': '__main__'} - - optionflags = get_optionflags(self) - runner = doctest.DebugRunner(verbose=0, optionflags=optionflags, - checker=_get_checker()) - _fix_spoof_python2(runner, encoding) - - parser = doctest.DocTestParser() - test = parser.get_doctest(text, globs, name, filename, 0) - if test.examples: - yield DoctestItem(test.name, self, runner, test) - - -def _check_all_skipped(test): - """raises pytest.skip() if all examples in the given DocTest have the SKIP - option set. - """ - import doctest - all_skipped = all(x.options.get(doctest.SKIP, False) for x in test.examples) - if all_skipped: - pytest.skip('all tests skipped by +SKIP option') - - -class DoctestModule(pytest.Module): - def collect(self): - import doctest - if self.fspath.basename == "conftest.py": - module = self.config.pluginmanager._importconftest(self.fspath) - else: - try: - module = self.fspath.pyimport() - except ImportError: - if self.config.getvalue('doctest_ignore_import_errors'): - pytest.skip('unable to import module %r' % self.fspath) - else: - raise - # uses internal doctest module parsing mechanism - finder = doctest.DocTestFinder() - optionflags = get_optionflags(self) - runner = doctest.DebugRunner(verbose=0, optionflags=optionflags, - checker=_get_checker()) - - for test in finder.find(module, module.__name__): - if test.examples: # skip empty doctests - yield DoctestItem(test.name, self, runner, test) - - -def _setup_fixtures(doctest_item): - """ - Used by DoctestTextfile and DoctestItem to setup fixture information. - """ - def func(): - pass - - doctest_item.funcargs = {} - fm = doctest_item.session._fixturemanager - doctest_item._fixtureinfo = fm.getfixtureinfo(node=doctest_item, func=func, - cls=None, funcargs=False) - fixture_request = FixtureRequest(doctest_item) - fixture_request._fillfixtures() - return fixture_request - - -def _get_checker(): - """ - Returns a doctest.OutputChecker subclass that takes in account the - ALLOW_UNICODE option to ignore u'' prefixes in strings and ALLOW_BYTES - to strip b'' prefixes. - Useful when the same doctest should run in Python 2 and Python 3. - - An inner class is used to avoid importing "doctest" at the module - level. - """ - if hasattr(_get_checker, 'LiteralsOutputChecker'): - return _get_checker.LiteralsOutputChecker() - - import doctest - import re - - class LiteralsOutputChecker(doctest.OutputChecker): - """ - Copied from doctest_nose_plugin.py from the nltk project: - https://github.com/nltk/nltk - - Further extended to also support byte literals. - """ - - _unicode_literal_re = re.compile(r"(\W|^)[uU]([rR]?[\'\"])", re.UNICODE) - _bytes_literal_re = re.compile(r"(\W|^)[bB]([rR]?[\'\"])", re.UNICODE) - - def check_output(self, want, got, optionflags): - res = doctest.OutputChecker.check_output(self, want, got, - optionflags) - if res: - return True - - allow_unicode = optionflags & _get_allow_unicode_flag() - allow_bytes = optionflags & _get_allow_bytes_flag() - if not allow_unicode and not allow_bytes: - return False - - else: # pragma: no cover - def remove_prefixes(regex, txt): - return re.sub(regex, r'\1\2', txt) - - if allow_unicode: - want = remove_prefixes(self._unicode_literal_re, want) - got = remove_prefixes(self._unicode_literal_re, got) - if allow_bytes: - want = remove_prefixes(self._bytes_literal_re, want) - got = remove_prefixes(self._bytes_literal_re, got) - res = doctest.OutputChecker.check_output(self, want, got, - optionflags) - return res - - _get_checker.LiteralsOutputChecker = LiteralsOutputChecker - return _get_checker.LiteralsOutputChecker() - - -def _get_allow_unicode_flag(): - """ - Registers and returns the ALLOW_UNICODE flag. - """ - import doctest - return doctest.register_optionflag('ALLOW_UNICODE') - - -def _get_allow_bytes_flag(): - """ - Registers and returns the ALLOW_BYTES flag. - """ - import doctest - return doctest.register_optionflag('ALLOW_BYTES') - - -def _get_report_choice(key): - """ - This function returns the actual `doctest` module flag value, we want to do it as late as possible to avoid - importing `doctest` and all its dependencies when parsing options, as it adds overhead and breaks tests. - """ - import doctest - - return { - DOCTEST_REPORT_CHOICE_UDIFF: doctest.REPORT_UDIFF, - DOCTEST_REPORT_CHOICE_CDIFF: doctest.REPORT_CDIFF, - DOCTEST_REPORT_CHOICE_NDIFF: doctest.REPORT_NDIFF, - DOCTEST_REPORT_CHOICE_ONLY_FIRST_FAILURE: doctest.REPORT_ONLY_FIRST_FAILURE, - DOCTEST_REPORT_CHOICE_NONE: 0, - }[key] - - -def _fix_spoof_python2(runner, encoding): - """ - Installs a "SpoofOut" into the given DebugRunner so it properly deals with unicode output. This - should patch only doctests for text files because they don't have a way to declare their - encoding. Doctests in docstrings from Python modules don't have the same problem given that - Python already decoded the strings. - - This fixes the problem related in issue #2434. - """ - from _pytest.compat import _PY2 - if not _PY2: - return - - from doctest import _SpoofOut - - class UnicodeSpoof(_SpoofOut): - - def getvalue(self): - result = _SpoofOut.getvalue(self) - if encoding: - result = result.decode(encoding) - return result - - runner._fakeout = UnicodeSpoof() - - -@pytest.fixture(scope='session') -def doctest_namespace(): - """ - Inject names into the doctest namespace. - """ - return dict() diff --git a/lib/spack/external/_pytest/fixtures.py b/lib/spack/external/_pytest/fixtures.py deleted file mode 100644 index 98317a4889..0000000000 --- a/lib/spack/external/_pytest/fixtures.py +++ /dev/null @@ -1,1137 +0,0 @@ -from __future__ import absolute_import, division, print_function - -import inspect -import sys -import warnings - -import py -from py._code.code import FormattedExcinfo - -import _pytest -from _pytest import nodes -from _pytest._code.code import TerminalRepr -from _pytest.compat import ( - NOTSET, exc_clear, _format_args, - getfslineno, get_real_func, - is_generator, isclass, getimfunc, - getlocation, getfuncargnames, - safe_getattr, - FuncargnamesCompatAttr, -) -from _pytest.outcomes import fail, TEST_OUTCOME - - -from ordereddict_backport import OrderedDict - - -def pytest_sessionstart(session): - import _pytest.python - scopename2class.update({ - 'class': _pytest.python.Class, - 'module': _pytest.python.Module, - 'function': _pytest.main.Item, - }) - session._fixturemanager = FixtureManager(session) - - -scopename2class = {} - - -scope2props = dict(session=()) -scope2props["module"] = ("fspath", "module") -scope2props["class"] = scope2props["module"] + ("cls",) -scope2props["instance"] = scope2props["class"] + ("instance", ) -scope2props["function"] = scope2props["instance"] + ("function", "keywords") - - -def scopeproperty(name=None, doc=None): - def decoratescope(func): - scopename = name or func.__name__ - - def provide(self): - if func.__name__ in scope2props[self.scope]: - return func(self) - raise AttributeError("%s not available in %s-scoped context" % ( - scopename, self.scope)) - - return property(provide, None, None, func.__doc__) - return decoratescope - - -def get_scope_node(node, scope): - cls = scopename2class.get(scope) - if cls is None: - if scope == "session": - return node.session - raise ValueError("unknown scope") - return node.getparent(cls) - - -def add_funcarg_pseudo_fixture_def(collector, metafunc, fixturemanager): - # this function will transform all collected calls to a functions - # if they use direct funcargs (i.e. direct parametrization) - # because we want later test execution to be able to rely on - # an existing FixtureDef structure for all arguments. - # XXX we can probably avoid this algorithm if we modify CallSpec2 - # to directly care for creating the fixturedefs within its methods. - if not metafunc._calls[0].funcargs: - return # this function call does not have direct parametrization - # collect funcargs of all callspecs into a list of values - arg2params = {} - arg2scope = {} - for callspec in metafunc._calls: - for argname, argvalue in callspec.funcargs.items(): - assert argname not in callspec.params - callspec.params[argname] = argvalue - arg2params_list = arg2params.setdefault(argname, []) - callspec.indices[argname] = len(arg2params_list) - arg2params_list.append(argvalue) - if argname not in arg2scope: - scopenum = callspec._arg2scopenum.get(argname, - scopenum_function) - arg2scope[argname] = scopes[scopenum] - callspec.funcargs.clear() - - # register artificial FixtureDef's so that later at test execution - # time we can rely on a proper FixtureDef to exist for fixture setup. - arg2fixturedefs = metafunc._arg2fixturedefs - for argname, valuelist in arg2params.items(): - # if we have a scope that is higher than function we need - # to make sure we only ever create an according fixturedef on - # a per-scope basis. We thus store and cache the fixturedef on the - # node related to the scope. - scope = arg2scope[argname] - node = None - if scope != "function": - node = get_scope_node(collector, scope) - if node is None: - assert scope == "class" and isinstance(collector, _pytest.python.Module) - # use module-level collector for class-scope (for now) - node = collector - if node and argname in node._name2pseudofixturedef: - arg2fixturedefs[argname] = [node._name2pseudofixturedef[argname]] - else: - fixturedef = FixtureDef(fixturemanager, '', argname, - get_direct_param_fixture_func, - arg2scope[argname], - valuelist, False, False) - arg2fixturedefs[argname] = [fixturedef] - if node is not None: - node._name2pseudofixturedef[argname] = fixturedef - - -def getfixturemarker(obj): - """ return fixturemarker or None if it doesn't exist or raised - exceptions.""" - try: - return getattr(obj, "_pytestfixturefunction", None) - except TEST_OUTCOME: - # some objects raise errors like request (from flask import request) - # we don't expect them to be fixture functions - return None - - -def get_parametrized_fixture_keys(item, scopenum): - """ return list of keys for all parametrized arguments which match - the specified scope. """ - assert scopenum < scopenum_function # function - try: - cs = item.callspec - except AttributeError: - pass - else: - # cs.indices.items() is random order of argnames. Need to - # sort this so that different calls to - # get_parametrized_fixture_keys will be deterministic. - for argname, param_index in sorted(cs.indices.items()): - if cs._arg2scopenum[argname] != scopenum: - continue - if scopenum == 0: # session - key = (argname, param_index) - elif scopenum == 1: # module - key = (argname, param_index, item.fspath) - elif scopenum == 2: # class - key = (argname, param_index, item.fspath, item.cls) - yield key - - -# algorithm for sorting on a per-parametrized resource setup basis -# it is called for scopenum==0 (session) first and performs sorting -# down to the lower scopes such as to minimize number of "high scope" -# setups and teardowns - -def reorder_items(items): - argkeys_cache = {} - for scopenum in range(0, scopenum_function): - argkeys_cache[scopenum] = d = {} - for item in items: - keys = OrderedDict.fromkeys(get_parametrized_fixture_keys(item, scopenum)) - if keys: - d[item] = keys - return reorder_items_atscope(items, set(), argkeys_cache, 0) - - -def reorder_items_atscope(items, ignore, argkeys_cache, scopenum): - if scopenum >= scopenum_function or len(items) < 3: - return items - items_done = [] - while 1: - items_before, items_same, items_other, newignore = \ - slice_items(items, ignore, argkeys_cache[scopenum]) - items_before = reorder_items_atscope( - items_before, ignore, argkeys_cache, scopenum + 1) - if items_same is None: - # nothing to reorder in this scope - assert items_other is None - return items_done + items_before - items_done.extend(items_before) - items = items_same + items_other - ignore = newignore - - -def slice_items(items, ignore, scoped_argkeys_cache): - # we pick the first item which uses a fixture instance in the - # requested scope and which we haven't seen yet. We slice the input - # items list into a list of items_nomatch, items_same and - # items_other - if scoped_argkeys_cache: # do we need to do work at all? - it = iter(items) - # first find a slicing key - for i, item in enumerate(it): - argkeys = scoped_argkeys_cache.get(item) - if argkeys is not None: - newargkeys = OrderedDict.fromkeys(k for k in argkeys if k not in ignore) - if newargkeys: # found a slicing key - slicing_argkey, _ = newargkeys.popitem() - items_before = items[:i] - items_same = [item] - items_other = [] - # now slice the remainder of the list - for item in it: - argkeys = scoped_argkeys_cache.get(item) - if argkeys and slicing_argkey in argkeys and \ - slicing_argkey not in ignore: - items_same.append(item) - else: - items_other.append(item) - newignore = ignore.copy() - newignore.add(slicing_argkey) - return (items_before, items_same, items_other, newignore) - return items, None, None, None - - -def fillfixtures(function): - """ fill missing funcargs for a test function. """ - try: - request = function._request - except AttributeError: - # XXX this special code path is only expected to execute - # with the oejskit plugin. It uses classes with funcargs - # and we thus have to work a bit to allow this. - fm = function.session._fixturemanager - fi = fm.getfixtureinfo(function.parent, function.obj, None) - function._fixtureinfo = fi - request = function._request = FixtureRequest(function) - request._fillfixtures() - # prune out funcargs for jstests - newfuncargs = {} - for name in fi.argnames: - newfuncargs[name] = function.funcargs[name] - function.funcargs = newfuncargs - else: - request._fillfixtures() - - -def get_direct_param_fixture_func(request): - return request.param - - -class FuncFixtureInfo: - def __init__(self, argnames, names_closure, name2fixturedefs): - self.argnames = argnames - self.names_closure = names_closure - self.name2fixturedefs = name2fixturedefs - - -class FixtureRequest(FuncargnamesCompatAttr): - """ A request for a fixture from a test or fixture function. - - A request object gives access to the requesting test context - and has an optional ``param`` attribute in case - the fixture is parametrized indirectly. - """ - - def __init__(self, pyfuncitem): - self._pyfuncitem = pyfuncitem - #: fixture for which this request is being performed - self.fixturename = None - #: Scope string, one of "function", "class", "module", "session" - self.scope = "function" - self._fixture_values = {} # argname -> fixture value - self._fixture_defs = {} # argname -> FixtureDef - fixtureinfo = pyfuncitem._fixtureinfo - self._arg2fixturedefs = fixtureinfo.name2fixturedefs.copy() - self._arg2index = {} - self._fixturemanager = pyfuncitem.session._fixturemanager - - @property - def fixturenames(self): - # backward incompatible note: now a readonly property - return list(self._pyfuncitem._fixtureinfo.names_closure) - - @property - def node(self): - """ underlying collection node (depends on current request scope)""" - return self._getscopeitem(self.scope) - - def _getnextfixturedef(self, argname): - fixturedefs = self._arg2fixturedefs.get(argname, None) - if fixturedefs is None: - # we arrive here because of a a dynamic call to - # getfixturevalue(argname) usage which was naturally - # not known at parsing/collection time - parentid = self._pyfuncitem.parent.nodeid - fixturedefs = self._fixturemanager.getfixturedefs(argname, parentid) - self._arg2fixturedefs[argname] = fixturedefs - # fixturedefs list is immutable so we maintain a decreasing index - index = self._arg2index.get(argname, 0) - 1 - if fixturedefs is None or (-index > len(fixturedefs)): - raise FixtureLookupError(argname, self) - self._arg2index[argname] = index - return fixturedefs[index] - - @property - def config(self): - """ the pytest config object associated with this request. """ - return self._pyfuncitem.config - - @scopeproperty() - def function(self): - """ test function object if the request has a per-function scope. """ - return self._pyfuncitem.obj - - @scopeproperty("class") - def cls(self): - """ class (can be None) where the test function was collected. """ - clscol = self._pyfuncitem.getparent(_pytest.python.Class) - if clscol: - return clscol.obj - - @property - def instance(self): - """ instance (can be None) on which test function was collected. """ - # unittest support hack, see _pytest.unittest.TestCaseFunction - try: - return self._pyfuncitem._testcase - except AttributeError: - function = getattr(self, "function", None) - if function is not None: - return py.builtin._getimself(function) - - @scopeproperty() - def module(self): - """ python module object where the test function was collected. """ - return self._pyfuncitem.getparent(_pytest.python.Module).obj - - @scopeproperty() - def fspath(self): - """ the file system path of the test module which collected this test. """ - return self._pyfuncitem.fspath - - @property - def keywords(self): - """ keywords/markers dictionary for the underlying node. """ - return self.node.keywords - - @property - def session(self): - """ pytest session object. """ - return self._pyfuncitem.session - - def addfinalizer(self, finalizer): - """ add finalizer/teardown function to be called after the - last test within the requesting test context finished - execution. """ - # XXX usually this method is shadowed by fixturedef specific ones - self._addfinalizer(finalizer, scope=self.scope) - - def _addfinalizer(self, finalizer, scope): - colitem = self._getscopeitem(scope) - self._pyfuncitem.session._setupstate.addfinalizer( - finalizer=finalizer, colitem=colitem) - - def applymarker(self, marker): - """ Apply a marker to a single test function invocation. - This method is useful if you don't want to have a keyword/marker - on all function invocations. - - :arg marker: a :py:class:`_pytest.mark.MarkDecorator` object - created by a call to ``pytest.mark.NAME(...)``. - """ - try: - self.node.keywords[marker.markname] = marker - except AttributeError: - raise ValueError(marker) - - def raiseerror(self, msg): - """ raise a FixtureLookupError with the given message. """ - raise self._fixturemanager.FixtureLookupError(None, self, msg) - - def _fillfixtures(self): - item = self._pyfuncitem - fixturenames = getattr(item, "fixturenames", self.fixturenames) - for argname in fixturenames: - if argname not in item.funcargs: - item.funcargs[argname] = self.getfixturevalue(argname) - - def cached_setup(self, setup, teardown=None, scope="module", extrakey=None): - """ (deprecated) Return a testing resource managed by ``setup`` & - ``teardown`` calls. ``scope`` and ``extrakey`` determine when the - ``teardown`` function will be called so that subsequent calls to - ``setup`` would recreate the resource. With pytest-2.3 you often - do not need ``cached_setup()`` as you can directly declare a scope - on a fixture function and register a finalizer through - ``request.addfinalizer()``. - - :arg teardown: function receiving a previously setup resource. - :arg setup: a no-argument function creating a resource. - :arg scope: a string value out of ``function``, ``class``, ``module`` - or ``session`` indicating the caching lifecycle of the resource. - :arg extrakey: added to internal caching key of (funcargname, scope). - """ - if not hasattr(self.config, '_setupcache'): - self.config._setupcache = {} # XXX weakref? - cachekey = (self.fixturename, self._getscopeitem(scope), extrakey) - cache = self.config._setupcache - try: - val = cache[cachekey] - except KeyError: - self._check_scope(self.fixturename, self.scope, scope) - val = setup() - cache[cachekey] = val - if teardown is not None: - def finalizer(): - del cache[cachekey] - teardown(val) - self._addfinalizer(finalizer, scope=scope) - return val - - def getfixturevalue(self, argname): - """ Dynamically run a named fixture function. - - Declaring fixtures via function argument is recommended where possible. - But if you can only decide whether to use another fixture at test - setup time, you may use this function to retrieve it inside a fixture - or test function body. - """ - return self._get_active_fixturedef(argname).cached_result[0] - - def getfuncargvalue(self, argname): - """ Deprecated, use getfixturevalue. """ - from _pytest import deprecated - warnings.warn( - deprecated.GETFUNCARGVALUE, - DeprecationWarning, - stacklevel=2) - return self.getfixturevalue(argname) - - def _get_active_fixturedef(self, argname): - try: - return self._fixture_defs[argname] - except KeyError: - try: - fixturedef = self._getnextfixturedef(argname) - except FixtureLookupError: - if argname == "request": - class PseudoFixtureDef: - cached_result = (self, [0], None) - scope = "function" - return PseudoFixtureDef - raise - # remove indent to prevent the python3 exception - # from leaking into the call - result = self._getfixturevalue(fixturedef) - self._fixture_values[argname] = result - self._fixture_defs[argname] = fixturedef - return fixturedef - - def _get_fixturestack(self): - current = self - values = [] - while 1: - fixturedef = getattr(current, "_fixturedef", None) - if fixturedef is None: - values.reverse() - return values - values.append(fixturedef) - current = current._parent_request - - def _getfixturevalue(self, fixturedef): - # prepare a subrequest object before calling fixture function - # (latter managed by fixturedef) - argname = fixturedef.argname - funcitem = self._pyfuncitem - scope = fixturedef.scope - try: - param = funcitem.callspec.getparam(argname) - except (AttributeError, ValueError): - param = NOTSET - param_index = 0 - if fixturedef.params is not None: - frame = inspect.stack()[3] - frameinfo = inspect.getframeinfo(frame[0]) - source_path = frameinfo.filename - source_lineno = frameinfo.lineno - source_path = py.path.local(source_path) - if source_path.relto(funcitem.config.rootdir): - source_path = source_path.relto(funcitem.config.rootdir) - msg = ( - "The requested fixture has no parameter defined for the " - "current test.\n\nRequested fixture '{0}' defined in:\n{1}" - "\n\nRequested here:\n{2}:{3}".format( - fixturedef.argname, - getlocation(fixturedef.func, funcitem.config.rootdir), - source_path, - source_lineno, - ) - ) - fail(msg) - else: - # indices might not be set if old-style metafunc.addcall() was used - param_index = funcitem.callspec.indices.get(argname, 0) - # if a parametrize invocation set a scope it will override - # the static scope defined with the fixture function - paramscopenum = funcitem.callspec._arg2scopenum.get(argname) - if paramscopenum is not None: - scope = scopes[paramscopenum] - - subrequest = SubRequest(self, scope, param, param_index, fixturedef) - - # check if a higher-level scoped fixture accesses a lower level one - subrequest._check_scope(argname, self.scope, scope) - - # clear sys.exc_info before invoking the fixture (python bug?) - # if its not explicitly cleared it will leak into the call - exc_clear() - try: - # call the fixture function - val = fixturedef.execute(request=subrequest) - finally: - # if fixture function failed it might have registered finalizers - self.session._setupstate.addfinalizer(fixturedef.finish, - subrequest.node) - return val - - def _check_scope(self, argname, invoking_scope, requested_scope): - if argname == "request": - return - if scopemismatch(invoking_scope, requested_scope): - # try to report something helpful - lines = self._factorytraceback() - fail("ScopeMismatch: You tried to access the %r scoped " - "fixture %r with a %r scoped request object, " - "involved factories\n%s" % ( - (requested_scope, argname, invoking_scope, "\n".join(lines))), - pytrace=False) - - def _factorytraceback(self): - lines = [] - for fixturedef in self._get_fixturestack(): - factory = fixturedef.func - fs, lineno = getfslineno(factory) - p = self._pyfuncitem.session.fspath.bestrelpath(fs) - args = _format_args(factory) - lines.append("%s:%d: def %s%s" % ( - p, lineno, factory.__name__, args)) - return lines - - def _getscopeitem(self, scope): - if scope == "function": - # this might also be a non-function Item despite its attribute name - return self._pyfuncitem - node = get_scope_node(self._pyfuncitem, scope) - if node is None and scope == "class": - # fallback to function item itself - node = self._pyfuncitem - assert node - return node - - def __repr__(self): - return "" % (self.node) - - -class SubRequest(FixtureRequest): - """ a sub request for handling getting a fixture from a - test function/fixture. """ - - def __init__(self, request, scope, param, param_index, fixturedef): - self._parent_request = request - self.fixturename = fixturedef.argname - if param is not NOTSET: - self.param = param - self.param_index = param_index - self.scope = scope - self._fixturedef = fixturedef - self._pyfuncitem = request._pyfuncitem - self._fixture_values = request._fixture_values - self._fixture_defs = request._fixture_defs - self._arg2fixturedefs = request._arg2fixturedefs - self._arg2index = request._arg2index - self._fixturemanager = request._fixturemanager - - def __repr__(self): - return "" % (self.fixturename, self._pyfuncitem) - - def addfinalizer(self, finalizer): - self._fixturedef.addfinalizer(finalizer) - - -class ScopeMismatchError(Exception): - """ A fixture function tries to use a different fixture function which - which has a lower scope (e.g. a Session one calls a function one) - """ - - -scopes = "session module class function".split() -scopenum_function = scopes.index("function") - - -def scopemismatch(currentscope, newscope): - return scopes.index(newscope) > scopes.index(currentscope) - - -def scope2index(scope, descr, where=None): - """Look up the index of ``scope`` and raise a descriptive value error - if not defined. - """ - try: - return scopes.index(scope) - except ValueError: - raise ValueError( - "{0} {1}has an unsupported scope value '{2}'".format( - descr, 'from {0} '.format(where) if where else '', - scope) - ) - - -class FixtureLookupError(LookupError): - """ could not return a requested Fixture (missing or invalid). """ - - def __init__(self, argname, request, msg=None): - self.argname = argname - self.request = request - self.fixturestack = request._get_fixturestack() - self.msg = msg - - def formatrepr(self): - tblines = [] - addline = tblines.append - stack = [self.request._pyfuncitem.obj] - stack.extend(map(lambda x: x.func, self.fixturestack)) - msg = self.msg - if msg is not None: - # the last fixture raise an error, let's present - # it at the requesting side - stack = stack[:-1] - for function in stack: - fspath, lineno = getfslineno(function) - try: - lines, _ = inspect.getsourcelines(get_real_func(function)) - except (IOError, IndexError, TypeError): - error_msg = "file %s, line %s: source code not available" - addline(error_msg % (fspath, lineno + 1)) - else: - addline("file %s, line %s" % (fspath, lineno + 1)) - for i, line in enumerate(lines): - line = line.rstrip() - addline(" " + line) - if line.lstrip().startswith('def'): - break - - if msg is None: - fm = self.request._fixturemanager - available = [] - parentid = self.request._pyfuncitem.parent.nodeid - for name, fixturedefs in fm._arg2fixturedefs.items(): - faclist = list(fm._matchfactories(fixturedefs, parentid)) - if faclist and name not in available: - available.append(name) - msg = "fixture %r not found" % (self.argname,) - msg += "\n available fixtures: %s" % (", ".join(sorted(available)),) - msg += "\n use 'pytest --fixtures [testpath]' for help on them." - - return FixtureLookupErrorRepr(fspath, lineno, tblines, msg, self.argname) - - -class FixtureLookupErrorRepr(TerminalRepr): - def __init__(self, filename, firstlineno, tblines, errorstring, argname): - self.tblines = tblines - self.errorstring = errorstring - self.filename = filename - self.firstlineno = firstlineno - self.argname = argname - - def toterminal(self, tw): - # tw.line("FixtureLookupError: %s" %(self.argname), red=True) - for tbline in self.tblines: - tw.line(tbline.rstrip()) - lines = self.errorstring.split("\n") - if lines: - tw.line('{0} {1}'.format(FormattedExcinfo.fail_marker, - lines[0].strip()), red=True) - for line in lines[1:]: - tw.line('{0} {1}'.format(FormattedExcinfo.flow_marker, - line.strip()), red=True) - tw.line() - tw.line("%s:%d" % (self.filename, self.firstlineno + 1)) - - -def fail_fixturefunc(fixturefunc, msg): - fs, lineno = getfslineno(fixturefunc) - location = "%s:%s" % (fs, lineno + 1) - source = _pytest._code.Source(fixturefunc) - fail(msg + ":\n\n" + str(source.indent()) + "\n" + location, - pytrace=False) - - -def call_fixture_func(fixturefunc, request, kwargs): - yieldctx = is_generator(fixturefunc) - if yieldctx: - it = fixturefunc(**kwargs) - res = next(it) - - def teardown(): - try: - next(it) - except StopIteration: - pass - else: - fail_fixturefunc(fixturefunc, - "yield_fixture function has more than one 'yield'") - - request.addfinalizer(teardown) - else: - res = fixturefunc(**kwargs) - return res - - -class FixtureDef: - """ A container for a factory definition. """ - - def __init__(self, fixturemanager, baseid, argname, func, scope, params, - unittest=False, ids=None): - self._fixturemanager = fixturemanager - self.baseid = baseid or '' - self.has_location = baseid is not None - self.func = func - self.argname = argname - self.scope = scope - self.scopenum = scope2index( - scope or "function", - descr='fixture {0}'.format(func.__name__), - where=baseid - ) - self.params = params - startindex = unittest and 1 or None - self.argnames = getfuncargnames(func, startindex=startindex) - self.unittest = unittest - self.ids = ids - self._finalizer = [] - - def addfinalizer(self, finalizer): - self._finalizer.append(finalizer) - - def finish(self): - exceptions = [] - try: - while self._finalizer: - try: - func = self._finalizer.pop() - func() - except: # noqa - exceptions.append(sys.exc_info()) - if exceptions: - e = exceptions[0] - del exceptions # ensure we don't keep all frames alive because of the traceback - py.builtin._reraise(*e) - - finally: - ihook = self._fixturemanager.session.ihook - ihook.pytest_fixture_post_finalizer(fixturedef=self) - # even if finalization fails, we invalidate - # the cached fixture value - if hasattr(self, "cached_result"): - del self.cached_result - - def execute(self, request): - # get required arguments and register our own finish() - # with their finalization - for argname in self.argnames: - fixturedef = request._get_active_fixturedef(argname) - if argname != "request": - fixturedef.addfinalizer(self.finish) - - my_cache_key = request.param_index - cached_result = getattr(self, "cached_result", None) - if cached_result is not None: - result, cache_key, err = cached_result - if my_cache_key == cache_key: - if err is not None: - py.builtin._reraise(*err) - else: - return result - # we have a previous but differently parametrized fixture instance - # so we need to tear it down before creating a new one - self.finish() - assert not hasattr(self, "cached_result") - - ihook = self._fixturemanager.session.ihook - return ihook.pytest_fixture_setup(fixturedef=self, request=request) - - def __repr__(self): - return ("" % - (self.argname, self.scope, self.baseid)) - - -def pytest_fixture_setup(fixturedef, request): - """ Execution of fixture setup. """ - kwargs = {} - for argname in fixturedef.argnames: - fixdef = request._get_active_fixturedef(argname) - result, arg_cache_key, exc = fixdef.cached_result - request._check_scope(argname, request.scope, fixdef.scope) - kwargs[argname] = result - - fixturefunc = fixturedef.func - if fixturedef.unittest: - if request.instance is not None: - # bind the unbound method to the TestCase instance - fixturefunc = fixturedef.func.__get__(request.instance) - else: - # the fixture function needs to be bound to the actual - # request.instance so that code working with "fixturedef" behaves - # as expected. - if request.instance is not None: - fixturefunc = getimfunc(fixturedef.func) - if fixturefunc != fixturedef.func: - fixturefunc = fixturefunc.__get__(request.instance) - my_cache_key = request.param_index - try: - result = call_fixture_func(fixturefunc, request, kwargs) - except TEST_OUTCOME: - fixturedef.cached_result = (None, my_cache_key, sys.exc_info()) - raise - fixturedef.cached_result = (result, my_cache_key, None) - return result - - -class FixtureFunctionMarker: - def __init__(self, scope, params, autouse=False, ids=None, name=None): - self.scope = scope - self.params = params - self.autouse = autouse - self.ids = ids - self.name = name - - def __call__(self, function): - if isclass(function): - raise ValueError( - "class fixtures not supported (may be in the future)") - function._pytestfixturefunction = self - return function - - -def fixture(scope="function", params=None, autouse=False, ids=None, name=None): - """ (return a) decorator to mark a fixture factory function. - - This decorator can be used (with or without parameters) to define a - fixture function. The name of the fixture function can later be - referenced to cause its invocation ahead of running tests: test - modules or classes can use the pytest.mark.usefixtures(fixturename) - marker. Test functions can directly use fixture names as input - arguments in which case the fixture instance returned from the fixture - function will be injected. - - :arg scope: the scope for which this fixture is shared, one of - "function" (default), "class", "module" or "session". - - :arg params: an optional list of parameters which will cause multiple - invocations of the fixture function and all of the tests - using it. - - :arg autouse: if True, the fixture func is activated for all tests that - can see it. If False (the default) then an explicit - reference is needed to activate the fixture. - - :arg ids: list of string ids each corresponding to the params - so that they are part of the test id. If no ids are provided - they will be generated automatically from the params. - - :arg name: the name of the fixture. This defaults to the name of the - decorated function. If a fixture is used in the same module in - which it is defined, the function name of the fixture will be - shadowed by the function arg that requests the fixture; one way - to resolve this is to name the decorated function - ``fixture_`` and then use - ``@pytest.fixture(name='')``. - - Fixtures can optionally provide their values to test functions using a ``yield`` statement, - instead of ``return``. In this case, the code block after the ``yield`` statement is executed - as teardown code regardless of the test outcome. A fixture function must yield exactly once. - """ - if callable(scope) and params is None and autouse is False: - # direct decoration - return FixtureFunctionMarker( - "function", params, autouse, name=name)(scope) - if params is not None and not isinstance(params, (list, tuple)): - params = list(params) - return FixtureFunctionMarker(scope, params, autouse, ids=ids, name=name) - - -def yield_fixture(scope="function", params=None, autouse=False, ids=None, name=None): - """ (return a) decorator to mark a yield-fixture factory function. - - .. deprecated:: 3.0 - Use :py:func:`pytest.fixture` directly instead. - """ - if callable(scope) and params is None and not autouse: - # direct decoration - return FixtureFunctionMarker( - "function", params, autouse, ids=ids, name=name)(scope) - else: - return FixtureFunctionMarker(scope, params, autouse, ids=ids, name=name) - - -defaultfuncargprefixmarker = fixture() - - -@fixture(scope="session") -def pytestconfig(request): - """ the pytest config object with access to command line opts.""" - return request.config - - -class FixtureManager: - """ - pytest fixtures definitions and information is stored and managed - from this class. - - During collection fm.parsefactories() is called multiple times to parse - fixture function definitions into FixtureDef objects and internal - data structures. - - During collection of test functions, metafunc-mechanics instantiate - a FuncFixtureInfo object which is cached per node/func-name. - This FuncFixtureInfo object is later retrieved by Function nodes - which themselves offer a fixturenames attribute. - - The FuncFixtureInfo object holds information about fixtures and FixtureDefs - relevant for a particular function. An initial list of fixtures is - assembled like this: - - - ini-defined usefixtures - - autouse-marked fixtures along the collection chain up from the function - - usefixtures markers at module/class/function level - - test function funcargs - - Subsequently the funcfixtureinfo.fixturenames attribute is computed - as the closure of the fixtures needed to setup the initial fixtures, - i. e. fixtures needed by fixture functions themselves are appended - to the fixturenames list. - - Upon the test-setup phases all fixturenames are instantiated, retrieved - by a lookup of their FuncFixtureInfo. - """ - - _argprefix = "pytest_funcarg__" - FixtureLookupError = FixtureLookupError - FixtureLookupErrorRepr = FixtureLookupErrorRepr - - def __init__(self, session): - self.session = session - self.config = session.config - self._arg2fixturedefs = {} - self._holderobjseen = set() - self._arg2finish = {} - self._nodeid_and_autousenames = [("", self.config.getini("usefixtures"))] - session.config.pluginmanager.register(self, "funcmanage") - - def getfixtureinfo(self, node, func, cls, funcargs=True): - if funcargs and not hasattr(node, "nofuncargs"): - argnames = getfuncargnames(func, cls=cls) - else: - argnames = () - usefixtures = getattr(func, "usefixtures", None) - initialnames = argnames - if usefixtures is not None: - initialnames = usefixtures.args + initialnames - fm = node.session._fixturemanager - names_closure, arg2fixturedefs = fm.getfixtureclosure(initialnames, - node) - return FuncFixtureInfo(argnames, names_closure, arg2fixturedefs) - - def pytest_plugin_registered(self, plugin): - nodeid = None - try: - p = py.path.local(plugin.__file__) - except AttributeError: - pass - else: - # construct the base nodeid which is later used to check - # what fixtures are visible for particular tests (as denoted - # by their test id) - if p.basename.startswith("conftest.py"): - nodeid = p.dirpath().relto(self.config.rootdir) - if p.sep != nodes.SEP: - nodeid = nodeid.replace(p.sep, nodes.SEP) - self.parsefactories(plugin, nodeid) - - def _getautousenames(self, nodeid): - """ return a tuple of fixture names to be used. """ - autousenames = [] - for baseid, basenames in self._nodeid_and_autousenames: - if nodeid.startswith(baseid): - if baseid: - i = len(baseid) - nextchar = nodeid[i:i + 1] - if nextchar and nextchar not in ":/": - continue - autousenames.extend(basenames) - # make sure autousenames are sorted by scope, scopenum 0 is session - autousenames.sort( - key=lambda x: self._arg2fixturedefs[x][-1].scopenum) - return autousenames - - def getfixtureclosure(self, fixturenames, parentnode): - # collect the closure of all fixtures , starting with the given - # fixturenames as the initial set. As we have to visit all - # factory definitions anyway, we also return a arg2fixturedefs - # mapping so that the caller can reuse it and does not have - # to re-discover fixturedefs again for each fixturename - # (discovering matching fixtures for a given name/node is expensive) - - parentid = parentnode.nodeid - fixturenames_closure = self._getautousenames(parentid) - - def merge(otherlist): - for arg in otherlist: - if arg not in fixturenames_closure: - fixturenames_closure.append(arg) - - merge(fixturenames) - arg2fixturedefs = {} - lastlen = -1 - while lastlen != len(fixturenames_closure): - lastlen = len(fixturenames_closure) - for argname in fixturenames_closure: - if argname in arg2fixturedefs: - continue - fixturedefs = self.getfixturedefs(argname, parentid) - if fixturedefs: - arg2fixturedefs[argname] = fixturedefs - merge(fixturedefs[-1].argnames) - return fixturenames_closure, arg2fixturedefs - - def pytest_generate_tests(self, metafunc): - for argname in metafunc.fixturenames: - faclist = metafunc._arg2fixturedefs.get(argname) - if faclist: - fixturedef = faclist[-1] - if fixturedef.params is not None: - parametrize_func = getattr(metafunc.function, 'parametrize', None) - func_params = getattr(parametrize_func, 'args', [[None]]) - func_kwargs = getattr(parametrize_func, 'kwargs', {}) - # skip directly parametrized arguments - if "argnames" in func_kwargs: - argnames = parametrize_func.kwargs["argnames"] - else: - argnames = func_params[0] - if not isinstance(argnames, (tuple, list)): - argnames = [x.strip() for x in argnames.split(",") if x.strip()] - if argname not in func_params and argname not in argnames: - metafunc.parametrize(argname, fixturedef.params, - indirect=True, scope=fixturedef.scope, - ids=fixturedef.ids) - else: - continue # will raise FixtureLookupError at setup time - - def pytest_collection_modifyitems(self, items): - # separate parametrized setups - items[:] = reorder_items(items) - - def parsefactories(self, node_or_obj, nodeid=NOTSET, unittest=False): - if nodeid is not NOTSET: - holderobj = node_or_obj - else: - holderobj = node_or_obj.obj - nodeid = node_or_obj.nodeid - if holderobj in self._holderobjseen: - return - self._holderobjseen.add(holderobj) - autousenames = [] - for name in dir(holderobj): - # The attribute can be an arbitrary descriptor, so the attribute - # access below can raise. safe_getatt() ignores such exceptions. - obj = safe_getattr(holderobj, name, None) - # fixture functions have a pytest_funcarg__ prefix (pre-2.3 style) - # or are "@pytest.fixture" marked - marker = getfixturemarker(obj) - if marker is None: - if not name.startswith(self._argprefix): - continue - if not callable(obj): - continue - marker = defaultfuncargprefixmarker - from _pytest import deprecated - self.config.warn('C1', deprecated.FUNCARG_PREFIX.format(name=name), nodeid=nodeid) - name = name[len(self._argprefix):] - elif not isinstance(marker, FixtureFunctionMarker): - # magic globals with __getattr__ might have got us a wrong - # fixture attribute - continue - else: - if marker.name: - name = marker.name - msg = 'fixtures cannot have "pytest_funcarg__" prefix ' \ - 'and be decorated with @pytest.fixture:\n%s' % name - assert not name.startswith(self._argprefix), msg - - fixture_def = FixtureDef(self, nodeid, name, obj, - marker.scope, marker.params, - unittest=unittest, ids=marker.ids) - - faclist = self._arg2fixturedefs.setdefault(name, []) - if fixture_def.has_location: - faclist.append(fixture_def) - else: - # fixturedefs with no location are at the front - # so this inserts the current fixturedef after the - # existing fixturedefs from external plugins but - # before the fixturedefs provided in conftests. - i = len([f for f in faclist if not f.has_location]) - faclist.insert(i, fixture_def) - if marker.autouse: - autousenames.append(name) - - if autousenames: - self._nodeid_and_autousenames.append((nodeid or '', autousenames)) - - def getfixturedefs(self, argname, nodeid): - """ - Gets a list of fixtures which are applicable to the given node id. - - :param str argname: name of the fixture to search for - :param str nodeid: full node id of the requesting test. - :return: list[FixtureDef] - """ - try: - fixturedefs = self._arg2fixturedefs[argname] - except KeyError: - return None - else: - return tuple(self._matchfactories(fixturedefs, nodeid)) - - def _matchfactories(self, fixturedefs, nodeid): - for fixturedef in fixturedefs: - if nodes.ischildnode(fixturedef.baseid, nodeid): - yield fixturedef diff --git a/lib/spack/external/_pytest/freeze_support.py b/lib/spack/external/_pytest/freeze_support.py deleted file mode 100644 index 97147a8825..0000000000 --- a/lib/spack/external/_pytest/freeze_support.py +++ /dev/null @@ -1,43 +0,0 @@ -""" -Provides a function to report all internal modules for using freezing tools -pytest -""" -from __future__ import absolute_import, division, print_function - - -def freeze_includes(): - """ - Returns a list of module names used by py.test that should be - included by cx_freeze. - """ - import py - import _pytest - result = list(_iter_all_modules(py)) - result += list(_iter_all_modules(_pytest)) - return result - - -def _iter_all_modules(package, prefix=''): - """ - Iterates over the names of all modules that can be found in the given - package, recursively. - Example: - _iter_all_modules(_pytest) -> - ['_pytest.assertion.newinterpret', - '_pytest.capture', - '_pytest.core', - ... - ] - """ - import os - import pkgutil - if type(package) is not str: - path, prefix = package.__path__[0], package.__name__ + '.' - else: - path = package - for _, name, is_package in pkgutil.iter_modules([path]): - if is_package: - for m in _iter_all_modules(os.path.join(path, name), prefix=name + '.'): - yield prefix + m - else: - yield prefix + name diff --git a/lib/spack/external/_pytest/helpconfig.py b/lib/spack/external/_pytest/helpconfig.py deleted file mode 100644 index e744637f86..0000000000 --- a/lib/spack/external/_pytest/helpconfig.py +++ /dev/null @@ -1,184 +0,0 @@ -""" version info, help messages, tracing configuration. """ -from __future__ import absolute_import, division, print_function - -import py -import pytest -from _pytest.config import PrintHelp -import os -import sys -from argparse import Action - - -class HelpAction(Action): - """This is an argparse Action that will raise an exception in - order to skip the rest of the argument parsing when --help is passed. - This prevents argparse from quitting due to missing required arguments - when any are defined, for example by ``pytest_addoption``. - This is similar to the way that the builtin argparse --help option is - implemented by raising SystemExit. - """ - - def __init__(self, - option_strings, - dest=None, - default=False, - help=None): - super(HelpAction, self).__init__( - option_strings=option_strings, - dest=dest, - const=True, - default=default, - nargs=0, - help=help) - - def __call__(self, parser, namespace, values, option_string=None): - setattr(namespace, self.dest, self.const) - - # We should only skip the rest of the parsing after preparse is done - if getattr(parser._parser, 'after_preparse', False): - raise PrintHelp - - -def pytest_addoption(parser): - group = parser.getgroup('debugconfig') - group.addoption('--version', action="store_true", - help="display pytest lib version and import information.") - group._addoption("-h", "--help", action=HelpAction, dest="help", - help="show help message and configuration info") - group._addoption('-p', action="append", dest="plugins", default=[], - metavar="name", - help="early-load given plugin (multi-allowed). " - "To avoid loading of plugins, use the `no:` prefix, e.g. " - "`no:doctest`.") - group.addoption('--traceconfig', '--trace-config', - action="store_true", default=False, - help="trace considerations of conftest.py files."), - group.addoption('--debug', - action="store_true", dest="debug", default=False, - help="store internal tracing debug information in 'pytestdebug.log'.") - group._addoption( - '-o', '--override-ini', nargs='*', dest="override_ini", - action="append", - help="override config option with option=value style, e.g. `-o xfail_strict=True`.") - - -@pytest.hookimpl(hookwrapper=True) -def pytest_cmdline_parse(): - outcome = yield - config = outcome.get_result() - if config.option.debug: - path = os.path.abspath("pytestdebug.log") - debugfile = open(path, 'w') - debugfile.write("versions pytest-%s, py-%s, " - "python-%s\ncwd=%s\nargs=%s\n\n" % ( - pytest.__version__, py.__version__, - ".".join(map(str, sys.version_info)), - os.getcwd(), config._origargs)) - config.trace.root.setwriter(debugfile.write) - undo_tracing = config.pluginmanager.enable_tracing() - sys.stderr.write("writing pytestdebug information to %s\n" % path) - - def unset_tracing(): - debugfile.close() - sys.stderr.write("wrote pytestdebug information to %s\n" % - debugfile.name) - config.trace.root.setwriter(None) - undo_tracing() - - config.add_cleanup(unset_tracing) - - -def pytest_cmdline_main(config): - if config.option.version: - p = py.path.local(pytest.__file__) - sys.stderr.write("This is pytest version %s, imported from %s\n" % - (pytest.__version__, p)) - plugininfo = getpluginversioninfo(config) - if plugininfo: - for line in plugininfo: - sys.stderr.write(line + "\n") - return 0 - elif config.option.help: - config._do_configure() - showhelp(config) - config._ensure_unconfigure() - return 0 - - -def showhelp(config): - reporter = config.pluginmanager.get_plugin('terminalreporter') - tw = reporter._tw - tw.write(config._parser.optparser.format_help()) - tw.line() - tw.line() - tw.line("[pytest] ini-options in the first " - "pytest.ini|tox.ini|setup.cfg file found:") - tw.line() - - for name in config._parser._ininames: - help, type, default = config._parser._inidict[name] - if type is None: - type = "string" - spec = "%s (%s)" % (name, type) - line = " %-24s %s" % (spec, help) - tw.line(line[:tw.fullwidth]) - - tw.line() - tw.line("environment variables:") - vars = [ - ("PYTEST_ADDOPTS", "extra command line options"), - ("PYTEST_PLUGINS", "comma-separated plugins to load during startup"), - ("PYTEST_DEBUG", "set to enable debug tracing of pytest's internals") - ] - for name, help in vars: - tw.line(" %-24s %s" % (name, help)) - tw.line() - tw.line() - - tw.line("to see available markers type: pytest --markers") - tw.line("to see available fixtures type: pytest --fixtures") - tw.line("(shown according to specified file_or_dir or current dir " - "if not specified)") - - for warningreport in reporter.stats.get('warnings', []): - tw.line("warning : " + warningreport.message, red=True) - return - - -conftest_options = [ - ('pytest_plugins', 'list of plugin names to load'), -] - - -def getpluginversioninfo(config): - lines = [] - plugininfo = config.pluginmanager.list_plugin_distinfo() - if plugininfo: - lines.append("setuptools registered plugins:") - for plugin, dist in plugininfo: - loc = getattr(plugin, '__file__', repr(plugin)) - content = "%s-%s at %s" % (dist.project_name, dist.version, loc) - lines.append(" " + content) - return lines - - -def pytest_report_header(config): - lines = [] - if config.option.debug or config.option.traceconfig: - lines.append("using: pytest-%s pylib-%s" % - (pytest.__version__, py.__version__)) - - verinfo = getpluginversioninfo(config) - if verinfo: - lines.extend(verinfo) - - if config.option.traceconfig: - lines.append("active plugins:") - items = config.pluginmanager.list_name_plugin() - for name, plugin in items: - if hasattr(plugin, '__file__'): - r = plugin.__file__ - else: - r = repr(plugin) - lines.append(" %-20s: %s" % (name, r)) - return lines diff --git a/lib/spack/external/_pytest/hookspec.py b/lib/spack/external/_pytest/hookspec.py deleted file mode 100644 index e5c966e58b..0000000000 --- a/lib/spack/external/_pytest/hookspec.py +++ /dev/null @@ -1,423 +0,0 @@ -""" hook specifications for pytest plugins, invoked from main.py and builtin plugins. """ - -from _pytest._pluggy import HookspecMarker - -hookspec = HookspecMarker("pytest") - -# ------------------------------------------------------------------------- -# Initialization hooks called for every plugin -# ------------------------------------------------------------------------- - - -@hookspec(historic=True) -def pytest_addhooks(pluginmanager): - """called at plugin registration time to allow adding new hooks via a call to - pluginmanager.add_hookspecs(module_or_class, prefix).""" - - -@hookspec(historic=True) -def pytest_namespace(): - """ - DEPRECATED: this hook causes direct monkeypatching on pytest, its use is strongly discouraged - return dict of name->object to be made globally available in - the pytest namespace. This hook is called at plugin registration - time. - """ - - -@hookspec(historic=True) -def pytest_plugin_registered(plugin, manager): - """ a new pytest plugin got registered. """ - - -@hookspec(historic=True) -def pytest_addoption(parser): - """register argparse-style options and ini-style config values, - called once at the beginning of a test run. - - .. note:: - - This function should be implemented only in plugins or ``conftest.py`` - files situated at the tests root directory due to how pytest - :ref:`discovers plugins during startup `. - - :arg parser: To add command line options, call - :py:func:`parser.addoption(...) <_pytest.config.Parser.addoption>`. - To add ini-file values call :py:func:`parser.addini(...) - <_pytest.config.Parser.addini>`. - - Options can later be accessed through the - :py:class:`config <_pytest.config.Config>` object, respectively: - - - :py:func:`config.getoption(name) <_pytest.config.Config.getoption>` to - retrieve the value of a command line option. - - - :py:func:`config.getini(name) <_pytest.config.Config.getini>` to retrieve - a value read from an ini-style file. - - The config object is passed around on many internal objects via the ``.config`` - attribute or can be retrieved as the ``pytestconfig`` fixture or accessed - via (deprecated) ``pytest.config``. - """ - - -@hookspec(historic=True) -def pytest_configure(config): - """ - Allows plugins and conftest files to perform initial configuration. - - This hook is called for every plugin and initial conftest file - after command line options have been parsed. - - After that, the hook is called for other conftest files as they are - imported. - - :arg config: pytest config object - :type config: _pytest.config.Config - """ - -# ------------------------------------------------------------------------- -# Bootstrapping hooks called for plugins registered early enough: -# internal and 3rd party plugins as well as directly -# discoverable conftest.py local plugins. -# ------------------------------------------------------------------------- - - -@hookspec(firstresult=True) -def pytest_cmdline_parse(pluginmanager, args): - """return initialized config object, parsing the specified args. - - Stops at first non-None result, see :ref:`firstresult` """ - - -def pytest_cmdline_preparse(config, args): - """(deprecated) modify command line arguments before option parsing. """ - - -@hookspec(firstresult=True) -def pytest_cmdline_main(config): - """ called for performing the main command line action. The default - implementation will invoke the configure hooks and runtest_mainloop. - - Stops at first non-None result, see :ref:`firstresult` """ - - -def pytest_load_initial_conftests(early_config, parser, args): - """ implements the loading of initial conftest files ahead - of command line option parsing. """ - - -# ------------------------------------------------------------------------- -# collection hooks -# ------------------------------------------------------------------------- - -@hookspec(firstresult=True) -def pytest_collection(session): - """ perform the collection protocol for the given session. - - Stops at first non-None result, see :ref:`firstresult` """ - - -def pytest_collection_modifyitems(session, config, items): - """ called after collection has been performed, may filter or re-order - the items in-place.""" - - -def pytest_collection_finish(session): - """ called after collection has been performed and modified. """ - - -@hookspec(firstresult=True) -def pytest_ignore_collect(path, config): - """ return True to prevent considering this path for collection. - This hook is consulted for all files and directories prior to calling - more specific hooks. - - Stops at first non-None result, see :ref:`firstresult` - """ - - -@hookspec(firstresult=True) -def pytest_collect_directory(path, parent): - """ called before traversing a directory for collection files. - - Stops at first non-None result, see :ref:`firstresult` """ - - -def pytest_collect_file(path, parent): - """ return collection Node or None for the given path. Any new node - needs to have the specified ``parent`` as a parent.""" - -# logging hooks for collection - - -def pytest_collectstart(collector): - """ collector starts collecting. """ - - -def pytest_itemcollected(item): - """ we just collected a test item. """ - - -def pytest_collectreport(report): - """ collector finished collecting. """ - - -def pytest_deselected(items): - """ called for test items deselected by keyword. """ - - -@hookspec(firstresult=True) -def pytest_make_collect_report(collector): - """ perform ``collector.collect()`` and return a CollectReport. - - Stops at first non-None result, see :ref:`firstresult` """ - -# ------------------------------------------------------------------------- -# Python test function related hooks -# ------------------------------------------------------------------------- - - -@hookspec(firstresult=True) -def pytest_pycollect_makemodule(path, parent): - """ return a Module collector or None for the given path. - This hook will be called for each matching test module path. - The pytest_collect_file hook needs to be used if you want to - create test modules for files that do not match as a test module. - - Stops at first non-None result, see :ref:`firstresult` """ - - -@hookspec(firstresult=True) -def pytest_pycollect_makeitem(collector, name, obj): - """ return custom item/collector for a python object in a module, or None. - - Stops at first non-None result, see :ref:`firstresult` """ - - -@hookspec(firstresult=True) -def pytest_pyfunc_call(pyfuncitem): - """ call underlying test function. - - Stops at first non-None result, see :ref:`firstresult` """ - - -def pytest_generate_tests(metafunc): - """ generate (multiple) parametrized calls to a test function.""" - - -@hookspec(firstresult=True) -def pytest_make_parametrize_id(config, val, argname): - """Return a user-friendly string representation of the given ``val`` that will be used - by @pytest.mark.parametrize calls. Return None if the hook doesn't know about ``val``. - The parameter name is available as ``argname``, if required. - - Stops at first non-None result, see :ref:`firstresult` """ - -# ------------------------------------------------------------------------- -# generic runtest related hooks -# ------------------------------------------------------------------------- - - -@hookspec(firstresult=True) -def pytest_runtestloop(session): - """ called for performing the main runtest loop - (after collection finished). - - Stops at first non-None result, see :ref:`firstresult` """ - - -def pytest_itemstart(item, node): - """ (deprecated, use pytest_runtest_logstart). """ - - -@hookspec(firstresult=True) -def pytest_runtest_protocol(item, nextitem): - """ implements the runtest_setup/call/teardown protocol for - the given test item, including capturing exceptions and calling - reporting hooks. - - :arg item: test item for which the runtest protocol is performed. - - :arg nextitem: the scheduled-to-be-next test item (or None if this - is the end my friend). This argument is passed on to - :py:func:`pytest_runtest_teardown`. - - :return boolean: True if no further hook implementations should be invoked. - - - Stops at first non-None result, see :ref:`firstresult` """ - - -def pytest_runtest_logstart(nodeid, location): - """ signal the start of running a single test item. """ - - -def pytest_runtest_setup(item): - """ called before ``pytest_runtest_call(item)``. """ - - -def pytest_runtest_call(item): - """ called to execute the test ``item``. """ - - -def pytest_runtest_teardown(item, nextitem): - """ called after ``pytest_runtest_call``. - - :arg nextitem: the scheduled-to-be-next test item (None if no further - test item is scheduled). This argument can be used to - perform exact teardowns, i.e. calling just enough finalizers - so that nextitem only needs to call setup-functions. - """ - - -@hookspec(firstresult=True) -def pytest_runtest_makereport(item, call): - """ return a :py:class:`_pytest.runner.TestReport` object - for the given :py:class:`pytest.Item <_pytest.main.Item>` and - :py:class:`_pytest.runner.CallInfo`. - - Stops at first non-None result, see :ref:`firstresult` """ - - -def pytest_runtest_logreport(report): - """ process a test setup/call/teardown report relating to - the respective phase of executing a test. """ - -# ------------------------------------------------------------------------- -# Fixture related hooks -# ------------------------------------------------------------------------- - - -@hookspec(firstresult=True) -def pytest_fixture_setup(fixturedef, request): - """ performs fixture setup execution. - - Stops at first non-None result, see :ref:`firstresult` """ - - -def pytest_fixture_post_finalizer(fixturedef): - """ called after fixture teardown, but before the cache is cleared so - the fixture result cache ``fixturedef.cached_result`` can - still be accessed.""" - -# ------------------------------------------------------------------------- -# test session related hooks -# ------------------------------------------------------------------------- - - -def pytest_sessionstart(session): - """ before session.main() is called. """ - - -def pytest_sessionfinish(session, exitstatus): - """ whole test run finishes. """ - - -def pytest_unconfigure(config): - """ called before test process is exited. """ - - -# ------------------------------------------------------------------------- -# hooks for customizing the assert methods -# ------------------------------------------------------------------------- - -def pytest_assertrepr_compare(config, op, left, right): - """return explanation for comparisons in failing assert expressions. - - Return None for no custom explanation, otherwise return a list - of strings. The strings will be joined by newlines but any newlines - *in* a string will be escaped. Note that all but the first line will - be indented slightly, the intention is for the first line to be a summary. - """ - -# ------------------------------------------------------------------------- -# hooks for influencing reporting (invoked from _pytest_terminal) -# ------------------------------------------------------------------------- - - -def pytest_report_header(config, startdir): - """ return a string or list of strings to be displayed as header info for terminal reporting. - - :param config: the pytest config object. - :param startdir: py.path object with the starting dir - - .. note:: - - This function should be implemented only in plugins or ``conftest.py`` - files situated at the tests root directory due to how pytest - :ref:`discovers plugins during startup `. - """ - - -def pytest_report_collectionfinish(config, startdir, items): - """ - .. versionadded:: 3.2 - - return a string or list of strings to be displayed after collection has finished successfully. - - This strings will be displayed after the standard "collected X items" message. - - :param config: the pytest config object. - :param startdir: py.path object with the starting dir - :param items: list of pytest items that are going to be executed; this list should not be modified. - """ - - -@hookspec(firstresult=True) -def pytest_report_teststatus(report): - """ return result-category, shortletter and verbose word for reporting. - - Stops at first non-None result, see :ref:`firstresult` """ - - -def pytest_terminal_summary(terminalreporter, exitstatus): - """ add additional section in terminal summary reporting. """ - - -@hookspec(historic=True) -def pytest_logwarning(message, code, nodeid, fslocation): - """ process a warning specified by a message, a code string, - a nodeid and fslocation (both of which may be None - if the warning is not tied to a partilar node/location).""" - -# ------------------------------------------------------------------------- -# doctest hooks -# ------------------------------------------------------------------------- - - -@hookspec(firstresult=True) -def pytest_doctest_prepare_content(content): - """ return processed content for a given doctest - - Stops at first non-None result, see :ref:`firstresult` """ - -# ------------------------------------------------------------------------- -# error handling and internal debugging hooks -# ------------------------------------------------------------------------- - - -def pytest_internalerror(excrepr, excinfo): - """ called for internal errors. """ - - -def pytest_keyboard_interrupt(excinfo): - """ called for keyboard interrupt. """ - - -def pytest_exception_interact(node, call, report): - """called when an exception was raised which can potentially be - interactively handled. - - This hook is only called if an exception was raised - that is not an internal exception like ``skip.Exception``. - """ - - -def pytest_enter_pdb(config): - """ called upon pdb.set_trace(), can be used by plugins to take special - action just before the python debugger enters in interactive mode. - - :arg config: pytest config object - :type config: _pytest.config.Config - """ diff --git a/lib/spack/external/_pytest/junitxml.py b/lib/spack/external/_pytest/junitxml.py deleted file mode 100644 index 7fb40dc354..0000000000 --- a/lib/spack/external/_pytest/junitxml.py +++ /dev/null @@ -1,453 +0,0 @@ -""" - report test results in JUnit-XML format, - for use with Jenkins and build integration servers. - - -Based on initial code from Ross Lawley. - -Output conforms to https://github.com/jenkinsci/xunit-plugin/blob/master/ -src/main/resources/org/jenkinsci/plugins/xunit/types/model/xsd/junit-10.xsd -""" -from __future__ import absolute_import, division, print_function - -import functools -import py -import os -import re -import sys -import time -import pytest -from _pytest import nodes -from _pytest.config import filename_arg - -# Python 2.X and 3.X compatibility -if sys.version_info[0] < 3: - from codecs import open -else: - unichr = chr - unicode = str - long = int - - -class Junit(py.xml.Namespace): - pass - - -# We need to get the subset of the invalid unicode ranges according to -# XML 1.0 which are valid in this python build. Hence we calculate -# this dynamically instead of hardcoding it. The spec range of valid -# chars is: Char ::= #x9 | #xA | #xD | [#x20-#xD7FF] | [#xE000-#xFFFD] -# | [#x10000-#x10FFFF] -_legal_chars = (0x09, 0x0A, 0x0d) -_legal_ranges = ( - (0x20, 0x7E), (0x80, 0xD7FF), (0xE000, 0xFFFD), (0x10000, 0x10FFFF), -) -_legal_xml_re = [ - unicode("%s-%s") % (unichr(low), unichr(high)) - for (low, high) in _legal_ranges if low < sys.maxunicode -] -_legal_xml_re = [unichr(x) for x in _legal_chars] + _legal_xml_re -illegal_xml_re = re.compile(unicode('[^%s]') % unicode('').join(_legal_xml_re)) -del _legal_chars -del _legal_ranges -del _legal_xml_re - -_py_ext_re = re.compile(r"\.py$") - - -def bin_xml_escape(arg): - def repl(matchobj): - i = ord(matchobj.group()) - if i <= 0xFF: - return unicode('#x%02X') % i - else: - return unicode('#x%04X') % i - - return py.xml.raw(illegal_xml_re.sub(repl, py.xml.escape(arg))) - - -class _NodeReporter(object): - def __init__(self, nodeid, xml): - - self.id = nodeid - self.xml = xml - self.add_stats = self.xml.add_stats - self.duration = 0 - self.properties = [] - self.nodes = [] - self.testcase = None - self.attrs = {} - - def append(self, node): - self.xml.add_stats(type(node).__name__) - self.nodes.append(node) - - def add_property(self, name, value): - self.properties.append((str(name), bin_xml_escape(value))) - - def make_properties_node(self): - """Return a Junit node containing custom properties, if any. - """ - if self.properties: - return Junit.properties([ - Junit.property(name=name, value=value) - for name, value in self.properties - ]) - return '' - - def record_testreport(self, testreport): - assert not self.testcase - names = mangle_test_address(testreport.nodeid) - classnames = names[:-1] - if self.xml.prefix: - classnames.insert(0, self.xml.prefix) - attrs = { - "classname": ".".join(classnames), - "name": bin_xml_escape(names[-1]), - "file": testreport.location[0], - } - if testreport.location[1] is not None: - attrs["line"] = testreport.location[1] - if hasattr(testreport, "url"): - attrs["url"] = testreport.url - self.attrs = attrs - - def to_xml(self): - testcase = Junit.testcase(time=self.duration, **self.attrs) - testcase.append(self.make_properties_node()) - for node in self.nodes: - testcase.append(node) - return testcase - - def _add_simple(self, kind, message, data=None): - data = bin_xml_escape(data) - node = kind(data, message=message) - self.append(node) - - def write_captured_output(self, report): - for capname in ('out', 'err'): - content = getattr(report, 'capstd' + capname) - if content: - tag = getattr(Junit, 'system-' + capname) - self.append(tag(bin_xml_escape(content))) - - def append_pass(self, report): - self.add_stats('passed') - - def append_failure(self, report): - # msg = str(report.longrepr.reprtraceback.extraline) - if hasattr(report, "wasxfail"): - self._add_simple( - Junit.skipped, - "xfail-marked test passes unexpectedly") - else: - if hasattr(report.longrepr, "reprcrash"): - message = report.longrepr.reprcrash.message - elif isinstance(report.longrepr, (unicode, str)): - message = report.longrepr - else: - message = str(report.longrepr) - message = bin_xml_escape(message) - fail = Junit.failure(message=message) - fail.append(bin_xml_escape(report.longrepr)) - self.append(fail) - - def append_collect_error(self, report): - # msg = str(report.longrepr.reprtraceback.extraline) - self.append(Junit.error(bin_xml_escape(report.longrepr), - message="collection failure")) - - def append_collect_skipped(self, report): - self._add_simple( - Junit.skipped, "collection skipped", report.longrepr) - - def append_error(self, report): - if getattr(report, 'when', None) == 'teardown': - msg = "test teardown failure" - else: - msg = "test setup failure" - self._add_simple( - Junit.error, msg, report.longrepr) - - def append_skipped(self, report): - if hasattr(report, "wasxfail"): - self._add_simple( - Junit.skipped, "expected test failure", report.wasxfail - ) - else: - filename, lineno, skipreason = report.longrepr - if skipreason.startswith("Skipped: "): - skipreason = bin_xml_escape(skipreason[9:]) - self.append( - Junit.skipped("%s:%s: %s" % (filename, lineno, skipreason), - type="pytest.skip", - message=skipreason)) - self.write_captured_output(report) - - def finalize(self): - data = self.to_xml().unicode(indent=0) - self.__dict__.clear() - self.to_xml = lambda: py.xml.raw(data) - - -@pytest.fixture -def record_xml_property(request): - """Add extra xml properties to the tag for the calling test. - The fixture is callable with ``(name, value)``, with value being automatically - xml-encoded. - """ - request.node.warn( - code='C3', - message='record_xml_property is an experimental feature', - ) - xml = getattr(request.config, "_xml", None) - if xml is not None: - node_reporter = xml.node_reporter(request.node.nodeid) - return node_reporter.add_property - else: - def add_property_noop(name, value): - pass - - return add_property_noop - - -def pytest_addoption(parser): - group = parser.getgroup("terminal reporting") - group.addoption( - '--junitxml', '--junit-xml', - action="store", - dest="xmlpath", - metavar="path", - type=functools.partial(filename_arg, optname="--junitxml"), - default=None, - help="create junit-xml style report file at given path.") - group.addoption( - '--junitprefix', '--junit-prefix', - action="store", - metavar="str", - default=None, - help="prepend prefix to classnames in junit-xml output") - parser.addini("junit_suite_name", "Test suite name for JUnit report", default="pytest") - - -def pytest_configure(config): - xmlpath = config.option.xmlpath - # prevent opening xmllog on slave nodes (xdist) - if xmlpath and not hasattr(config, 'slaveinput'): - config._xml = LogXML(xmlpath, config.option.junitprefix, config.getini("junit_suite_name")) - config.pluginmanager.register(config._xml) - - -def pytest_unconfigure(config): - xml = getattr(config, '_xml', None) - if xml: - del config._xml - config.pluginmanager.unregister(xml) - - -def mangle_test_address(address): - path, possible_open_bracket, params = address.partition('[') - names = path.split("::") - try: - names.remove('()') - except ValueError: - pass - # convert file path to dotted path - names[0] = names[0].replace(nodes.SEP, '.') - names[0] = _py_ext_re.sub("", names[0]) - # put any params back - names[-1] += possible_open_bracket + params - return names - - -class LogXML(object): - def __init__(self, logfile, prefix, suite_name="pytest"): - logfile = os.path.expanduser(os.path.expandvars(logfile)) - self.logfile = os.path.normpath(os.path.abspath(logfile)) - self.prefix = prefix - self.suite_name = suite_name - self.stats = dict.fromkeys([ - 'error', - 'passed', - 'failure', - 'skipped', - ], 0) - self.node_reporters = {} # nodeid -> _NodeReporter - self.node_reporters_ordered = [] - self.global_properties = [] - # List of reports that failed on call but teardown is pending. - self.open_reports = [] - self.cnt_double_fail_tests = 0 - - def finalize(self, report): - nodeid = getattr(report, 'nodeid', report) - # local hack to handle xdist report order - slavenode = getattr(report, 'node', None) - reporter = self.node_reporters.pop((nodeid, slavenode)) - if reporter is not None: - reporter.finalize() - - def node_reporter(self, report): - nodeid = getattr(report, 'nodeid', report) - # local hack to handle xdist report order - slavenode = getattr(report, 'node', None) - - key = nodeid, slavenode - - if key in self.node_reporters: - # TODO: breasks for --dist=each - return self.node_reporters[key] - - reporter = _NodeReporter(nodeid, self) - - self.node_reporters[key] = reporter - self.node_reporters_ordered.append(reporter) - - return reporter - - def add_stats(self, key): - if key in self.stats: - self.stats[key] += 1 - - def _opentestcase(self, report): - reporter = self.node_reporter(report) - reporter.record_testreport(report) - return reporter - - def pytest_runtest_logreport(self, report): - """handle a setup/call/teardown report, generating the appropriate - xml tags as necessary. - - note: due to plugins like xdist, this hook may be called in interlaced - order with reports from other nodes. for example: - - usual call order: - -> setup node1 - -> call node1 - -> teardown node1 - -> setup node2 - -> call node2 - -> teardown node2 - - possible call order in xdist: - -> setup node1 - -> call node1 - -> setup node2 - -> call node2 - -> teardown node2 - -> teardown node1 - """ - close_report = None - if report.passed: - if report.when == "call": # ignore setup/teardown - reporter = self._opentestcase(report) - reporter.append_pass(report) - elif report.failed: - if report.when == "teardown": - # The following vars are needed when xdist plugin is used - report_wid = getattr(report, "worker_id", None) - report_ii = getattr(report, "item_index", None) - close_report = next( - (rep for rep in self.open_reports - if (rep.nodeid == report.nodeid and - getattr(rep, "item_index", None) == report_ii and - getattr(rep, "worker_id", None) == report_wid - ) - ), None) - if close_report: - # We need to open new testcase in case we have failure in - # call and error in teardown in order to follow junit - # schema - self.finalize(close_report) - self.cnt_double_fail_tests += 1 - reporter = self._opentestcase(report) - if report.when == "call": - reporter.append_failure(report) - self.open_reports.append(report) - else: - reporter.append_error(report) - elif report.skipped: - reporter = self._opentestcase(report) - reporter.append_skipped(report) - self.update_testcase_duration(report) - if report.when == "teardown": - reporter = self._opentestcase(report) - reporter.write_captured_output(report) - self.finalize(report) - report_wid = getattr(report, "worker_id", None) - report_ii = getattr(report, "item_index", None) - close_report = next( - (rep for rep in self.open_reports - if (rep.nodeid == report.nodeid and - getattr(rep, "item_index", None) == report_ii and - getattr(rep, "worker_id", None) == report_wid - ) - ), None) - if close_report: - self.open_reports.remove(close_report) - - def update_testcase_duration(self, report): - """accumulates total duration for nodeid from given report and updates - the Junit.testcase with the new total if already created. - """ - reporter = self.node_reporter(report) - reporter.duration += getattr(report, 'duration', 0.0) - - def pytest_collectreport(self, report): - if not report.passed: - reporter = self._opentestcase(report) - if report.failed: - reporter.append_collect_error(report) - else: - reporter.append_collect_skipped(report) - - def pytest_internalerror(self, excrepr): - reporter = self.node_reporter('internal') - reporter.attrs.update(classname="pytest", name='internal') - reporter._add_simple(Junit.error, 'internal error', excrepr) - - def pytest_sessionstart(self): - self.suite_start_time = time.time() - - def pytest_sessionfinish(self): - dirname = os.path.dirname(os.path.abspath(self.logfile)) - if not os.path.isdir(dirname): - os.makedirs(dirname) - logfile = open(self.logfile, 'w', encoding='utf-8') - suite_stop_time = time.time() - suite_time_delta = suite_stop_time - self.suite_start_time - - numtests = (self.stats['passed'] + self.stats['failure'] + - self.stats['skipped'] + self.stats['error'] - - self.cnt_double_fail_tests) - logfile.write('') - - logfile.write(Junit.testsuite( - self._get_global_properties_node(), - [x.to_xml() for x in self.node_reporters_ordered], - name=self.suite_name, - errors=self.stats['error'], - failures=self.stats['failure'], - skips=self.stats['skipped'], - tests=numtests, - time="%.3f" % suite_time_delta, ).unicode(indent=0)) - logfile.close() - - def pytest_terminal_summary(self, terminalreporter): - terminalreporter.write_sep("-", - "generated xml file: %s" % (self.logfile)) - - def add_global_property(self, name, value): - self.global_properties.append((str(name), bin_xml_escape(value))) - - def _get_global_properties_node(self): - """Return a Junit node containing custom properties, if any. - """ - if self.global_properties: - return Junit.properties( - [ - Junit.property(name=name, value=value) - for name, value in self.global_properties - ] - ) - return '' diff --git a/lib/spack/external/_pytest/main.py b/lib/spack/external/_pytest/main.py deleted file mode 100644 index 98aa28eb34..0000000000 --- a/lib/spack/external/_pytest/main.py +++ /dev/null @@ -1,838 +0,0 @@ -""" core implementation of testing process: init, session, runtest loop. """ -from __future__ import absolute_import, division, print_function - -import functools -import os -import sys - -import _pytest -from _pytest import nodes -import _pytest._code -import py -try: - from collections.abc import MutableMapping as MappingMixin -except ImportError: - try: - from collections import MutableMapping as MappingMixin - except ImportError: - from UserDict import DictMixin as MappingMixin - -from _pytest.config import directory_arg, UsageError, hookimpl -from _pytest.outcomes import exit -from _pytest.runner import collect_one_node - -tracebackcutdir = py.path.local(_pytest.__file__).dirpath() - -# exitcodes for the command line -EXIT_OK = 0 -EXIT_TESTSFAILED = 1 -EXIT_INTERRUPTED = 2 -EXIT_INTERNALERROR = 3 -EXIT_USAGEERROR = 4 -EXIT_NOTESTSCOLLECTED = 5 - - -def pytest_addoption(parser): - parser.addini("norecursedirs", "directory patterns to avoid for recursion", - type="args", default=['.*', 'build', 'dist', 'CVS', '_darcs', '{arch}', '*.egg', 'venv']) - parser.addini("testpaths", "directories to search for tests when no files or directories are given in the " - "command line.", - type="args", default=[]) - # parser.addini("dirpatterns", - # "patterns specifying possible locations of test files", - # type="linelist", default=["**/test_*.txt", - # "**/test_*.py", "**/*_test.py"] - # ) - group = parser.getgroup("general", "running and selection options") - group._addoption('-x', '--exitfirst', action="store_const", - dest="maxfail", const=1, - help="exit instantly on first error or failed test."), - group._addoption('--maxfail', metavar="num", - action="store", type=int, dest="maxfail", default=0, - help="exit after first num failures or errors.") - group._addoption('--strict', action="store_true", - help="marks not registered in configuration file raise errors.") - group._addoption("-c", metavar="file", type=str, dest="inifilename", - help="load configuration from `file` instead of trying to locate one of the implicit " - "configuration files.") - group._addoption("--continue-on-collection-errors", action="store_true", - default=False, dest="continue_on_collection_errors", - help="Force test execution even if collection errors occur.") - - group = parser.getgroup("collect", "collection") - group.addoption('--collectonly', '--collect-only', action="store_true", - help="only collect tests, don't execute them."), - group.addoption('--pyargs', action="store_true", - help="try to interpret all arguments as python packages.") - group.addoption("--ignore", action="append", metavar="path", - help="ignore path during collection (multi-allowed).") - # when changing this to --conf-cut-dir, config.py Conftest.setinitial - # needs upgrading as well - group.addoption('--confcutdir', dest="confcutdir", default=None, - metavar="dir", type=functools.partial(directory_arg, optname="--confcutdir"), - help="only load conftest.py's relative to specified dir.") - group.addoption('--noconftest', action="store_true", - dest="noconftest", default=False, - help="Don't load any conftest.py files.") - group.addoption('--keepduplicates', '--keep-duplicates', action="store_true", - dest="keepduplicates", default=False, - help="Keep duplicate tests.") - group.addoption('--collect-in-virtualenv', action='store_true', - dest='collect_in_virtualenv', default=False, - help="Don't ignore tests in a local virtualenv directory") - - group = parser.getgroup("debugconfig", - "test session debugging and configuration") - group.addoption('--basetemp', dest="basetemp", default=None, metavar="dir", - help="base temporary directory for this test run.") - - -def pytest_namespace(): - """keeping this one works around a deeper startup issue in pytest - - i tried to find it for a while but the amount of time turned unsustainable, - so i put a hack in to revisit later - """ - return {} - - -def pytest_configure(config): - __import__('pytest').config = config # compatibiltiy - - -def wrap_session(config, doit): - """Skeleton command line program""" - session = Session(config) - session.exitstatus = EXIT_OK - initstate = 0 - try: - try: - config._do_configure() - initstate = 1 - config.hook.pytest_sessionstart(session=session) - initstate = 2 - session.exitstatus = doit(config, session) or 0 - except UsageError: - raise - except KeyboardInterrupt: - excinfo = _pytest._code.ExceptionInfo() - if initstate < 2 and isinstance(excinfo.value, exit.Exception): - sys.stderr.write('{0}: {1}\n'.format( - excinfo.typename, excinfo.value.msg)) - config.hook.pytest_keyboard_interrupt(excinfo=excinfo) - session.exitstatus = EXIT_INTERRUPTED - except: # noqa - excinfo = _pytest._code.ExceptionInfo() - config.notify_exception(excinfo, config.option) - session.exitstatus = EXIT_INTERNALERROR - if excinfo.errisinstance(SystemExit): - sys.stderr.write("mainloop: caught Spurious SystemExit!\n") - - finally: - excinfo = None # Explicitly break reference cycle. - session.startdir.chdir() - if initstate >= 2: - config.hook.pytest_sessionfinish( - session=session, - exitstatus=session.exitstatus) - config._ensure_unconfigure() - return session.exitstatus - - -def pytest_cmdline_main(config): - return wrap_session(config, _main) - - -def _main(config, session): - """ default command line protocol for initialization, session, - running tests and reporting. """ - config.hook.pytest_collection(session=session) - config.hook.pytest_runtestloop(session=session) - - if session.testsfailed: - return EXIT_TESTSFAILED - elif session.testscollected == 0: - return EXIT_NOTESTSCOLLECTED - - -def pytest_collection(session): - return session.perform_collect() - - -def pytest_runtestloop(session): - if (session.testsfailed and - not session.config.option.continue_on_collection_errors): - raise session.Interrupted( - "%d errors during collection" % session.testsfailed) - - if session.config.option.collectonly: - return True - - for i, item in enumerate(session.items): - nextitem = session.items[i + 1] if i + 1 < len(session.items) else None - item.config.hook.pytest_runtest_protocol(item=item, nextitem=nextitem) - if session.shouldstop: - raise session.Interrupted(session.shouldstop) - return True - - -def _in_venv(path): - """Attempts to detect if ``path`` is the root of a Virtual Environment by - checking for the existence of the appropriate activate script""" - bindir = path.join('Scripts' if sys.platform.startswith('win') else 'bin') - if not bindir.exists(): - return False - activates = ('activate', 'activate.csh', 'activate.fish', - 'Activate', 'Activate.bat', 'Activate.ps1') - return any([fname.basename in activates for fname in bindir.listdir()]) - - -def pytest_ignore_collect(path, config): - ignore_paths = config._getconftest_pathlist("collect_ignore", path=path.dirpath()) - ignore_paths = ignore_paths or [] - excludeopt = config.getoption("ignore") - if excludeopt: - ignore_paths.extend([py.path.local(x) for x in excludeopt]) - - if py.path.local(path) in ignore_paths: - return True - - allow_in_venv = config.getoption("collect_in_virtualenv") - if _in_venv(path) and not allow_in_venv: - return True - - # Skip duplicate paths. - keepduplicates = config.getoption("keepduplicates") - duplicate_paths = config.pluginmanager._duplicatepaths - if not keepduplicates: - if path in duplicate_paths: - return True - else: - duplicate_paths.add(path) - - return False - - -class FSHookProxy: - def __init__(self, fspath, pm, remove_mods): - self.fspath = fspath - self.pm = pm - self.remove_mods = remove_mods - - def __getattr__(self, name): - x = self.pm.subset_hook_caller(name, remove_plugins=self.remove_mods) - self.__dict__[name] = x - return x - - -class _CompatProperty(object): - def __init__(self, name): - self.name = name - - def __get__(self, obj, owner): - if obj is None: - return self - - # TODO: reenable in the features branch - # warnings.warn( - # "usage of {owner!r}.{name} is deprecated, please use pytest.{name} instead".format( - # name=self.name, owner=type(owner).__name__), - # PendingDeprecationWarning, stacklevel=2) - return getattr(__import__('pytest'), self.name) - - -class NodeKeywords(MappingMixin): - def __init__(self, node): - self.node = node - self.parent = node.parent - self._markers = {node.name: True} - - def __getitem__(self, key): - try: - return self._markers[key] - except KeyError: - if self.parent is None: - raise - return self.parent.keywords[key] - - def __setitem__(self, key, value): - self._markers[key] = value - - def __delitem__(self, key): - raise ValueError("cannot delete key in keywords dict") - - def __iter__(self): - seen = set(self._markers) - if self.parent is not None: - seen.update(self.parent.keywords) - return iter(seen) - - def __len__(self): - return len(self.__iter__()) - - def keys(self): - return list(self) - - def __repr__(self): - return "" % (self.node, ) - - -class Node(object): - """ base class for Collector and Item the test collection tree. - Collector subclasses have children, Items are terminal nodes.""" - - def __init__(self, name, parent=None, config=None, session=None): - #: a unique name within the scope of the parent node - self.name = name - - #: the parent collector node. - self.parent = parent - - #: the pytest config object - self.config = config or parent.config - - #: the session this node is part of - self.session = session or parent.session - - #: filesystem path where this node was collected from (can be None) - self.fspath = getattr(parent, 'fspath', None) - - #: keywords/markers collected from all scopes - self.keywords = NodeKeywords(self) - - #: allow adding of extra keywords to use for matching - self.extra_keyword_matches = set() - - # used for storing artificial fixturedefs for direct parametrization - self._name2pseudofixturedef = {} - - @property - def ihook(self): - """ fspath sensitive hook proxy used to call pytest hooks""" - return self.session.gethookproxy(self.fspath) - - Module = _CompatProperty("Module") - Class = _CompatProperty("Class") - Instance = _CompatProperty("Instance") - Function = _CompatProperty("Function") - File = _CompatProperty("File") - Item = _CompatProperty("Item") - - def _getcustomclass(self, name): - maybe_compatprop = getattr(type(self), name) - if isinstance(maybe_compatprop, _CompatProperty): - return getattr(__import__('pytest'), name) - else: - cls = getattr(self, name) - # TODO: reenable in the features branch - # warnings.warn("use of node.%s is deprecated, " - # "use pytest_pycollect_makeitem(...) to create custom " - # "collection nodes" % name, category=DeprecationWarning) - return cls - - def __repr__(self): - return "<%s %r>" % (self.__class__.__name__, - getattr(self, 'name', None)) - - def warn(self, code, message): - """ generate a warning with the given code and message for this - item. """ - assert isinstance(code, str) - fslocation = getattr(self, "location", None) - if fslocation is None: - fslocation = getattr(self, "fspath", None) - self.ihook.pytest_logwarning.call_historic(kwargs=dict( - code=code, message=message, - nodeid=self.nodeid, fslocation=fslocation)) - - # methods for ordering nodes - @property - def nodeid(self): - """ a ::-separated string denoting its collection tree address. """ - try: - return self._nodeid - except AttributeError: - self._nodeid = x = self._makeid() - return x - - def _makeid(self): - return self.parent.nodeid + "::" + self.name - - def __hash__(self): - return hash(self.nodeid) - - def setup(self): - pass - - def teardown(self): - pass - - def _memoizedcall(self, attrname, function): - exattrname = "_ex_" + attrname - failure = getattr(self, exattrname, None) - if failure is not None: - py.builtin._reraise(failure[0], failure[1], failure[2]) - if hasattr(self, attrname): - return getattr(self, attrname) - try: - res = function() - except py.builtin._sysex: - raise - except: # noqa - failure = sys.exc_info() - setattr(self, exattrname, failure) - raise - setattr(self, attrname, res) - return res - - def listchain(self): - """ return list of all parent collectors up to self, - starting from root of collection tree. """ - chain = [] - item = self - while item is not None: - chain.append(item) - item = item.parent - chain.reverse() - return chain - - def add_marker(self, marker): - """ dynamically add a marker object to the node. - - ``marker`` can be a string or pytest.mark.* instance. - """ - from _pytest.mark import MarkDecorator, MARK_GEN - if isinstance(marker, py.builtin._basestring): - marker = getattr(MARK_GEN, marker) - elif not isinstance(marker, MarkDecorator): - raise ValueError("is not a string or pytest.mark.* Marker") - self.keywords[marker.name] = marker - - def get_marker(self, name): - """ get a marker object from this node or None if - the node doesn't have a marker with that name. """ - val = self.keywords.get(name, None) - if val is not None: - from _pytest.mark import MarkInfo, MarkDecorator - if isinstance(val, (MarkDecorator, MarkInfo)): - return val - - def listextrakeywords(self): - """ Return a set of all extra keywords in self and any parents.""" - extra_keywords = set() - item = self - for item in self.listchain(): - extra_keywords.update(item.extra_keyword_matches) - return extra_keywords - - def listnames(self): - return [x.name for x in self.listchain()] - - def addfinalizer(self, fin): - """ register a function to be called when this node is finalized. - - This method can only be called when this node is active - in a setup chain, for example during self.setup(). - """ - self.session._setupstate.addfinalizer(fin, self) - - def getparent(self, cls): - """ get the next parent node (including ourself) - which is an instance of the given class""" - current = self - while current and not isinstance(current, cls): - current = current.parent - return current - - def _prunetraceback(self, excinfo): - pass - - def _repr_failure_py(self, excinfo, style=None): - fm = self.session._fixturemanager - if excinfo.errisinstance(fm.FixtureLookupError): - return excinfo.value.formatrepr() - tbfilter = True - if self.config.option.fulltrace: - style = "long" - else: - tb = _pytest._code.Traceback([excinfo.traceback[-1]]) - self._prunetraceback(excinfo) - if len(excinfo.traceback) == 0: - excinfo.traceback = tb - tbfilter = False # prunetraceback already does it - if style == "auto": - style = "long" - # XXX should excinfo.getrepr record all data and toterminal() process it? - if style is None: - if self.config.option.tbstyle == "short": - style = "short" - else: - style = "long" - - try: - os.getcwd() - abspath = False - except OSError: - abspath = True - - return excinfo.getrepr(funcargs=True, abspath=abspath, - showlocals=self.config.option.showlocals, - style=style, tbfilter=tbfilter) - - repr_failure = _repr_failure_py - - -class Collector(Node): - """ Collector instances create children through collect() - and thus iteratively build a tree. - """ - - class CollectError(Exception): - """ an error during collection, contains a custom message. """ - - def collect(self): - """ returns a list of children (items and collectors) - for this collection node. - """ - raise NotImplementedError("abstract") - - def repr_failure(self, excinfo): - """ represent a collection failure. """ - if excinfo.errisinstance(self.CollectError): - exc = excinfo.value - return str(exc.args[0]) - return self._repr_failure_py(excinfo, style="short") - - def _prunetraceback(self, excinfo): - if hasattr(self, 'fspath'): - traceback = excinfo.traceback - ntraceback = traceback.cut(path=self.fspath) - if ntraceback == traceback: - ntraceback = ntraceback.cut(excludepath=tracebackcutdir) - excinfo.traceback = ntraceback.filter() - - -class FSCollector(Collector): - def __init__(self, fspath, parent=None, config=None, session=None): - fspath = py.path.local(fspath) # xxx only for test_resultlog.py? - name = fspath.basename - if parent is not None: - rel = fspath.relto(parent.fspath) - if rel: - name = rel - name = name.replace(os.sep, nodes.SEP) - super(FSCollector, self).__init__(name, parent, config, session) - self.fspath = fspath - - def _check_initialpaths_for_relpath(self): - for initialpath in self.session._initialpaths: - if self.fspath.common(initialpath) == initialpath: - return self.fspath.relto(initialpath.dirname) - - def _makeid(self): - relpath = self.fspath.relto(self.config.rootdir) - - if not relpath: - relpath = self._check_initialpaths_for_relpath() - if os.sep != nodes.SEP: - relpath = relpath.replace(os.sep, nodes.SEP) - return relpath - - -class File(FSCollector): - """ base class for collecting tests from a file. """ - - -class Item(Node): - """ a basic test invocation item. Note that for a single function - there might be multiple test invocation items. - """ - nextitem = None - - def __init__(self, name, parent=None, config=None, session=None): - super(Item, self).__init__(name, parent, config, session) - self._report_sections = [] - - def add_report_section(self, when, key, content): - """ - Adds a new report section, similar to what's done internally to add stdout and - stderr captured output:: - - item.add_report_section("call", "stdout", "report section contents") - - :param str when: - One of the possible capture states, ``"setup"``, ``"call"``, ``"teardown"``. - :param str key: - Name of the section, can be customized at will. Pytest uses ``"stdout"`` and - ``"stderr"`` internally. - - :param str content: - The full contents as a string. - """ - if content: - self._report_sections.append((when, key, content)) - - def reportinfo(self): - return self.fspath, None, "" - - @property - def location(self): - try: - return self._location - except AttributeError: - location = self.reportinfo() - # bestrelpath is a quite slow function - cache = self.config.__dict__.setdefault("_bestrelpathcache", {}) - try: - fspath = cache[location[0]] - except KeyError: - fspath = self.session.fspath.bestrelpath(location[0]) - cache[location[0]] = fspath - location = (fspath, location[1], str(location[2])) - self._location = location - return location - - -class NoMatch(Exception): - """ raised if matching cannot locate a matching names. """ - - -class Interrupted(KeyboardInterrupt): - """ signals an interrupted test run. """ - __module__ = 'builtins' # for py3 - - -class Session(FSCollector): - Interrupted = Interrupted - - def __init__(self, config): - FSCollector.__init__(self, config.rootdir, parent=None, - config=config, session=self) - self.testsfailed = 0 - self.testscollected = 0 - self.shouldstop = False - self.trace = config.trace.root.get("collection") - self._norecursepatterns = config.getini("norecursedirs") - self.startdir = py.path.local() - self.config.pluginmanager.register(self, name="session") - - def _makeid(self): - return "" - - @hookimpl(tryfirst=True) - def pytest_collectstart(self): - if self.shouldstop: - raise self.Interrupted(self.shouldstop) - - @hookimpl(tryfirst=True) - def pytest_runtest_logreport(self, report): - if report.failed and not hasattr(report, 'wasxfail'): - self.testsfailed += 1 - maxfail = self.config.getvalue("maxfail") - if maxfail and self.testsfailed >= maxfail: - self.shouldstop = "stopping after %d failures" % ( - self.testsfailed) - pytest_collectreport = pytest_runtest_logreport - - def isinitpath(self, path): - return path in self._initialpaths - - def gethookproxy(self, fspath): - # check if we have the common case of running - # hooks with all conftest.py filesall conftest.py - pm = self.config.pluginmanager - my_conftestmodules = pm._getconftestmodules(fspath) - remove_mods = pm._conftest_plugins.difference(my_conftestmodules) - if remove_mods: - # one or more conftests are not in use at this fspath - proxy = FSHookProxy(fspath, pm, remove_mods) - else: - # all plugis are active for this fspath - proxy = self.config.hook - return proxy - - def perform_collect(self, args=None, genitems=True): - hook = self.config.hook - try: - items = self._perform_collect(args, genitems) - self.config.pluginmanager.check_pending() - hook.pytest_collection_modifyitems(session=self, - config=self.config, items=items) - finally: - hook.pytest_collection_finish(session=self) - self.testscollected = len(items) - return items - - def _perform_collect(self, args, genitems): - if args is None: - args = self.config.args - self.trace("perform_collect", self, args) - self.trace.root.indent += 1 - self._notfound = [] - self._initialpaths = set() - self._initialparts = [] - self.items = items = [] - for arg in args: - parts = self._parsearg(arg) - self._initialparts.append(parts) - self._initialpaths.add(parts[0]) - rep = collect_one_node(self) - self.ihook.pytest_collectreport(report=rep) - self.trace.root.indent -= 1 - if self._notfound: - errors = [] - for arg, exc in self._notfound: - line = "(no name %r in any of %r)" % (arg, exc.args[0]) - errors.append("not found: %s\n%s" % (arg, line)) - # XXX: test this - raise UsageError(*errors) - if not genitems: - return rep.result - else: - if rep.passed: - for node in rep.result: - self.items.extend(self.genitems(node)) - return items - - def collect(self): - for parts in self._initialparts: - arg = "::".join(map(str, parts)) - self.trace("processing argument", arg) - self.trace.root.indent += 1 - try: - for x in self._collect(arg): - yield x - except NoMatch: - # we are inside a make_report hook so - # we cannot directly pass through the exception - self._notfound.append((arg, sys.exc_info()[1])) - - self.trace.root.indent -= 1 - - def _collect(self, arg): - names = self._parsearg(arg) - path = names.pop(0) - if path.check(dir=1): - assert not names, "invalid arg %r" % (arg,) - for path in path.visit(fil=lambda x: x.check(file=1), - rec=self._recurse, bf=True, sort=True): - for x in self._collectfile(path): - yield x - else: - assert path.check(file=1) - for x in self.matchnodes(self._collectfile(path), names): - yield x - - def _collectfile(self, path): - ihook = self.gethookproxy(path) - if not self.isinitpath(path): - if ihook.pytest_ignore_collect(path=path, config=self.config): - return () - return ihook.pytest_collect_file(path=path, parent=self) - - def _recurse(self, path): - ihook = self.gethookproxy(path.dirpath()) - if ihook.pytest_ignore_collect(path=path, config=self.config): - return - for pat in self._norecursepatterns: - if path.check(fnmatch=pat): - return False - ihook = self.gethookproxy(path) - ihook.pytest_collect_directory(path=path, parent=self) - return True - - def _tryconvertpyarg(self, x): - """Convert a dotted module name to path. - - """ - import pkgutil - try: - loader = pkgutil.find_loader(x) - except ImportError: - return x - if loader is None: - return x - # This method is sometimes invoked when AssertionRewritingHook, which - # does not define a get_filename method, is already in place: - try: - path = loader.get_filename(x) - except AttributeError: - # Retrieve path from AssertionRewritingHook: - path = loader.modules[x][0].co_filename - if loader.is_package(x): - path = os.path.dirname(path) - return path - - def _parsearg(self, arg): - """ return (fspath, names) tuple after checking the file exists. """ - parts = str(arg).split("::") - if self.config.option.pyargs: - parts[0] = self._tryconvertpyarg(parts[0]) - relpath = parts[0].replace("/", os.sep) - path = self.config.invocation_dir.join(relpath, abs=True) - if not path.check(): - if self.config.option.pyargs: - raise UsageError( - "file or package not found: " + arg + - " (missing __init__.py?)") - else: - raise UsageError("file not found: " + arg) - parts[0] = path - return parts - - def matchnodes(self, matching, names): - self.trace("matchnodes", matching, names) - self.trace.root.indent += 1 - nodes = self._matchnodes(matching, names) - num = len(nodes) - self.trace("matchnodes finished -> ", num, "nodes") - self.trace.root.indent -= 1 - if num == 0: - raise NoMatch(matching, names[:1]) - return nodes - - def _matchnodes(self, matching, names): - if not matching or not names: - return matching - name = names[0] - assert name - nextnames = names[1:] - resultnodes = [] - for node in matching: - if isinstance(node, Item): - if not names: - resultnodes.append(node) - continue - assert isinstance(node, Collector) - rep = collect_one_node(node) - if rep.passed: - has_matched = False - for x in rep.result: - # TODO: remove parametrized workaround once collection structure contains parametrization - if x.name == name or x.name.split("[")[0] == name: - resultnodes.extend(self.matchnodes([x], nextnames)) - has_matched = True - # XXX accept IDs that don't have "()" for class instances - if not has_matched and len(rep.result) == 1 and x.name == "()": - nextnames.insert(0, name) - resultnodes.extend(self.matchnodes([x], nextnames)) - else: - # report collection failures here to avoid failing to run some test - # specified in the command line because the module could not be - # imported (#134) - node.ihook.pytest_collectreport(report=rep) - return resultnodes - - def genitems(self, node): - self.trace("genitems", node) - if isinstance(node, Item): - node.ihook.pytest_itemcollected(item=node) - yield node - else: - assert isinstance(node, Collector) - rep = collect_one_node(node) - if rep.passed: - for subnode in rep.result: - for x in self.genitems(subnode): - yield x - node.ihook.pytest_collectreport(report=rep) diff --git a/lib/spack/external/_pytest/mark.py b/lib/spack/external/_pytest/mark.py deleted file mode 100644 index 454722ca2c..0000000000 --- a/lib/spack/external/_pytest/mark.py +++ /dev/null @@ -1,465 +0,0 @@ -""" generic mechanism for marking and selecting python functions. """ -from __future__ import absolute_import, division, print_function - -import inspect -import warnings -from collections import namedtuple -from operator import attrgetter -from .compat import imap -from .deprecated import MARK_PARAMETERSET_UNPACKING - - -def alias(name, warning=None): - getter = attrgetter(name) - - def warned(self): - warnings.warn(warning, stacklevel=2) - return getter(self) - - return property(getter if warning is None else warned, doc='alias for ' + name) - - -class ParameterSet(namedtuple('ParameterSet', 'values, marks, id')): - @classmethod - def param(cls, *values, **kw): - marks = kw.pop('marks', ()) - if isinstance(marks, MarkDecorator): - marks = marks, - else: - assert isinstance(marks, (tuple, list, set)) - - def param_extract_id(id=None): - return id - - id = param_extract_id(**kw) - return cls(values, marks, id) - - @classmethod - def extract_from(cls, parameterset, legacy_force_tuple=False): - """ - :param parameterset: - a legacy style parameterset that may or may not be a tuple, - and may or may not be wrapped into a mess of mark objects - - :param legacy_force_tuple: - enforce tuple wrapping so single argument tuple values - don't get decomposed and break tests - - """ - - if isinstance(parameterset, cls): - return parameterset - if not isinstance(parameterset, MarkDecorator) and legacy_force_tuple: - return cls.param(parameterset) - - newmarks = [] - argval = parameterset - while isinstance(argval, MarkDecorator): - newmarks.append(MarkDecorator(Mark( - argval.markname, argval.args[:-1], argval.kwargs))) - argval = argval.args[-1] - assert not isinstance(argval, ParameterSet) - if legacy_force_tuple: - argval = argval, - - if newmarks: - warnings.warn(MARK_PARAMETERSET_UNPACKING) - - return cls(argval, marks=newmarks, id=None) - - @property - def deprecated_arg_dict(self): - return dict((mark.name, mark) for mark in self.marks) - - -class MarkerError(Exception): - - """Error in use of a pytest marker/attribute.""" - - -def param(*values, **kw): - return ParameterSet.param(*values, **kw) - - -def pytest_addoption(parser): - group = parser.getgroup("general") - group._addoption( - '-k', - action="store", dest="keyword", default='', metavar="EXPRESSION", - help="only run tests which match the given substring expression. " - "An expression is a python evaluatable expression " - "where all names are substring-matched against test names " - "and their parent classes. Example: -k 'test_method or test_" - "other' matches all test functions and classes whose name " - "contains 'test_method' or 'test_other', while -k 'not test_method' " - "matches those that don't contain 'test_method' in their names. " - "Additionally keywords are matched to classes and functions " - "containing extra names in their 'extra_keyword_matches' set, " - "as well as functions which have names assigned directly to them." - ) - - group._addoption( - "-m", - action="store", dest="markexpr", default="", metavar="MARKEXPR", - help="only run tests matching given mark expression. " - "example: -m 'mark1 and not mark2'." - ) - - group.addoption( - "--markers", action="store_true", - help="show markers (builtin, plugin and per-project ones)." - ) - - parser.addini("markers", "markers for test functions", 'linelist') - - -def pytest_cmdline_main(config): - import _pytest.config - if config.option.markers: - config._do_configure() - tw = _pytest.config.create_terminal_writer(config) - for line in config.getini("markers"): - name, rest = line.split(":", 1) - tw.write("@pytest.mark.%s:" % name, bold=True) - tw.line(rest) - tw.line() - config._ensure_unconfigure() - return 0 - - -pytest_cmdline_main.tryfirst = True - - -def pytest_collection_modifyitems(items, config): - keywordexpr = config.option.keyword.lstrip() - matchexpr = config.option.markexpr - if not keywordexpr and not matchexpr: - return - # pytest used to allow "-" for negating - # but today we just allow "-" at the beginning, use "not" instead - # we probably remove "-" altogether soon - if keywordexpr.startswith("-"): - keywordexpr = "not " + keywordexpr[1:] - selectuntil = False - if keywordexpr[-1:] == ":": - selectuntil = True - keywordexpr = keywordexpr[:-1] - - remaining = [] - deselected = [] - for colitem in items: - if keywordexpr and not matchkeyword(colitem, keywordexpr): - deselected.append(colitem) - else: - if selectuntil: - keywordexpr = None - if matchexpr: - if not matchmark(colitem, matchexpr): - deselected.append(colitem) - continue - remaining.append(colitem) - - if deselected: - config.hook.pytest_deselected(items=deselected) - items[:] = remaining - - -class MarkMapping: - """Provides a local mapping for markers where item access - resolves to True if the marker is present. """ - - def __init__(self, keywords): - mymarks = set() - for key, value in keywords.items(): - if isinstance(value, MarkInfo) or isinstance(value, MarkDecorator): - mymarks.add(key) - self._mymarks = mymarks - - def __getitem__(self, name): - return name in self._mymarks - - -class KeywordMapping: - """Provides a local mapping for keywords. - Given a list of names, map any substring of one of these names to True. - """ - - def __init__(self, names): - self._names = names - - def __getitem__(self, subname): - for name in self._names: - if subname in name: - return True - return False - - -def matchmark(colitem, markexpr): - """Tries to match on any marker names, attached to the given colitem.""" - return eval(markexpr, {}, MarkMapping(colitem.keywords)) - - -def matchkeyword(colitem, keywordexpr): - """Tries to match given keyword expression to given collector item. - - Will match on the name of colitem, including the names of its parents. - Only matches names of items which are either a :class:`Class` or a - :class:`Function`. - Additionally, matches on names in the 'extra_keyword_matches' set of - any item, as well as names directly assigned to test functions. - """ - mapped_names = set() - - # Add the names of the current item and any parent items - import pytest - for item in colitem.listchain(): - if not isinstance(item, pytest.Instance): - mapped_names.add(item.name) - - # Add the names added as extra keywords to current or parent items - for name in colitem.listextrakeywords(): - mapped_names.add(name) - - # Add the names attached to the current function through direct assignment - if hasattr(colitem, 'function'): - for name in colitem.function.__dict__: - mapped_names.add(name) - - mapping = KeywordMapping(mapped_names) - if " " not in keywordexpr: - # special case to allow for simple "-k pass" and "-k 1.3" - return mapping[keywordexpr] - elif keywordexpr.startswith("not ") and " " not in keywordexpr[4:]: - return not mapping[keywordexpr[4:]] - return eval(keywordexpr, {}, mapping) - - -def pytest_configure(config): - config._old_mark_config = MARK_GEN._config - if config.option.strict: - MARK_GEN._config = config - - -def pytest_unconfigure(config): - MARK_GEN._config = getattr(config, '_old_mark_config', None) - - -class MarkGenerator: - """ Factory for :class:`MarkDecorator` objects - exposed as - a ``pytest.mark`` singleton instance. Example:: - - import pytest - @pytest.mark.slowtest - def test_function(): - pass - - will set a 'slowtest' :class:`MarkInfo` object - on the ``test_function`` object. """ - _config = None - - def __getattr__(self, name): - if name[0] == "_": - raise AttributeError("Marker name must NOT start with underscore") - if self._config is not None: - self._check(name) - return MarkDecorator(Mark(name, (), {})) - - def _check(self, name): - try: - if name in self._markers: - return - except AttributeError: - pass - self._markers = values = set() - for line in self._config.getini("markers"): - marker, _ = line.split(":", 1) - marker = marker.rstrip() - x = marker.split("(", 1)[0] - values.add(x) - if name not in self._markers: - raise AttributeError("%r not a registered marker" % (name,)) - - -def istestfunc(func): - return hasattr(func, "__call__") and \ - getattr(func, "__name__", "") != "" - - -class MarkDecorator: - """ A decorator for test functions and test classes. When applied - it will create :class:`MarkInfo` objects which may be - :ref:`retrieved by hooks as item keywords `. - MarkDecorator instances are often created like this:: - - mark1 = pytest.mark.NAME # simple MarkDecorator - mark2 = pytest.mark.NAME(name1=value) # parametrized MarkDecorator - - and can then be applied as decorators to test functions:: - - @mark2 - def test_function(): - pass - - When a MarkDecorator instance is called it does the following: - 1. If called with a single class as its only positional argument and no - additional keyword arguments, it attaches itself to the class so it - gets applied automatically to all test cases found in that class. - 2. If called with a single function as its only positional argument and - no additional keyword arguments, it attaches a MarkInfo object to the - function, containing all the arguments already stored internally in - the MarkDecorator. - 3. When called in any other case, it performs a 'fake construction' call, - i.e. it returns a new MarkDecorator instance with the original - MarkDecorator's content updated with the arguments passed to this - call. - - Note: The rules above prevent MarkDecorator objects from storing only a - single function or class reference as their positional argument with no - additional keyword or positional arguments. - - """ - - def __init__(self, mark): - assert isinstance(mark, Mark), repr(mark) - self.mark = mark - - name = alias('mark.name') - args = alias('mark.args') - kwargs = alias('mark.kwargs') - - @property - def markname(self): - return self.name # for backward-compat (2.4.1 had this attr) - - def __eq__(self, other): - return self.mark == other.mark if isinstance(other, MarkDecorator) else False - - def __repr__(self): - return "" % (self.mark,) - - def with_args(self, *args, **kwargs): - """ return a MarkDecorator with extra arguments added - - unlike call this can be used even if the sole argument is a callable/class - - :return: MarkDecorator - """ - - mark = Mark(self.name, args, kwargs) - return self.__class__(self.mark.combined_with(mark)) - - def __call__(self, *args, **kwargs): - """ if passed a single callable argument: decorate it with mark info. - otherwise add *args/**kwargs in-place to mark information. """ - if args and not kwargs: - func = args[0] - is_class = inspect.isclass(func) - if len(args) == 1 and (istestfunc(func) or is_class): - if is_class: - store_mark(func, self.mark) - else: - store_legacy_markinfo(func, self.mark) - store_mark(func, self.mark) - return func - return self.with_args(*args, **kwargs) - - -def get_unpacked_marks(obj): - """ - obtain the unpacked marks that are stored on a object - """ - mark_list = getattr(obj, 'pytestmark', []) - - if not isinstance(mark_list, list): - mark_list = [mark_list] - return [ - getattr(mark, 'mark', mark) # unpack MarkDecorator - for mark in mark_list - ] - - -def store_mark(obj, mark): - """store a Mark on a object - this is used to implement the Mark declarations/decorators correctly - """ - assert isinstance(mark, Mark), mark - # always reassign name to avoid updating pytestmark - # in a reference that was only borrowed - obj.pytestmark = get_unpacked_marks(obj) + [mark] - - -def store_legacy_markinfo(func, mark): - """create the legacy MarkInfo objects and put them onto the function - """ - if not isinstance(mark, Mark): - raise TypeError("got {mark!r} instead of a Mark".format(mark=mark)) - holder = getattr(func, mark.name, None) - if holder is None: - holder = MarkInfo(mark) - setattr(func, mark.name, holder) - else: - holder.add_mark(mark) - - -class Mark(namedtuple('Mark', 'name, args, kwargs')): - - def combined_with(self, other): - assert self.name == other.name - return Mark( - self.name, self.args + other.args, - dict(self.kwargs, **other.kwargs)) - - -class MarkInfo(object): - """ Marking object created by :class:`MarkDecorator` instances. """ - - def __init__(self, mark): - assert isinstance(mark, Mark), repr(mark) - self.combined = mark - self._marks = [mark] - - name = alias('combined.name') - args = alias('combined.args') - kwargs = alias('combined.kwargs') - - def __repr__(self): - return "".format(self.combined) - - def add_mark(self, mark): - """ add a MarkInfo with the given args and kwargs. """ - self._marks.append(mark) - self.combined = self.combined.combined_with(mark) - - def __iter__(self): - """ yield MarkInfo objects each relating to a marking-call. """ - return imap(MarkInfo, self._marks) - - -MARK_GEN = MarkGenerator() - - -def _marked(func, mark): - """ Returns True if :func: is already marked with :mark:, False otherwise. - This can happen if marker is applied to class and the test file is - invoked more than once. - """ - try: - func_mark = getattr(func, mark.name) - except AttributeError: - return False - return mark.args == func_mark.args and mark.kwargs == func_mark.kwargs - - -def transfer_markers(funcobj, cls, mod): - """ - this function transfers class level markers and module level markers - into function level markinfo objects - - this is the main reason why marks are so broken - the resolution will involve phasing out function level MarkInfo objects - - """ - for obj in (cls, mod): - for mark in get_unpacked_marks(obj): - if not _marked(funcobj, mark): - store_legacy_markinfo(funcobj, mark) diff --git a/lib/spack/external/_pytest/monkeypatch.py b/lib/spack/external/_pytest/monkeypatch.py deleted file mode 100644 index 39ac770135..0000000000 --- a/lib/spack/external/_pytest/monkeypatch.py +++ /dev/null @@ -1,259 +0,0 @@ -""" monkeypatching and mocking functionality. """ -from __future__ import absolute_import, division, print_function - -import os -import sys -import re - -from py.builtin import _basestring -from _pytest.fixtures import fixture - -RE_IMPORT_ERROR_NAME = re.compile("^No module named (.*)$") - - -@fixture -def monkeypatch(): - """The returned ``monkeypatch`` fixture provides these - helper methods to modify objects, dictionaries or os.environ:: - - monkeypatch.setattr(obj, name, value, raising=True) - monkeypatch.delattr(obj, name, raising=True) - monkeypatch.setitem(mapping, name, value) - monkeypatch.delitem(obj, name, raising=True) - monkeypatch.setenv(name, value, prepend=False) - monkeypatch.delenv(name, value, raising=True) - monkeypatch.syspath_prepend(path) - monkeypatch.chdir(path) - - All modifications will be undone after the requesting - test function or fixture has finished. The ``raising`` - parameter determines if a KeyError or AttributeError - will be raised if the set/deletion operation has no target. - """ - mpatch = MonkeyPatch() - yield mpatch - mpatch.undo() - - -def resolve(name): - # simplified from zope.dottedname - parts = name.split('.') - - used = parts.pop(0) - found = __import__(used) - for part in parts: - used += '.' + part - try: - found = getattr(found, part) - except AttributeError: - pass - else: - continue - # we use explicit un-nesting of the handling block in order - # to avoid nested exceptions on python 3 - try: - __import__(used) - except ImportError as ex: - # str is used for py2 vs py3 - expected = str(ex).split()[-1] - if expected == used: - raise - else: - raise ImportError( - 'import error in %s: %s' % (used, ex) - ) - found = annotated_getattr(found, part, used) - return found - - -def annotated_getattr(obj, name, ann): - try: - obj = getattr(obj, name) - except AttributeError: - raise AttributeError( - '%r object at %s has no attribute %r' % ( - type(obj).__name__, ann, name - ) - ) - return obj - - -def derive_importpath(import_path, raising): - if not isinstance(import_path, _basestring) or "." not in import_path: - raise TypeError("must be absolute import path string, not %r" % - (import_path,)) - module, attr = import_path.rsplit('.', 1) - target = resolve(module) - if raising: - annotated_getattr(target, attr, ann=module) - return attr, target - - -class Notset: - def __repr__(self): - return "" - - -notset = Notset() - - -class MonkeyPatch: - """ Object returned by the ``monkeypatch`` fixture keeping a record of setattr/item/env/syspath changes. - """ - - def __init__(self): - self._setattr = [] - self._setitem = [] - self._cwd = None - self._savesyspath = None - - def setattr(self, target, name, value=notset, raising=True): - """ Set attribute value on target, memorizing the old value. - By default raise AttributeError if the attribute did not exist. - - For convenience you can specify a string as ``target`` which - will be interpreted as a dotted import path, with the last part - being the attribute name. Example: - ``monkeypatch.setattr("os.getcwd", lambda x: "/")`` - would set the ``getcwd`` function of the ``os`` module. - - The ``raising`` value determines if the setattr should fail - if the attribute is not already present (defaults to True - which means it will raise). - """ - __tracebackhide__ = True - import inspect - - if value is notset: - if not isinstance(target, _basestring): - raise TypeError("use setattr(target, name, value) or " - "setattr(target, value) with target being a dotted " - "import string") - value = name - name, target = derive_importpath(target, raising) - - oldval = getattr(target, name, notset) - if raising and oldval is notset: - raise AttributeError("%r has no attribute %r" % (target, name)) - - # avoid class descriptors like staticmethod/classmethod - if inspect.isclass(target): - oldval = target.__dict__.get(name, notset) - self._setattr.append((target, name, oldval)) - setattr(target, name, value) - - def delattr(self, target, name=notset, raising=True): - """ Delete attribute ``name`` from ``target``, by default raise - AttributeError it the attribute did not previously exist. - - If no ``name`` is specified and ``target`` is a string - it will be interpreted as a dotted import path with the - last part being the attribute name. - - If ``raising`` is set to False, no exception will be raised if the - attribute is missing. - """ - __tracebackhide__ = True - if name is notset: - if not isinstance(target, _basestring): - raise TypeError("use delattr(target, name) or " - "delattr(target) with target being a dotted " - "import string") - name, target = derive_importpath(target, raising) - - if not hasattr(target, name): - if raising: - raise AttributeError(name) - else: - self._setattr.append((target, name, getattr(target, name, notset))) - delattr(target, name) - - def setitem(self, dic, name, value): - """ Set dictionary entry ``name`` to value. """ - self._setitem.append((dic, name, dic.get(name, notset))) - dic[name] = value - - def delitem(self, dic, name, raising=True): - """ Delete ``name`` from dict. Raise KeyError if it doesn't exist. - - If ``raising`` is set to False, no exception will be raised if the - key is missing. - """ - if name not in dic: - if raising: - raise KeyError(name) - else: - self._setitem.append((dic, name, dic.get(name, notset))) - del dic[name] - - def setenv(self, name, value, prepend=None): - """ Set environment variable ``name`` to ``value``. If ``prepend`` - is a character, read the current environment variable value - and prepend the ``value`` adjoined with the ``prepend`` character.""" - value = str(value) - if prepend and name in os.environ: - value = value + prepend + os.environ[name] - self.setitem(os.environ, name, value) - - def delenv(self, name, raising=True): - """ Delete ``name`` from the environment. Raise KeyError it does not - exist. - - If ``raising`` is set to False, no exception will be raised if the - environment variable is missing. - """ - self.delitem(os.environ, name, raising=raising) - - def syspath_prepend(self, path): - """ Prepend ``path`` to ``sys.path`` list of import locations. """ - if self._savesyspath is None: - self._savesyspath = sys.path[:] - sys.path.insert(0, str(path)) - - def chdir(self, path): - """ Change the current working directory to the specified path. - Path can be a string or a py.path.local object. - """ - if self._cwd is None: - self._cwd = os.getcwd() - if hasattr(path, "chdir"): - path.chdir() - else: - os.chdir(path) - - def undo(self): - """ Undo previous changes. This call consumes the - undo stack. Calling it a second time has no effect unless - you do more monkeypatching after the undo call. - - There is generally no need to call `undo()`, since it is - called automatically during tear-down. - - Note that the same `monkeypatch` fixture is used across a - single test function invocation. If `monkeypatch` is used both by - the test function itself and one of the test fixtures, - calling `undo()` will undo all of the changes made in - both functions. - """ - for obj, name, value in reversed(self._setattr): - if value is not notset: - setattr(obj, name, value) - else: - delattr(obj, name) - self._setattr[:] = [] - for dictionary, name, value in reversed(self._setitem): - if value is notset: - try: - del dictionary[name] - except KeyError: - pass # was already deleted, so we have the desired state - else: - dictionary[name] = value - self._setitem[:] = [] - if self._savesyspath is not None: - sys.path[:] = self._savesyspath - self._savesyspath = None - - if self._cwd is not None: - os.chdir(self._cwd) - self._cwd = None diff --git a/lib/spack/external/_pytest/nodes.py b/lib/spack/external/_pytest/nodes.py deleted file mode 100644 index ad3af2ce67..0000000000 --- a/lib/spack/external/_pytest/nodes.py +++ /dev/null @@ -1,37 +0,0 @@ -SEP = "/" - - -def _splitnode(nodeid): - """Split a nodeid into constituent 'parts'. - - Node IDs are strings, and can be things like: - '' - 'testing/code' - 'testing/code/test_excinfo.py' - 'testing/code/test_excinfo.py::TestFormattedExcinfo::()' - - Return values are lists e.g. - [] - ['testing', 'code'] - ['testing', 'code', 'test_excinfo.py'] - ['testing', 'code', 'test_excinfo.py', 'TestFormattedExcinfo', '()'] - """ - if nodeid == '': - # If there is no root node at all, return an empty list so the caller's logic can remain sane - return [] - parts = nodeid.split(SEP) - # Replace single last element 'test_foo.py::Bar::()' with multiple elements 'test_foo.py', 'Bar', '()' - parts[-1:] = parts[-1].split("::") - return parts - - -def ischildnode(baseid, nodeid): - """Return True if the nodeid is a child node of the baseid. - - E.g. 'foo/bar::Baz::()' is a child of 'foo', 'foo/bar' and 'foo/bar::Baz', but not of 'foo/blorp' - """ - base_parts = _splitnode(baseid) - node_parts = _splitnode(nodeid) - if len(node_parts) < len(base_parts): - return False - return node_parts[:len(base_parts)] == base_parts diff --git a/lib/spack/external/_pytest/nose.py b/lib/spack/external/_pytest/nose.py deleted file mode 100644 index d246c5603d..0000000000 --- a/lib/spack/external/_pytest/nose.py +++ /dev/null @@ -1,73 +0,0 @@ -""" run test suites written for nose. """ -from __future__ import absolute_import, division, print_function - -import sys - -import py -from _pytest import unittest, runner, python -from _pytest.config import hookimpl - - -def get_skip_exceptions(): - skip_classes = set() - for module_name in ('unittest', 'unittest2', 'nose'): - mod = sys.modules.get(module_name) - if hasattr(mod, 'SkipTest'): - skip_classes.add(mod.SkipTest) - return tuple(skip_classes) - - -def pytest_runtest_makereport(item, call): - if call.excinfo and call.excinfo.errisinstance(get_skip_exceptions()): - # let's substitute the excinfo with a pytest.skip one - call2 = call.__class__( - lambda: runner.skip(str(call.excinfo.value)), call.when) - call.excinfo = call2.excinfo - - -@hookimpl(trylast=True) -def pytest_runtest_setup(item): - if is_potential_nosetest(item): - if isinstance(item.parent, python.Generator): - gen = item.parent - if not hasattr(gen, '_nosegensetup'): - call_optional(gen.obj, 'setup') - if isinstance(gen.parent, python.Instance): - call_optional(gen.parent.obj, 'setup') - gen._nosegensetup = True - if not call_optional(item.obj, 'setup'): - # call module level setup if there is no object level one - call_optional(item.parent.obj, 'setup') - # XXX this implies we only call teardown when setup worked - item.session._setupstate.addfinalizer((lambda: teardown_nose(item)), item) - - -def teardown_nose(item): - if is_potential_nosetest(item): - if not call_optional(item.obj, 'teardown'): - call_optional(item.parent.obj, 'teardown') - # if hasattr(item.parent, '_nosegensetup'): - # #call_optional(item._nosegensetup, 'teardown') - # del item.parent._nosegensetup - - -def pytest_make_collect_report(collector): - if isinstance(collector, python.Generator): - call_optional(collector.obj, 'setup') - - -def is_potential_nosetest(item): - # extra check needed since we do not do nose style setup/teardown - # on direct unittest style classes - return isinstance(item, python.Function) and \ - not isinstance(item, unittest.TestCaseFunction) - - -def call_optional(obj, name): - method = getattr(obj, name, None) - isfixture = hasattr(method, "_pytestfixturefunction") - if method is not None and not isfixture and py.builtin.callable(method): - # If there's any problems allow the exception to raise rather than - # silently ignoring them - method() - return True diff --git a/lib/spack/external/_pytest/outcomes.py b/lib/spack/external/_pytest/outcomes.py deleted file mode 100644 index ff5ef756d9..0000000000 --- a/lib/spack/external/_pytest/outcomes.py +++ /dev/null @@ -1,140 +0,0 @@ -""" -exception classes and constants handling test outcomes -as well as functions creating them -""" -from __future__ import absolute_import, division, print_function -import py -import sys - - -class OutcomeException(BaseException): - """ OutcomeException and its subclass instances indicate and - contain info about test and collection outcomes. - """ - def __init__(self, msg=None, pytrace=True): - BaseException.__init__(self, msg) - self.msg = msg - self.pytrace = pytrace - - def __repr__(self): - if self.msg: - val = self.msg - if isinstance(val, bytes): - val = py._builtin._totext(val, errors='replace') - return val - return "<%s instance>" % (self.__class__.__name__,) - __str__ = __repr__ - - -TEST_OUTCOME = (OutcomeException, Exception) - - -class Skipped(OutcomeException): - # XXX hackish: on 3k we fake to live in the builtins - # in order to have Skipped exception printing shorter/nicer - __module__ = 'builtins' - - def __init__(self, msg=None, pytrace=True, allow_module_level=False): - OutcomeException.__init__(self, msg=msg, pytrace=pytrace) - self.allow_module_level = allow_module_level - - -class Failed(OutcomeException): - """ raised from an explicit call to pytest.fail() """ - __module__ = 'builtins' - - -class Exit(KeyboardInterrupt): - """ raised for immediate program exits (no tracebacks/summaries)""" - def __init__(self, msg="unknown reason"): - self.msg = msg - KeyboardInterrupt.__init__(self, msg) - -# exposed helper methods - - -def exit(msg): - """ exit testing process as if KeyboardInterrupt was triggered. """ - __tracebackhide__ = True - raise Exit(msg) - - -exit.Exception = Exit - - -def skip(msg=""): - """ skip an executing test with the given message. Note: it's usually - better to use the pytest.mark.skipif marker to declare a test to be - skipped under certain conditions like mismatching platforms or - dependencies. See the pytest_skipping plugin for details. - """ - __tracebackhide__ = True - raise Skipped(msg=msg) - - -skip.Exception = Skipped - - -def fail(msg="", pytrace=True): - """ explicitly fail an currently-executing test with the given Message. - - :arg pytrace: if false the msg represents the full failure information - and no python traceback will be reported. - """ - __tracebackhide__ = True - raise Failed(msg=msg, pytrace=pytrace) - - -fail.Exception = Failed - - -class XFailed(fail.Exception): - """ raised from an explicit call to pytest.xfail() """ - - -def xfail(reason=""): - """ xfail an executing test or setup functions with the given reason.""" - __tracebackhide__ = True - raise XFailed(reason) - - -xfail.Exception = XFailed - - -def importorskip(modname, minversion=None): - """ return imported module if it has at least "minversion" as its - __version__ attribute. If no minversion is specified the a skip - is only triggered if the module can not be imported. - """ - import warnings - __tracebackhide__ = True - compile(modname, '', 'eval') # to catch syntaxerrors - should_skip = False - - with warnings.catch_warnings(): - # make sure to ignore ImportWarnings that might happen because - # of existing directories with the same name we're trying to - # import but without a __init__.py file - warnings.simplefilter('ignore') - try: - __import__(modname) - except ImportError: - # Do not raise chained exception here(#1485) - should_skip = True - if should_skip: - raise Skipped("could not import %r" % (modname,), allow_module_level=True) - mod = sys.modules[modname] - if minversion is None: - return mod - verattr = getattr(mod, '__version__', None) - if minversion is not None: - try: - from pkg_resources import parse_version as pv - except ImportError: - raise Skipped("we have a required version for %r but can not import " - "pkg_resources to parse version strings." % (modname,), - allow_module_level=True) - if verattr is None or pv(verattr) < pv(minversion): - raise Skipped("module %r has __version__ %r, required is: %r" % ( - modname, verattr, minversion), allow_module_level=True) - return mod diff --git a/lib/spack/external/_pytest/pastebin.py b/lib/spack/external/_pytest/pastebin.py deleted file mode 100644 index 9d689819f0..0000000000 --- a/lib/spack/external/_pytest/pastebin.py +++ /dev/null @@ -1,100 +0,0 @@ -""" submit failure or test session information to a pastebin service. """ -from __future__ import absolute_import, division, print_function - -import pytest -import sys -import tempfile - - -def pytest_addoption(parser): - group = parser.getgroup("terminal reporting") - group._addoption('--pastebin', metavar="mode", - action='store', dest="pastebin", default=None, - choices=['failed', 'all'], - help="send failed|all info to bpaste.net pastebin service.") - - -@pytest.hookimpl(trylast=True) -def pytest_configure(config): - import py - if config.option.pastebin == "all": - tr = config.pluginmanager.getplugin('terminalreporter') - # if no terminal reporter plugin is present, nothing we can do here; - # this can happen when this function executes in a slave node - # when using pytest-xdist, for example - if tr is not None: - # pastebin file will be utf-8 encoded binary file - config._pastebinfile = tempfile.TemporaryFile('w+b') - oldwrite = tr._tw.write - - def tee_write(s, **kwargs): - oldwrite(s, **kwargs) - if py.builtin._istext(s): - s = s.encode('utf-8') - config._pastebinfile.write(s) - - tr._tw.write = tee_write - - -def pytest_unconfigure(config): - if hasattr(config, '_pastebinfile'): - # get terminal contents and delete file - config._pastebinfile.seek(0) - sessionlog = config._pastebinfile.read() - config._pastebinfile.close() - del config._pastebinfile - # undo our patching in the terminal reporter - tr = config.pluginmanager.getplugin('terminalreporter') - del tr._tw.__dict__['write'] - # write summary - tr.write_sep("=", "Sending information to Paste Service") - pastebinurl = create_new_paste(sessionlog) - tr.write_line("pastebin session-log: %s\n" % pastebinurl) - - -def create_new_paste(contents): - """ - Creates a new paste using bpaste.net service. - - :contents: paste contents as utf-8 encoded bytes - :returns: url to the pasted contents - """ - import re - if sys.version_info < (3, 0): - from urllib import urlopen, urlencode - else: - from urllib.request import urlopen - from urllib.parse import urlencode - - params = { - 'code': contents, - 'lexer': 'python3' if sys.version_info[0] == 3 else 'python', - 'expiry': '1week', - } - url = 'https://bpaste.net' - response = urlopen(url, data=urlencode(params).encode('ascii')).read() - m = re.search(r'href="/raw/(\w+)"', response.decode('utf-8')) - if m: - return '%s/show/%s' % (url, m.group(1)) - else: - return 'bad response: ' + response - - -def pytest_terminal_summary(terminalreporter): - import _pytest.config - if terminalreporter.config.option.pastebin != "failed": - return - tr = terminalreporter - if 'failed' in tr.stats: - terminalreporter.write_sep("=", "Sending information to Paste Service") - for rep in terminalreporter.stats.get('failed'): - try: - msg = rep.longrepr.reprtraceback.reprentries[-1].reprfileloc - except AttributeError: - msg = tr._getfailureheadline(rep) - tw = _pytest.config.create_terminal_writer(terminalreporter.config, stringio=True) - rep.toterminal(tw) - s = tw.stringio.getvalue() - assert len(s) - pastebinurl = create_new_paste(s) - tr.write_line("%s --> %s" % (msg, pastebinurl)) diff --git a/lib/spack/external/_pytest/pytester.py b/lib/spack/external/_pytest/pytester.py deleted file mode 100644 index 82aa00e0d2..0000000000 --- a/lib/spack/external/_pytest/pytester.py +++ /dev/null @@ -1,1167 +0,0 @@ -""" (disabled by default) support for testing pytest and pytest plugins. """ -from __future__ import absolute_import, division, print_function - -import codecs -import gc -import os -import platform -import re -import subprocess -import sys -import time -import traceback -from fnmatch import fnmatch - -from weakref import WeakKeyDictionary - -from _pytest.capture import MultiCapture, SysCapture -from _pytest._code import Source -import py -import pytest -from _pytest.main import Session, EXIT_OK -from _pytest.assertion.rewrite import AssertionRewritingHook - - -def pytest_addoption(parser): - # group = parser.getgroup("pytester", "pytester (self-tests) options") - parser.addoption('--lsof', - action="store_true", dest="lsof", default=False, - help=("run FD checks if lsof is available")) - - parser.addoption('--runpytest', default="inprocess", dest="runpytest", - choices=("inprocess", "subprocess", ), - help=("run pytest sub runs in tests using an 'inprocess' " - "or 'subprocess' (python -m main) method")) - - -def pytest_configure(config): - # This might be called multiple times. Only take the first. - global _pytest_fullpath - try: - _pytest_fullpath - except NameError: - _pytest_fullpath = os.path.abspath(pytest.__file__.rstrip("oc")) - _pytest_fullpath = _pytest_fullpath.replace("$py.class", ".py") - - if config.getvalue("lsof"): - checker = LsofFdLeakChecker() - if checker.matching_platform(): - config.pluginmanager.register(checker) - - -class LsofFdLeakChecker(object): - def get_open_files(self): - out = self._exec_lsof() - open_files = self._parse_lsof_output(out) - return open_files - - def _exec_lsof(self): - pid = os.getpid() - return py.process.cmdexec("lsof -Ffn0 -p %d" % pid) - - def _parse_lsof_output(self, out): - def isopen(line): - return line.startswith('f') and ("deleted" not in line and - 'mem' not in line and "txt" not in line and 'cwd' not in line) - - open_files = [] - - for line in out.split("\n"): - if isopen(line): - fields = line.split('\0') - fd = fields[0][1:] - filename = fields[1][1:] - if filename.startswith('/'): - open_files.append((fd, filename)) - - return open_files - - def matching_platform(self): - try: - py.process.cmdexec("lsof -v") - except (py.process.cmdexec.Error, UnicodeDecodeError): - # cmdexec may raise UnicodeDecodeError on Windows systems - # with locale other than english: - # https://bitbucket.org/pytest-dev/py/issues/66 - return False - else: - return True - - @pytest.hookimpl(hookwrapper=True, tryfirst=True) - def pytest_runtest_protocol(self, item): - lines1 = self.get_open_files() - yield - if hasattr(sys, "pypy_version_info"): - gc.collect() - lines2 = self.get_open_files() - - new_fds = set([t[0] for t in lines2]) - set([t[0] for t in lines1]) - leaked_files = [t for t in lines2 if t[0] in new_fds] - if leaked_files: - error = [] - error.append("***** %s FD leakage detected" % len(leaked_files)) - error.extend([str(f) for f in leaked_files]) - error.append("*** Before:") - error.extend([str(f) for f in lines1]) - error.append("*** After:") - error.extend([str(f) for f in lines2]) - error.append(error[0]) - error.append("*** function %s:%s: %s " % item.location) - error.append("See issue #2366") - item.warn('', "\n".join(error)) - - -# XXX copied from execnet's conftest.py - needs to be merged -winpymap = { - 'python2.7': r'C:\Python27\python.exe', - 'python2.6': r'C:\Python26\python.exe', - 'python3.1': r'C:\Python31\python.exe', - 'python3.2': r'C:\Python32\python.exe', - 'python3.3': r'C:\Python33\python.exe', - 'python3.4': r'C:\Python34\python.exe', - 'python3.5': r'C:\Python35\python.exe', -} - - -def getexecutable(name, cache={}): - try: - return cache[name] - except KeyError: - executable = py.path.local.sysfind(name) - if executable: - import subprocess - popen = subprocess.Popen([str(executable), "--version"], - universal_newlines=True, stderr=subprocess.PIPE) - out, err = popen.communicate() - if name == "jython": - if not err or "2.5" not in err: - executable = None - if "2.5.2" in err: - executable = None # http://bugs.jython.org/issue1790 - elif popen.returncode != 0: - # Handle pyenv's 127. - executable = None - cache[name] = executable - return executable - - -@pytest.fixture(params=['python2.6', 'python2.7', 'python3.3', "python3.4", - 'pypy', 'pypy3']) -def anypython(request): - name = request.param - executable = getexecutable(name) - if executable is None: - if sys.platform == "win32": - executable = winpymap.get(name, None) - if executable: - executable = py.path.local(executable) - if executable.check(): - return executable - pytest.skip("no suitable %s found" % (name,)) - return executable - -# used at least by pytest-xdist plugin - - -@pytest.fixture -def _pytest(request): - """ Return a helper which offers a gethookrecorder(hook) - method which returns a HookRecorder instance which helps - to make assertions about called hooks. - """ - return PytestArg(request) - - -class PytestArg: - def __init__(self, request): - self.request = request - - def gethookrecorder(self, hook): - hookrecorder = HookRecorder(hook._pm) - self.request.addfinalizer(hookrecorder.finish_recording) - return hookrecorder - - -def get_public_names(values): - """Only return names from iterator values without a leading underscore.""" - return [x for x in values if x[0] != "_"] - - -class ParsedCall: - def __init__(self, name, kwargs): - self.__dict__.update(kwargs) - self._name = name - - def __repr__(self): - d = self.__dict__.copy() - del d['_name'] - return "" % (self._name, d) - - -class HookRecorder: - """Record all hooks called in a plugin manager. - - This wraps all the hook calls in the plugin manager, recording - each call before propagating the normal calls. - - """ - - def __init__(self, pluginmanager): - self._pluginmanager = pluginmanager - self.calls = [] - - def before(hook_name, hook_impls, kwargs): - self.calls.append(ParsedCall(hook_name, kwargs)) - - def after(outcome, hook_name, hook_impls, kwargs): - pass - - self._undo_wrapping = pluginmanager.add_hookcall_monitoring(before, after) - - def finish_recording(self): - self._undo_wrapping() - - def getcalls(self, names): - if isinstance(names, str): - names = names.split() - return [call for call in self.calls if call._name in names] - - def assert_contains(self, entries): - __tracebackhide__ = True - i = 0 - entries = list(entries) - backlocals = sys._getframe(1).f_locals - while entries: - name, check = entries.pop(0) - for ind, call in enumerate(self.calls[i:]): - if call._name == name: - print("NAMEMATCH", name, call) - if eval(check, backlocals, call.__dict__): - print("CHECKERMATCH", repr(check), "->", call) - else: - print("NOCHECKERMATCH", repr(check), "-", call) - continue - i += ind + 1 - break - print("NONAMEMATCH", name, "with", call) - else: - pytest.fail("could not find %r check %r" % (name, check)) - - def popcall(self, name): - __tracebackhide__ = True - for i, call in enumerate(self.calls): - if call._name == name: - del self.calls[i] - return call - lines = ["could not find call %r, in:" % (name,)] - lines.extend([" %s" % str(x) for x in self.calls]) - pytest.fail("\n".join(lines)) - - def getcall(self, name): - values = self.getcalls(name) - assert len(values) == 1, (name, values) - return values[0] - - # functionality for test reports - - def getreports(self, - names="pytest_runtest_logreport pytest_collectreport"): - return [x.report for x in self.getcalls(names)] - - def matchreport(self, inamepart="", - names="pytest_runtest_logreport pytest_collectreport", when=None): - """ return a testreport whose dotted import path matches """ - values = [] - for rep in self.getreports(names=names): - try: - if not when and rep.when != "call" and rep.passed: - # setup/teardown passing reports - let's ignore those - continue - except AttributeError: - pass - if when and getattr(rep, 'when', None) != when: - continue - if not inamepart or inamepart in rep.nodeid.split("::"): - values.append(rep) - if not values: - raise ValueError("could not find test report matching %r: " - "no test reports at all!" % (inamepart,)) - if len(values) > 1: - raise ValueError( - "found 2 or more testreports matching %r: %s" % (inamepart, values)) - return values[0] - - def getfailures(self, - names='pytest_runtest_logreport pytest_collectreport'): - return [rep for rep in self.getreports(names) if rep.failed] - - def getfailedcollections(self): - return self.getfailures('pytest_collectreport') - - def listoutcomes(self): - passed = [] - skipped = [] - failed = [] - for rep in self.getreports( - "pytest_collectreport pytest_runtest_logreport"): - if rep.passed: - if getattr(rep, "when", None) == "call": - passed.append(rep) - elif rep.skipped: - skipped.append(rep) - elif rep.failed: - failed.append(rep) - return passed, skipped, failed - - def countoutcomes(self): - return [len(x) for x in self.listoutcomes()] - - def assertoutcome(self, passed=0, skipped=0, failed=0): - realpassed, realskipped, realfailed = self.listoutcomes() - assert passed == len(realpassed) - assert skipped == len(realskipped) - assert failed == len(realfailed) - - def clear(self): - self.calls[:] = [] - - -@pytest.fixture -def linecomp(request): - return LineComp() - - -@pytest.fixture(name='LineMatcher') -def LineMatcher_fixture(request): - return LineMatcher - - -@pytest.fixture -def testdir(request, tmpdir_factory): - return Testdir(request, tmpdir_factory) - - -rex_outcome = re.compile(r"(\d+) ([\w-]+)") - - -class RunResult: - """The result of running a command. - - Attributes: - - :ret: The return value. - :outlines: List of lines captured from stdout. - :errlines: List of lines captures from stderr. - :stdout: :py:class:`LineMatcher` of stdout, use ``stdout.str()`` to - reconstruct stdout or the commonly used - ``stdout.fnmatch_lines()`` method. - :stderrr: :py:class:`LineMatcher` of stderr. - :duration: Duration in seconds. - - """ - - def __init__(self, ret, outlines, errlines, duration): - self.ret = ret - self.outlines = outlines - self.errlines = errlines - self.stdout = LineMatcher(outlines) - self.stderr = LineMatcher(errlines) - self.duration = duration - - def parseoutcomes(self): - """ Return a dictionary of outcomestring->num from parsing - the terminal output that the test process produced.""" - for line in reversed(self.outlines): - if 'seconds' in line: - outcomes = rex_outcome.findall(line) - if outcomes: - d = {} - for num, cat in outcomes: - d[cat] = int(num) - return d - raise ValueError("Pytest terminal report not found") - - def assert_outcomes(self, passed=0, skipped=0, failed=0, error=0): - """ assert that the specified outcomes appear with the respective - numbers (0 means it didn't occur) in the text output from a test run.""" - d = self.parseoutcomes() - obtained = { - 'passed': d.get('passed', 0), - 'skipped': d.get('skipped', 0), - 'failed': d.get('failed', 0), - 'error': d.get('error', 0), - } - assert obtained == dict(passed=passed, skipped=skipped, failed=failed, error=error) - - -class Testdir: - """Temporary test directory with tools to test/run pytest itself. - - This is based on the ``tmpdir`` fixture but provides a number of - methods which aid with testing pytest itself. Unless - :py:meth:`chdir` is used all methods will use :py:attr:`tmpdir` as - current working directory. - - Attributes: - - :tmpdir: The :py:class:`py.path.local` instance of the temporary - directory. - - :plugins: A list of plugins to use with :py:meth:`parseconfig` and - :py:meth:`runpytest`. Initially this is an empty list but - plugins can be added to the list. The type of items to add to - the list depend on the method which uses them so refer to them - for details. - - """ - - def __init__(self, request, tmpdir_factory): - self.request = request - self._mod_collections = WeakKeyDictionary() - # XXX remove duplication with tmpdir plugin - basetmp = tmpdir_factory.ensuretemp("testdir") - name = request.function.__name__ - for i in range(100): - try: - tmpdir = basetmp.mkdir(name + str(i)) - except py.error.EEXIST: - continue - break - self.tmpdir = tmpdir - self.plugins = [] - self._savesyspath = (list(sys.path), list(sys.meta_path)) - self._savemodulekeys = set(sys.modules) - self.chdir() # always chdir - self.request.addfinalizer(self.finalize) - method = self.request.config.getoption("--runpytest") - if method == "inprocess": - self._runpytest_method = self.runpytest_inprocess - elif method == "subprocess": - self._runpytest_method = self.runpytest_subprocess - - def __repr__(self): - return "" % (self.tmpdir,) - - def finalize(self): - """Clean up global state artifacts. - - Some methods modify the global interpreter state and this - tries to clean this up. It does not remove the temporary - directory however so it can be looked at after the test run - has finished. - - """ - sys.path[:], sys.meta_path[:] = self._savesyspath - if hasattr(self, '_olddir'): - self._olddir.chdir() - self.delete_loaded_modules() - - def delete_loaded_modules(self): - """Delete modules that have been loaded during a test. - - This allows the interpreter to catch module changes in case - the module is re-imported. - """ - for name in set(sys.modules).difference(self._savemodulekeys): - # some zope modules used by twisted-related tests keeps internal - # state and can't be deleted; we had some trouble in the past - # with zope.interface for example - if not name.startswith("zope"): - del sys.modules[name] - - def make_hook_recorder(self, pluginmanager): - """Create a new :py:class:`HookRecorder` for a PluginManager.""" - assert not hasattr(pluginmanager, "reprec") - pluginmanager.reprec = reprec = HookRecorder(pluginmanager) - self.request.addfinalizer(reprec.finish_recording) - return reprec - - def chdir(self): - """Cd into the temporary directory. - - This is done automatically upon instantiation. - - """ - old = self.tmpdir.chdir() - if not hasattr(self, '_olddir'): - self._olddir = old - - def _makefile(self, ext, args, kwargs, encoding="utf-8"): - items = list(kwargs.items()) - if args: - source = py.builtin._totext("\n").join( - map(py.builtin._totext, args)) + py.builtin._totext("\n") - basename = self.request.function.__name__ - items.insert(0, (basename, source)) - ret = None - for name, value in items: - p = self.tmpdir.join(name).new(ext=ext) - p.dirpath().ensure_dir() - source = Source(value) - - def my_totext(s, encoding="utf-8"): - if py.builtin._isbytes(s): - s = py.builtin._totext(s, encoding=encoding) - return s - - source_unicode = "\n".join([my_totext(line) for line in source.lines]) - source = py.builtin._totext(source_unicode) - content = source.strip().encode(encoding) # + "\n" - # content = content.rstrip() + "\n" - p.write(content, "wb") - if ret is None: - ret = p - return ret - - def makefile(self, ext, *args, **kwargs): - """Create a new file in the testdir. - - ext: The extension the file should use, including the dot. - E.g. ".py". - - args: All args will be treated as strings and joined using - newlines. The result will be written as contents to the - file. The name of the file will be based on the test - function requesting this fixture. - E.g. "testdir.makefile('.txt', 'line1', 'line2')" - - kwargs: Each keyword is the name of a file, while the value of - it will be written as contents of the file. - E.g. "testdir.makefile('.ini', pytest='[pytest]\naddopts=-rs\n')" - - """ - return self._makefile(ext, args, kwargs) - - def makeconftest(self, source): - """Write a contest.py file with 'source' as contents.""" - return self.makepyfile(conftest=source) - - def makeini(self, source): - """Write a tox.ini file with 'source' as contents.""" - return self.makefile('.ini', tox=source) - - def getinicfg(self, source): - """Return the pytest section from the tox.ini config file.""" - p = self.makeini(source) - return py.iniconfig.IniConfig(p)['pytest'] - - def makepyfile(self, *args, **kwargs): - """Shortcut for .makefile() with a .py extension.""" - return self._makefile('.py', args, kwargs) - - def maketxtfile(self, *args, **kwargs): - """Shortcut for .makefile() with a .txt extension.""" - return self._makefile('.txt', args, kwargs) - - def syspathinsert(self, path=None): - """Prepend a directory to sys.path, defaults to :py:attr:`tmpdir`. - - This is undone automatically after the test. - """ - if path is None: - path = self.tmpdir - sys.path.insert(0, str(path)) - # a call to syspathinsert() usually means that the caller - # wants to import some dynamically created files. - # with python3 we thus invalidate import caches. - self._possibly_invalidate_import_caches() - - def _possibly_invalidate_import_caches(self): - # invalidate caches if we can (py33 and above) - try: - import importlib - except ImportError: - pass - else: - if hasattr(importlib, "invalidate_caches"): - importlib.invalidate_caches() - - def mkdir(self, name): - """Create a new (sub)directory.""" - return self.tmpdir.mkdir(name) - - def mkpydir(self, name): - """Create a new python package. - - This creates a (sub)directory with an empty ``__init__.py`` - file so that is recognised as a python package. - - """ - p = self.mkdir(name) - p.ensure("__init__.py") - return p - - Session = Session - - def getnode(self, config, arg): - """Return the collection node of a file. - - :param config: :py:class:`_pytest.config.Config` instance, see - :py:meth:`parseconfig` and :py:meth:`parseconfigure` to - create the configuration. - - :param arg: A :py:class:`py.path.local` instance of the file. - - """ - session = Session(config) - assert '::' not in str(arg) - p = py.path.local(arg) - config.hook.pytest_sessionstart(session=session) - res = session.perform_collect([str(p)], genitems=False)[0] - config.hook.pytest_sessionfinish(session=session, exitstatus=EXIT_OK) - return res - - def getpathnode(self, path): - """Return the collection node of a file. - - This is like :py:meth:`getnode` but uses - :py:meth:`parseconfigure` to create the (configured) pytest - Config instance. - - :param path: A :py:class:`py.path.local` instance of the file. - - """ - config = self.parseconfigure(path) - session = Session(config) - x = session.fspath.bestrelpath(path) - config.hook.pytest_sessionstart(session=session) - res = session.perform_collect([x], genitems=False)[0] - config.hook.pytest_sessionfinish(session=session, exitstatus=EXIT_OK) - return res - - def genitems(self, colitems): - """Generate all test items from a collection node. - - This recurses into the collection node and returns a list of - all the test items contained within. - - """ - session = colitems[0].session - result = [] - for colitem in colitems: - result.extend(session.genitems(colitem)) - return result - - def runitem(self, source): - """Run the "test_func" Item. - - The calling test instance (the class which contains the test - method) must provide a ``.getrunner()`` method which should - return a runner which can run the test protocol for a single - item, like e.g. :py:func:`_pytest.runner.runtestprotocol`. - - """ - # used from runner functional tests - item = self.getitem(source) - # the test class where we are called from wants to provide the runner - testclassinstance = self.request.instance - runner = testclassinstance.getrunner() - return runner(item) - - def inline_runsource(self, source, *cmdlineargs): - """Run a test module in process using ``pytest.main()``. - - This run writes "source" into a temporary file and runs - ``pytest.main()`` on it, returning a :py:class:`HookRecorder` - instance for the result. - - :param source: The source code of the test module. - - :param cmdlineargs: Any extra command line arguments to use. - - :return: :py:class:`HookRecorder` instance of the result. - - """ - p = self.makepyfile(source) - values = list(cmdlineargs) + [p] - return self.inline_run(*values) - - def inline_genitems(self, *args): - """Run ``pytest.main(['--collectonly'])`` in-process. - - Returns a tuple of the collected items and a - :py:class:`HookRecorder` instance. - - This runs the :py:func:`pytest.main` function to run all of - pytest inside the test process itself like - :py:meth:`inline_run`. However the return value is a tuple of - the collection items and a :py:class:`HookRecorder` instance. - - """ - rec = self.inline_run("--collect-only", *args) - items = [x.item for x in rec.getcalls("pytest_itemcollected")] - return items, rec - - def inline_run(self, *args, **kwargs): - """Run ``pytest.main()`` in-process, returning a HookRecorder. - - This runs the :py:func:`pytest.main` function to run all of - pytest inside the test process itself. This means it can - return a :py:class:`HookRecorder` instance which gives more - detailed results from then run then can be done by matching - stdout/stderr from :py:meth:`runpytest`. - - :param args: Any command line arguments to pass to - :py:func:`pytest.main`. - - :param plugin: (keyword-only) Extra plugin instances the - ``pytest.main()`` instance should use. - - :return: A :py:class:`HookRecorder` instance. - """ - # When running py.test inline any plugins active in the main - # test process are already imported. So this disables the - # warning which will trigger to say they can no longer be - # re-written, which is fine as they are already re-written. - orig_warn = AssertionRewritingHook._warn_already_imported - - def revert(): - AssertionRewritingHook._warn_already_imported = orig_warn - - self.request.addfinalizer(revert) - AssertionRewritingHook._warn_already_imported = lambda *a: None - - rec = [] - - class Collect: - def pytest_configure(x, config): - rec.append(self.make_hook_recorder(config.pluginmanager)) - - plugins = kwargs.get("plugins") or [] - plugins.append(Collect()) - ret = pytest.main(list(args), plugins=plugins) - self.delete_loaded_modules() - if len(rec) == 1: - reprec = rec.pop() - else: - class reprec: - pass - reprec.ret = ret - - # typically we reraise keyboard interrupts from the child run - # because it's our user requesting interruption of the testing - if ret == 2 and not kwargs.get("no_reraise_ctrlc"): - calls = reprec.getcalls("pytest_keyboard_interrupt") - if calls and calls[-1].excinfo.type == KeyboardInterrupt: - raise KeyboardInterrupt() - return reprec - - def runpytest_inprocess(self, *args, **kwargs): - """ Return result of running pytest in-process, providing a similar - interface to what self.runpytest() provides. """ - if kwargs.get("syspathinsert"): - self.syspathinsert() - now = time.time() - capture = MultiCapture(Capture=SysCapture) - capture.start_capturing() - try: - try: - reprec = self.inline_run(*args, **kwargs) - except SystemExit as e: - - class reprec: - ret = e.args[0] - - except Exception: - traceback.print_exc() - - class reprec: - ret = 3 - finally: - out, err = capture.readouterr() - capture.stop_capturing() - sys.stdout.write(out) - sys.stderr.write(err) - - res = RunResult(reprec.ret, - out.split("\n"), err.split("\n"), - time.time() - now) - res.reprec = reprec - return res - - def runpytest(self, *args, **kwargs): - """ Run pytest inline or in a subprocess, depending on the command line - option "--runpytest" and return a :py:class:`RunResult`. - - """ - args = self._ensure_basetemp(args) - return self._runpytest_method(*args, **kwargs) - - def _ensure_basetemp(self, args): - args = [str(x) for x in args] - for x in args: - if str(x).startswith('--basetemp'): - # print("basedtemp exists: %s" %(args,)) - break - else: - args.append("--basetemp=%s" % self.tmpdir.dirpath('basetemp')) - # print("added basetemp: %s" %(args,)) - return args - - def parseconfig(self, *args): - """Return a new pytest Config instance from given commandline args. - - This invokes the pytest bootstrapping code in _pytest.config - to create a new :py:class:`_pytest.core.PluginManager` and - call the pytest_cmdline_parse hook to create new - :py:class:`_pytest.config.Config` instance. - - If :py:attr:`plugins` has been populated they should be plugin - modules which will be registered with the PluginManager. - - """ - args = self._ensure_basetemp(args) - - import _pytest.config - config = _pytest.config._prepareconfig(args, self.plugins) - # we don't know what the test will do with this half-setup config - # object and thus we make sure it gets unconfigured properly in any - # case (otherwise capturing could still be active, for example) - self.request.addfinalizer(config._ensure_unconfigure) - return config - - def parseconfigure(self, *args): - """Return a new pytest configured Config instance. - - This returns a new :py:class:`_pytest.config.Config` instance - like :py:meth:`parseconfig`, but also calls the - pytest_configure hook. - - """ - config = self.parseconfig(*args) - config._do_configure() - self.request.addfinalizer(config._ensure_unconfigure) - return config - - def getitem(self, source, funcname="test_func"): - """Return the test item for a test function. - - This writes the source to a python file and runs pytest's - collection on the resulting module, returning the test item - for the requested function name. - - :param source: The module source. - - :param funcname: The name of the test function for which the - Item must be returned. - - """ - items = self.getitems(source) - for item in items: - if item.name == funcname: - return item - assert 0, "%r item not found in module:\n%s\nitems: %s" % ( - funcname, source, items) - - def getitems(self, source): - """Return all test items collected from the module. - - This writes the source to a python file and runs pytest's - collection on the resulting module, returning all test items - contained within. - - """ - modcol = self.getmodulecol(source) - return self.genitems([modcol]) - - def getmodulecol(self, source, configargs=(), withinit=False): - """Return the module collection node for ``source``. - - This writes ``source`` to a file using :py:meth:`makepyfile` - and then runs the pytest collection on it, returning the - collection node for the test module. - - :param source: The source code of the module to collect. - - :param configargs: Any extra arguments to pass to - :py:meth:`parseconfigure`. - - :param withinit: Whether to also write a ``__init__.py`` file - to the temporary directory to ensure it is a package. - - """ - kw = {self.request.function.__name__: Source(source).strip()} - path = self.makepyfile(**kw) - if withinit: - self.makepyfile(__init__="#") - self.config = config = self.parseconfigure(path, *configargs) - node = self.getnode(config, path) - - return node - - def collect_by_name(self, modcol, name): - """Return the collection node for name from the module collection. - - This will search a module collection node for a collection - node matching the given name. - - :param modcol: A module collection node, see - :py:meth:`getmodulecol`. - - :param name: The name of the node to return. - - """ - if modcol not in self._mod_collections: - self._mod_collections[modcol] = list(modcol.collect()) - for colitem in self._mod_collections[modcol]: - if colitem.name == name: - return colitem - - def popen(self, cmdargs, stdout, stderr, **kw): - """Invoke subprocess.Popen. - - This calls subprocess.Popen making sure the current working - directory is the PYTHONPATH. - - You probably want to use :py:meth:`run` instead. - - """ - env = os.environ.copy() - env['PYTHONPATH'] = os.pathsep.join(filter(None, [ - str(os.getcwd()), env.get('PYTHONPATH', '')])) - kw['env'] = env - - popen = subprocess.Popen(cmdargs, stdin=subprocess.PIPE, stdout=stdout, stderr=stderr, **kw) - popen.stdin.close() - - return popen - - def run(self, *cmdargs): - """Run a command with arguments. - - Run a process using subprocess.Popen saving the stdout and - stderr. - - Returns a :py:class:`RunResult`. - - """ - return self._run(*cmdargs) - - def _run(self, *cmdargs): - cmdargs = [str(x) for x in cmdargs] - p1 = self.tmpdir.join("stdout") - p2 = self.tmpdir.join("stderr") - print("running:", ' '.join(cmdargs)) - print(" in:", str(py.path.local())) - f1 = codecs.open(str(p1), "w", encoding="utf8") - f2 = codecs.open(str(p2), "w", encoding="utf8") - try: - now = time.time() - popen = self.popen(cmdargs, stdout=f1, stderr=f2, - close_fds=(sys.platform != "win32")) - ret = popen.wait() - finally: - f1.close() - f2.close() - f1 = codecs.open(str(p1), "r", encoding="utf8") - f2 = codecs.open(str(p2), "r", encoding="utf8") - try: - out = f1.read().splitlines() - err = f2.read().splitlines() - finally: - f1.close() - f2.close() - self._dump_lines(out, sys.stdout) - self._dump_lines(err, sys.stderr) - return RunResult(ret, out, err, time.time() - now) - - def _dump_lines(self, lines, fp): - try: - for line in lines: - print(line, file=fp) - except UnicodeEncodeError: - print("couldn't print to %s because of encoding" % (fp,)) - - def _getpytestargs(self): - # we cannot use "(sys.executable,script)" - # because on windows the script is e.g. a pytest.exe - return (sys.executable, _pytest_fullpath,) # noqa - - def runpython(self, script): - """Run a python script using sys.executable as interpreter. - - Returns a :py:class:`RunResult`. - """ - return self.run(sys.executable, script) - - def runpython_c(self, command): - """Run python -c "command", return a :py:class:`RunResult`.""" - return self.run(sys.executable, "-c", command) - - def runpytest_subprocess(self, *args, **kwargs): - """Run pytest as a subprocess with given arguments. - - Any plugins added to the :py:attr:`plugins` list will added - using the ``-p`` command line option. Addtionally - ``--basetemp`` is used put any temporary files and directories - in a numbered directory prefixed with "runpytest-" so they do - not conflict with the normal numberd pytest location for - temporary files and directories. - - Returns a :py:class:`RunResult`. - - """ - p = py.path.local.make_numbered_dir(prefix="runpytest-", - keep=None, rootdir=self.tmpdir) - args = ('--basetemp=%s' % p, ) + args - # for x in args: - # if '--confcutdir' in str(x): - # break - # else: - # pass - # args = ('--confcutdir=.',) + args - plugins = [x for x in self.plugins if isinstance(x, str)] - if plugins: - args = ('-p', plugins[0]) + args - args = self._getpytestargs() + args - return self.run(*args) - - def spawn_pytest(self, string, expect_timeout=10.0): - """Run pytest using pexpect. - - This makes sure to use the right pytest and sets up the - temporary directory locations. - - The pexpect child is returned. - - """ - basetemp = self.tmpdir.mkdir("temp-pexpect") - invoke = " ".join(map(str, self._getpytestargs())) - cmd = "%s --basetemp=%s %s" % (invoke, basetemp, string) - return self.spawn(cmd, expect_timeout=expect_timeout) - - def spawn(self, cmd, expect_timeout=10.0): - """Run a command using pexpect. - - The pexpect child is returned. - """ - pexpect = pytest.importorskip("pexpect", "3.0") - if hasattr(sys, 'pypy_version_info') and '64' in platform.machine(): - pytest.skip("pypy-64 bit not supported") - if sys.platform.startswith("freebsd"): - pytest.xfail("pexpect does not work reliably on freebsd") - logfile = self.tmpdir.join("spawn.out").open("wb") - child = pexpect.spawn(cmd, logfile=logfile) - self.request.addfinalizer(logfile.close) - child.timeout = expect_timeout - return child - - -def getdecoded(out): - try: - return out.decode("utf-8") - except UnicodeDecodeError: - return "INTERNAL not-utf8-decodeable, truncated string:\n%s" % ( - py.io.saferepr(out),) - - -class LineComp: - def __init__(self): - self.stringio = py.io.TextIO() - - def assert_contains_lines(self, lines2): - """ assert that lines2 are contained (linearly) in lines1. - return a list of extralines found. - """ - __tracebackhide__ = True - val = self.stringio.getvalue() - self.stringio.truncate(0) - self.stringio.seek(0) - lines1 = val.split("\n") - return LineMatcher(lines1).fnmatch_lines(lines2) - - -class LineMatcher: - """Flexible matching of text. - - This is a convenience class to test large texts like the output of - commands. - - The constructor takes a list of lines without their trailing - newlines, i.e. ``text.splitlines()``. - - """ - - def __init__(self, lines): - self.lines = lines - self._log_output = [] - - def str(self): - """Return the entire original text.""" - return "\n".join(self.lines) - - def _getlines(self, lines2): - if isinstance(lines2, str): - lines2 = Source(lines2) - if isinstance(lines2, Source): - lines2 = lines2.strip().lines - return lines2 - - def fnmatch_lines_random(self, lines2): - """Check lines exist in the output. - - The argument is a list of lines which have to occur in the - output, in any order. Each line can contain glob whildcards. - - """ - lines2 = self._getlines(lines2) - for line in lines2: - for x in self.lines: - if line == x or fnmatch(x, line): - self._log("matched: ", repr(line)) - break - else: - self._log("line %r not found in output" % line) - raise ValueError(self._log_text) - - def get_lines_after(self, fnline): - """Return all lines following the given line in the text. - - The given line can contain glob wildcards. - """ - for i, line in enumerate(self.lines): - if fnline == line or fnmatch(line, fnline): - return self.lines[i + 1:] - raise ValueError("line %r not found in output" % fnline) - - def _log(self, *args): - self._log_output.append(' '.join((str(x) for x in args))) - - @property - def _log_text(self): - return '\n'.join(self._log_output) - - def fnmatch_lines(self, lines2): - """Search the text for matching lines. - - The argument is a list of lines which have to match and can - use glob wildcards. If they do not match an pytest.fail() is - called. The matches and non-matches are also printed on - stdout. - - """ - lines2 = self._getlines(lines2) - lines1 = self.lines[:] - nextline = None - extralines = [] - __tracebackhide__ = True - for line in lines2: - nomatchprinted = False - while lines1: - nextline = lines1.pop(0) - if line == nextline: - self._log("exact match:", repr(line)) - break - elif fnmatch(nextline, line): - self._log("fnmatch:", repr(line)) - self._log(" with:", repr(nextline)) - break - else: - if not nomatchprinted: - self._log("nomatch:", repr(line)) - nomatchprinted = True - self._log(" and:", repr(nextline)) - extralines.append(nextline) - else: - self._log("remains unmatched: %r" % (line,)) - pytest.fail(self._log_text) diff --git a/lib/spack/external/_pytest/python.py b/lib/spack/external/_pytest/python.py deleted file mode 100644 index 41fd2bdb7f..0000000000 --- a/lib/spack/external/_pytest/python.py +++ /dev/null @@ -1,1173 +0,0 @@ -""" Python test discovery, setup and run of test functions. """ -from __future__ import absolute_import, division, print_function - -import fnmatch -import inspect -import sys -import os -import collections -from textwrap import dedent -from itertools import count - -import py -from _pytest.mark import MarkerError -from _pytest.config import hookimpl - -import _pytest -import _pytest._pluggy as pluggy -from _pytest import fixtures -from _pytest import main -from _pytest.compat import ( - isclass, isfunction, is_generator, _ascii_escaped, - REGEX_TYPE, STRING_TYPES, NoneType, NOTSET, - get_real_func, getfslineno, safe_getattr, - safe_str, getlocation, enum, -) -from _pytest.outcomes import fail -from _pytest.mark import transfer_markers - -cutdir1 = py.path.local(pluggy.__file__.rstrip("oc")) -cutdir2 = py.path.local(_pytest.__file__).dirpath() -cutdir3 = py.path.local(py.__file__).dirpath() - - -def filter_traceback(entry): - """Return True if a TracebackEntry instance should be removed from tracebacks: - * dynamically generated code (no code to show up for it); - * internal traceback from pytest or its internal libraries, py and pluggy. - """ - # entry.path might sometimes return a str object when the entry - # points to dynamically generated code - # see https://bitbucket.org/pytest-dev/py/issues/71 - raw_filename = entry.frame.code.raw.co_filename - is_generated = '<' in raw_filename and '>' in raw_filename - if is_generated: - return False - # entry.path might point to an inexisting file, in which case it will - # alsso return a str object. see #1133 - p = py.path.local(entry.path) - return p != cutdir1 and not p.relto(cutdir2) and not p.relto(cutdir3) - - -def pyobj_property(name): - def get(self): - node = self.getparent(getattr(__import__('pytest'), name)) - if node is not None: - return node.obj - doc = "python %s object this node was collected from (can be None)." % ( - name.lower(),) - return property(get, None, None, doc) - - -def pytest_addoption(parser): - group = parser.getgroup("general") - group.addoption('--fixtures', '--funcargs', - action="store_true", dest="showfixtures", default=False, - help="show available fixtures, sorted by plugin appearance") - group.addoption( - '--fixtures-per-test', - action="store_true", - dest="show_fixtures_per_test", - default=False, - help="show fixtures per test", - ) - parser.addini("usefixtures", type="args", default=[], - help="list of default fixtures to be used with this project") - parser.addini("python_files", type="args", - default=['test_*.py', '*_test.py'], - help="glob-style file patterns for Python test module discovery") - parser.addini("python_classes", type="args", default=["Test", ], - help="prefixes or glob names for Python test class discovery") - parser.addini("python_functions", type="args", default=["test", ], - help="prefixes or glob names for Python test function and " - "method discovery") - - group.addoption("--import-mode", default="prepend", - choices=["prepend", "append"], dest="importmode", - help="prepend/append to sys.path when importing test modules, " - "default is to prepend.") - - -def pytest_cmdline_main(config): - if config.option.showfixtures: - showfixtures(config) - return 0 - if config.option.show_fixtures_per_test: - show_fixtures_per_test(config) - return 0 - - -def pytest_generate_tests(metafunc): - # those alternative spellings are common - raise a specific error to alert - # the user - alt_spellings = ['parameterize', 'parametrise', 'parameterise'] - for attr in alt_spellings: - if hasattr(metafunc.function, attr): - msg = "{0} has '{1}', spelling should be 'parametrize'" - raise MarkerError(msg.format(metafunc.function.__name__, attr)) - try: - markers = metafunc.function.parametrize - except AttributeError: - return - for marker in markers: - metafunc.parametrize(*marker.args, **marker.kwargs) - - -def pytest_configure(config): - config.addinivalue_line("markers", - "parametrize(argnames, argvalues): call a test function multiple " - "times passing in different arguments in turn. argvalues generally " - "needs to be a list of values if argnames specifies only one name " - "or a list of tuples of values if argnames specifies multiple names. " - "Example: @parametrize('arg1', [1,2]) would lead to two calls of the " - "decorated test function, one with arg1=1 and another with arg1=2." - "see http://pytest.org/latest/parametrize.html for more info and " - "examples." - ) - config.addinivalue_line("markers", - "usefixtures(fixturename1, fixturename2, ...): mark tests as needing " - "all of the specified fixtures. see http://pytest.org/latest/fixture.html#usefixtures " - ) - - -@hookimpl(trylast=True) -def pytest_pyfunc_call(pyfuncitem): - testfunction = pyfuncitem.obj - if pyfuncitem._isyieldedfunction(): - testfunction(*pyfuncitem._args) - else: - funcargs = pyfuncitem.funcargs - testargs = {} - for arg in pyfuncitem._fixtureinfo.argnames: - testargs[arg] = funcargs[arg] - testfunction(**testargs) - return True - - -def pytest_collect_file(path, parent): - ext = path.ext - if ext == ".py": - if not parent.session.isinitpath(path): - for pat in parent.config.getini('python_files'): - if path.fnmatch(pat): - break - else: - return - ihook = parent.session.gethookproxy(path) - return ihook.pytest_pycollect_makemodule(path=path, parent=parent) - - -def pytest_pycollect_makemodule(path, parent): - return Module(path, parent) - - -@hookimpl(hookwrapper=True) -def pytest_pycollect_makeitem(collector, name, obj): - outcome = yield - res = outcome.get_result() - if res is not None: - return - # nothing was collected elsewhere, let's do it here - if isclass(obj): - if collector.istestclass(obj, name): - Class = collector._getcustomclass("Class") - outcome.force_result(Class(name, parent=collector)) - elif collector.istestfunction(obj, name): - # mock seems to store unbound methods (issue473), normalize it - obj = getattr(obj, "__func__", obj) - # We need to try and unwrap the function if it's a functools.partial - # or a funtools.wrapped. - # We musn't if it's been wrapped with mock.patch (python 2 only) - if not (isfunction(obj) or isfunction(get_real_func(obj))): - collector.warn(code="C2", message="cannot collect %r because it is not a function." - % name, ) - elif getattr(obj, "__test__", True): - if is_generator(obj): - res = Generator(name, parent=collector) - else: - res = list(collector._genfunctions(name, obj)) - outcome.force_result(res) - - -def pytest_make_parametrize_id(config, val, argname=None): - return None - - -class PyobjContext(object): - module = pyobj_property("Module") - cls = pyobj_property("Class") - instance = pyobj_property("Instance") - - -class PyobjMixin(PyobjContext): - def obj(): - def fget(self): - obj = getattr(self, '_obj', None) - if obj is None: - self._obj = obj = self._getobj() - return obj - - def fset(self, value): - self._obj = value - - return property(fget, fset, None, "underlying python object") - - obj = obj() - - def _getobj(self): - return getattr(self.parent.obj, self.name) - - def getmodpath(self, stopatmodule=True, includemodule=False): - """ return python path relative to the containing module. """ - chain = self.listchain() - chain.reverse() - parts = [] - for node in chain: - if isinstance(node, Instance): - continue - name = node.name - if isinstance(node, Module): - name = os.path.splitext(name)[0] - if stopatmodule: - if includemodule: - parts.append(name) - break - parts.append(name) - parts.reverse() - s = ".".join(parts) - return s.replace(".[", "[") - - def _getfslineno(self): - return getfslineno(self.obj) - - def reportinfo(self): - # XXX caching? - obj = self.obj - compat_co_firstlineno = getattr(obj, 'compat_co_firstlineno', None) - if isinstance(compat_co_firstlineno, int): - # nose compatibility - fspath = sys.modules[obj.__module__].__file__ - if fspath.endswith(".pyc"): - fspath = fspath[:-1] - lineno = compat_co_firstlineno - else: - fspath, lineno = getfslineno(obj) - modpath = self.getmodpath() - assert isinstance(lineno, int) - return fspath, lineno, modpath - - -class PyCollector(PyobjMixin, main.Collector): - - def funcnamefilter(self, name): - return self._matches_prefix_or_glob_option('python_functions', name) - - def isnosetest(self, obj): - """ Look for the __test__ attribute, which is applied by the - @nose.tools.istest decorator - """ - # We explicitly check for "is True" here to not mistakenly treat - # classes with a custom __getattr__ returning something truthy (like a - # function) as test classes. - return safe_getattr(obj, '__test__', False) is True - - def classnamefilter(self, name): - return self._matches_prefix_or_glob_option('python_classes', name) - - def istestfunction(self, obj, name): - if self.funcnamefilter(name) or self.isnosetest(obj): - if isinstance(obj, staticmethod): - # static methods need to be unwrapped - obj = safe_getattr(obj, '__func__', False) - if obj is False: - # Python 2.6 wraps in a different way that we won't try to handle - msg = "cannot collect static method %r because " \ - "it is not a function (always the case in Python 2.6)" - self.warn( - code="C2", message=msg % name) - return False - return ( - safe_getattr(obj, "__call__", False) and fixtures.getfixturemarker(obj) is None - ) - else: - return False - - def istestclass(self, obj, name): - return self.classnamefilter(name) or self.isnosetest(obj) - - def _matches_prefix_or_glob_option(self, option_name, name): - """ - checks if the given name matches the prefix or glob-pattern defined - in ini configuration. - """ - for option in self.config.getini(option_name): - if name.startswith(option): - return True - # check that name looks like a glob-string before calling fnmatch - # because this is called for every name in each collected module, - # and fnmatch is somewhat expensive to call - elif ('*' in option or '?' in option or '[' in option) and \ - fnmatch.fnmatch(name, option): - return True - return False - - def collect(self): - if not getattr(self.obj, "__test__", True): - return [] - - # NB. we avoid random getattrs and peek in the __dict__ instead - # (XXX originally introduced from a PyPy need, still true?) - dicts = [getattr(self.obj, '__dict__', {})] - for basecls in inspect.getmro(self.obj.__class__): - dicts.append(basecls.__dict__) - seen = {} - values = [] - for dic in dicts: - for name, obj in list(dic.items()): - if name in seen: - continue - seen[name] = True - res = self.makeitem(name, obj) - if res is None: - continue - if not isinstance(res, list): - res = [res] - values.extend(res) - values.sort(key=lambda item: item.reportinfo()[:2]) - return values - - def makeitem(self, name, obj): - # assert self.ihook.fspath == self.fspath, self - return self.ihook.pytest_pycollect_makeitem( - collector=self, name=name, obj=obj) - - def _genfunctions(self, name, funcobj): - module = self.getparent(Module).obj - clscol = self.getparent(Class) - cls = clscol and clscol.obj or None - transfer_markers(funcobj, cls, module) - fm = self.session._fixturemanager - fixtureinfo = fm.getfixtureinfo(self, funcobj, cls) - metafunc = Metafunc(funcobj, fixtureinfo, self.config, - cls=cls, module=module) - methods = [] - if hasattr(module, "pytest_generate_tests"): - methods.append(module.pytest_generate_tests) - if hasattr(cls, "pytest_generate_tests"): - methods.append(cls().pytest_generate_tests) - if methods: - self.ihook.pytest_generate_tests.call_extra(methods, - dict(metafunc=metafunc)) - else: - self.ihook.pytest_generate_tests(metafunc=metafunc) - - Function = self._getcustomclass("Function") - if not metafunc._calls: - yield Function(name, parent=self, fixtureinfo=fixtureinfo) - else: - # add funcargs() as fixturedefs to fixtureinfo.arg2fixturedefs - fixtures.add_funcarg_pseudo_fixture_def(self, metafunc, fm) - - for callspec in metafunc._calls: - subname = "%s[%s]" % (name, callspec.id) - yield Function(name=subname, parent=self, - callspec=callspec, callobj=funcobj, - fixtureinfo=fixtureinfo, - keywords={callspec.id: True}, - originalname=name, - ) - - -class Module(main.File, PyCollector): - """ Collector for test classes and functions. """ - - def _getobj(self): - return self._importtestmodule() - - def collect(self): - self.session._fixturemanager.parsefactories(self) - return super(Module, self).collect() - - def _importtestmodule(self): - # we assume we are only called once per module - importmode = self.config.getoption("--import-mode") - try: - mod = self.fspath.pyimport(ensuresyspath=importmode) - except SyntaxError: - raise self.CollectError( - _pytest._code.ExceptionInfo().getrepr(style="short")) - except self.fspath.ImportMismatchError: - e = sys.exc_info()[1] - raise self.CollectError( - "import file mismatch:\n" - "imported module %r has this __file__ attribute:\n" - " %s\n" - "which is not the same as the test file we want to collect:\n" - " %s\n" - "HINT: remove __pycache__ / .pyc files and/or use a " - "unique basename for your test file modules" - % e.args - ) - except ImportError: - from _pytest._code.code import ExceptionInfo - exc_info = ExceptionInfo() - if self.config.getoption('verbose') < 2: - exc_info.traceback = exc_info.traceback.filter(filter_traceback) - exc_repr = exc_info.getrepr(style='short') if exc_info.traceback else exc_info.exconly() - formatted_tb = safe_str(exc_repr) - raise self.CollectError( - "ImportError while importing test module '{fspath}'.\n" - "Hint: make sure your test modules/packages have valid Python names.\n" - "Traceback:\n" - "{traceback}".format(fspath=self.fspath, traceback=formatted_tb) - ) - except _pytest.runner.Skipped as e: - if e.allow_module_level: - raise - raise self.CollectError( - "Using pytest.skip outside of a test is not allowed. " - "To decorate a test function, use the @pytest.mark.skip " - "or @pytest.mark.skipif decorators instead, and to skip a " - "module use `pytestmark = pytest.mark.{skip,skipif}." - ) - self.config.pluginmanager.consider_module(mod) - return mod - - def setup(self): - setup_module = _get_xunit_setup_teardown(self.obj, "setUpModule") - if setup_module is None: - setup_module = _get_xunit_setup_teardown(self.obj, "setup_module") - if setup_module is not None: - setup_module() - - teardown_module = _get_xunit_setup_teardown(self.obj, 'tearDownModule') - if teardown_module is None: - teardown_module = _get_xunit_setup_teardown(self.obj, 'teardown_module') - if teardown_module is not None: - self.addfinalizer(teardown_module) - - -def _get_xunit_setup_teardown(holder, attr_name, param_obj=None): - """ - Return a callable to perform xunit-style setup or teardown if - the function exists in the ``holder`` object. - The ``param_obj`` parameter is the parameter which will be passed to the function - when the callable is called without arguments, defaults to the ``holder`` object. - Return ``None`` if a suitable callable is not found. - """ - param_obj = param_obj if param_obj is not None else holder - result = _get_xunit_func(holder, attr_name) - if result is not None: - arg_count = result.__code__.co_argcount - if inspect.ismethod(result): - arg_count -= 1 - if arg_count: - return lambda: result(param_obj) - else: - return result - - -def _get_xunit_func(obj, name): - """Return the attribute from the given object to be used as a setup/teardown - xunit-style function, but only if not marked as a fixture to - avoid calling it twice. - """ - meth = getattr(obj, name, None) - if fixtures.getfixturemarker(meth) is None: - return meth - - -class Class(PyCollector): - """ Collector for test methods. """ - - def collect(self): - if not safe_getattr(self.obj, "__test__", True): - return [] - if hasinit(self.obj): - self.warn("C1", "cannot collect test class %r because it has a " - "__init__ constructor" % self.obj.__name__) - return [] - elif hasnew(self.obj): - self.warn("C1", "cannot collect test class %r because it has a " - "__new__ constructor" % self.obj.__name__) - return [] - return [self._getcustomclass("Instance")(name="()", parent=self)] - - def setup(self): - setup_class = _get_xunit_func(self.obj, 'setup_class') - if setup_class is not None: - setup_class = getattr(setup_class, 'im_func', setup_class) - setup_class = getattr(setup_class, '__func__', setup_class) - setup_class(self.obj) - - fin_class = getattr(self.obj, 'teardown_class', None) - if fin_class is not None: - fin_class = getattr(fin_class, 'im_func', fin_class) - fin_class = getattr(fin_class, '__func__', fin_class) - self.addfinalizer(lambda: fin_class(self.obj)) - - -class Instance(PyCollector): - def _getobj(self): - return self.parent.obj() - - def collect(self): - self.session._fixturemanager.parsefactories(self) - return super(Instance, self).collect() - - def newinstance(self): - self.obj = self._getobj() - return self.obj - - -class FunctionMixin(PyobjMixin): - """ mixin for the code common to Function and Generator. - """ - - def setup(self): - """ perform setup for this test function. """ - if hasattr(self, '_preservedparent'): - obj = self._preservedparent - elif isinstance(self.parent, Instance): - obj = self.parent.newinstance() - self.obj = self._getobj() - else: - obj = self.parent.obj - if inspect.ismethod(self.obj): - setup_name = 'setup_method' - teardown_name = 'teardown_method' - else: - setup_name = 'setup_function' - teardown_name = 'teardown_function' - setup_func_or_method = _get_xunit_setup_teardown(obj, setup_name, param_obj=self.obj) - if setup_func_or_method is not None: - setup_func_or_method() - teardown_func_or_method = _get_xunit_setup_teardown(obj, teardown_name, param_obj=self.obj) - if teardown_func_or_method is not None: - self.addfinalizer(teardown_func_or_method) - - def _prunetraceback(self, excinfo): - if hasattr(self, '_obj') and not self.config.option.fulltrace: - code = _pytest._code.Code(get_real_func(self.obj)) - path, firstlineno = code.path, code.firstlineno - traceback = excinfo.traceback - ntraceback = traceback.cut(path=path, firstlineno=firstlineno) - if ntraceback == traceback: - ntraceback = ntraceback.cut(path=path) - if ntraceback == traceback: - # ntraceback = ntraceback.cut(excludepath=cutdir2) - ntraceback = ntraceback.filter(filter_traceback) - if not ntraceback: - ntraceback = traceback - - excinfo.traceback = ntraceback.filter() - # issue364: mark all but first and last frames to - # only show a single-line message for each frame - if self.config.option.tbstyle == "auto": - if len(excinfo.traceback) > 2: - for entry in excinfo.traceback[1:-1]: - entry.set_repr_style('short') - - def _repr_failure_py(self, excinfo, style="long"): - if excinfo.errisinstance(fail.Exception): - if not excinfo.value.pytrace: - return py._builtin._totext(excinfo.value) - return super(FunctionMixin, self)._repr_failure_py(excinfo, - style=style) - - def repr_failure(self, excinfo, outerr=None): - assert outerr is None, "XXX outerr usage is deprecated" - style = self.config.option.tbstyle - if style == "auto": - style = "long" - return self._repr_failure_py(excinfo, style=style) - - -class Generator(FunctionMixin, PyCollector): - def collect(self): - # test generators are seen as collectors but they also - # invoke setup/teardown on popular request - # (induced by the common "test_*" naming shared with normal tests) - from _pytest import deprecated - self.session._setupstate.prepare(self) - # see FunctionMixin.setup and test_setupstate_is_preserved_134 - self._preservedparent = self.parent.obj - values = [] - seen = {} - for i, x in enumerate(self.obj()): - name, call, args = self.getcallargs(x) - if not callable(call): - raise TypeError("%r yielded non callable test %r" % (self.obj, call,)) - if name is None: - name = "[%d]" % i - else: - name = "['%s']" % name - if name in seen: - raise ValueError("%r generated tests with non-unique name %r" % (self, name)) - seen[name] = True - values.append(self.Function(name, self, args=args, callobj=call)) - self.warn('C1', deprecated.YIELD_TESTS) - return values - - def getcallargs(self, obj): - if not isinstance(obj, (tuple, list)): - obj = (obj,) - # explicit naming - if isinstance(obj[0], py.builtin._basestring): - name = obj[0] - obj = obj[1:] - else: - name = None - call, args = obj[0], obj[1:] - return name, call, args - - -def hasinit(obj): - init = getattr(obj, '__init__', None) - if init: - return init != object.__init__ - - -def hasnew(obj): - new = getattr(obj, '__new__', None) - if new: - return new != object.__new__ - - -class CallSpec2(object): - def __init__(self, metafunc): - self.metafunc = metafunc - self.funcargs = {} - self._idlist = [] - self.params = {} - self._globalid = NOTSET - self._globalid_args = set() - self._globalparam = NOTSET - self._arg2scopenum = {} # used for sorting parametrized resources - self.keywords = {} - self.indices = {} - - def copy(self, metafunc): - cs = CallSpec2(self.metafunc) - cs.funcargs.update(self.funcargs) - cs.params.update(self.params) - cs.keywords.update(self.keywords) - cs.indices.update(self.indices) - cs._arg2scopenum.update(self._arg2scopenum) - cs._idlist = list(self._idlist) - cs._globalid = self._globalid - cs._globalid_args = self._globalid_args - cs._globalparam = self._globalparam - return cs - - def _checkargnotcontained(self, arg): - if arg in self.params or arg in self.funcargs: - raise ValueError("duplicate %r" % (arg,)) - - def getparam(self, name): - try: - return self.params[name] - except KeyError: - if self._globalparam is NOTSET: - raise ValueError(name) - return self._globalparam - - @property - def id(self): - return "-".join(map(str, filter(None, self._idlist))) - - def setmulti(self, valtypes, argnames, valset, id, keywords, scopenum, - param_index): - for arg, val in zip(argnames, valset): - self._checkargnotcontained(arg) - valtype_for_arg = valtypes[arg] - getattr(self, valtype_for_arg)[arg] = val - self.indices[arg] = param_index - self._arg2scopenum[arg] = scopenum - self._idlist.append(id) - self.keywords.update(keywords) - - def setall(self, funcargs, id, param): - for x in funcargs: - self._checkargnotcontained(x) - self.funcargs.update(funcargs) - if id is not NOTSET: - self._idlist.append(id) - if param is not NOTSET: - assert self._globalparam is NOTSET - self._globalparam = param - for arg in funcargs: - self._arg2scopenum[arg] = fixtures.scopenum_function - - -class Metafunc(fixtures.FuncargnamesCompatAttr): - """ - Metafunc objects are passed to the ``pytest_generate_tests`` hook. - They help to inspect a test function and to generate tests according to - test configuration or values specified in the class or module where a - test function is defined. - """ - - def __init__(self, function, fixtureinfo, config, cls=None, module=None): - #: access to the :class:`_pytest.config.Config` object for the test session - self.config = config - - #: the module object where the test function is defined in. - self.module = module - - #: underlying python test function - self.function = function - - #: set of fixture names required by the test function - self.fixturenames = fixtureinfo.names_closure - - #: class object where the test function is defined in or ``None``. - self.cls = cls - - self._calls = [] - self._ids = py.builtin.set() - self._arg2fixturedefs = fixtureinfo.name2fixturedefs - - def parametrize(self, argnames, argvalues, indirect=False, ids=None, - scope=None): - """ Add new invocations to the underlying test function using the list - of argvalues for the given argnames. Parametrization is performed - during the collection phase. If you need to setup expensive resources - see about setting indirect to do it rather at test setup time. - - :arg argnames: a comma-separated string denoting one or more argument - names, or a list/tuple of argument strings. - - :arg argvalues: The list of argvalues determines how often a - test is invoked with different argument values. If only one - argname was specified argvalues is a list of values. If N - argnames were specified, argvalues must be a list of N-tuples, - where each tuple-element specifies a value for its respective - argname. - - :arg indirect: The list of argnames or boolean. A list of arguments' - names (subset of argnames). If True the list contains all names from - the argnames. Each argvalue corresponding to an argname in this list will - be passed as request.param to its respective argname fixture - function so that it can perform more expensive setups during the - setup phase of a test rather than at collection time. - - :arg ids: list of string ids, or a callable. - If strings, each is corresponding to the argvalues so that they are - part of the test id. If None is given as id of specific test, the - automatically generated id for that argument will be used. - If callable, it should take one argument (a single argvalue) and return - a string or return None. If None, the automatically generated id for that - argument will be used. - If no ids are provided they will be generated automatically from - the argvalues. - - :arg scope: if specified it denotes the scope of the parameters. - The scope is used for grouping tests by parameter instances. - It will also override any fixture-function defined scope, allowing - to set a dynamic scope using test context or configuration. - """ - from _pytest.fixtures import scope2index - from _pytest.mark import MARK_GEN, ParameterSet - from py.io import saferepr - - if not isinstance(argnames, (tuple, list)): - argnames = [x.strip() for x in argnames.split(",") if x.strip()] - force_tuple = len(argnames) == 1 - else: - force_tuple = False - parameters = [ - ParameterSet.extract_from(x, legacy_force_tuple=force_tuple) - for x in argvalues] - del argvalues - - if not parameters: - fs, lineno = getfslineno(self.function) - reason = "got empty parameter set %r, function %s at %s:%d" % ( - argnames, self.function.__name__, fs, lineno) - mark = MARK_GEN.skip(reason=reason) - parameters.append(ParameterSet( - values=(NOTSET,) * len(argnames), - marks=[mark], - id=None, - )) - - if scope is None: - scope = _find_parametrized_scope(argnames, self._arg2fixturedefs, indirect) - - scopenum = scope2index(scope, descr='call to {0}'.format(self.parametrize)) - valtypes = {} - for arg in argnames: - if arg not in self.fixturenames: - if isinstance(indirect, (tuple, list)): - name = 'fixture' if arg in indirect else 'argument' - else: - name = 'fixture' if indirect else 'argument' - raise ValueError( - "%r uses no %s %r" % ( - self.function, name, arg)) - - if indirect is True: - valtypes = dict.fromkeys(argnames, "params") - elif indirect is False: - valtypes = dict.fromkeys(argnames, "funcargs") - elif isinstance(indirect, (tuple, list)): - valtypes = dict.fromkeys(argnames, "funcargs") - for arg in indirect: - if arg not in argnames: - raise ValueError("indirect given to %r: fixture %r doesn't exist" % ( - self.function, arg)) - valtypes[arg] = "params" - idfn = None - if callable(ids): - idfn = ids - ids = None - if ids: - if len(ids) != len(parameters): - raise ValueError('%d tests specified with %d ids' % ( - len(parameters), len(ids))) - for id_value in ids: - if id_value is not None and not isinstance(id_value, py.builtin._basestring): - msg = 'ids must be list of strings, found: %s (type: %s)' - raise ValueError(msg % (saferepr(id_value), type(id_value).__name__)) - ids = idmaker(argnames, parameters, idfn, ids, self.config) - newcalls = [] - for callspec in self._calls or [CallSpec2(self)]: - elements = zip(ids, parameters, count()) - for a_id, param, param_index in elements: - if len(param.values) != len(argnames): - raise ValueError( - 'In "parametrize" the number of values ({0}) must be ' - 'equal to the number of names ({1})'.format( - param.values, argnames)) - newcallspec = callspec.copy(self) - newcallspec.setmulti(valtypes, argnames, param.values, a_id, - param.deprecated_arg_dict, scopenum, param_index) - newcalls.append(newcallspec) - self._calls = newcalls - - def addcall(self, funcargs=None, id=NOTSET, param=NOTSET): - """ (deprecated, use parametrize) Add a new call to the underlying - test function during the collection phase of a test run. Note that - request.addcall() is called during the test collection phase prior and - independently to actual test execution. You should only use addcall() - if you need to specify multiple arguments of a test function. - - :arg funcargs: argument keyword dictionary used when invoking - the test function. - - :arg id: used for reporting and identification purposes. If you - don't supply an `id` an automatic unique id will be generated. - - :arg param: a parameter which will be exposed to a later fixture function - invocation through the ``request.param`` attribute. - """ - assert funcargs is None or isinstance(funcargs, dict) - if funcargs is not None: - for name in funcargs: - if name not in self.fixturenames: - fail("funcarg %r not used in this function." % name) - else: - funcargs = {} - if id is None: - raise ValueError("id=None not allowed") - if id is NOTSET: - id = len(self._calls) - id = str(id) - if id in self._ids: - raise ValueError("duplicate id %r" % id) - self._ids.add(id) - - cs = CallSpec2(self) - cs.setall(funcargs, id, param) - self._calls.append(cs) - - -def _find_parametrized_scope(argnames, arg2fixturedefs, indirect): - """Find the most appropriate scope for a parametrized call based on its arguments. - - When there's at least one direct argument, always use "function" scope. - - When a test function is parametrized and all its arguments are indirect - (e.g. fixtures), return the most narrow scope based on the fixtures used. - - Related to issue #1832, based on code posted by @Kingdread. - """ - from _pytest.fixtures import scopes - indirect_as_list = isinstance(indirect, (list, tuple)) - all_arguments_are_fixtures = indirect is True or \ - indirect_as_list and len(indirect) == argnames - if all_arguments_are_fixtures: - fixturedefs = arg2fixturedefs or {} - used_scopes = [fixturedef[0].scope for name, fixturedef in fixturedefs.items()] - if used_scopes: - # Takes the most narrow scope from used fixtures - for scope in reversed(scopes): - if scope in used_scopes: - return scope - - return 'function' - - -def _idval(val, argname, idx, idfn, config=None): - if idfn: - s = None - try: - s = idfn(val) - except Exception: - # See issue https://github.com/pytest-dev/pytest/issues/2169 - import warnings - msg = "Raised while trying to determine id of parameter %s at position %d." % (argname, idx) - msg += '\nUpdate your code as this will raise an error in pytest-4.0.' - warnings.warn(msg, DeprecationWarning) - if s: - return _ascii_escaped(s) - - if config: - hook_id = config.hook.pytest_make_parametrize_id( - config=config, val=val, argname=argname) - if hook_id: - return hook_id - - if isinstance(val, STRING_TYPES): - return _ascii_escaped(val) - elif isinstance(val, (float, int, bool, NoneType)): - return str(val) - elif isinstance(val, REGEX_TYPE): - return _ascii_escaped(val.pattern) - elif enum is not None and isinstance(val, enum.Enum): - return str(val) - elif isclass(val) and hasattr(val, '__name__'): - return val.__name__ - return str(argname) + str(idx) - - -def _idvalset(idx, parameterset, argnames, idfn, ids, config=None): - if parameterset.id is not None: - return parameterset.id - if ids is None or (idx >= len(ids) or ids[idx] is None): - this_id = [_idval(val, argname, idx, idfn, config) - for val, argname in zip(parameterset.values, argnames)] - return "-".join(this_id) - else: - return _ascii_escaped(ids[idx]) - - -def idmaker(argnames, parametersets, idfn=None, ids=None, config=None): - ids = [_idvalset(valindex, parameterset, argnames, idfn, ids, config) - for valindex, parameterset in enumerate(parametersets)] - if len(set(ids)) != len(ids): - # The ids are not unique - duplicates = [testid for testid in ids if ids.count(testid) > 1] - counters = collections.defaultdict(lambda: 0) - for index, testid in enumerate(ids): - if testid in duplicates: - ids[index] = testid + str(counters[testid]) - counters[testid] += 1 - return ids - - -def show_fixtures_per_test(config): - from _pytest.main import wrap_session - return wrap_session(config, _show_fixtures_per_test) - - -def _show_fixtures_per_test(config, session): - import _pytest.config - session.perform_collect() - curdir = py.path.local() - tw = _pytest.config.create_terminal_writer(config) - verbose = config.getvalue("verbose") - - def get_best_relpath(func): - loc = getlocation(func, curdir) - return curdir.bestrelpath(loc) - - def write_fixture(fixture_def): - argname = fixture_def.argname - if verbose <= 0 and argname.startswith("_"): - return - if verbose > 0: - bestrel = get_best_relpath(fixture_def.func) - funcargspec = "{0} -- {1}".format(argname, bestrel) - else: - funcargspec = argname - tw.line(funcargspec, green=True) - fixture_doc = fixture_def.func.__doc__ - if fixture_doc: - write_docstring(tw, fixture_doc) - else: - tw.line(' no docstring available', red=True) - - def write_item(item): - try: - info = item._fixtureinfo - except AttributeError: - # doctests items have no _fixtureinfo attribute - return - if not info.name2fixturedefs: - # this test item does not use any fixtures - return - tw.line() - tw.sep('-', 'fixtures used by {0}'.format(item.name)) - tw.sep('-', '({0})'.format(get_best_relpath(item.function))) - # dict key not used in loop but needed for sorting - for _, fixturedefs in sorted(info.name2fixturedefs.items()): - assert fixturedefs is not None - if not fixturedefs: - continue - # last item is expected to be the one used by the test item - write_fixture(fixturedefs[-1]) - - for session_item in session.items: - write_item(session_item) - - -def showfixtures(config): - from _pytest.main import wrap_session - return wrap_session(config, _showfixtures_main) - - -def _showfixtures_main(config, session): - import _pytest.config - session.perform_collect() - curdir = py.path.local() - tw = _pytest.config.create_terminal_writer(config) - verbose = config.getvalue("verbose") - - fm = session._fixturemanager - - available = [] - seen = set() - - for argname, fixturedefs in fm._arg2fixturedefs.items(): - assert fixturedefs is not None - if not fixturedefs: - continue - for fixturedef in fixturedefs: - loc = getlocation(fixturedef.func, curdir) - if (fixturedef.argname, loc) in seen: - continue - seen.add((fixturedef.argname, loc)) - available.append((len(fixturedef.baseid), - fixturedef.func.__module__, - curdir.bestrelpath(loc), - fixturedef.argname, fixturedef)) - - available.sort() - currentmodule = None - for baseid, module, bestrel, argname, fixturedef in available: - if currentmodule != module: - if not module.startswith("_pytest."): - tw.line() - tw.sep("-", "fixtures defined from %s" % (module,)) - currentmodule = module - if verbose <= 0 and argname[0] == "_": - continue - if verbose > 0: - funcargspec = "%s -- %s" % (argname, bestrel,) - else: - funcargspec = argname - tw.line(funcargspec, green=True) - loc = getlocation(fixturedef.func, curdir) - doc = fixturedef.func.__doc__ or "" - if doc: - write_docstring(tw, doc) - else: - tw.line(" %s: no docstring available" % (loc,), - red=True) - - -def write_docstring(tw, doc): - INDENT = " " - doc = doc.rstrip() - if "\n" in doc: - firstline, rest = doc.split("\n", 1) - else: - firstline, rest = doc, "" - - if firstline.strip(): - tw.line(INDENT + firstline.strip()) - - if rest: - for line in dedent(rest).split("\n"): - tw.write(INDENT + line + "\n") - - -class Function(FunctionMixin, main.Item, fixtures.FuncargnamesCompatAttr): - """ a Function Item is responsible for setting up and executing a - Python test function. - """ - _genid = None - - def __init__(self, name, parent, args=None, config=None, - callspec=None, callobj=NOTSET, keywords=None, session=None, - fixtureinfo=None, originalname=None): - super(Function, self).__init__(name, parent, config=config, - session=session) - self._args = args - if callobj is not NOTSET: - self.obj = callobj - - self.keywords.update(self.obj.__dict__) - if callspec: - self.callspec = callspec - self.keywords.update(callspec.keywords) - if keywords: - self.keywords.update(keywords) - - if fixtureinfo is None: - fixtureinfo = self.session._fixturemanager.getfixtureinfo( - self.parent, self.obj, self.cls, - funcargs=not self._isyieldedfunction()) - self._fixtureinfo = fixtureinfo - self.fixturenames = fixtureinfo.names_closure - self._initrequest() - - #: original function name, without any decorations (for example - #: parametrization adds a ``"[...]"`` suffix to function names). - #: - #: .. versionadded:: 3.0 - self.originalname = originalname - - def _initrequest(self): - self.funcargs = {} - if self._isyieldedfunction(): - assert not hasattr(self, "callspec"), ( - "yielded functions (deprecated) cannot have funcargs") - else: - if hasattr(self, "callspec"): - callspec = self.callspec - assert not callspec.funcargs - self._genid = callspec.id - if hasattr(callspec, "param"): - self.param = callspec.param - self._request = fixtures.FixtureRequest(self) - - @property - def function(self): - "underlying python 'function' object" - return getattr(self.obj, 'im_func', self.obj) - - def _getobj(self): - name = self.name - i = name.find("[") # parametrization - if i != -1: - name = name[:i] - return getattr(self.parent.obj, name) - - @property - def _pyfuncitem(self): - "(compatonly) for code expecting pytest-2.2 style request objects" - return self - - def _isyieldedfunction(self): - return getattr(self, "_args", None) is not None - - def runtest(self): - """ execute the underlying test function. """ - self.ihook.pytest_pyfunc_call(pyfuncitem=self) - - def setup(self): - super(Function, self).setup() - fixtures.fillfixtures(self) diff --git a/lib/spack/external/_pytest/python_api.py b/lib/spack/external/_pytest/python_api.py deleted file mode 100644 index a931b4d2c7..0000000000 --- a/lib/spack/external/_pytest/python_api.py +++ /dev/null @@ -1,629 +0,0 @@ -import math -import sys - -import py - -from _pytest.compat import isclass, izip -from _pytest.outcomes import fail -import _pytest._code - - -def _cmp_raises_type_error(self, other): - """__cmp__ implementation which raises TypeError. Used - by Approx base classes to implement only == and != and raise a - TypeError for other comparisons. - - Needed in Python 2 only, Python 3 all it takes is not implementing the - other operators at all. - """ - __tracebackhide__ = True - raise TypeError('Comparison operators other than == and != not supported by approx objects') - - -# builtin pytest.approx helper - - -class ApproxBase(object): - """ - Provide shared utilities for making approximate comparisons between numbers - or sequences of numbers. - """ - - def __init__(self, expected, rel=None, abs=None, nan_ok=False): - self.expected = expected - self.abs = abs - self.rel = rel - self.nan_ok = nan_ok - - def __repr__(self): - raise NotImplementedError - - def __eq__(self, actual): - return all( - a == self._approx_scalar(x) - for a, x in self._yield_comparisons(actual)) - - __hash__ = None - - def __ne__(self, actual): - return not (actual == self) - - if sys.version_info[0] == 2: - __cmp__ = _cmp_raises_type_error - - def _approx_scalar(self, x): - return ApproxScalar(x, rel=self.rel, abs=self.abs, nan_ok=self.nan_ok) - - def _yield_comparisons(self, actual): - """ - Yield all the pairs of numbers to be compared. This is used to - implement the `__eq__` method. - """ - raise NotImplementedError - - -class ApproxNumpy(ApproxBase): - """ - Perform approximate comparisons for numpy arrays. - """ - - # Tell numpy to use our `__eq__` operator instead of its. - __array_priority__ = 100 - - def __repr__(self): - # It might be nice to rewrite this function to account for the - # shape of the array... - return "approx({0!r})".format(list( - self._approx_scalar(x) for x in self.expected)) - - if sys.version_info[0] == 2: - __cmp__ = _cmp_raises_type_error - - def __eq__(self, actual): - import numpy as np - - try: - actual = np.asarray(actual) - except: # noqa - raise TypeError("cannot compare '{0}' to numpy.ndarray".format(actual)) - - if actual.shape != self.expected.shape: - return False - - return ApproxBase.__eq__(self, actual) - - def _yield_comparisons(self, actual): - import numpy as np - - # We can be sure that `actual` is a numpy array, because it's - # casted in `__eq__` before being passed to `ApproxBase.__eq__`, - # which is the only method that calls this one. - for i in np.ndindex(self.expected.shape): - yield actual[i], self.expected[i] - - -class ApproxMapping(ApproxBase): - """ - Perform approximate comparisons for mappings where the values are numbers - (the keys can be anything). - """ - - def __repr__(self): - return "approx({0!r})".format(dict( - (k, self._approx_scalar(v)) - for k, v in self.expected.items())) - - def __eq__(self, actual): - if set(actual.keys()) != set(self.expected.keys()): - return False - - return ApproxBase.__eq__(self, actual) - - def _yield_comparisons(self, actual): - for k in self.expected.keys(): - yield actual[k], self.expected[k] - - -class ApproxSequence(ApproxBase): - """ - Perform approximate comparisons for sequences of numbers. - """ - - # Tell numpy to use our `__eq__` operator instead of its. - __array_priority__ = 100 - - def __repr__(self): - seq_type = type(self.expected) - if seq_type not in (tuple, list, set): - seq_type = list - return "approx({0!r})".format(seq_type( - self._approx_scalar(x) for x in self.expected)) - - def __eq__(self, actual): - if len(actual) != len(self.expected): - return False - return ApproxBase.__eq__(self, actual) - - def _yield_comparisons(self, actual): - return izip(actual, self.expected) - - -class ApproxScalar(ApproxBase): - """ - Perform approximate comparisons for single numbers only. - """ - - def __repr__(self): - """ - Return a string communicating both the expected value and the tolerance - for the comparison being made, e.g. '1.0 +- 1e-6'. Use the unicode - plus/minus symbol if this is python3 (it's too hard to get right for - python2). - """ - if isinstance(self.expected, complex): - return str(self.expected) - - # Infinities aren't compared using tolerances, so don't show a - # tolerance. - if math.isinf(self.expected): - return str(self.expected) - - # If a sensible tolerance can't be calculated, self.tolerance will - # raise a ValueError. In this case, display '???'. - try: - vetted_tolerance = '{:.1e}'.format(self.tolerance) - except ValueError: - vetted_tolerance = '???' - - if sys.version_info[0] == 2: - return '{0} +- {1}'.format(self.expected, vetted_tolerance) - else: - return u'{0} \u00b1 {1}'.format(self.expected, vetted_tolerance) - - def __eq__(self, actual): - """ - Return true if the given value is equal to the expected value within - the pre-specified tolerance. - """ - - # Short-circuit exact equality. - if actual == self.expected: - return True - - # Allow the user to control whether NaNs are considered equal to each - # other or not. The abs() calls are for compatibility with complex - # numbers. - if math.isnan(abs(self.expected)): - return self.nan_ok and math.isnan(abs(actual)) - - # Infinity shouldn't be approximately equal to anything but itself, but - # if there's a relative tolerance, it will be infinite and infinity - # will seem approximately equal to everything. The equal-to-itself - # case would have been short circuited above, so here we can just - # return false if the expected value is infinite. The abs() call is - # for compatibility with complex numbers. - if math.isinf(abs(self.expected)): - return False - - # Return true if the two numbers are within the tolerance. - return abs(self.expected - actual) <= self.tolerance - - __hash__ = None - - @property - def tolerance(self): - """ - Return the tolerance for the comparison. This could be either an - absolute tolerance or a relative tolerance, depending on what the user - specified or which would be larger. - """ - def set_default(x, default): - return x if x is not None else default - - # Figure out what the absolute tolerance should be. ``self.abs`` is - # either None or a value specified by the user. - absolute_tolerance = set_default(self.abs, 1e-12) - - if absolute_tolerance < 0: - raise ValueError("absolute tolerance can't be negative: {0}".format(absolute_tolerance)) - if math.isnan(absolute_tolerance): - raise ValueError("absolute tolerance can't be NaN.") - - # If the user specified an absolute tolerance but not a relative one, - # just return the absolute tolerance. - if self.rel is None: - if self.abs is not None: - return absolute_tolerance - - # Figure out what the relative tolerance should be. ``self.rel`` is - # either None or a value specified by the user. This is done after - # we've made sure the user didn't ask for an absolute tolerance only, - # because we don't want to raise errors about the relative tolerance if - # we aren't even going to use it. - relative_tolerance = set_default(self.rel, 1e-6) * abs(self.expected) - - if relative_tolerance < 0: - raise ValueError("relative tolerance can't be negative: {0}".format(absolute_tolerance)) - if math.isnan(relative_tolerance): - raise ValueError("relative tolerance can't be NaN.") - - # Return the larger of the relative and absolute tolerances. - return max(relative_tolerance, absolute_tolerance) - - -def approx(expected, rel=None, abs=None, nan_ok=False): - """ - Assert that two numbers (or two sets of numbers) are equal to each other - within some tolerance. - - Due to the `intricacies of floating-point arithmetic`__, numbers that we - would intuitively expect to be equal are not always so:: - - >>> 0.1 + 0.2 == 0.3 - False - - __ https://docs.python.org/3/tutorial/floatingpoint.html - - This problem is commonly encountered when writing tests, e.g. when making - sure that floating-point values are what you expect them to be. One way to - deal with this problem is to assert that two floating-point numbers are - equal to within some appropriate tolerance:: - - >>> abs((0.1 + 0.2) - 0.3) < 1e-6 - True - - However, comparisons like this are tedious to write and difficult to - understand. Furthermore, absolute comparisons like the one above are - usually discouraged because there's no tolerance that works well for all - situations. ``1e-6`` is good for numbers around ``1``, but too small for - very big numbers and too big for very small ones. It's better to express - the tolerance as a fraction of the expected value, but relative comparisons - like that are even more difficult to write correctly and concisely. - - The ``approx`` class performs floating-point comparisons using a syntax - that's as intuitive as possible:: - - >>> from pytest import approx - >>> 0.1 + 0.2 == approx(0.3) - True - - The same syntax also works for sequences of numbers:: - - >>> (0.1 + 0.2, 0.2 + 0.4) == approx((0.3, 0.6)) - True - - Dictionary *values*:: - - >>> {'a': 0.1 + 0.2, 'b': 0.2 + 0.4} == approx({'a': 0.3, 'b': 0.6}) - True - - And ``numpy`` arrays:: - - >>> import numpy as np # doctest: +SKIP - >>> np.array([0.1, 0.2]) + np.array([0.2, 0.4]) == approx(np.array([0.3, 0.6])) # doctest: +SKIP - True - - By default, ``approx`` considers numbers within a relative tolerance of - ``1e-6`` (i.e. one part in a million) of its expected value to be equal. - This treatment would lead to surprising results if the expected value was - ``0.0``, because nothing but ``0.0`` itself is relatively close to ``0.0``. - To handle this case less surprisingly, ``approx`` also considers numbers - within an absolute tolerance of ``1e-12`` of its expected value to be - equal. Infinity and NaN are special cases. Infinity is only considered - equal to itself, regardless of the relative tolerance. NaN is not - considered equal to anything by default, but you can make it be equal to - itself by setting the ``nan_ok`` argument to True. (This is meant to - facilitate comparing arrays that use NaN to mean "no data".) - - Both the relative and absolute tolerances can be changed by passing - arguments to the ``approx`` constructor:: - - >>> 1.0001 == approx(1) - False - >>> 1.0001 == approx(1, rel=1e-3) - True - >>> 1.0001 == approx(1, abs=1e-3) - True - - If you specify ``abs`` but not ``rel``, the comparison will not consider - the relative tolerance at all. In other words, two numbers that are within - the default relative tolerance of ``1e-6`` will still be considered unequal - if they exceed the specified absolute tolerance. If you specify both - ``abs`` and ``rel``, the numbers will be considered equal if either - tolerance is met:: - - >>> 1 + 1e-8 == approx(1) - True - >>> 1 + 1e-8 == approx(1, abs=1e-12) - False - >>> 1 + 1e-8 == approx(1, rel=1e-6, abs=1e-12) - True - - If you're thinking about using ``approx``, then you might want to know how - it compares to other good ways of comparing floating-point numbers. All of - these algorithms are based on relative and absolute tolerances and should - agree for the most part, but they do have meaningful differences: - - - ``math.isclose(a, b, rel_tol=1e-9, abs_tol=0.0)``: True if the relative - tolerance is met w.r.t. either ``a`` or ``b`` or if the absolute - tolerance is met. Because the relative tolerance is calculated w.r.t. - both ``a`` and ``b``, this test is symmetric (i.e. neither ``a`` nor - ``b`` is a "reference value"). You have to specify an absolute tolerance - if you want to compare to ``0.0`` because there is no tolerance by - default. Only available in python>=3.5. `More information...`__ - - __ https://docs.python.org/3/library/math.html#math.isclose - - - ``numpy.isclose(a, b, rtol=1e-5, atol=1e-8)``: True if the difference - between ``a`` and ``b`` is less that the sum of the relative tolerance - w.r.t. ``b`` and the absolute tolerance. Because the relative tolerance - is only calculated w.r.t. ``b``, this test is asymmetric and you can - think of ``b`` as the reference value. Support for comparing sequences - is provided by ``numpy.allclose``. `More information...`__ - - __ http://docs.scipy.org/doc/numpy-1.10.0/reference/generated/numpy.isclose.html - - - ``unittest.TestCase.assertAlmostEqual(a, b)``: True if ``a`` and ``b`` - are within an absolute tolerance of ``1e-7``. No relative tolerance is - considered and the absolute tolerance cannot be changed, so this function - is not appropriate for very large or very small numbers. Also, it's only - available in subclasses of ``unittest.TestCase`` and it's ugly because it - doesn't follow PEP8. `More information...`__ - - __ https://docs.python.org/3/library/unittest.html#unittest.TestCase.assertAlmostEqual - - - ``a == pytest.approx(b, rel=1e-6, abs=1e-12)``: True if the relative - tolerance is met w.r.t. ``b`` or if the absolute tolerance is met. - Because the relative tolerance is only calculated w.r.t. ``b``, this test - is asymmetric and you can think of ``b`` as the reference value. In the - special case that you explicitly specify an absolute tolerance but not a - relative tolerance, only the absolute tolerance is considered. - - .. warning:: - - .. versionchanged:: 3.2 - - In order to avoid inconsistent behavior, ``TypeError`` is - raised for ``>``, ``>=``, ``<`` and ``<=`` comparisons. - The example below illustrates the problem:: - - assert approx(0.1) > 0.1 + 1e-10 # calls approx(0.1).__gt__(0.1 + 1e-10) - assert 0.1 + 1e-10 > approx(0.1) # calls approx(0.1).__lt__(0.1 + 1e-10) - - In the second example one expects ``approx(0.1).__le__(0.1 + 1e-10)`` - to be called. But instead, ``approx(0.1).__lt__(0.1 + 1e-10)`` is used to - comparison. This is because the call hierarchy of rich comparisons - follows a fixed behavior. `More information...`__ - - __ https://docs.python.org/3/reference/datamodel.html#object.__ge__ - """ - - if sys.version_info >= (3, 3): - from collections.abc import Mapping, Sequence - else: - from collections import Mapping, Sequence - from _pytest.compat import STRING_TYPES as String - - # Delegate the comparison to a class that knows how to deal with the type - # of the expected value (e.g. int, float, list, dict, numpy.array, etc). - # - # This architecture is really driven by the need to support numpy arrays. - # The only way to override `==` for arrays without requiring that approx be - # the left operand is to inherit the approx object from `numpy.ndarray`. - # But that can't be a general solution, because it requires (1) numpy to be - # installed and (2) the expected value to be a numpy array. So the general - # solution is to delegate each type of expected value to a different class. - # - # This has the advantage that it made it easy to support mapping types - # (i.e. dict). The old code accepted mapping types, but would only compare - # their keys, which is probably not what most people would expect. - - if _is_numpy_array(expected): - cls = ApproxNumpy - elif isinstance(expected, Mapping): - cls = ApproxMapping - elif isinstance(expected, Sequence) and not isinstance(expected, String): - cls = ApproxSequence - else: - cls = ApproxScalar - - return cls(expected, rel, abs, nan_ok) - - -def _is_numpy_array(obj): - """ - Return true if the given object is a numpy array. Make a special effort to - avoid importing numpy unless it's really necessary. - """ - import inspect - - for cls in inspect.getmro(type(obj)): - if cls.__module__ == 'numpy': - try: - import numpy as np - return isinstance(obj, np.ndarray) - except ImportError: - pass - - return False - - -# builtin pytest.raises helper - -def raises(expected_exception, *args, **kwargs): - """ - Assert that a code block/function call raises ``expected_exception`` - and raise a failure exception otherwise. - - This helper produces a ``ExceptionInfo()`` object (see below). - - If using Python 2.5 or above, you may use this function as a - context manager:: - - >>> with raises(ZeroDivisionError): - ... 1/0 - - .. versionchanged:: 2.10 - - In the context manager form you may use the keyword argument - ``message`` to specify a custom failure message:: - - >>> with raises(ZeroDivisionError, message="Expecting ZeroDivisionError"): - ... pass - Traceback (most recent call last): - ... - Failed: Expecting ZeroDivisionError - - .. note:: - - When using ``pytest.raises`` as a context manager, it's worthwhile to - note that normal context manager rules apply and that the exception - raised *must* be the final line in the scope of the context manager. - Lines of code after that, within the scope of the context manager will - not be executed. For example:: - - >>> value = 15 - >>> with raises(ValueError) as exc_info: - ... if value > 10: - ... raise ValueError("value must be <= 10") - ... assert exc_info.type == ValueError # this will not execute - - Instead, the following approach must be taken (note the difference in - scope):: - - >>> with raises(ValueError) as exc_info: - ... if value > 10: - ... raise ValueError("value must be <= 10") - ... - >>> assert exc_info.type == ValueError - - - Since version ``3.1`` you can use the keyword argument ``match`` to assert that the - exception matches a text or regex:: - - >>> with raises(ValueError, match='must be 0 or None'): - ... raise ValueError("value must be 0 or None") - - >>> with raises(ValueError, match=r'must be \d+$'): - ... raise ValueError("value must be 42") - - **Legacy forms** - - The forms below are fully supported but are discouraged for new code because the - context manager form is regarded as more readable and less error-prone. - - It is possible to specify a callable by passing a to-be-called lambda:: - - >>> raises(ZeroDivisionError, lambda: 1/0) - - - or you can specify an arbitrary callable with arguments:: - - >>> def f(x): return 1/x - ... - >>> raises(ZeroDivisionError, f, 0) - - >>> raises(ZeroDivisionError, f, x=0) - - - It is also possible to pass a string to be evaluated at runtime:: - - >>> raises(ZeroDivisionError, "f(0)") - - - The string will be evaluated using the same ``locals()`` and ``globals()`` - at the moment of the ``raises`` call. - - .. autoclass:: _pytest._code.ExceptionInfo - :members: - - .. note:: - Similar to caught exception objects in Python, explicitly clearing - local references to returned ``ExceptionInfo`` objects can - help the Python interpreter speed up its garbage collection. - - Clearing those references breaks a reference cycle - (``ExceptionInfo`` --> caught exception --> frame stack raising - the exception --> current frame stack --> local variables --> - ``ExceptionInfo``) which makes Python keep all objects referenced - from that cycle (including all local variables in the current - frame) alive until the next cyclic garbage collection run. See the - official Python ``try`` statement documentation for more detailed - information. - - """ - __tracebackhide__ = True - msg = ("exceptions must be old-style classes or" - " derived from BaseException, not %s") - if isinstance(expected_exception, tuple): - for exc in expected_exception: - if not isclass(exc): - raise TypeError(msg % type(exc)) - elif not isclass(expected_exception): - raise TypeError(msg % type(expected_exception)) - - message = "DID NOT RAISE {0}".format(expected_exception) - match_expr = None - - if not args: - if "message" in kwargs: - message = kwargs.pop("message") - if "match" in kwargs: - match_expr = kwargs.pop("match") - message += " matching '{0}'".format(match_expr) - return RaisesContext(expected_exception, message, match_expr) - elif isinstance(args[0], str): - code, = args - assert isinstance(code, str) - frame = sys._getframe(1) - loc = frame.f_locals.copy() - loc.update(kwargs) - # print "raises frame scope: %r" % frame.f_locals - try: - code = _pytest._code.Source(code).compile() - py.builtin.exec_(code, frame.f_globals, loc) - # XXX didn'T mean f_globals == f_locals something special? - # this is destroyed here ... - except expected_exception: - return _pytest._code.ExceptionInfo() - else: - func = args[0] - try: - func(*args[1:], **kwargs) - except expected_exception: - return _pytest._code.ExceptionInfo() - fail(message) - - -raises.Exception = fail.Exception - - -class RaisesContext(object): - def __init__(self, expected_exception, message, match_expr): - self.expected_exception = expected_exception - self.message = message - self.match_expr = match_expr - self.excinfo = None - - def __enter__(self): - self.excinfo = object.__new__(_pytest._code.ExceptionInfo) - return self.excinfo - - def __exit__(self, *tp): - __tracebackhide__ = True - if tp[0] is None: - fail(self.message) - if sys.version_info < (2, 7): - # py26: on __exit__() exc_value often does not contain the - # exception value. - # http://bugs.python.org/issue7853 - if not isinstance(tp[1], BaseException): - exc_type, value, traceback = tp - tp = exc_type, exc_type(value), traceback - self.excinfo.__init__(tp) - suppress_exception = issubclass(self.excinfo.type, self.expected_exception) - if sys.version_info[0] == 2 and suppress_exception: - sys.exc_clear() - if self.match_expr: - self.excinfo.match(self.match_expr) - return suppress_exception diff --git a/lib/spack/external/_pytest/recwarn.py b/lib/spack/external/_pytest/recwarn.py deleted file mode 100644 index c9fa872c07..0000000000 --- a/lib/spack/external/_pytest/recwarn.py +++ /dev/null @@ -1,205 +0,0 @@ -""" recording warnings during test function execution. """ -from __future__ import absolute_import, division, print_function - -import inspect - -import _pytest._code -import py -import sys -import warnings - -from _pytest.fixtures import yield_fixture -from _pytest.outcomes import fail - - -@yield_fixture -def recwarn(): - """Return a WarningsRecorder instance that provides these methods: - - * ``pop(category=None)``: return last warning matching the category. - * ``clear()``: clear list of warnings - - See http://docs.python.org/library/warnings.html for information - on warning categories. - """ - wrec = WarningsRecorder() - with wrec: - warnings.simplefilter('default') - yield wrec - - -def deprecated_call(func=None, *args, **kwargs): - """context manager that can be used to ensure a block of code triggers a - ``DeprecationWarning`` or ``PendingDeprecationWarning``:: - - >>> import warnings - >>> def api_call_v2(): - ... warnings.warn('use v3 of this api', DeprecationWarning) - ... return 200 - - >>> with deprecated_call(): - ... assert api_call_v2() == 200 - - ``deprecated_call`` can also be used by passing a function and ``*args`` and ``*kwargs``, - in which case it will ensure calling ``func(*args, **kwargs)`` produces one of the warnings - types above. - """ - if not func: - return _DeprecatedCallContext() - else: - __tracebackhide__ = True - with _DeprecatedCallContext(): - return func(*args, **kwargs) - - -class _DeprecatedCallContext(object): - """Implements the logic to capture deprecation warnings as a context manager.""" - - def __enter__(self): - self._captured_categories = [] - self._old_warn = warnings.warn - self._old_warn_explicit = warnings.warn_explicit - warnings.warn_explicit = self._warn_explicit - warnings.warn = self._warn - - def _warn_explicit(self, message, category, *args, **kwargs): - self._captured_categories.append(category) - - def _warn(self, message, category=None, *args, **kwargs): - if isinstance(message, Warning): - self._captured_categories.append(message.__class__) - else: - self._captured_categories.append(category) - - def __exit__(self, exc_type, exc_val, exc_tb): - warnings.warn_explicit = self._old_warn_explicit - warnings.warn = self._old_warn - - if exc_type is None: - deprecation_categories = (DeprecationWarning, PendingDeprecationWarning) - if not any(issubclass(c, deprecation_categories) for c in self._captured_categories): - __tracebackhide__ = True - msg = "Did not produce DeprecationWarning or PendingDeprecationWarning" - raise AssertionError(msg) - - -def warns(expected_warning, *args, **kwargs): - """Assert that code raises a particular class of warning. - - Specifically, the input @expected_warning can be a warning class or - tuple of warning classes, and the code must return that warning - (if a single class) or one of those warnings (if a tuple). - - This helper produces a list of ``warnings.WarningMessage`` objects, - one for each warning raised. - - This function can be used as a context manager, or any of the other ways - ``pytest.raises`` can be used:: - - >>> with warns(RuntimeWarning): - ... warnings.warn("my warning", RuntimeWarning) - """ - wcheck = WarningsChecker(expected_warning) - if not args: - return wcheck - elif isinstance(args[0], str): - code, = args - assert isinstance(code, str) - frame = sys._getframe(1) - loc = frame.f_locals.copy() - loc.update(kwargs) - - with wcheck: - code = _pytest._code.Source(code).compile() - py.builtin.exec_(code, frame.f_globals, loc) - else: - func = args[0] - with wcheck: - return func(*args[1:], **kwargs) - - -class WarningsRecorder(warnings.catch_warnings): - """A context manager to record raised warnings. - - Adapted from `warnings.catch_warnings`. - """ - - def __init__(self): - super(WarningsRecorder, self).__init__(record=True) - self._entered = False - self._list = [] - - @property - def list(self): - """The list of recorded warnings.""" - return self._list - - def __getitem__(self, i): - """Get a recorded warning by index.""" - return self._list[i] - - def __iter__(self): - """Iterate through the recorded warnings.""" - return iter(self._list) - - def __len__(self): - """The number of recorded warnings.""" - return len(self._list) - - def pop(self, cls=Warning): - """Pop the first recorded warning, raise exception if not exists.""" - for i, w in enumerate(self._list): - if issubclass(w.category, cls): - return self._list.pop(i) - __tracebackhide__ = True - raise AssertionError("%r not found in warning list" % cls) - - def clear(self): - """Clear the list of recorded warnings.""" - self._list[:] = [] - - def __enter__(self): - if self._entered: - __tracebackhide__ = True - raise RuntimeError("Cannot enter %r twice" % self) - self._list = super(WarningsRecorder, self).__enter__() - warnings.simplefilter('always') - return self - - def __exit__(self, *exc_info): - if not self._entered: - __tracebackhide__ = True - raise RuntimeError("Cannot exit %r without entering first" % self) - super(WarningsRecorder, self).__exit__(*exc_info) - - -class WarningsChecker(WarningsRecorder): - def __init__(self, expected_warning=None): - super(WarningsChecker, self).__init__() - - msg = ("exceptions must be old-style classes or " - "derived from Warning, not %s") - if isinstance(expected_warning, tuple): - for exc in expected_warning: - if not inspect.isclass(exc): - raise TypeError(msg % type(exc)) - elif inspect.isclass(expected_warning): - expected_warning = (expected_warning,) - elif expected_warning is not None: - raise TypeError(msg % type(expected_warning)) - - self.expected_warning = expected_warning - - def __exit__(self, *exc_info): - super(WarningsChecker, self).__exit__(*exc_info) - - # only check if we're not currently handling an exception - if all(a is None for a in exc_info): - if self.expected_warning is not None: - if not any(issubclass(r.category, self.expected_warning) - for r in self): - __tracebackhide__ = True - fail("DID NOT WARN. No warnings of type {0} was emitted. " - "The list of emitted warnings is: {1}.".format( - self.expected_warning, - [each.message for each in self])) diff --git a/lib/spack/external/_pytest/resultlog.py b/lib/spack/external/_pytest/resultlog.py deleted file mode 100644 index 9f9c2d1f65..0000000000 --- a/lib/spack/external/_pytest/resultlog.py +++ /dev/null @@ -1,113 +0,0 @@ -""" log machine-parseable test session result information in a plain -text file. -""" -from __future__ import absolute_import, division, print_function - -import py -import os - - -def pytest_addoption(parser): - group = parser.getgroup("terminal reporting", "resultlog plugin options") - group.addoption('--resultlog', '--result-log', action="store", - metavar="path", default=None, - help="DEPRECATED path for machine-readable result log.") - - -def pytest_configure(config): - resultlog = config.option.resultlog - # prevent opening resultlog on slave nodes (xdist) - if resultlog and not hasattr(config, 'slaveinput'): - dirname = os.path.dirname(os.path.abspath(resultlog)) - if not os.path.isdir(dirname): - os.makedirs(dirname) - logfile = open(resultlog, 'w', 1) # line buffered - config._resultlog = ResultLog(config, logfile) - config.pluginmanager.register(config._resultlog) - - from _pytest.deprecated import RESULT_LOG - config.warn('C1', RESULT_LOG) - - -def pytest_unconfigure(config): - resultlog = getattr(config, '_resultlog', None) - if resultlog: - resultlog.logfile.close() - del config._resultlog - config.pluginmanager.unregister(resultlog) - - -def generic_path(item): - chain = item.listchain() - gpath = [chain[0].name] - fspath = chain[0].fspath - fspart = False - for node in chain[1:]: - newfspath = node.fspath - if newfspath == fspath: - if fspart: - gpath.append(':') - fspart = False - else: - gpath.append('.') - else: - gpath.append('/') - fspart = True - name = node.name - if name[0] in '([': - gpath.pop() - gpath.append(name) - fspath = newfspath - return ''.join(gpath) - - -class ResultLog(object): - def __init__(self, config, logfile): - self.config = config - self.logfile = logfile # preferably line buffered - - def write_log_entry(self, testpath, lettercode, longrepr): - print("%s %s" % (lettercode, testpath), file=self.logfile) - for line in longrepr.splitlines(): - print(" %s" % line, file=self.logfile) - - def log_outcome(self, report, lettercode, longrepr): - testpath = getattr(report, 'nodeid', None) - if testpath is None: - testpath = report.fspath - self.write_log_entry(testpath, lettercode, longrepr) - - def pytest_runtest_logreport(self, report): - if report.when != "call" and report.passed: - return - res = self.config.hook.pytest_report_teststatus(report=report) - code = res[1] - if code == 'x': - longrepr = str(report.longrepr) - elif code == 'X': - longrepr = '' - elif report.passed: - longrepr = "" - elif report.failed: - longrepr = str(report.longrepr) - elif report.skipped: - longrepr = str(report.longrepr[2]) - self.log_outcome(report, code, longrepr) - - def pytest_collectreport(self, report): - if not report.passed: - if report.failed: - code = "F" - longrepr = str(report.longrepr) - else: - assert report.skipped - code = "S" - longrepr = "%s:%d: %s" % report.longrepr - self.log_outcome(report, code, longrepr) - - def pytest_internalerror(self, excrepr): - reprcrash = getattr(excrepr, 'reprcrash', None) - path = getattr(reprcrash, "path", None) - if path is None: - path = "cwd:%s" % py.path.local() - self.write_log_entry(path, '!', str(excrepr)) diff --git a/lib/spack/external/_pytest/runner.py b/lib/spack/external/_pytest/runner.py deleted file mode 100644 index b643fa3c91..0000000000 --- a/lib/spack/external/_pytest/runner.py +++ /dev/null @@ -1,508 +0,0 @@ -""" basic collect and runtest protocol implementations """ -from __future__ import absolute_import, division, print_function - -import bdb -import os -import sys -from time import time - -import py -from _pytest.compat import _PY2 -from _pytest._code.code import TerminalRepr, ExceptionInfo -from _pytest.outcomes import skip, Skipped, TEST_OUTCOME - -# -# pytest plugin hooks - - -def pytest_addoption(parser): - group = parser.getgroup("terminal reporting", "reporting", after="general") - group.addoption('--durations', - action="store", type=int, default=None, metavar="N", - help="show N slowest setup/test durations (N=0 for all)."), - - -def pytest_terminal_summary(terminalreporter): - durations = terminalreporter.config.option.durations - if durations is None: - return - tr = terminalreporter - dlist = [] - for replist in tr.stats.values(): - for rep in replist: - if hasattr(rep, 'duration'): - dlist.append(rep) - if not dlist: - return - dlist.sort(key=lambda x: x.duration) - dlist.reverse() - if not durations: - tr.write_sep("=", "slowest test durations") - else: - tr.write_sep("=", "slowest %s test durations" % durations) - dlist = dlist[:durations] - - for rep in dlist: - nodeid = rep.nodeid.replace("::()::", "::") - tr.write_line("%02.2fs %-8s %s" % - (rep.duration, rep.when, nodeid)) - - -def pytest_sessionstart(session): - session._setupstate = SetupState() - - -def pytest_sessionfinish(session): - session._setupstate.teardown_all() - - -def pytest_runtest_protocol(item, nextitem): - item.ihook.pytest_runtest_logstart( - nodeid=item.nodeid, location=item.location, - ) - runtestprotocol(item, nextitem=nextitem) - return True - - -def runtestprotocol(item, log=True, nextitem=None): - hasrequest = hasattr(item, "_request") - if hasrequest and not item._request: - item._initrequest() - rep = call_and_report(item, "setup", log) - reports = [rep] - if rep.passed: - if item.config.option.setupshow: - show_test_item(item) - if not item.config.option.setuponly: - reports.append(call_and_report(item, "call", log)) - reports.append(call_and_report(item, "teardown", log, - nextitem=nextitem)) - # after all teardown hooks have been called - # want funcargs and request info to go away - if hasrequest: - item._request = False - item.funcargs = None - return reports - - -def show_test_item(item): - """Show test function, parameters and the fixtures of the test item.""" - tw = item.config.get_terminal_writer() - tw.line() - tw.write(' ' * 8) - tw.write(item._nodeid) - used_fixtures = sorted(item._fixtureinfo.name2fixturedefs.keys()) - if used_fixtures: - tw.write(' (fixtures used: {0})'.format(', '.join(used_fixtures))) - - -def pytest_runtest_setup(item): - _update_current_test_var(item, 'setup') - item.session._setupstate.prepare(item) - - -def pytest_runtest_call(item): - _update_current_test_var(item, 'call') - try: - item.runtest() - except Exception: - # Store trace info to allow postmortem debugging - type, value, tb = sys.exc_info() - tb = tb.tb_next # Skip *this* frame - sys.last_type = type - sys.last_value = value - sys.last_traceback = tb - del tb # Get rid of it in this namespace - raise - - -def pytest_runtest_teardown(item, nextitem): - _update_current_test_var(item, 'teardown') - item.session._setupstate.teardown_exact(item, nextitem) - _update_current_test_var(item, None) - - -def _update_current_test_var(item, when): - """ - Update PYTEST_CURRENT_TEST to reflect the current item and stage. - - If ``when`` is None, delete PYTEST_CURRENT_TEST from the environment. - """ - var_name = 'PYTEST_CURRENT_TEST' - if when: - value = '{0} ({1})'.format(item.nodeid, when) - if _PY2: - # python 2 doesn't like null bytes on environment variables (see #2644) - value = value.replace('\x00', '(null)') - os.environ[var_name] = value - else: - os.environ.pop(var_name) - - -def pytest_report_teststatus(report): - if report.when in ("setup", "teardown"): - if report.failed: - # category, shortletter, verbose-word - return "error", "E", "ERROR" - elif report.skipped: - return "skipped", "s", "SKIPPED" - else: - return "", "", "" - - -# -# Implementation - -def call_and_report(item, when, log=True, **kwds): - call = call_runtest_hook(item, when, **kwds) - hook = item.ihook - report = hook.pytest_runtest_makereport(item=item, call=call) - if log: - hook.pytest_runtest_logreport(report=report) - if check_interactive_exception(call, report): - hook.pytest_exception_interact(node=item, call=call, report=report) - return report - - -def check_interactive_exception(call, report): - return call.excinfo and not ( - hasattr(report, "wasxfail") or - call.excinfo.errisinstance(skip.Exception) or - call.excinfo.errisinstance(bdb.BdbQuit)) - - -def call_runtest_hook(item, when, **kwds): - hookname = "pytest_runtest_" + when - ihook = getattr(item.ihook, hookname) - return CallInfo(lambda: ihook(item=item, **kwds), when=when) - - -class CallInfo: - """ Result/Exception info a function invocation. """ - #: None or ExceptionInfo object. - excinfo = None - - def __init__(self, func, when): - #: context of invocation: one of "setup", "call", - #: "teardown", "memocollect" - self.when = when - self.start = time() - try: - self.result = func() - except KeyboardInterrupt: - self.stop = time() - raise - except: # noqa - self.excinfo = ExceptionInfo() - self.stop = time() - - def __repr__(self): - if self.excinfo: - status = "exception: %s" % str(self.excinfo.value) - else: - status = "result: %r" % (self.result,) - return "" % (self.when, status) - - -def getslaveinfoline(node): - try: - return node._slaveinfocache - except AttributeError: - d = node.slaveinfo - ver = "%s.%s.%s" % d['version_info'][:3] - node._slaveinfocache = s = "[%s] %s -- Python %s %s" % ( - d['id'], d['sysplatform'], ver, d['executable']) - return s - - -class BaseReport(object): - - def __init__(self, **kw): - self.__dict__.update(kw) - - def toterminal(self, out): - if hasattr(self, 'node'): - out.line(getslaveinfoline(self.node)) - - longrepr = self.longrepr - if longrepr is None: - return - - if hasattr(longrepr, 'toterminal'): - longrepr.toterminal(out) - else: - try: - out.line(longrepr) - except UnicodeEncodeError: - out.line("") - - def get_sections(self, prefix): - for name, content in self.sections: - if name.startswith(prefix): - yield prefix, content - - @property - def longreprtext(self): - """ - Read-only property that returns the full string representation - of ``longrepr``. - - .. versionadded:: 3.0 - """ - tw = py.io.TerminalWriter(stringio=True) - tw.hasmarkup = False - self.toterminal(tw) - exc = tw.stringio.getvalue() - return exc.strip() - - @property - def capstdout(self): - """Return captured text from stdout, if capturing is enabled - - .. versionadded:: 3.0 - """ - return ''.join(content for (prefix, content) in self.get_sections('Captured stdout')) - - @property - def capstderr(self): - """Return captured text from stderr, if capturing is enabled - - .. versionadded:: 3.0 - """ - return ''.join(content for (prefix, content) in self.get_sections('Captured stderr')) - - passed = property(lambda x: x.outcome == "passed") - failed = property(lambda x: x.outcome == "failed") - skipped = property(lambda x: x.outcome == "skipped") - - @property - def fspath(self): - return self.nodeid.split("::")[0] - - -def pytest_runtest_makereport(item, call): - when = call.when - duration = call.stop - call.start - keywords = dict([(x, 1) for x in item.keywords]) - excinfo = call.excinfo - sections = [] - if not call.excinfo: - outcome = "passed" - longrepr = None - else: - if not isinstance(excinfo, ExceptionInfo): - outcome = "failed" - longrepr = excinfo - elif excinfo.errisinstance(skip.Exception): - outcome = "skipped" - r = excinfo._getreprcrash() - longrepr = (str(r.path), r.lineno, r.message) - else: - outcome = "failed" - if call.when == "call": - longrepr = item.repr_failure(excinfo) - else: # exception in setup or teardown - longrepr = item._repr_failure_py(excinfo, - style=item.config.option.tbstyle) - for rwhen, key, content in item._report_sections: - sections.append(("Captured %s %s" % (key, rwhen), content)) - return TestReport(item.nodeid, item.location, - keywords, outcome, longrepr, when, - sections, duration) - - -class TestReport(BaseReport): - """ Basic test report object (also used for setup and teardown calls if - they fail). - """ - - def __init__(self, nodeid, location, keywords, outcome, - longrepr, when, sections=(), duration=0, **extra): - #: normalized collection node id - self.nodeid = nodeid - - #: a (filesystempath, lineno, domaininfo) tuple indicating the - #: actual location of a test item - it might be different from the - #: collected one e.g. if a method is inherited from a different module. - self.location = location - - #: a name -> value dictionary containing all keywords and - #: markers associated with a test invocation. - self.keywords = keywords - - #: test outcome, always one of "passed", "failed", "skipped". - self.outcome = outcome - - #: None or a failure representation. - self.longrepr = longrepr - - #: one of 'setup', 'call', 'teardown' to indicate runtest phase. - self.when = when - - #: list of pairs ``(str, str)`` of extra information which needs to - #: marshallable. Used by pytest to add captured text - #: from ``stdout`` and ``stderr``, but may be used by other plugins - #: to add arbitrary information to reports. - self.sections = list(sections) - - #: time it took to run just the test - self.duration = duration - - self.__dict__.update(extra) - - def __repr__(self): - return "" % ( - self.nodeid, self.when, self.outcome) - - -class TeardownErrorReport(BaseReport): - outcome = "failed" - when = "teardown" - - def __init__(self, longrepr, **extra): - self.longrepr = longrepr - self.sections = [] - self.__dict__.update(extra) - - -def pytest_make_collect_report(collector): - call = CallInfo( - lambda: list(collector.collect()), - 'collect') - longrepr = None - if not call.excinfo: - outcome = "passed" - else: - from _pytest import nose - skip_exceptions = (Skipped,) + nose.get_skip_exceptions() - if call.excinfo.errisinstance(skip_exceptions): - outcome = "skipped" - r = collector._repr_failure_py(call.excinfo, "line").reprcrash - longrepr = (str(r.path), r.lineno, r.message) - else: - outcome = "failed" - errorinfo = collector.repr_failure(call.excinfo) - if not hasattr(errorinfo, "toterminal"): - errorinfo = CollectErrorRepr(errorinfo) - longrepr = errorinfo - rep = CollectReport(collector.nodeid, outcome, longrepr, - getattr(call, 'result', None)) - rep.call = call # see collect_one_node - return rep - - -class CollectReport(BaseReport): - def __init__(self, nodeid, outcome, longrepr, result, - sections=(), **extra): - self.nodeid = nodeid - self.outcome = outcome - self.longrepr = longrepr - self.result = result or [] - self.sections = list(sections) - self.__dict__.update(extra) - - @property - def location(self): - return (self.fspath, None, self.fspath) - - def __repr__(self): - return "" % ( - self.nodeid, len(self.result), self.outcome) - - -class CollectErrorRepr(TerminalRepr): - def __init__(self, msg): - self.longrepr = msg - - def toterminal(self, out): - out.line(self.longrepr, red=True) - - -class SetupState(object): - """ shared state for setting up/tearing down test items or collectors. """ - - def __init__(self): - self.stack = [] - self._finalizers = {} - - def addfinalizer(self, finalizer, colitem): - """ attach a finalizer to the given colitem. - if colitem is None, this will add a finalizer that - is called at the end of teardown_all(). - """ - assert colitem and not isinstance(colitem, tuple) - assert py.builtin.callable(finalizer) - # assert colitem in self.stack # some unit tests don't setup stack :/ - self._finalizers.setdefault(colitem, []).append(finalizer) - - def _pop_and_teardown(self): - colitem = self.stack.pop() - self._teardown_with_finalization(colitem) - - def _callfinalizers(self, colitem): - finalizers = self._finalizers.pop(colitem, None) - exc = None - while finalizers: - fin = finalizers.pop() - try: - fin() - except TEST_OUTCOME: - # XXX Only first exception will be seen by user, - # ideally all should be reported. - if exc is None: - exc = sys.exc_info() - if exc: - py.builtin._reraise(*exc) - - def _teardown_with_finalization(self, colitem): - self._callfinalizers(colitem) - if hasattr(colitem, "teardown"): - colitem.teardown() - for colitem in self._finalizers: - assert colitem is None or colitem in self.stack \ - or isinstance(colitem, tuple) - - def teardown_all(self): - while self.stack: - self._pop_and_teardown() - for key in list(self._finalizers): - self._teardown_with_finalization(key) - assert not self._finalizers - - def teardown_exact(self, item, nextitem): - needed_collectors = nextitem and nextitem.listchain() or [] - self._teardown_towards(needed_collectors) - - def _teardown_towards(self, needed_collectors): - while self.stack: - if self.stack == needed_collectors[:len(self.stack)]: - break - self._pop_and_teardown() - - def prepare(self, colitem): - """ setup objects along the collector chain to the test-method - and teardown previously setup objects.""" - needed_collectors = colitem.listchain() - self._teardown_towards(needed_collectors) - - # check if the last collection node has raised an error - for col in self.stack: - if hasattr(col, '_prepare_exc'): - py.builtin._reraise(*col._prepare_exc) - for col in needed_collectors[len(self.stack):]: - self.stack.append(col) - try: - col.setup() - except TEST_OUTCOME: - col._prepare_exc = sys.exc_info() - raise - - -def collect_one_node(collector): - ihook = collector.ihook - ihook.pytest_collectstart(collector=collector) - rep = ihook.pytest_make_collect_report(collector=collector) - call = rep.__dict__.pop("call", None) - if call and check_interactive_exception(call, rep): - ihook.pytest_exception_interact(node=collector, call=call, report=rep) - return rep diff --git a/lib/spack/external/_pytest/setuponly.py b/lib/spack/external/_pytest/setuponly.py deleted file mode 100644 index 15e195ad5a..0000000000 --- a/lib/spack/external/_pytest/setuponly.py +++ /dev/null @@ -1,74 +0,0 @@ -from __future__ import absolute_import, division, print_function - -import pytest -import sys - - -def pytest_addoption(parser): - group = parser.getgroup("debugconfig") - group.addoption('--setuponly', '--setup-only', action="store_true", - help="only setup fixtures, do not execute tests.") - group.addoption('--setupshow', '--setup-show', action="store_true", - help="show setup of fixtures while executing tests.") - - -@pytest.hookimpl(hookwrapper=True) -def pytest_fixture_setup(fixturedef, request): - yield - config = request.config - if config.option.setupshow: - if hasattr(request, 'param'): - # Save the fixture parameter so ._show_fixture_action() can - # display it now and during the teardown (in .finish()). - if fixturedef.ids: - if callable(fixturedef.ids): - fixturedef.cached_param = fixturedef.ids(request.param) - else: - fixturedef.cached_param = fixturedef.ids[ - request.param_index] - else: - fixturedef.cached_param = request.param - _show_fixture_action(fixturedef, 'SETUP') - - -def pytest_fixture_post_finalizer(fixturedef): - if hasattr(fixturedef, "cached_result"): - config = fixturedef._fixturemanager.config - if config.option.setupshow: - _show_fixture_action(fixturedef, 'TEARDOWN') - if hasattr(fixturedef, "cached_param"): - del fixturedef.cached_param - - -def _show_fixture_action(fixturedef, msg): - config = fixturedef._fixturemanager.config - capman = config.pluginmanager.getplugin('capturemanager') - if capman: - out, err = capman.suspendcapture() - - tw = config.get_terminal_writer() - tw.line() - tw.write(' ' * 2 * fixturedef.scopenum) - tw.write('{step} {scope} {fixture}'.format( - step=msg.ljust(8), # align the output to TEARDOWN - scope=fixturedef.scope[0].upper(), - fixture=fixturedef.argname)) - - if msg == 'SETUP': - deps = sorted(arg for arg in fixturedef.argnames if arg != 'request') - if deps: - tw.write(' (fixtures used: {0})'.format(', '.join(deps))) - - if hasattr(fixturedef, 'cached_param'): - tw.write('[{0}]'.format(fixturedef.cached_param)) - - if capman: - capman.resumecapture() - sys.stdout.write(out) - sys.stderr.write(err) - - -@pytest.hookimpl(tryfirst=True) -def pytest_cmdline_main(config): - if config.option.setuponly: - config.option.setupshow = True diff --git a/lib/spack/external/_pytest/setupplan.py b/lib/spack/external/_pytest/setupplan.py deleted file mode 100644 index e11bd40698..0000000000 --- a/lib/spack/external/_pytest/setupplan.py +++ /dev/null @@ -1,25 +0,0 @@ -from __future__ import absolute_import, division, print_function - -import pytest - - -def pytest_addoption(parser): - group = parser.getgroup("debugconfig") - group.addoption('--setupplan', '--setup-plan', action="store_true", - help="show what fixtures and tests would be executed but " - "don't execute anything.") - - -@pytest.hookimpl(tryfirst=True) -def pytest_fixture_setup(fixturedef, request): - # Will return a dummy fixture if the setuponly option is provided. - if request.config.option.setupplan: - fixturedef.cached_result = (None, None, None) - return fixturedef.cached_result - - -@pytest.hookimpl(tryfirst=True) -def pytest_cmdline_main(config): - if config.option.setupplan: - config.option.setuponly = True - config.option.setupshow = True diff --git a/lib/spack/external/_pytest/skipping.py b/lib/spack/external/_pytest/skipping.py deleted file mode 100644 index b92800d10b..0000000000 --- a/lib/spack/external/_pytest/skipping.py +++ /dev/null @@ -1,372 +0,0 @@ -""" support for skip/xfail functions and markers. """ -from __future__ import absolute_import, division, print_function - -import os -import sys -import traceback - -import py -from _pytest.config import hookimpl -from _pytest.mark import MarkInfo, MarkDecorator -from _pytest.outcomes import fail, skip, xfail, TEST_OUTCOME - - -def pytest_addoption(parser): - group = parser.getgroup("general") - group.addoption('--runxfail', - action="store_true", dest="runxfail", default=False, - help="run tests even if they are marked xfail") - - parser.addini("xfail_strict", "default for the strict parameter of xfail " - "markers when not given explicitly (default: " - "False)", - default=False, - type="bool") - - -def pytest_configure(config): - if config.option.runxfail: - # yay a hack - import pytest - old = pytest.xfail - config._cleanup.append(lambda: setattr(pytest, "xfail", old)) - - def nop(*args, **kwargs): - pass - - nop.Exception = xfail.Exception - setattr(pytest, "xfail", nop) - - config.addinivalue_line("markers", - "skip(reason=None): skip the given test function with an optional reason. " - "Example: skip(reason=\"no way of currently testing this\") skips the " - "test." - ) - config.addinivalue_line("markers", - "skipif(condition): skip the given test function if eval(condition) " - "results in a True value. Evaluation happens within the " - "module global context. Example: skipif('sys.platform == \"win32\"') " - "skips the test if we are on the win32 platform. see " - "http://pytest.org/latest/skipping.html" - ) - config.addinivalue_line("markers", - "xfail(condition, reason=None, run=True, raises=None, strict=False): " - "mark the test function as an expected failure if eval(condition) " - "has a True value. Optionally specify a reason for better reporting " - "and run=False if you don't even want to execute the test function. " - "If only specific exception(s) are expected, you can list them in " - "raises, and if the test fails in other ways, it will be reported as " - "a true failure. See http://pytest.org/latest/skipping.html" - ) - - -class MarkEvaluator: - def __init__(self, item, name): - self.item = item - self.name = name - - @property - def holder(self): - return self.item.keywords.get(self.name) - - def __bool__(self): - return bool(self.holder) - __nonzero__ = __bool__ - - def wasvalid(self): - return not hasattr(self, 'exc') - - def invalidraise(self, exc): - raises = self.get('raises') - if not raises: - return - return not isinstance(exc, raises) - - def istrue(self): - try: - return self._istrue() - except TEST_OUTCOME: - self.exc = sys.exc_info() - if isinstance(self.exc[1], SyntaxError): - msg = [" " * (self.exc[1].offset + 4) + "^", ] - msg.append("SyntaxError: invalid syntax") - else: - msg = traceback.format_exception_only(*self.exc[:2]) - fail("Error evaluating %r expression\n" - " %s\n" - "%s" - % (self.name, self.expr, "\n".join(msg)), - pytrace=False) - - def _getglobals(self): - d = {'os': os, 'sys': sys, 'config': self.item.config} - if hasattr(self.item, 'obj'): - d.update(self.item.obj.__globals__) - return d - - def _istrue(self): - if hasattr(self, 'result'): - return self.result - if self.holder: - if self.holder.args or 'condition' in self.holder.kwargs: - self.result = False - # "holder" might be a MarkInfo or a MarkDecorator; only - # MarkInfo keeps track of all parameters it received in an - # _arglist attribute - marks = getattr(self.holder, '_marks', None) \ - or [self.holder.mark] - for _, args, kwargs in marks: - if 'condition' in kwargs: - args = (kwargs['condition'],) - for expr in args: - self.expr = expr - if isinstance(expr, py.builtin._basestring): - d = self._getglobals() - result = cached_eval(self.item.config, expr, d) - else: - if "reason" not in kwargs: - # XXX better be checked at collection time - msg = "you need to specify reason=STRING " \ - "when using booleans as conditions." - fail(msg) - result = bool(expr) - if result: - self.result = True - self.reason = kwargs.get('reason', None) - self.expr = expr - return self.result - else: - self.result = True - return getattr(self, 'result', False) - - def get(self, attr, default=None): - return self.holder.kwargs.get(attr, default) - - def getexplanation(self): - expl = getattr(self, 'reason', None) or self.get('reason', None) - if not expl: - if not hasattr(self, 'expr'): - return "" - else: - return "condition: " + str(self.expr) - return expl - - -@hookimpl(tryfirst=True) -def pytest_runtest_setup(item): - # Check if skip or skipif are specified as pytest marks - - skipif_info = item.keywords.get('skipif') - if isinstance(skipif_info, (MarkInfo, MarkDecorator)): - eval_skipif = MarkEvaluator(item, 'skipif') - if eval_skipif.istrue(): - item._evalskip = eval_skipif - skip(eval_skipif.getexplanation()) - - skip_info = item.keywords.get('skip') - if isinstance(skip_info, (MarkInfo, MarkDecorator)): - item._evalskip = True - if 'reason' in skip_info.kwargs: - skip(skip_info.kwargs['reason']) - elif skip_info.args: - skip(skip_info.args[0]) - else: - skip("unconditional skip") - - item._evalxfail = MarkEvaluator(item, 'xfail') - check_xfail_no_run(item) - - -@hookimpl(hookwrapper=True) -def pytest_pyfunc_call(pyfuncitem): - check_xfail_no_run(pyfuncitem) - outcome = yield - passed = outcome.excinfo is None - if passed: - check_strict_xfail(pyfuncitem) - - -def check_xfail_no_run(item): - """check xfail(run=False)""" - if not item.config.option.runxfail: - evalxfail = item._evalxfail - if evalxfail.istrue(): - if not evalxfail.get('run', True): - xfail("[NOTRUN] " + evalxfail.getexplanation()) - - -def check_strict_xfail(pyfuncitem): - """check xfail(strict=True) for the given PASSING test""" - evalxfail = pyfuncitem._evalxfail - if evalxfail.istrue(): - strict_default = pyfuncitem.config.getini('xfail_strict') - is_strict_xfail = evalxfail.get('strict', strict_default) - if is_strict_xfail: - del pyfuncitem._evalxfail - explanation = evalxfail.getexplanation() - fail('[XPASS(strict)] ' + explanation, pytrace=False) - - -@hookimpl(hookwrapper=True) -def pytest_runtest_makereport(item, call): - outcome = yield - rep = outcome.get_result() - evalxfail = getattr(item, '_evalxfail', None) - evalskip = getattr(item, '_evalskip', None) - # unitttest special case, see setting of _unexpectedsuccess - if hasattr(item, '_unexpectedsuccess') and rep.when == "call": - from _pytest.compat import _is_unittest_unexpected_success_a_failure - if item._unexpectedsuccess: - rep.longrepr = "Unexpected success: {0}".format(item._unexpectedsuccess) - else: - rep.longrepr = "Unexpected success" - if _is_unittest_unexpected_success_a_failure(): - rep.outcome = "failed" - else: - rep.outcome = "passed" - rep.wasxfail = rep.longrepr - elif item.config.option.runxfail: - pass # don't interefere - elif call.excinfo and call.excinfo.errisinstance(xfail.Exception): - rep.wasxfail = "reason: " + call.excinfo.value.msg - rep.outcome = "skipped" - elif evalxfail and not rep.skipped and evalxfail.wasvalid() and \ - evalxfail.istrue(): - if call.excinfo: - if evalxfail.invalidraise(call.excinfo.value): - rep.outcome = "failed" - else: - rep.outcome = "skipped" - rep.wasxfail = evalxfail.getexplanation() - elif call.when == "call": - strict_default = item.config.getini('xfail_strict') - is_strict_xfail = evalxfail.get('strict', strict_default) - explanation = evalxfail.getexplanation() - if is_strict_xfail: - rep.outcome = "failed" - rep.longrepr = "[XPASS(strict)] {0}".format(explanation) - else: - rep.outcome = "passed" - rep.wasxfail = explanation - elif evalskip is not None and rep.skipped and type(rep.longrepr) is tuple: - # skipped by mark.skipif; change the location of the failure - # to point to the item definition, otherwise it will display - # the location of where the skip exception was raised within pytest - filename, line, reason = rep.longrepr - filename, line = item.location[:2] - rep.longrepr = filename, line, reason - -# called by terminalreporter progress reporting - - -def pytest_report_teststatus(report): - if hasattr(report, "wasxfail"): - if report.skipped: - return "xfailed", "x", "xfail" - elif report.passed: - return "xpassed", "X", ("XPASS", {'yellow': True}) - -# called by the terminalreporter instance/plugin - - -def pytest_terminal_summary(terminalreporter): - tr = terminalreporter - if not tr.reportchars: - # for name in "xfailed skipped failed xpassed": - # if not tr.stats.get(name, 0): - # tr.write_line("HINT: use '-r' option to see extra " - # "summary info about tests") - # break - return - - lines = [] - for char in tr.reportchars: - if char == "x": - show_xfailed(terminalreporter, lines) - elif char == "X": - show_xpassed(terminalreporter, lines) - elif char in "fF": - show_simple(terminalreporter, lines, 'failed', "FAIL %s") - elif char in "sS": - show_skipped(terminalreporter, lines) - elif char == "E": - show_simple(terminalreporter, lines, 'error', "ERROR %s") - elif char == 'p': - show_simple(terminalreporter, lines, 'passed', "PASSED %s") - - if lines: - tr._tw.sep("=", "short test summary info") - for line in lines: - tr._tw.line(line) - - -def show_simple(terminalreporter, lines, stat, format): - failed = terminalreporter.stats.get(stat) - if failed: - for rep in failed: - pos = terminalreporter.config.cwd_relative_nodeid(rep.nodeid) - lines.append(format % (pos,)) - - -def show_xfailed(terminalreporter, lines): - xfailed = terminalreporter.stats.get("xfailed") - if xfailed: - for rep in xfailed: - pos = terminalreporter.config.cwd_relative_nodeid(rep.nodeid) - reason = rep.wasxfail - lines.append("XFAIL %s" % (pos,)) - if reason: - lines.append(" " + str(reason)) - - -def show_xpassed(terminalreporter, lines): - xpassed = terminalreporter.stats.get("xpassed") - if xpassed: - for rep in xpassed: - pos = terminalreporter.config.cwd_relative_nodeid(rep.nodeid) - reason = rep.wasxfail - lines.append("XPASS %s %s" % (pos, reason)) - - -def cached_eval(config, expr, d): - if not hasattr(config, '_evalcache'): - config._evalcache = {} - try: - return config._evalcache[expr] - except KeyError: - import _pytest._code - exprcode = _pytest._code.compile(expr, mode="eval") - config._evalcache[expr] = x = eval(exprcode, d) - return x - - -def folded_skips(skipped): - d = {} - for event in skipped: - key = event.longrepr - assert len(key) == 3, (event, key) - d.setdefault(key, []).append(event) - values = [] - for key, events in d.items(): - values.append((len(events),) + key) - return values - - -def show_skipped(terminalreporter, lines): - tr = terminalreporter - skipped = tr.stats.get('skipped', []) - if skipped: - # if not tr.hasopt('skipped'): - # tr.write_line( - # "%d skipped tests, specify -rs for more info" % - # len(skipped)) - # return - fskips = folded_skips(skipped) - if fskips: - # tr.write_sep("_", "skipped test summary") - for num, fspath, lineno, reason in fskips: - if reason.startswith("Skipped: "): - reason = reason[9:] - lines.append( - "SKIP [%d] %s:%d: %s" % - (num, fspath, lineno + 1, reason)) diff --git a/lib/spack/external/_pytest/terminal.py b/lib/spack/external/_pytest/terminal.py deleted file mode 100644 index 9da94d0c91..0000000000 --- a/lib/spack/external/_pytest/terminal.py +++ /dev/null @@ -1,650 +0,0 @@ -""" terminal reporting of the full testing process. - -This is a good source for looking at the various reporting hooks. -""" -from __future__ import absolute_import, division, print_function - -import itertools -from _pytest.main import EXIT_OK, EXIT_TESTSFAILED, EXIT_INTERRUPTED, \ - EXIT_USAGEERROR, EXIT_NOTESTSCOLLECTED -import pytest -import py -import sys -import time -import platform - -from _pytest import nodes -import _pytest._pluggy as pluggy - - -def pytest_addoption(parser): - group = parser.getgroup("terminal reporting", "reporting", after="general") - group._addoption('-v', '--verbose', action="count", - dest="verbose", default=0, help="increase verbosity."), - group._addoption('-q', '--quiet', action="count", - dest="quiet", default=0, help="decrease verbosity."), - group._addoption('-r', - action="store", dest="reportchars", default='', metavar="chars", - help="show extra test summary info as specified by chars (f)ailed, " - "(E)error, (s)skipped, (x)failed, (X)passed, " - "(p)passed, (P)passed with output, (a)all except pP. " - "Warnings are displayed at all times except when " - "--disable-warnings is set") - group._addoption('--disable-warnings', '--disable-pytest-warnings', default=False, - dest='disable_warnings', action='store_true', - help='disable warnings summary') - group._addoption('-l', '--showlocals', - action="store_true", dest="showlocals", default=False, - help="show locals in tracebacks (disabled by default).") - group._addoption('--tb', metavar="style", - action="store", dest="tbstyle", default='auto', - choices=['auto', 'long', 'short', 'no', 'line', 'native'], - help="traceback print mode (auto/long/short/line/native/no).") - group._addoption('--fulltrace', '--full-trace', - action="store_true", default=False, - help="don't cut any tracebacks (default is to cut).") - group._addoption('--color', metavar="color", - action="store", dest="color", default='auto', - choices=['yes', 'no', 'auto'], - help="color terminal output (yes/no/auto).") - - -def pytest_configure(config): - config.option.verbose -= config.option.quiet - reporter = TerminalReporter(config, sys.stdout) - config.pluginmanager.register(reporter, 'terminalreporter') - if config.option.debug or config.option.traceconfig: - def mywriter(tags, args): - msg = " ".join(map(str, args)) - reporter.write_line("[traceconfig] " + msg) - config.trace.root.setprocessor("pytest:config", mywriter) - - -def getreportopt(config): - reportopts = "" - reportchars = config.option.reportchars - if not config.option.disable_warnings and 'w' not in reportchars: - reportchars += 'w' - elif config.option.disable_warnings and 'w' in reportchars: - reportchars = reportchars.replace('w', '') - if reportchars: - for char in reportchars: - if char not in reportopts and char != 'a': - reportopts += char - elif char == 'a': - reportopts = 'fEsxXw' - return reportopts - - -def pytest_report_teststatus(report): - if report.passed: - letter = "." - elif report.skipped: - letter = "s" - elif report.failed: - letter = "F" - if report.when != "call": - letter = "f" - return report.outcome, letter, report.outcome.upper() - - -class WarningReport: - """ - Simple structure to hold warnings information captured by ``pytest_logwarning``. - """ - - def __init__(self, code, message, nodeid=None, fslocation=None): - """ - :param code: unused - :param str message: user friendly message about the warning - :param str|None nodeid: node id that generated the warning (see ``get_location``). - :param tuple|py.path.local fslocation: - file system location of the source of the warning (see ``get_location``). - """ - self.code = code - self.message = message - self.nodeid = nodeid - self.fslocation = fslocation - - def get_location(self, config): - """ - Returns the more user-friendly information about the location - of a warning, or None. - """ - if self.nodeid: - return self.nodeid - if self.fslocation: - if isinstance(self.fslocation, tuple) and len(self.fslocation) >= 2: - filename, linenum = self.fslocation[:2] - relpath = py.path.local(filename).relto(config.invocation_dir) - return '%s:%s' % (relpath, linenum) - else: - return str(self.fslocation) - return None - - -class TerminalReporter: - def __init__(self, config, file=None): - import _pytest.config - self.config = config - self.verbosity = self.config.option.verbose - self.showheader = self.verbosity >= 0 - self.showfspath = self.verbosity >= 0 - self.showlongtestinfo = self.verbosity > 0 - self._numcollected = 0 - - self.stats = {} - self.startdir = py.path.local() - if file is None: - file = sys.stdout - self._tw = self.writer = _pytest.config.create_terminal_writer(config, - file) - self.currentfspath = None - self.reportchars = getreportopt(config) - self.hasmarkup = self._tw.hasmarkup - self.isatty = file.isatty() - - def hasopt(self, char): - char = {'xfailed': 'x', 'skipped': 's'}.get(char, char) - return char in self.reportchars - - def write_fspath_result(self, nodeid, res): - fspath = self.config.rootdir.join(nodeid.split("::")[0]) - if fspath != self.currentfspath: - self.currentfspath = fspath - fspath = self.startdir.bestrelpath(fspath) - self._tw.line() - self._tw.write(fspath + " ") - self._tw.write(res) - - def write_ensure_prefix(self, prefix, extra="", **kwargs): - if self.currentfspath != prefix: - self._tw.line() - self.currentfspath = prefix - self._tw.write(prefix) - if extra: - self._tw.write(extra, **kwargs) - self.currentfspath = -2 - - def ensure_newline(self): - if self.currentfspath: - self._tw.line() - self.currentfspath = None - - def write(self, content, **markup): - self._tw.write(content, **markup) - - def write_line(self, line, **markup): - if not py.builtin._istext(line): - line = py.builtin.text(line, errors="replace") - self.ensure_newline() - self._tw.line(line, **markup) - - def rewrite(self, line, **markup): - """ - Rewinds the terminal cursor to the beginning and writes the given line. - - :kwarg erase: if True, will also add spaces until the full terminal width to ensure - previous lines are properly erased. - - The rest of the keyword arguments are markup instructions. - """ - erase = markup.pop('erase', False) - if erase: - fill_count = self._tw.fullwidth - len(line) - fill = ' ' * fill_count - else: - fill = '' - line = str(line) - self._tw.write("\r" + line + fill, **markup) - - def write_sep(self, sep, title=None, **markup): - self.ensure_newline() - self._tw.sep(sep, title, **markup) - - def section(self, title, sep="=", **kw): - self._tw.sep(sep, title, **kw) - - def line(self, msg, **kw): - self._tw.line(msg, **kw) - - def pytest_internalerror(self, excrepr): - for line in py.builtin.text(excrepr).split("\n"): - self.write_line("INTERNALERROR> " + line) - return 1 - - def pytest_logwarning(self, code, fslocation, message, nodeid): - warnings = self.stats.setdefault("warnings", []) - warning = WarningReport(code=code, fslocation=fslocation, - message=message, nodeid=nodeid) - warnings.append(warning) - - def pytest_plugin_registered(self, plugin): - if self.config.option.traceconfig: - msg = "PLUGIN registered: %s" % (plugin,) - # XXX this event may happen during setup/teardown time - # which unfortunately captures our output here - # which garbles our output if we use self.write_line - self.write_line(msg) - - def pytest_deselected(self, items): - self.stats.setdefault('deselected', []).extend(items) - - def pytest_runtest_logstart(self, nodeid, location): - # ensure that the path is printed before the - # 1st test of a module starts running - if self.showlongtestinfo: - line = self._locationline(nodeid, *location) - self.write_ensure_prefix(line, "") - elif self.showfspath: - fsid = nodeid.split("::")[0] - self.write_fspath_result(fsid, "") - - def pytest_runtest_logreport(self, report): - rep = report - res = self.config.hook.pytest_report_teststatus(report=rep) - cat, letter, word = res - self.stats.setdefault(cat, []).append(rep) - self._tests_ran = True - if not letter and not word: - # probably passed setup/teardown - return - if self.verbosity <= 0: - if not hasattr(rep, 'node') and self.showfspath: - self.write_fspath_result(rep.nodeid, letter) - else: - self._tw.write(letter) - else: - if isinstance(word, tuple): - word, markup = word - else: - if rep.passed: - markup = {'green': True} - elif rep.failed: - markup = {'red': True} - elif rep.skipped: - markup = {'yellow': True} - line = self._locationline(rep.nodeid, *rep.location) - if not hasattr(rep, 'node'): - self.write_ensure_prefix(line, word, **markup) - # self._tw.write(word, **markup) - else: - self.ensure_newline() - if hasattr(rep, 'node'): - self._tw.write("[%s] " % rep.node.gateway.id) - self._tw.write(word, **markup) - self._tw.write(" " + line) - self.currentfspath = -2 - - def pytest_collection(self): - if not self.isatty and self.config.option.verbose >= 1: - self.write("collecting ... ", bold=True) - - def pytest_collectreport(self, report): - if report.failed: - self.stats.setdefault("error", []).append(report) - elif report.skipped: - self.stats.setdefault("skipped", []).append(report) - items = [x for x in report.result if isinstance(x, pytest.Item)] - self._numcollected += len(items) - if self.isatty: - # self.write_fspath_result(report.nodeid, 'E') - self.report_collect() - - def report_collect(self, final=False): - if self.config.option.verbose < 0: - return - - errors = len(self.stats.get('error', [])) - skipped = len(self.stats.get('skipped', [])) - if final: - line = "collected " - else: - line = "collecting " - line += str(self._numcollected) + " item" + ('' if self._numcollected == 1 else 's') - if errors: - line += " / %d errors" % errors - if skipped: - line += " / %d skipped" % skipped - if self.isatty: - self.rewrite(line, bold=True, erase=True) - if final: - self.write('\n') - else: - self.write_line(line) - - def pytest_collection_modifyitems(self): - self.report_collect(True) - - @pytest.hookimpl(trylast=True) - def pytest_sessionstart(self, session): - self._sessionstarttime = time.time() - if not self.showheader: - return - self.write_sep("=", "test session starts", bold=True) - verinfo = platform.python_version() - msg = "platform %s -- Python %s" % (sys.platform, verinfo) - if hasattr(sys, 'pypy_version_info'): - verinfo = ".".join(map(str, sys.pypy_version_info[:3])) - msg += "[pypy-%s-%s]" % (verinfo, sys.pypy_version_info[3]) - msg += ", pytest-%s, py-%s, pluggy-%s" % ( - pytest.__version__, py.__version__, pluggy.__version__) - if self.verbosity > 0 or self.config.option.debug or \ - getattr(self.config.option, 'pastebin', None): - msg += " -- " + str(sys.executable) - self.write_line(msg) - lines = self.config.hook.pytest_report_header( - config=self.config, startdir=self.startdir) - self._write_report_lines_from_hooks(lines) - - def _write_report_lines_from_hooks(self, lines): - lines.reverse() - for line in flatten(lines): - self.write_line(line) - - def pytest_report_header(self, config): - inifile = "" - if config.inifile: - inifile = " " + config.rootdir.bestrelpath(config.inifile) - lines = ["rootdir: %s, inifile:%s" % (config.rootdir, inifile)] - - plugininfo = config.pluginmanager.list_plugin_distinfo() - if plugininfo: - - lines.append( - "plugins: %s" % ", ".join(_plugin_nameversions(plugininfo))) - return lines - - def pytest_collection_finish(self, session): - if self.config.option.collectonly: - self._printcollecteditems(session.items) - if self.stats.get('failed'): - self._tw.sep("!", "collection failures") - for rep in self.stats.get('failed'): - rep.toterminal(self._tw) - return 1 - return 0 - lines = self.config.hook.pytest_report_collectionfinish( - config=self.config, startdir=self.startdir, items=session.items) - self._write_report_lines_from_hooks(lines) - - def _printcollecteditems(self, items): - # to print out items and their parent collectors - # we take care to leave out Instances aka () - # because later versions are going to get rid of them anyway - if self.config.option.verbose < 0: - if self.config.option.verbose < -1: - counts = {} - for item in items: - name = item.nodeid.split('::', 1)[0] - counts[name] = counts.get(name, 0) + 1 - for name, count in sorted(counts.items()): - self._tw.line("%s: %d" % (name, count)) - else: - for item in items: - nodeid = item.nodeid - nodeid = nodeid.replace("::()::", "::") - self._tw.line(nodeid) - return - stack = [] - indent = "" - for item in items: - needed_collectors = item.listchain()[1:] # strip root node - while stack: - if stack == needed_collectors[:len(stack)]: - break - stack.pop() - for col in needed_collectors[len(stack):]: - stack.append(col) - # if col.name == "()": - # continue - indent = (len(stack) - 1) * " " - self._tw.line("%s%s" % (indent, col)) - - @pytest.hookimpl(hookwrapper=True) - def pytest_sessionfinish(self, exitstatus): - outcome = yield - outcome.get_result() - self._tw.line("") - summary_exit_codes = ( - EXIT_OK, EXIT_TESTSFAILED, EXIT_INTERRUPTED, EXIT_USAGEERROR, - EXIT_NOTESTSCOLLECTED) - if exitstatus in summary_exit_codes: - self.config.hook.pytest_terminal_summary(terminalreporter=self, - exitstatus=exitstatus) - self.summary_errors() - self.summary_failures() - self.summary_warnings() - self.summary_passes() - if exitstatus == EXIT_INTERRUPTED: - self._report_keyboardinterrupt() - del self._keyboardinterrupt_memo - self.summary_deselected() - self.summary_stats() - - def pytest_keyboard_interrupt(self, excinfo): - self._keyboardinterrupt_memo = excinfo.getrepr(funcargs=True) - - def pytest_unconfigure(self): - if hasattr(self, '_keyboardinterrupt_memo'): - self._report_keyboardinterrupt() - - def _report_keyboardinterrupt(self): - excrepr = self._keyboardinterrupt_memo - msg = excrepr.reprcrash.message - self.write_sep("!", msg) - if "KeyboardInterrupt" in msg: - if self.config.option.fulltrace: - excrepr.toterminal(self._tw) - else: - self._tw.line("to show a full traceback on KeyboardInterrupt use --fulltrace", yellow=True) - excrepr.reprcrash.toterminal(self._tw) - - def _locationline(self, nodeid, fspath, lineno, domain): - def mkrel(nodeid): - line = self.config.cwd_relative_nodeid(nodeid) - if domain and line.endswith(domain): - line = line[:-len(domain)] - values = domain.split("[") - values[0] = values[0].replace('.', '::') # don't replace '.' in params - line += "[".join(values) - return line - # collect_fspath comes from testid which has a "/"-normalized path - - if fspath: - res = mkrel(nodeid).replace("::()", "") # parens-normalization - if nodeid.split("::")[0] != fspath.replace("\\", nodes.SEP): - res += " <- " + self.startdir.bestrelpath(fspath) - else: - res = "[location]" - return res + " " - - def _getfailureheadline(self, rep): - if hasattr(rep, 'location'): - fspath, lineno, domain = rep.location - return domain - else: - return "test session" # XXX? - - def _getcrashline(self, rep): - try: - return str(rep.longrepr.reprcrash) - except AttributeError: - try: - return str(rep.longrepr)[:50] - except AttributeError: - return "" - - # - # summaries for sessionfinish - # - def getreports(self, name): - values = [] - for x in self.stats.get(name, []): - if not hasattr(x, '_pdbshown'): - values.append(x) - return values - - def summary_warnings(self): - if self.hasopt("w"): - all_warnings = self.stats.get("warnings") - if not all_warnings: - return - - grouped = itertools.groupby(all_warnings, key=lambda wr: wr.get_location(self.config)) - - self.write_sep("=", "warnings summary", yellow=True, bold=False) - for location, warnings in grouped: - self._tw.line(str(location) or '') - for w in warnings: - lines = w.message.splitlines() - indented = '\n'.join(' ' + x for x in lines) - self._tw.line(indented) - self._tw.line() - self._tw.line('-- Docs: http://doc.pytest.org/en/latest/warnings.html') - - def summary_passes(self): - if self.config.option.tbstyle != "no": - if self.hasopt("P"): - reports = self.getreports('passed') - if not reports: - return - self.write_sep("=", "PASSES") - for rep in reports: - msg = self._getfailureheadline(rep) - self.write_sep("_", msg) - self._outrep_summary(rep) - - def print_teardown_sections(self, rep): - for secname, content in rep.sections: - if 'teardown' in secname: - self._tw.sep('-', secname) - if content[-1:] == "\n": - content = content[:-1] - self._tw.line(content) - - def summary_failures(self): - if self.config.option.tbstyle != "no": - reports = self.getreports('failed') - if not reports: - return - self.write_sep("=", "FAILURES") - for rep in reports: - if self.config.option.tbstyle == "line": - line = self._getcrashline(rep) - self.write_line(line) - else: - msg = self._getfailureheadline(rep) - markup = {'red': True, 'bold': True} - self.write_sep("_", msg, **markup) - self._outrep_summary(rep) - for report in self.getreports(''): - if report.nodeid == rep.nodeid and report.when == 'teardown': - self.print_teardown_sections(report) - - def summary_errors(self): - if self.config.option.tbstyle != "no": - reports = self.getreports('error') - if not reports: - return - self.write_sep("=", "ERRORS") - for rep in self.stats['error']: - msg = self._getfailureheadline(rep) - if not hasattr(rep, 'when'): - # collect - msg = "ERROR collecting " + msg - elif rep.when == "setup": - msg = "ERROR at setup of " + msg - elif rep.when == "teardown": - msg = "ERROR at teardown of " + msg - self.write_sep("_", msg) - self._outrep_summary(rep) - - def _outrep_summary(self, rep): - rep.toterminal(self._tw) - for secname, content in rep.sections: - self._tw.sep("-", secname) - if content[-1:] == "\n": - content = content[:-1] - self._tw.line(content) - - def summary_stats(self): - session_duration = time.time() - self._sessionstarttime - (line, color) = build_summary_stats_line(self.stats) - msg = "%s in %.2f seconds" % (line, session_duration) - markup = {color: True, 'bold': True} - - if self.verbosity >= 0: - self.write_sep("=", msg, **markup) - if self.verbosity == -1: - self.write_line(msg, **markup) - - def summary_deselected(self): - if 'deselected' in self.stats: - self.write_sep("=", "%d tests deselected" % ( - len(self.stats['deselected'])), bold=True) - - -def repr_pythonversion(v=None): - if v is None: - v = sys.version_info - try: - return "%s.%s.%s-%s-%s" % v - except (TypeError, ValueError): - return str(v) - - -def flatten(values): - for x in values: - if isinstance(x, (list, tuple)): - for y in flatten(x): - yield y - else: - yield x - - -def build_summary_stats_line(stats): - keys = ("failed passed skipped deselected " - "xfailed xpassed warnings error").split() - unknown_key_seen = False - for key in stats.keys(): - if key not in keys: - if key: # setup/teardown reports have an empty key, ignore them - keys.append(key) - unknown_key_seen = True - parts = [] - for key in keys: - val = stats.get(key, None) - if val: - parts.append("%d %s" % (len(val), key)) - - if parts: - line = ", ".join(parts) - else: - line = "no tests ran" - - if 'failed' in stats or 'error' in stats: - color = 'red' - elif 'warnings' in stats or unknown_key_seen: - color = 'yellow' - elif 'passed' in stats: - color = 'green' - else: - color = 'yellow' - - return (line, color) - - -def _plugin_nameversions(plugininfo): - values = [] - for plugin, dist in plugininfo: - # gets us name and version! - name = '{dist.project_name}-{dist.version}'.format(dist=dist) - # questionable convenience, but it keeps things short - if name.startswith("pytest-"): - name = name[7:] - # we decided to print python package names - # they can have more than one plugin - if name not in values: - values.append(name) - return values diff --git a/lib/spack/external/_pytest/tmpdir.py b/lib/spack/external/_pytest/tmpdir.py deleted file mode 100644 index da1b032237..0000000000 --- a/lib/spack/external/_pytest/tmpdir.py +++ /dev/null @@ -1,126 +0,0 @@ -""" support for providing temporary directories to test functions. """ -from __future__ import absolute_import, division, print_function - -import re - -import pytest -import py -from _pytest.monkeypatch import MonkeyPatch - - -class TempdirFactory: - """Factory for temporary directories under the common base temp directory. - - The base directory can be configured using the ``--basetemp`` option. - """ - - def __init__(self, config): - self.config = config - self.trace = config.trace.get("tmpdir") - - def ensuretemp(self, string, dir=1): - """ (deprecated) return temporary directory path with - the given string as the trailing part. It is usually - better to use the 'tmpdir' function argument which - provides an empty unique-per-test-invocation directory - and is guaranteed to be empty. - """ - # py.log._apiwarn(">1.1", "use tmpdir function argument") - return self.getbasetemp().ensure(string, dir=dir) - - def mktemp(self, basename, numbered=True): - """Create a subdirectory of the base temporary directory and return it. - If ``numbered``, ensure the directory is unique by adding a number - prefix greater than any existing one. - """ - basetemp = self.getbasetemp() - if not numbered: - p = basetemp.mkdir(basename) - else: - p = py.path.local.make_numbered_dir(prefix=basename, - keep=0, rootdir=basetemp, lock_timeout=None) - self.trace("mktemp", p) - return p - - def getbasetemp(self): - """ return base temporary directory. """ - try: - return self._basetemp - except AttributeError: - basetemp = self.config.option.basetemp - if basetemp: - basetemp = py.path.local(basetemp) - if basetemp.check(): - basetemp.remove() - basetemp.mkdir() - else: - temproot = py.path.local.get_temproot() - user = get_user() - if user: - # use a sub-directory in the temproot to speed-up - # make_numbered_dir() call - rootdir = temproot.join('pytest-of-%s' % user) - else: - rootdir = temproot - rootdir.ensure(dir=1) - basetemp = py.path.local.make_numbered_dir(prefix='pytest-', - rootdir=rootdir) - self._basetemp = t = basetemp.realpath() - self.trace("new basetemp", t) - return t - - def finish(self): - self.trace("finish") - - -def get_user(): - """Return the current user name, or None if getuser() does not work - in the current environment (see #1010). - """ - import getpass - try: - return getpass.getuser() - except (ImportError, KeyError): - return None - - -# backward compatibility -TempdirHandler = TempdirFactory - - -def pytest_configure(config): - """Create a TempdirFactory and attach it to the config object. - - This is to comply with existing plugins which expect the handler to be - available at pytest_configure time, but ideally should be moved entirely - to the tmpdir_factory session fixture. - """ - mp = MonkeyPatch() - t = TempdirFactory(config) - config._cleanup.extend([mp.undo, t.finish]) - mp.setattr(config, '_tmpdirhandler', t, raising=False) - mp.setattr(pytest, 'ensuretemp', t.ensuretemp, raising=False) - - -@pytest.fixture(scope='session') -def tmpdir_factory(request): - """Return a TempdirFactory instance for the test session. - """ - return request.config._tmpdirhandler - - -@pytest.fixture -def tmpdir(request, tmpdir_factory): - """Return a temporary directory path object - which is unique to each test function invocation, - created as a sub directory of the base temporary - directory. The returned object is a `py.path.local`_ - path object. - """ - name = request.node.name - name = re.sub(r"[\W]", "_", name) - MAXVAL = 30 - if len(name) > MAXVAL: - name = name[:MAXVAL] - x = tmpdir_factory.mktemp(name, numbered=True) - return x diff --git a/lib/spack/external/_pytest/unittest.py b/lib/spack/external/_pytest/unittest.py deleted file mode 100644 index 52c9813e8b..0000000000 --- a/lib/spack/external/_pytest/unittest.py +++ /dev/null @@ -1,239 +0,0 @@ -""" discovery and running of std-library "unittest" style tests. """ -from __future__ import absolute_import, division, print_function - -import sys -import traceback - -# for transferring markers -import _pytest._code -from _pytest.config import hookimpl -from _pytest.outcomes import fail, skip, xfail -from _pytest.python import transfer_markers, Class, Module, Function -from _pytest.skipping import MarkEvaluator - - -def pytest_pycollect_makeitem(collector, name, obj): - # has unittest been imported and is obj a subclass of its TestCase? - try: - if not issubclass(obj, sys.modules["unittest"].TestCase): - return - except Exception: - return - # yes, so let's collect it - return UnitTestCase(name, parent=collector) - - -class UnitTestCase(Class): - # marker for fixturemanger.getfixtureinfo() - # to declare that our children do not support funcargs - nofuncargs = True - - def setup(self): - cls = self.obj - if getattr(cls, '__unittest_skip__', False): - return # skipped - setup = getattr(cls, 'setUpClass', None) - if setup is not None: - setup() - teardown = getattr(cls, 'tearDownClass', None) - if teardown is not None: - self.addfinalizer(teardown) - super(UnitTestCase, self).setup() - - def collect(self): - from unittest import TestLoader - cls = self.obj - if not getattr(cls, "__test__", True): - return - self.session._fixturemanager.parsefactories(self, unittest=True) - loader = TestLoader() - module = self.getparent(Module).obj - foundsomething = False - for name in loader.getTestCaseNames(self.obj): - x = getattr(self.obj, name) - if not getattr(x, '__test__', True): - continue - funcobj = getattr(x, 'im_func', x) - transfer_markers(funcobj, cls, module) - yield TestCaseFunction(name, parent=self) - foundsomething = True - - if not foundsomething: - runtest = getattr(self.obj, 'runTest', None) - if runtest is not None: - ut = sys.modules.get("twisted.trial.unittest", None) - if ut is None or runtest != ut.TestCase.runTest: - yield TestCaseFunction('runTest', parent=self) - - -class TestCaseFunction(Function): - _excinfo = None - - def setup(self): - self._testcase = self.parent.obj(self.name) - self._fix_unittest_skip_decorator() - self._obj = getattr(self._testcase, self.name) - if hasattr(self._testcase, 'setup_method'): - self._testcase.setup_method(self._obj) - if hasattr(self, "_request"): - self._request._fillfixtures() - - def _fix_unittest_skip_decorator(self): - """ - The @unittest.skip decorator calls functools.wraps(self._testcase) - The call to functools.wraps() fails unless self._testcase - has a __name__ attribute. This is usually automatically supplied - if the test is a function or method, but we need to add manually - here. - - See issue #1169 - """ - if sys.version_info[0] == 2: - setattr(self._testcase, "__name__", self.name) - - def teardown(self): - if hasattr(self._testcase, 'teardown_method'): - self._testcase.teardown_method(self._obj) - # Allow garbage collection on TestCase instance attributes. - self._testcase = None - self._obj = None - - def startTest(self, testcase): - pass - - def _addexcinfo(self, rawexcinfo): - # unwrap potential exception info (see twisted trial support below) - rawexcinfo = getattr(rawexcinfo, '_rawexcinfo', rawexcinfo) - try: - excinfo = _pytest._code.ExceptionInfo(rawexcinfo) - except TypeError: - try: - try: - values = traceback.format_exception(*rawexcinfo) - values.insert(0, "NOTE: Incompatible Exception Representation, " - "displaying natively:\n\n") - fail("".join(values), pytrace=False) - except (fail.Exception, KeyboardInterrupt): - raise - except: # noqa - fail("ERROR: Unknown Incompatible Exception " - "representation:\n%r" % (rawexcinfo,), pytrace=False) - except KeyboardInterrupt: - raise - except fail.Exception: - excinfo = _pytest._code.ExceptionInfo() - self.__dict__.setdefault('_excinfo', []).append(excinfo) - - def addError(self, testcase, rawexcinfo): - self._addexcinfo(rawexcinfo) - - def addFailure(self, testcase, rawexcinfo): - self._addexcinfo(rawexcinfo) - - def addSkip(self, testcase, reason): - try: - skip(reason) - except skip.Exception: - self._evalskip = MarkEvaluator(self, 'SkipTest') - self._evalskip.result = True - self._addexcinfo(sys.exc_info()) - - def addExpectedFailure(self, testcase, rawexcinfo, reason=""): - try: - xfail(str(reason)) - except xfail.Exception: - self._addexcinfo(sys.exc_info()) - - def addUnexpectedSuccess(self, testcase, reason=""): - self._unexpectedsuccess = reason - - def addSuccess(self, testcase): - pass - - def stopTest(self, testcase): - pass - - def _handle_skip(self): - # implements the skipping machinery (see #2137) - # analog to pythons Lib/unittest/case.py:run - testMethod = getattr(self._testcase, self._testcase._testMethodName) - if (getattr(self._testcase.__class__, "__unittest_skip__", False) or - getattr(testMethod, "__unittest_skip__", False)): - # If the class or method was skipped. - skip_why = (getattr(self._testcase.__class__, '__unittest_skip_why__', '') or - getattr(testMethod, '__unittest_skip_why__', '')) - try: # PY3, unittest2 on PY2 - self._testcase._addSkip(self, self._testcase, skip_why) - except TypeError: # PY2 - if sys.version_info[0] != 2: - raise - self._testcase._addSkip(self, skip_why) - return True - return False - - def runtest(self): - if self.config.pluginmanager.get_plugin("pdbinvoke") is None: - self._testcase(result=self) - else: - # disables tearDown and cleanups for post mortem debugging (see #1890) - if self._handle_skip(): - return - self._testcase.debug() - - def _prunetraceback(self, excinfo): - Function._prunetraceback(self, excinfo) - traceback = excinfo.traceback.filter( - lambda x: not x.frame.f_globals.get('__unittest')) - if traceback: - excinfo.traceback = traceback - - -@hookimpl(tryfirst=True) -def pytest_runtest_makereport(item, call): - if isinstance(item, TestCaseFunction): - if item._excinfo: - call.excinfo = item._excinfo.pop(0) - try: - del call.result - except AttributeError: - pass - -# twisted trial support - - -@hookimpl(hookwrapper=True) -def pytest_runtest_protocol(item): - if isinstance(item, TestCaseFunction) and \ - 'twisted.trial.unittest' in sys.modules: - ut = sys.modules['twisted.python.failure'] - Failure__init__ = ut.Failure.__init__ - check_testcase_implements_trial_reporter() - - def excstore(self, exc_value=None, exc_type=None, exc_tb=None, - captureVars=None): - if exc_value is None: - self._rawexcinfo = sys.exc_info() - else: - if exc_type is None: - exc_type = type(exc_value) - self._rawexcinfo = (exc_type, exc_value, exc_tb) - try: - Failure__init__(self, exc_value, exc_type, exc_tb, - captureVars=captureVars) - except TypeError: - Failure__init__(self, exc_value, exc_type, exc_tb) - - ut.Failure.__init__ = excstore - yield - ut.Failure.__init__ = Failure__init__ - else: - yield - - -def check_testcase_implements_trial_reporter(done=[]): - if done: - return - from zope.interface import classImplements - from twisted.trial.itrial import IReporter - classImplements(TestCaseFunction, IReporter) - done.append(1) diff --git a/lib/spack/external/_pytest/vendored_packages/README.md b/lib/spack/external/_pytest/vendored_packages/README.md deleted file mode 100644 index b5fe6febb0..0000000000 --- a/lib/spack/external/_pytest/vendored_packages/README.md +++ /dev/null @@ -1,13 +0,0 @@ -This directory vendors the `pluggy` module. - -For a more detailed discussion for the reasons to vendoring this -package, please see [this issue](https://github.com/pytest-dev/pytest/issues/944). - -To update the current version, execute: - -``` -$ pip install -U pluggy== --no-compile --target=_pytest/vendored_packages -``` - -And commit the modified files. The `pluggy-.dist-info` directory -created by `pip` should be added as well. diff --git a/lib/spack/external/_pytest/vendored_packages/__init__.py b/lib/spack/external/_pytest/vendored_packages/__init__.py deleted file mode 100644 index e69de29bb2..0000000000 diff --git a/lib/spack/external/_pytest/vendored_packages/pluggy-0.4.0.dist-info/DESCRIPTION.rst b/lib/spack/external/_pytest/vendored_packages/pluggy-0.4.0.dist-info/DESCRIPTION.rst deleted file mode 100644 index da0e7a6ed7..0000000000 --- a/lib/spack/external/_pytest/vendored_packages/pluggy-0.4.0.dist-info/DESCRIPTION.rst +++ /dev/null @@ -1,11 +0,0 @@ - -Plugin registration and hook calling for Python -=============================================== - -This is the plugin manager as used by pytest but stripped -of pytest specific details. - -During the 0.x series this plugin does not have much documentation -except extensive docstrings in the pluggy.py module. - - diff --git a/lib/spack/external/_pytest/vendored_packages/pluggy-0.4.0.dist-info/INSTALLER b/lib/spack/external/_pytest/vendored_packages/pluggy-0.4.0.dist-info/INSTALLER deleted file mode 100644 index a1b589e38a..0000000000 --- a/lib/spack/external/_pytest/vendored_packages/pluggy-0.4.0.dist-info/INSTALLER +++ /dev/null @@ -1 +0,0 @@ -pip diff --git a/lib/spack/external/_pytest/vendored_packages/pluggy-0.4.0.dist-info/LICENSE.txt b/lib/spack/external/_pytest/vendored_packages/pluggy-0.4.0.dist-info/LICENSE.txt deleted file mode 100644 index 121017d086..0000000000 --- a/lib/spack/external/_pytest/vendored_packages/pluggy-0.4.0.dist-info/LICENSE.txt +++ /dev/null @@ -1,22 +0,0 @@ -The MIT License (MIT) - -Copyright (c) 2015 holger krekel (rather uses bitbucket/hpk42) - -Permission is hereby granted, free of charge, to any person obtaining a copy -of this software and associated documentation files (the "Software"), to deal -in the Software without restriction, including without limitation the rights -to use, copy, modify, merge, publish, distribute, sublicense, and/or sell -copies of the Software, and to permit persons to whom the Software is -furnished to do so, subject to the following conditions: - -The above copyright notice and this permission notice shall be included in all -copies or substantial portions of the Software. - -THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR -IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, -FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE -AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER -LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, -OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE -SOFTWARE. - diff --git a/lib/spack/external/_pytest/vendored_packages/pluggy-0.4.0.dist-info/METADATA b/lib/spack/external/_pytest/vendored_packages/pluggy-0.4.0.dist-info/METADATA deleted file mode 100644 index bd88517c94..0000000000 --- a/lib/spack/external/_pytest/vendored_packages/pluggy-0.4.0.dist-info/METADATA +++ /dev/null @@ -1,40 +0,0 @@ -Metadata-Version: 2.0 -Name: pluggy -Version: 0.4.0 -Summary: plugin and hook calling mechanisms for python -Home-page: https://github.com/pytest-dev/pluggy -Author: Holger Krekel -Author-email: holger at merlinux.eu -License: MIT license -Platform: unix -Platform: linux -Platform: osx -Platform: win32 -Classifier: Development Status :: 4 - Beta -Classifier: Intended Audience :: Developers -Classifier: License :: OSI Approved :: MIT License -Classifier: Operating System :: POSIX -Classifier: Operating System :: Microsoft :: Windows -Classifier: Operating System :: MacOS :: MacOS X -Classifier: Topic :: Software Development :: Testing -Classifier: Topic :: Software Development :: Libraries -Classifier: Topic :: Utilities -Classifier: Programming Language :: Python :: 2 -Classifier: Programming Language :: Python :: 2.6 -Classifier: Programming Language :: Python :: 2.7 -Classifier: Programming Language :: Python :: 3 -Classifier: Programming Language :: Python :: 3.3 -Classifier: Programming Language :: Python :: 3.4 -Classifier: Programming Language :: Python :: 3.5 - - -Plugin registration and hook calling for Python -=============================================== - -This is the plugin manager as used by pytest but stripped -of pytest specific details. - -During the 0.x series this plugin does not have much documentation -except extensive docstrings in the pluggy.py module. - - diff --git a/lib/spack/external/_pytest/vendored_packages/pluggy-0.4.0.dist-info/RECORD b/lib/spack/external/_pytest/vendored_packages/pluggy-0.4.0.dist-info/RECORD deleted file mode 100644 index 3003a3bf2b..0000000000 --- a/lib/spack/external/_pytest/vendored_packages/pluggy-0.4.0.dist-info/RECORD +++ /dev/null @@ -1,9 +0,0 @@ -pluggy.py,sha256=u0oG9cv-oLOkNvEBlwnnu8pp1AyxpoERgUO00S3rvpQ,31543 -pluggy-0.4.0.dist-info/DESCRIPTION.rst,sha256=ltvjkFd40LW_xShthp6RRVM6OB_uACYDFR3kTpKw7o4,307 -pluggy-0.4.0.dist-info/LICENSE.txt,sha256=ruwhUOyV1HgE9F35JVL9BCZ9vMSALx369I4xq9rhpkM,1134 -pluggy-0.4.0.dist-info/METADATA,sha256=pe2hbsqKFaLHC6wAQPpFPn0KlpcPfLBe_BnS4O70bfk,1364 -pluggy-0.4.0.dist-info/RECORD,, -pluggy-0.4.0.dist-info/WHEEL,sha256=9Z5Xm-eel1bTS7e6ogYiKz0zmPEqDwIypurdHN1hR40,116 -pluggy-0.4.0.dist-info/metadata.json,sha256=T3go5L2qOa_-H-HpCZi3EoVKb8sZ3R-fOssbkWo2nvM,1119 -pluggy-0.4.0.dist-info/top_level.txt,sha256=xKSCRhai-v9MckvMuWqNz16c1tbsmOggoMSwTgcpYHE,7 -pluggy-0.4.0.dist-info/INSTALLER,sha256=zuuue4knoyJ-UwPPXg8fezS7VCrXJQrAP7zeNuwvFQg,4 diff --git a/lib/spack/external/_pytest/vendored_packages/pluggy-0.4.0.dist-info/WHEEL b/lib/spack/external/_pytest/vendored_packages/pluggy-0.4.0.dist-info/WHEEL deleted file mode 100644 index 8b6dd1b5a8..0000000000 --- a/lib/spack/external/_pytest/vendored_packages/pluggy-0.4.0.dist-info/WHEEL +++ /dev/null @@ -1,6 +0,0 @@ -Wheel-Version: 1.0 -Generator: bdist_wheel (0.29.0) -Root-Is-Purelib: true -Tag: py2-none-any -Tag: py3-none-any - diff --git a/lib/spack/external/_pytest/vendored_packages/pluggy-0.4.0.dist-info/metadata.json b/lib/spack/external/_pytest/vendored_packages/pluggy-0.4.0.dist-info/metadata.json deleted file mode 100644 index cde22aff02..0000000000 --- a/lib/spack/external/_pytest/vendored_packages/pluggy-0.4.0.dist-info/metadata.json +++ /dev/null @@ -1 +0,0 @@ -{"classifiers": ["Development Status :: 4 - Beta", "Intended Audience :: Developers", "License :: OSI Approved :: MIT License", "Operating System :: POSIX", "Operating System :: Microsoft :: Windows", "Operating System :: MacOS :: MacOS X", "Topic :: Software Development :: Testing", "Topic :: Software Development :: Libraries", "Topic :: Utilities", "Programming Language :: Python :: 2", "Programming Language :: Python :: 2.6", "Programming Language :: Python :: 2.7", "Programming Language :: Python :: 3", "Programming Language :: Python :: 3.3", "Programming Language :: Python :: 3.4", "Programming Language :: Python :: 3.5"], "extensions": {"python.details": {"contacts": [{"email": "holger at merlinux.eu", "name": "Holger Krekel", "role": "author"}], "document_names": {"description": "DESCRIPTION.rst", "license": "LICENSE.txt"}, "project_urls": {"Home": "https://github.com/pytest-dev/pluggy"}}}, "generator": "bdist_wheel (0.29.0)", "license": "MIT license", "metadata_version": "2.0", "name": "pluggy", "platform": "unix", "summary": "plugin and hook calling mechanisms for python", "version": "0.4.0"} \ No newline at end of file diff --git a/lib/spack/external/_pytest/vendored_packages/pluggy-0.4.0.dist-info/top_level.txt b/lib/spack/external/_pytest/vendored_packages/pluggy-0.4.0.dist-info/top_level.txt deleted file mode 100644 index 11bdb5c1f5..0000000000 --- a/lib/spack/external/_pytest/vendored_packages/pluggy-0.4.0.dist-info/top_level.txt +++ /dev/null @@ -1 +0,0 @@ -pluggy diff --git a/lib/spack/external/_pytest/vendored_packages/pluggy.py b/lib/spack/external/_pytest/vendored_packages/pluggy.py deleted file mode 100644 index 6f26552d73..0000000000 --- a/lib/spack/external/_pytest/vendored_packages/pluggy.py +++ /dev/null @@ -1,782 +0,0 @@ -""" -PluginManager, basic initialization and tracing. - -pluggy is the cristallized core of plugin management as used -by some 150 plugins for pytest. - -Pluggy uses semantic versioning. Breaking changes are only foreseen for -Major releases (incremented X in "X.Y.Z"). If you want to use pluggy in -your project you should thus use a dependency restriction like -"pluggy>=0.1.0,<1.0" to avoid surprises. - -pluggy is concerned with hook specification, hook implementations and hook -calling. For any given hook specification a hook call invokes up to N implementations. -A hook implementation can influence its position and type of execution: -if attributed "tryfirst" or "trylast" it will be tried to execute -first or last. However, if attributed "hookwrapper" an implementation -can wrap all calls to non-hookwrapper implementations. A hookwrapper -can thus execute some code ahead and after the execution of other hooks. - -Hook specification is done by way of a regular python function where -both the function name and the names of all its arguments are significant. -Each hook implementation function is verified against the original specification -function, including the names of all its arguments. To allow for hook specifications -to evolve over the livetime of a project, hook implementations can -accept less arguments. One can thus add new arguments and semantics to -a hook specification by adding another argument typically without breaking -existing hook implementations. - -The chosen approach is meant to let a hook designer think carefuly about -which objects are needed by an extension writer. By contrast, subclass-based -extension mechanisms often expose a lot more state and behaviour than needed, -thus restricting future developments. - -Pluggy currently consists of functionality for: - -- a way to register new hook specifications. Without a hook - specification no hook calling can be performed. - -- a registry of plugins which contain hook implementation functions. It - is possible to register plugins for which a hook specification is not yet - known and validate all hooks when the system is in a more referentially - consistent state. Setting an "optionalhook" attribution to a hook - implementation will avoid PluginValidationError's if a specification - is missing. This allows to have optional integration between plugins. - -- a "hook" relay object from which you can launch 1:N calls to - registered hook implementation functions - -- a mechanism for ordering hook implementation functions - -- mechanisms for two different type of 1:N calls: "firstresult" for when - the call should stop when the first implementation returns a non-None result. - And the other (default) way of guaranteeing that all hook implementations - will be called and their non-None result collected. - -- mechanisms for "historic" extension points such that all newly - registered functions will receive all hook calls that happened - before their registration. - -- a mechanism for discovering plugin objects which are based on - setuptools based entry points. - -- a simple tracing mechanism, including tracing of plugin calls and - their arguments. - -""" -import sys -import inspect - -__version__ = '0.4.0' - -__all__ = ["PluginManager", "PluginValidationError", "HookCallError", - "HookspecMarker", "HookimplMarker"] - -_py3 = sys.version_info > (3, 0) - - -class HookspecMarker: - """ Decorator helper class for marking functions as hook specifications. - - You can instantiate it with a project_name to get a decorator. - Calling PluginManager.add_hookspecs later will discover all marked functions - if the PluginManager uses the same project_name. - """ - - def __init__(self, project_name): - self.project_name = project_name - - def __call__(self, function=None, firstresult=False, historic=False): - """ if passed a function, directly sets attributes on the function - which will make it discoverable to add_hookspecs(). If passed no - function, returns a decorator which can be applied to a function - later using the attributes supplied. - - If firstresult is True the 1:N hook call (N being the number of registered - hook implementation functions) will stop at I<=N when the I'th function - returns a non-None result. - - If historic is True calls to a hook will be memorized and replayed - on later registered plugins. - - """ - def setattr_hookspec_opts(func): - if historic and firstresult: - raise ValueError("cannot have a historic firstresult hook") - setattr(func, self.project_name + "_spec", - dict(firstresult=firstresult, historic=historic)) - return func - - if function is not None: - return setattr_hookspec_opts(function) - else: - return setattr_hookspec_opts - - -class HookimplMarker: - """ Decorator helper class for marking functions as hook implementations. - - You can instantiate with a project_name to get a decorator. - Calling PluginManager.register later will discover all marked functions - if the PluginManager uses the same project_name. - """ - def __init__(self, project_name): - self.project_name = project_name - - def __call__(self, function=None, hookwrapper=False, optionalhook=False, - tryfirst=False, trylast=False): - - """ if passed a function, directly sets attributes on the function - which will make it discoverable to register(). If passed no function, - returns a decorator which can be applied to a function later using - the attributes supplied. - - If optionalhook is True a missing matching hook specification will not result - in an error (by default it is an error if no matching spec is found). - - If tryfirst is True this hook implementation will run as early as possible - in the chain of N hook implementations for a specfication. - - If trylast is True this hook implementation will run as late as possible - in the chain of N hook implementations. - - If hookwrapper is True the hook implementations needs to execute exactly - one "yield". The code before the yield is run early before any non-hookwrapper - function is run. The code after the yield is run after all non-hookwrapper - function have run. The yield receives an ``_CallOutcome`` object representing - the exception or result outcome of the inner calls (including other hookwrapper - calls). - - """ - def setattr_hookimpl_opts(func): - setattr(func, self.project_name + "_impl", - dict(hookwrapper=hookwrapper, optionalhook=optionalhook, - tryfirst=tryfirst, trylast=trylast)) - return func - - if function is None: - return setattr_hookimpl_opts - else: - return setattr_hookimpl_opts(function) - - -def normalize_hookimpl_opts(opts): - opts.setdefault("tryfirst", False) - opts.setdefault("trylast", False) - opts.setdefault("hookwrapper", False) - opts.setdefault("optionalhook", False) - - -class _TagTracer: - def __init__(self): - self._tag2proc = {} - self.writer = None - self.indent = 0 - - def get(self, name): - return _TagTracerSub(self, (name,)) - - def format_message(self, tags, args): - if isinstance(args[-1], dict): - extra = args[-1] - args = args[:-1] - else: - extra = {} - - content = " ".join(map(str, args)) - indent = " " * self.indent - - lines = [ - "%s%s [%s]\n" % (indent, content, ":".join(tags)) - ] - - for name, value in extra.items(): - lines.append("%s %s: %s\n" % (indent, name, value)) - return lines - - def processmessage(self, tags, args): - if self.writer is not None and args: - lines = self.format_message(tags, args) - self.writer(''.join(lines)) - try: - self._tag2proc[tags](tags, args) - except KeyError: - pass - - def setwriter(self, writer): - self.writer = writer - - def setprocessor(self, tags, processor): - if isinstance(tags, str): - tags = tuple(tags.split(":")) - else: - assert isinstance(tags, tuple) - self._tag2proc[tags] = processor - - -class _TagTracerSub: - def __init__(self, root, tags): - self.root = root - self.tags = tags - - def __call__(self, *args): - self.root.processmessage(self.tags, args) - - def setmyprocessor(self, processor): - self.root.setprocessor(self.tags, processor) - - def get(self, name): - return self.__class__(self.root, self.tags + (name,)) - - -def _raise_wrapfail(wrap_controller, msg): - co = wrap_controller.gi_code - raise RuntimeError("wrap_controller at %r %s:%d %s" % - (co.co_name, co.co_filename, co.co_firstlineno, msg)) - - -def _wrapped_call(wrap_controller, func): - """ Wrap calling to a function with a generator which needs to yield - exactly once. The yield point will trigger calling the wrapped function - and return its _CallOutcome to the yield point. The generator then needs - to finish (raise StopIteration) in order for the wrapped call to complete. - """ - try: - next(wrap_controller) # first yield - except StopIteration: - _raise_wrapfail(wrap_controller, "did not yield") - call_outcome = _CallOutcome(func) - try: - wrap_controller.send(call_outcome) - _raise_wrapfail(wrap_controller, "has second yield") - except StopIteration: - pass - return call_outcome.get_result() - - -class _CallOutcome: - """ Outcome of a function call, either an exception or a proper result. - Calling the ``get_result`` method will return the result or reraise - the exception raised when the function was called. """ - excinfo = None - - def __init__(self, func): - try: - self.result = func() - except BaseException: - self.excinfo = sys.exc_info() - - def force_result(self, result): - self.result = result - self.excinfo = None - - def get_result(self): - if self.excinfo is None: - return self.result - else: - ex = self.excinfo - if _py3: - raise ex[1].with_traceback(ex[2]) - _reraise(*ex) # noqa - -if not _py3: - exec(""" -def _reraise(cls, val, tb): - raise cls, val, tb -""") - - -class _TracedHookExecution: - def __init__(self, pluginmanager, before, after): - self.pluginmanager = pluginmanager - self.before = before - self.after = after - self.oldcall = pluginmanager._inner_hookexec - assert not isinstance(self.oldcall, _TracedHookExecution) - self.pluginmanager._inner_hookexec = self - - def __call__(self, hook, hook_impls, kwargs): - self.before(hook.name, hook_impls, kwargs) - outcome = _CallOutcome(lambda: self.oldcall(hook, hook_impls, kwargs)) - self.after(outcome, hook.name, hook_impls, kwargs) - return outcome.get_result() - - def undo(self): - self.pluginmanager._inner_hookexec = self.oldcall - - -class PluginManager(object): - """ Core Pluginmanager class which manages registration - of plugin objects and 1:N hook calling. - - You can register new hooks by calling ``add_hookspec(module_or_class)``. - You can register plugin objects (which contain hooks) by calling - ``register(plugin)``. The Pluginmanager is initialized with a - prefix that is searched for in the names of the dict of registered - plugin objects. An optional excludefunc allows to blacklist names which - are not considered as hooks despite a matching prefix. - - For debugging purposes you can call ``enable_tracing()`` - which will subsequently send debug information to the trace helper. - """ - - def __init__(self, project_name, implprefix=None): - """ if implprefix is given implementation functions - will be recognized if their name matches the implprefix. """ - self.project_name = project_name - self._name2plugin = {} - self._plugin2hookcallers = {} - self._plugin_distinfo = [] - self.trace = _TagTracer().get("pluginmanage") - self.hook = _HookRelay(self.trace.root.get("hook")) - self._implprefix = implprefix - self._inner_hookexec = lambda hook, methods, kwargs: \ - _MultiCall(methods, kwargs, hook.spec_opts).execute() - - def _hookexec(self, hook, methods, kwargs): - # called from all hookcaller instances. - # enable_tracing will set its own wrapping function at self._inner_hookexec - return self._inner_hookexec(hook, methods, kwargs) - - def register(self, plugin, name=None): - """ Register a plugin and return its canonical name or None if the name - is blocked from registering. Raise a ValueError if the plugin is already - registered. """ - plugin_name = name or self.get_canonical_name(plugin) - - if plugin_name in self._name2plugin or plugin in self._plugin2hookcallers: - if self._name2plugin.get(plugin_name, -1) is None: - return # blocked plugin, return None to indicate no registration - raise ValueError("Plugin already registered: %s=%s\n%s" % - (plugin_name, plugin, self._name2plugin)) - - # XXX if an error happens we should make sure no state has been - # changed at point of return - self._name2plugin[plugin_name] = plugin - - # register matching hook implementations of the plugin - self._plugin2hookcallers[plugin] = hookcallers = [] - for name in dir(plugin): - hookimpl_opts = self.parse_hookimpl_opts(plugin, name) - if hookimpl_opts is not None: - normalize_hookimpl_opts(hookimpl_opts) - method = getattr(plugin, name) - hookimpl = HookImpl(plugin, plugin_name, method, hookimpl_opts) - hook = getattr(self.hook, name, None) - if hook is None: - hook = _HookCaller(name, self._hookexec) - setattr(self.hook, name, hook) - elif hook.has_spec(): - self._verify_hook(hook, hookimpl) - hook._maybe_apply_history(hookimpl) - hook._add_hookimpl(hookimpl) - hookcallers.append(hook) - return plugin_name - - def parse_hookimpl_opts(self, plugin, name): - method = getattr(plugin, name) - try: - res = getattr(method, self.project_name + "_impl", None) - except Exception: - res = {} - if res is not None and not isinstance(res, dict): - # false positive - res = None - elif res is None and self._implprefix and name.startswith(self._implprefix): - res = {} - return res - - def unregister(self, plugin=None, name=None): - """ unregister a plugin object and all its contained hook implementations - from internal data structures. """ - if name is None: - assert plugin is not None, "one of name or plugin needs to be specified" - name = self.get_name(plugin) - - if plugin is None: - plugin = self.get_plugin(name) - - # if self._name2plugin[name] == None registration was blocked: ignore - if self._name2plugin.get(name): - del self._name2plugin[name] - - for hookcaller in self._plugin2hookcallers.pop(plugin, []): - hookcaller._remove_plugin(plugin) - - return plugin - - def set_blocked(self, name): - """ block registrations of the given name, unregister if already registered. """ - self.unregister(name=name) - self._name2plugin[name] = None - - def is_blocked(self, name): - """ return True if the name blogs registering plugins of that name. """ - return name in self._name2plugin and self._name2plugin[name] is None - - def add_hookspecs(self, module_or_class): - """ add new hook specifications defined in the given module_or_class. - Functions are recognized if they have been decorated accordingly. """ - names = [] - for name in dir(module_or_class): - spec_opts = self.parse_hookspec_opts(module_or_class, name) - if spec_opts is not None: - hc = getattr(self.hook, name, None) - if hc is None: - hc = _HookCaller(name, self._hookexec, module_or_class, spec_opts) - setattr(self.hook, name, hc) - else: - # plugins registered this hook without knowing the spec - hc.set_specification(module_or_class, spec_opts) - for hookfunction in (hc._wrappers + hc._nonwrappers): - self._verify_hook(hc, hookfunction) - names.append(name) - - if not names: - raise ValueError("did not find any %r hooks in %r" % - (self.project_name, module_or_class)) - - def parse_hookspec_opts(self, module_or_class, name): - method = getattr(module_or_class, name) - return getattr(method, self.project_name + "_spec", None) - - def get_plugins(self): - """ return the set of registered plugins. """ - return set(self._plugin2hookcallers) - - def is_registered(self, plugin): - """ Return True if the plugin is already registered. """ - return plugin in self._plugin2hookcallers - - def get_canonical_name(self, plugin): - """ Return canonical name for a plugin object. Note that a plugin - may be registered under a different name which was specified - by the caller of register(plugin, name). To obtain the name - of an registered plugin use ``get_name(plugin)`` instead.""" - return getattr(plugin, "__name__", None) or str(id(plugin)) - - def get_plugin(self, name): - """ Return a plugin or None for the given name. """ - return self._name2plugin.get(name) - - def has_plugin(self, name): - """ Return True if a plugin with the given name is registered. """ - return self.get_plugin(name) is not None - - def get_name(self, plugin): - """ Return name for registered plugin or None if not registered. """ - for name, val in self._name2plugin.items(): - if plugin == val: - return name - - def _verify_hook(self, hook, hookimpl): - if hook.is_historic() and hookimpl.hookwrapper: - raise PluginValidationError( - "Plugin %r\nhook %r\nhistoric incompatible to hookwrapper" % - (hookimpl.plugin_name, hook.name)) - - for arg in hookimpl.argnames: - if arg not in hook.argnames: - raise PluginValidationError( - "Plugin %r\nhook %r\nargument %r not available\n" - "plugin definition: %s\n" - "available hookargs: %s" % - (hookimpl.plugin_name, hook.name, arg, - _formatdef(hookimpl.function), ", ".join(hook.argnames))) - - def check_pending(self): - """ Verify that all hooks which have not been verified against - a hook specification are optional, otherwise raise PluginValidationError""" - for name in self.hook.__dict__: - if name[0] != "_": - hook = getattr(self.hook, name) - if not hook.has_spec(): - for hookimpl in (hook._wrappers + hook._nonwrappers): - if not hookimpl.optionalhook: - raise PluginValidationError( - "unknown hook %r in plugin %r" % - (name, hookimpl.plugin)) - - def list_plugin_distinfo(self): - """ return list of distinfo/plugin tuples for all setuptools registered - plugins. """ - return list(self._plugin_distinfo) - - def list_name_plugin(self): - """ return list of name/plugin pairs. """ - return list(self._name2plugin.items()) - - def get_hookcallers(self, plugin): - """ get all hook callers for the specified plugin. """ - return self._plugin2hookcallers.get(plugin) - - def add_hookcall_monitoring(self, before, after): - """ add before/after tracing functions for all hooks - and return an undo function which, when called, - will remove the added tracers. - - ``before(hook_name, hook_impls, kwargs)`` will be called ahead - of all hook calls and receive a hookcaller instance, a list - of HookImpl instances and the keyword arguments for the hook call. - - ``after(outcome, hook_name, hook_impls, kwargs)`` receives the - same arguments as ``before`` but also a :py:class:`_CallOutcome <_pytest.vendored_packages.pluggy._CallOutcome>` object - which represents the result of the overall hook call. - """ - return _TracedHookExecution(self, before, after).undo - - def enable_tracing(self): - """ enable tracing of hook calls and return an undo function. """ - hooktrace = self.hook._trace - - def before(hook_name, methods, kwargs): - hooktrace.root.indent += 1 - hooktrace(hook_name, kwargs) - - def after(outcome, hook_name, methods, kwargs): - if outcome.excinfo is None: - hooktrace("finish", hook_name, "-->", outcome.result) - hooktrace.root.indent -= 1 - - return self.add_hookcall_monitoring(before, after) - - def subset_hook_caller(self, name, remove_plugins): - """ Return a new _HookCaller instance for the named method - which manages calls to all registered plugins except the - ones from remove_plugins. """ - orig = getattr(self.hook, name) - plugins_to_remove = [plug for plug in remove_plugins if hasattr(plug, name)] - if plugins_to_remove: - hc = _HookCaller(orig.name, orig._hookexec, orig._specmodule_or_class, - orig.spec_opts) - for hookimpl in (orig._wrappers + orig._nonwrappers): - plugin = hookimpl.plugin - if plugin not in plugins_to_remove: - hc._add_hookimpl(hookimpl) - # we also keep track of this hook caller so it - # gets properly removed on plugin unregistration - self._plugin2hookcallers.setdefault(plugin, []).append(hc) - return hc - return orig - - -class _MultiCall: - """ execute a call into multiple python functions/methods. """ - - # XXX note that the __multicall__ argument is supported only - # for pytest compatibility reasons. It was never officially - # supported there and is explicitely deprecated since 2.8 - # so we can remove it soon, allowing to avoid the below recursion - # in execute() and simplify/speed up the execute loop. - - def __init__(self, hook_impls, kwargs, specopts={}): - self.hook_impls = hook_impls - self.kwargs = kwargs - self.kwargs["__multicall__"] = self - self.specopts = specopts - - def execute(self): - all_kwargs = self.kwargs - self.results = results = [] - firstresult = self.specopts.get("firstresult") - - while self.hook_impls: - hook_impl = self.hook_impls.pop() - try: - args = [all_kwargs[argname] for argname in hook_impl.argnames] - except KeyError: - for argname in hook_impl.argnames: - if argname not in all_kwargs: - raise HookCallError( - "hook call must provide argument %r" % (argname,)) - if hook_impl.hookwrapper: - return _wrapped_call(hook_impl.function(*args), self.execute) - res = hook_impl.function(*args) - if res is not None: - if firstresult: - return res - results.append(res) - - if not firstresult: - return results - - def __repr__(self): - status = "%d meths" % (len(self.hook_impls),) - if hasattr(self, "results"): - status = ("%d results, " % len(self.results)) + status - return "<_MultiCall %s, kwargs=%r>" % (status, self.kwargs) - - -def varnames(func, startindex=None): - """ return argument name tuple for a function, method, class or callable. - - In case of a class, its "__init__" method is considered. - For methods the "self" parameter is not included unless you are passing - an unbound method with Python3 (which has no supports for unbound methods) - """ - cache = getattr(func, "__dict__", {}) - try: - return cache["_varnames"] - except KeyError: - pass - if inspect.isclass(func): - try: - func = func.__init__ - except AttributeError: - return () - startindex = 1 - else: - if not inspect.isfunction(func) and not inspect.ismethod(func): - try: - func = getattr(func, '__call__', func) - except Exception: - return () - if startindex is None: - startindex = int(inspect.ismethod(func)) - - try: - rawcode = func.__code__ - except AttributeError: - return () - try: - x = rawcode.co_varnames[startindex:rawcode.co_argcount] - except AttributeError: - x = () - else: - defaults = func.__defaults__ - if defaults: - x = x[:-len(defaults)] - try: - cache["_varnames"] = x - except TypeError: - pass - return x - - -class _HookRelay: - """ hook holder object for performing 1:N hook calls where N is the number - of registered plugins. - - """ - - def __init__(self, trace): - self._trace = trace - - -class _HookCaller(object): - def __init__(self, name, hook_execute, specmodule_or_class=None, spec_opts=None): - self.name = name - self._wrappers = [] - self._nonwrappers = [] - self._hookexec = hook_execute - if specmodule_or_class is not None: - assert spec_opts is not None - self.set_specification(specmodule_or_class, spec_opts) - - def has_spec(self): - return hasattr(self, "_specmodule_or_class") - - def set_specification(self, specmodule_or_class, spec_opts): - assert not self.has_spec() - self._specmodule_or_class = specmodule_or_class - specfunc = getattr(specmodule_or_class, self.name) - argnames = varnames(specfunc, startindex=inspect.isclass(specmodule_or_class)) - assert "self" not in argnames # sanity check - self.argnames = ["__multicall__"] + list(argnames) - self.spec_opts = spec_opts - if spec_opts.get("historic"): - self._call_history = [] - - def is_historic(self): - return hasattr(self, "_call_history") - - def _remove_plugin(self, plugin): - def remove(wrappers): - for i, method in enumerate(wrappers): - if method.plugin == plugin: - del wrappers[i] - return True - if remove(self._wrappers) is None: - if remove(self._nonwrappers) is None: - raise ValueError("plugin %r not found" % (plugin,)) - - def _add_hookimpl(self, hookimpl): - if hookimpl.hookwrapper: - methods = self._wrappers - else: - methods = self._nonwrappers - - if hookimpl.trylast: - methods.insert(0, hookimpl) - elif hookimpl.tryfirst: - methods.append(hookimpl) - else: - # find last non-tryfirst method - i = len(methods) - 1 - while i >= 0 and methods[i].tryfirst: - i -= 1 - methods.insert(i + 1, hookimpl) - - def __repr__(self): - return "<_HookCaller %r>" % (self.name,) - - def __call__(self, **kwargs): - assert not self.is_historic() - return self._hookexec(self, self._nonwrappers + self._wrappers, kwargs) - - def call_historic(self, proc=None, kwargs=None): - self._call_history.append((kwargs or {}, proc)) - # historizing hooks don't return results - self._hookexec(self, self._nonwrappers + self._wrappers, kwargs) - - def call_extra(self, methods, kwargs): - """ Call the hook with some additional temporarily participating - methods using the specified kwargs as call parameters. """ - old = list(self._nonwrappers), list(self._wrappers) - for method in methods: - opts = dict(hookwrapper=False, trylast=False, tryfirst=False) - hookimpl = HookImpl(None, "", method, opts) - self._add_hookimpl(hookimpl) - try: - return self(**kwargs) - finally: - self._nonwrappers, self._wrappers = old - - def _maybe_apply_history(self, method): - if self.is_historic(): - for kwargs, proc in self._call_history: - res = self._hookexec(self, [method], kwargs) - if res and proc is not None: - proc(res[0]) - - -class HookImpl: - def __init__(self, plugin, plugin_name, function, hook_impl_opts): - self.function = function - self.argnames = varnames(self.function) - self.plugin = plugin - self.opts = hook_impl_opts - self.plugin_name = plugin_name - self.__dict__.update(hook_impl_opts) - - -class PluginValidationError(Exception): - """ plugin failed validation. """ - - -class HookCallError(Exception): - """ Hook was called wrongly. """ - - -if hasattr(inspect, 'signature'): - def _formatdef(func): - return "%s%s" % ( - func.__name__, - str(inspect.signature(func)) - ) -else: - def _formatdef(func): - return "%s%s" % ( - func.__name__, - inspect.formatargspec(*inspect.getargspec(func)) - ) diff --git a/lib/spack/external/_pytest/warnings.py b/lib/spack/external/_pytest/warnings.py deleted file mode 100644 index 926b1f5811..0000000000 --- a/lib/spack/external/_pytest/warnings.py +++ /dev/null @@ -1,94 +0,0 @@ -from __future__ import absolute_import, division, print_function - -import warnings -from contextlib import contextmanager - -import pytest - -from _pytest import compat - - -def _setoption(wmod, arg): - """ - Copy of the warning._setoption function but does not escape arguments. - """ - parts = arg.split(':') - if len(parts) > 5: - raise wmod._OptionError("too many fields (max 5): %r" % (arg,)) - while len(parts) < 5: - parts.append('') - action, message, category, module, lineno = [s.strip() - for s in parts] - action = wmod._getaction(action) - category = wmod._getcategory(category) - if lineno: - try: - lineno = int(lineno) - if lineno < 0: - raise ValueError - except (ValueError, OverflowError): - raise wmod._OptionError("invalid lineno %r" % (lineno,)) - else: - lineno = 0 - wmod.filterwarnings(action, message, category, module, lineno) - - -def pytest_addoption(parser): - group = parser.getgroup("pytest-warnings") - group.addoption( - '-W', '--pythonwarnings', action='append', - help="set which warnings to report, see -W option of python itself.") - parser.addini("filterwarnings", type="linelist", - help="Each line specifies a pattern for " - "warnings.filterwarnings. " - "Processed after -W and --pythonwarnings.") - - -@contextmanager -def catch_warnings_for_item(item): - """ - catches the warnings generated during setup/call/teardown execution - of the given item and after it is done posts them as warnings to this - item. - """ - args = item.config.getoption('pythonwarnings') or [] - inifilters = item.config.getini("filterwarnings") - with warnings.catch_warnings(record=True) as log: - for arg in args: - warnings._setoption(arg) - - for arg in inifilters: - _setoption(warnings, arg) - - mark = item.get_marker('filterwarnings') - if mark: - for arg in mark.args: - warnings._setoption(arg) - - yield - - for warning in log: - warn_msg = warning.message - unicode_warning = False - - if compat._PY2 and any(isinstance(m, compat.UNICODE_TYPES) for m in warn_msg.args): - new_args = [compat.safe_str(m) for m in warn_msg.args] - unicode_warning = warn_msg.args != new_args - warn_msg.args = new_args - - msg = warnings.formatwarning( - warn_msg, warning.category, - warning.filename, warning.lineno, warning.line) - item.warn("unused", msg) - - if unicode_warning: - warnings.warn( - "Warning is using unicode non convertible to ascii, " - "converting to a safe representation:\n %s" % msg, - UnicodeWarning) - - -@pytest.hookimpl(hookwrapper=True) -def pytest_runtest_protocol(item): - with catch_warnings_for_item(item): - yield diff --git a/lib/spack/external/py/__init__.py b/lib/spack/external/py/__init__.py deleted file mode 100644 index 85af650f5c..0000000000 --- a/lib/spack/external/py/__init__.py +++ /dev/null @@ -1,152 +0,0 @@ -""" -pylib: rapid testing and development utils - -this module uses apipkg.py for lazy-loading sub modules -and classes. The initpkg-dictionary below specifies -name->value mappings where value can be another namespace -dictionary or an import path. - -(c) Holger Krekel and others, 2004-2014 -""" -__version__ = '1.4.34' - -from py import _apipkg - -# so that py.error.* instances are picklable -import sys -sys.modules['py.error'] = _apipkg.AliasModule("py.error", "py._error", 'error') -import py.error # "Dereference" it now just to be safe (issue110) - - -_apipkg.initpkg(__name__, attr={'_apipkg': _apipkg}, exportdefs={ - # access to all standard lib modules - 'std': '._std:std', - # access to all posix errno's as classes - 'error': '._error:error', - - '_pydir' : '.__metainfo:pydir', - 'version': 'py:__version__', # backward compatibility - - # pytest-2.0 has a flat namespace, we use alias modules - # to keep old references compatible - 'test' : 'pytest', - 'test.collect' : 'pytest', - 'test.cmdline' : 'pytest', - - # hook into the top-level standard library - 'process' : { - '__doc__' : '._process:__doc__', - 'cmdexec' : '._process.cmdexec:cmdexec', - 'kill' : '._process.killproc:kill', - 'ForkedFunc' : '._process.forkedfunc:ForkedFunc', - }, - - 'apipkg' : { - 'initpkg' : '._apipkg:initpkg', - 'ApiModule' : '._apipkg:ApiModule', - }, - - 'iniconfig' : { - 'IniConfig' : '._iniconfig:IniConfig', - 'ParseError' : '._iniconfig:ParseError', - }, - - 'path' : { - '__doc__' : '._path:__doc__', - 'svnwc' : '._path.svnwc:SvnWCCommandPath', - 'svnurl' : '._path.svnurl:SvnCommandPath', - 'local' : '._path.local:LocalPath', - 'SvnAuth' : '._path.svnwc:SvnAuth', - }, - - # python inspection/code-generation API - 'code' : { - '__doc__' : '._code:__doc__', - 'compile' : '._code.source:compile_', - 'Source' : '._code.source:Source', - 'Code' : '._code.code:Code', - 'Frame' : '._code.code:Frame', - 'ExceptionInfo' : '._code.code:ExceptionInfo', - 'Traceback' : '._code.code:Traceback', - 'getfslineno' : '._code.source:getfslineno', - 'getrawcode' : '._code.code:getrawcode', - 'patch_builtins' : '._code.code:patch_builtins', - 'unpatch_builtins' : '._code.code:unpatch_builtins', - '_AssertionError' : '._code.assertion:AssertionError', - '_reinterpret_old' : '._code.assertion:reinterpret_old', - '_reinterpret' : '._code.assertion:reinterpret', - '_reprcompare' : '._code.assertion:_reprcompare', - '_format_explanation' : '._code.assertion:_format_explanation', - }, - - # backports and additions of builtins - 'builtin' : { - '__doc__' : '._builtin:__doc__', - 'enumerate' : '._builtin:enumerate', - 'reversed' : '._builtin:reversed', - 'sorted' : '._builtin:sorted', - 'any' : '._builtin:any', - 'all' : '._builtin:all', - 'set' : '._builtin:set', - 'frozenset' : '._builtin:frozenset', - 'BaseException' : '._builtin:BaseException', - 'GeneratorExit' : '._builtin:GeneratorExit', - '_sysex' : '._builtin:_sysex', - 'print_' : '._builtin:print_', - '_reraise' : '._builtin:_reraise', - '_tryimport' : '._builtin:_tryimport', - 'exec_' : '._builtin:exec_', - '_basestring' : '._builtin:_basestring', - '_totext' : '._builtin:_totext', - '_isbytes' : '._builtin:_isbytes', - '_istext' : '._builtin:_istext', - '_getimself' : '._builtin:_getimself', - '_getfuncdict' : '._builtin:_getfuncdict', - '_getcode' : '._builtin:_getcode', - 'builtins' : '._builtin:builtins', - 'execfile' : '._builtin:execfile', - 'callable' : '._builtin:callable', - 'bytes' : '._builtin:bytes', - 'text' : '._builtin:text', - }, - - # input-output helping - 'io' : { - '__doc__' : '._io:__doc__', - 'dupfile' : '._io.capture:dupfile', - 'TextIO' : '._io.capture:TextIO', - 'BytesIO' : '._io.capture:BytesIO', - 'FDCapture' : '._io.capture:FDCapture', - 'StdCapture' : '._io.capture:StdCapture', - 'StdCaptureFD' : '._io.capture:StdCaptureFD', - 'TerminalWriter' : '._io.terminalwriter:TerminalWriter', - 'ansi_print' : '._io.terminalwriter:ansi_print', - 'get_terminal_width' : '._io.terminalwriter:get_terminal_width', - 'saferepr' : '._io.saferepr:saferepr', - }, - - # small and mean xml/html generation - 'xml' : { - '__doc__' : '._xmlgen:__doc__', - 'html' : '._xmlgen:html', - 'Tag' : '._xmlgen:Tag', - 'raw' : '._xmlgen:raw', - 'Namespace' : '._xmlgen:Namespace', - 'escape' : '._xmlgen:escape', - }, - - 'log' : { - # logging API ('producers' and 'consumers' connected via keywords) - '__doc__' : '._log:__doc__', - '_apiwarn' : '._log.warning:_apiwarn', - 'Producer' : '._log.log:Producer', - 'setconsumer' : '._log.log:setconsumer', - '_setstate' : '._log.log:setstate', - '_getstate' : '._log.log:getstate', - 'Path' : '._log.log:Path', - 'STDOUT' : '._log.log:STDOUT', - 'STDERR' : '._log.log:STDERR', - 'Syslog' : '._log.log:Syslog', - }, - -}) diff --git a/lib/spack/external/py/__metainfo.py b/lib/spack/external/py/__metainfo.py deleted file mode 100644 index 12581eb7af..0000000000 --- a/lib/spack/external/py/__metainfo.py +++ /dev/null @@ -1,2 +0,0 @@ -import py -pydir = py.path.local(py.__file__).dirpath() diff --git a/lib/spack/external/py/_apipkg.py b/lib/spack/external/py/_apipkg.py deleted file mode 100644 index a73b8f6d0b..0000000000 --- a/lib/spack/external/py/_apipkg.py +++ /dev/null @@ -1,181 +0,0 @@ -""" -apipkg: control the exported namespace of a python package. - -see http://pypi.python.org/pypi/apipkg - -(c) holger krekel, 2009 - MIT license -""" -import os -import sys -from types import ModuleType - -__version__ = '1.3.dev' - -def _py_abspath(path): - """ - special version of abspath - that will leave paths from jython jars alone - """ - if path.startswith('__pyclasspath__'): - - return path - else: - return os.path.abspath(path) - -def initpkg(pkgname, exportdefs, attr=dict()): - """ initialize given package from the export definitions. """ - oldmod = sys.modules.get(pkgname) - d = {} - f = getattr(oldmod, '__file__', None) - if f: - f = _py_abspath(f) - d['__file__'] = f - if hasattr(oldmod, '__version__'): - d['__version__'] = oldmod.__version__ - if hasattr(oldmod, '__loader__'): - d['__loader__'] = oldmod.__loader__ - if hasattr(oldmod, '__path__'): - d['__path__'] = [_py_abspath(p) for p in oldmod.__path__] - if '__doc__' not in exportdefs and getattr(oldmod, '__doc__', None): - d['__doc__'] = oldmod.__doc__ - d.update(attr) - if hasattr(oldmod, "__dict__"): - oldmod.__dict__.update(d) - mod = ApiModule(pkgname, exportdefs, implprefix=pkgname, attr=d) - sys.modules[pkgname] = mod - -def importobj(modpath, attrname): - module = __import__(modpath, None, None, ['__doc__']) - if not attrname: - return module - - retval = module - names = attrname.split(".") - for x in names: - retval = getattr(retval, x) - return retval - -class ApiModule(ModuleType): - def __docget(self): - try: - return self.__doc - except AttributeError: - if '__doc__' in self.__map__: - return self.__makeattr('__doc__') - def __docset(self, value): - self.__doc = value - __doc__ = property(__docget, __docset) - - def __init__(self, name, importspec, implprefix=None, attr=None): - self.__name__ = name - self.__all__ = [x for x in importspec if x != '__onfirstaccess__'] - self.__map__ = {} - self.__implprefix__ = implprefix or name - if attr: - for name, val in attr.items(): - # print "setting", self.__name__, name, val - setattr(self, name, val) - for name, importspec in importspec.items(): - if isinstance(importspec, dict): - subname = '%s.%s' % (self.__name__, name) - apimod = ApiModule(subname, importspec, implprefix) - sys.modules[subname] = apimod - setattr(self, name, apimod) - else: - parts = importspec.split(':') - modpath = parts.pop(0) - attrname = parts and parts[0] or "" - if modpath[0] == '.': - modpath = implprefix + modpath - - if not attrname: - subname = '%s.%s' % (self.__name__, name) - apimod = AliasModule(subname, modpath) - sys.modules[subname] = apimod - if '.' not in name: - setattr(self, name, apimod) - else: - self.__map__[name] = (modpath, attrname) - - def __repr__(self): - l = [] - if hasattr(self, '__version__'): - l.append("version=" + repr(self.__version__)) - if hasattr(self, '__file__'): - l.append('from ' + repr(self.__file__)) - if l: - return '' % (self.__name__, " ".join(l)) - return '' % (self.__name__,) - - def __makeattr(self, name): - """lazily compute value for name or raise AttributeError if unknown.""" - # print "makeattr", self.__name__, name - target = None - if '__onfirstaccess__' in self.__map__: - target = self.__map__.pop('__onfirstaccess__') - importobj(*target)() - try: - modpath, attrname = self.__map__[name] - except KeyError: - if target is not None and name != '__onfirstaccess__': - # retry, onfirstaccess might have set attrs - return getattr(self, name) - raise AttributeError(name) - else: - result = importobj(modpath, attrname) - setattr(self, name, result) - try: - del self.__map__[name] - except KeyError: - pass # in a recursive-import situation a double-del can happen - return result - - __getattr__ = __makeattr - - def __dict__(self): - # force all the content of the module to be loaded when __dict__ is read - dictdescr = ModuleType.__dict__['__dict__'] - dict = dictdescr.__get__(self) - if dict is not None: - hasattr(self, 'some') - for name in self.__all__: - try: - self.__makeattr(name) - except AttributeError: - pass - return dict - __dict__ = property(__dict__) - - -def AliasModule(modname, modpath, attrname=None): - mod = [] - - def getmod(): - if not mod: - x = importobj(modpath, None) - if attrname is not None: - x = getattr(x, attrname) - mod.append(x) - return mod[0] - - class AliasModule(ModuleType): - - def __repr__(self): - x = modpath - if attrname: - x += "." + attrname - return '' % (modname, x) - - def __getattribute__(self, name): - try: - return getattr(getmod(), name) - except ImportError: - return None - - def __setattr__(self, name, value): - setattr(getmod(), name, value) - - def __delattr__(self, name): - delattr(getmod(), name) - - return AliasModule(str(modname)) diff --git a/lib/spack/external/py/_builtin.py b/lib/spack/external/py/_builtin.py deleted file mode 100644 index 52ee9d79ca..0000000000 --- a/lib/spack/external/py/_builtin.py +++ /dev/null @@ -1,248 +0,0 @@ -import sys - -try: - reversed = reversed -except NameError: - def reversed(sequence): - """reversed(sequence) -> reverse iterator over values of the sequence - - Return a reverse iterator - """ - if hasattr(sequence, '__reversed__'): - return sequence.__reversed__() - if not hasattr(sequence, '__getitem__'): - raise TypeError("argument to reversed() must be a sequence") - return reversed_iterator(sequence) - - class reversed_iterator(object): - - def __init__(self, seq): - self.seq = seq - self.remaining = len(seq) - - def __iter__(self): - return self - - def next(self): - i = self.remaining - if i > 0: - i -= 1 - item = self.seq[i] - self.remaining = i - return item - raise StopIteration - - def __length_hint__(self): - return self.remaining - -try: - any = any -except NameError: - def any(iterable): - for x in iterable: - if x: - return True - return False - -try: - all = all -except NameError: - def all(iterable): - for x in iterable: - if not x: - return False - return True - -try: - sorted = sorted -except NameError: - builtin_cmp = cmp # need to use cmp as keyword arg - - def sorted(iterable, cmp=None, key=None, reverse=0): - use_cmp = None - if key is not None: - if cmp is None: - def use_cmp(x, y): - return builtin_cmp(x[0], y[0]) - else: - def use_cmp(x, y): - return cmp(x[0], y[0]) - l = [(key(element), element) for element in iterable] - else: - if cmp is not None: - use_cmp = cmp - l = list(iterable) - if use_cmp is not None: - l.sort(use_cmp) - else: - l.sort() - if reverse: - l.reverse() - if key is not None: - return [element for (_, element) in l] - return l - -try: - set, frozenset = set, frozenset -except NameError: - from sets import set, frozenset - -# pass through -enumerate = enumerate - -try: - BaseException = BaseException -except NameError: - BaseException = Exception - -try: - GeneratorExit = GeneratorExit -except NameError: - class GeneratorExit(Exception): - """ This exception is never raised, it is there to make it possible to - write code compatible with CPython 2.5 even in lower CPython - versions.""" - pass - GeneratorExit.__module__ = 'exceptions' - -_sysex = (KeyboardInterrupt, SystemExit, MemoryError, GeneratorExit) - -try: - callable = callable -except NameError: - def callable(obj): - return hasattr(obj, "__call__") - -if sys.version_info >= (3, 0): - exec ("print_ = print ; exec_=exec") - import builtins - - # some backward compatibility helpers - _basestring = str - def _totext(obj, encoding=None, errors=None): - if isinstance(obj, bytes): - if errors is None: - obj = obj.decode(encoding) - else: - obj = obj.decode(encoding, errors) - elif not isinstance(obj, str): - obj = str(obj) - return obj - - def _isbytes(x): - return isinstance(x, bytes) - def _istext(x): - return isinstance(x, str) - - text = str - bytes = bytes - - - def _getimself(function): - return getattr(function, '__self__', None) - - def _getfuncdict(function): - return getattr(function, "__dict__", None) - - def _getcode(function): - return getattr(function, "__code__", None) - - def execfile(fn, globs=None, locs=None): - if globs is None: - back = sys._getframe(1) - globs = back.f_globals - locs = back.f_locals - del back - elif locs is None: - locs = globs - fp = open(fn, "r") - try: - source = fp.read() - finally: - fp.close() - co = compile(source, fn, "exec", dont_inherit=True) - exec_(co, globs, locs) - -else: - import __builtin__ as builtins - _totext = unicode - _basestring = basestring - text = unicode - bytes = str - execfile = execfile - callable = callable - def _isbytes(x): - return isinstance(x, str) - def _istext(x): - return isinstance(x, unicode) - - def _getimself(function): - return getattr(function, 'im_self', None) - - def _getfuncdict(function): - return getattr(function, "__dict__", None) - - def _getcode(function): - try: - return getattr(function, "__code__") - except AttributeError: - return getattr(function, "func_code", None) - - def print_(*args, **kwargs): - """ minimal backport of py3k print statement. """ - sep = ' ' - if 'sep' in kwargs: - sep = kwargs.pop('sep') - end = '\n' - if 'end' in kwargs: - end = kwargs.pop('end') - file = 'file' in kwargs and kwargs.pop('file') or sys.stdout - if kwargs: - args = ", ".join([str(x) for x in kwargs]) - raise TypeError("invalid keyword arguments: %s" % args) - at_start = True - for x in args: - if not at_start: - file.write(sep) - file.write(str(x)) - at_start = False - file.write(end) - - def exec_(obj, globals=None, locals=None): - """ minimal backport of py3k exec statement. """ - __tracebackhide__ = True - if globals is None: - frame = sys._getframe(1) - globals = frame.f_globals - if locals is None: - locals = frame.f_locals - elif locals is None: - locals = globals - exec2(obj, globals, locals) - -if sys.version_info >= (3, 0): - def _reraise(cls, val, tb): - __tracebackhide__ = True - assert hasattr(val, '__traceback__') - raise cls.with_traceback(val, tb) -else: - exec (""" -def _reraise(cls, val, tb): - __tracebackhide__ = True - raise cls, val, tb -def exec2(obj, globals, locals): - __tracebackhide__ = True - exec obj in globals, locals -""") - -def _tryimport(*names): - """ return the first successfully imported module. """ - assert names - for name in names: - try: - __import__(name) - except ImportError: - excinfo = sys.exc_info() - else: - return sys.modules[name] - _reraise(*excinfo) diff --git a/lib/spack/external/py/_code/__init__.py b/lib/spack/external/py/_code/__init__.py deleted file mode 100644 index f15acf8513..0000000000 --- a/lib/spack/external/py/_code/__init__.py +++ /dev/null @@ -1 +0,0 @@ -""" python inspection/code generation API """ diff --git a/lib/spack/external/py/_code/_assertionnew.py b/lib/spack/external/py/_code/_assertionnew.py deleted file mode 100644 index afb1b31ff0..0000000000 --- a/lib/spack/external/py/_code/_assertionnew.py +++ /dev/null @@ -1,339 +0,0 @@ -""" -Find intermediate evalutation results in assert statements through builtin AST. -This should replace _assertionold.py eventually. -""" - -import sys -import ast - -import py -from py._code.assertion import _format_explanation, BuiltinAssertionError - - -if sys.platform.startswith("java") and sys.version_info < (2, 5, 2): - # See http://bugs.jython.org/issue1497 - _exprs = ("BoolOp", "BinOp", "UnaryOp", "Lambda", "IfExp", "Dict", - "ListComp", "GeneratorExp", "Yield", "Compare", "Call", - "Repr", "Num", "Str", "Attribute", "Subscript", "Name", - "List", "Tuple") - _stmts = ("FunctionDef", "ClassDef", "Return", "Delete", "Assign", - "AugAssign", "Print", "For", "While", "If", "With", "Raise", - "TryExcept", "TryFinally", "Assert", "Import", "ImportFrom", - "Exec", "Global", "Expr", "Pass", "Break", "Continue") - _expr_nodes = set(getattr(ast, name) for name in _exprs) - _stmt_nodes = set(getattr(ast, name) for name in _stmts) - def _is_ast_expr(node): - return node.__class__ in _expr_nodes - def _is_ast_stmt(node): - return node.__class__ in _stmt_nodes -else: - def _is_ast_expr(node): - return isinstance(node, ast.expr) - def _is_ast_stmt(node): - return isinstance(node, ast.stmt) - - -class Failure(Exception): - """Error found while interpreting AST.""" - - def __init__(self, explanation=""): - self.cause = sys.exc_info() - self.explanation = explanation - - -def interpret(source, frame, should_fail=False): - mod = ast.parse(source) - visitor = DebugInterpreter(frame) - try: - visitor.visit(mod) - except Failure: - failure = sys.exc_info()[1] - return getfailure(failure) - if should_fail: - return ("(assertion failed, but when it was re-run for " - "printing intermediate values, it did not fail. Suggestions: " - "compute assert expression before the assert or use --no-assert)") - -def run(offending_line, frame=None): - if frame is None: - frame = py.code.Frame(sys._getframe(1)) - return interpret(offending_line, frame) - -def getfailure(failure): - explanation = _format_explanation(failure.explanation) - value = failure.cause[1] - if str(value): - lines = explanation.splitlines() - if not lines: - lines.append("") - lines[0] += " << %s" % (value,) - explanation = "\n".join(lines) - text = "%s: %s" % (failure.cause[0].__name__, explanation) - if text.startswith("AssertionError: assert "): - text = text[16:] - return text - - -operator_map = { - ast.BitOr : "|", - ast.BitXor : "^", - ast.BitAnd : "&", - ast.LShift : "<<", - ast.RShift : ">>", - ast.Add : "+", - ast.Sub : "-", - ast.Mult : "*", - ast.Div : "/", - ast.FloorDiv : "//", - ast.Mod : "%", - ast.Eq : "==", - ast.NotEq : "!=", - ast.Lt : "<", - ast.LtE : "<=", - ast.Gt : ">", - ast.GtE : ">=", - ast.Pow : "**", - ast.Is : "is", - ast.IsNot : "is not", - ast.In : "in", - ast.NotIn : "not in" -} - -unary_map = { - ast.Not : "not %s", - ast.Invert : "~%s", - ast.USub : "-%s", - ast.UAdd : "+%s" -} - - -class DebugInterpreter(ast.NodeVisitor): - """Interpret AST nodes to gleam useful debugging information. """ - - def __init__(self, frame): - self.frame = frame - - def generic_visit(self, node): - # Fallback when we don't have a special implementation. - if _is_ast_expr(node): - mod = ast.Expression(node) - co = self._compile(mod) - try: - result = self.frame.eval(co) - except Exception: - raise Failure() - explanation = self.frame.repr(result) - return explanation, result - elif _is_ast_stmt(node): - mod = ast.Module([node]) - co = self._compile(mod, "exec") - try: - self.frame.exec_(co) - except Exception: - raise Failure() - return None, None - else: - raise AssertionError("can't handle %s" %(node,)) - - def _compile(self, source, mode="eval"): - return compile(source, "", mode) - - def visit_Expr(self, expr): - return self.visit(expr.value) - - def visit_Module(self, mod): - for stmt in mod.body: - self.visit(stmt) - - def visit_Name(self, name): - explanation, result = self.generic_visit(name) - # See if the name is local. - source = "%r in locals() is not globals()" % (name.id,) - co = self._compile(source) - try: - local = self.frame.eval(co) - except Exception: - # have to assume it isn't - local = False - if not local: - return name.id, result - return explanation, result - - def visit_Compare(self, comp): - left = comp.left - left_explanation, left_result = self.visit(left) - for op, next_op in zip(comp.ops, comp.comparators): - next_explanation, next_result = self.visit(next_op) - op_symbol = operator_map[op.__class__] - explanation = "%s %s %s" % (left_explanation, op_symbol, - next_explanation) - source = "__exprinfo_left %s __exprinfo_right" % (op_symbol,) - co = self._compile(source) - try: - result = self.frame.eval(co, __exprinfo_left=left_result, - __exprinfo_right=next_result) - except Exception: - raise Failure(explanation) - try: - if not result: - break - except KeyboardInterrupt: - raise - except: - break - left_explanation, left_result = next_explanation, next_result - - rcomp = py.code._reprcompare - if rcomp: - res = rcomp(op_symbol, left_result, next_result) - if res: - explanation = res - return explanation, result - - def visit_BoolOp(self, boolop): - is_or = isinstance(boolop.op, ast.Or) - explanations = [] - for operand in boolop.values: - explanation, result = self.visit(operand) - explanations.append(explanation) - if result == is_or: - break - name = is_or and " or " or " and " - explanation = "(" + name.join(explanations) + ")" - return explanation, result - - def visit_UnaryOp(self, unary): - pattern = unary_map[unary.op.__class__] - operand_explanation, operand_result = self.visit(unary.operand) - explanation = pattern % (operand_explanation,) - co = self._compile(pattern % ("__exprinfo_expr",)) - try: - result = self.frame.eval(co, __exprinfo_expr=operand_result) - except Exception: - raise Failure(explanation) - return explanation, result - - def visit_BinOp(self, binop): - left_explanation, left_result = self.visit(binop.left) - right_explanation, right_result = self.visit(binop.right) - symbol = operator_map[binop.op.__class__] - explanation = "(%s %s %s)" % (left_explanation, symbol, - right_explanation) - source = "__exprinfo_left %s __exprinfo_right" % (symbol,) - co = self._compile(source) - try: - result = self.frame.eval(co, __exprinfo_left=left_result, - __exprinfo_right=right_result) - except Exception: - raise Failure(explanation) - return explanation, result - - def visit_Call(self, call): - func_explanation, func = self.visit(call.func) - arg_explanations = [] - ns = {"__exprinfo_func" : func} - arguments = [] - for arg in call.args: - arg_explanation, arg_result = self.visit(arg) - arg_name = "__exprinfo_%s" % (len(ns),) - ns[arg_name] = arg_result - arguments.append(arg_name) - arg_explanations.append(arg_explanation) - for keyword in call.keywords: - arg_explanation, arg_result = self.visit(keyword.value) - arg_name = "__exprinfo_%s" % (len(ns),) - ns[arg_name] = arg_result - keyword_source = "%s=%%s" % (keyword.arg) - arguments.append(keyword_source % (arg_name,)) - arg_explanations.append(keyword_source % (arg_explanation,)) - if call.starargs: - arg_explanation, arg_result = self.visit(call.starargs) - arg_name = "__exprinfo_star" - ns[arg_name] = arg_result - arguments.append("*%s" % (arg_name,)) - arg_explanations.append("*%s" % (arg_explanation,)) - if call.kwargs: - arg_explanation, arg_result = self.visit(call.kwargs) - arg_name = "__exprinfo_kwds" - ns[arg_name] = arg_result - arguments.append("**%s" % (arg_name,)) - arg_explanations.append("**%s" % (arg_explanation,)) - args_explained = ", ".join(arg_explanations) - explanation = "%s(%s)" % (func_explanation, args_explained) - args = ", ".join(arguments) - source = "__exprinfo_func(%s)" % (args,) - co = self._compile(source) - try: - result = self.frame.eval(co, **ns) - except Exception: - raise Failure(explanation) - pattern = "%s\n{%s = %s\n}" - rep = self.frame.repr(result) - explanation = pattern % (rep, rep, explanation) - return explanation, result - - def _is_builtin_name(self, name): - pattern = "%r not in globals() and %r not in locals()" - source = pattern % (name.id, name.id) - co = self._compile(source) - try: - return self.frame.eval(co) - except Exception: - return False - - def visit_Attribute(self, attr): - if not isinstance(attr.ctx, ast.Load): - return self.generic_visit(attr) - source_explanation, source_result = self.visit(attr.value) - explanation = "%s.%s" % (source_explanation, attr.attr) - source = "__exprinfo_expr.%s" % (attr.attr,) - co = self._compile(source) - try: - result = self.frame.eval(co, __exprinfo_expr=source_result) - except Exception: - raise Failure(explanation) - explanation = "%s\n{%s = %s.%s\n}" % (self.frame.repr(result), - self.frame.repr(result), - source_explanation, attr.attr) - # Check if the attr is from an instance. - source = "%r in getattr(__exprinfo_expr, '__dict__', {})" - source = source % (attr.attr,) - co = self._compile(source) - try: - from_instance = self.frame.eval(co, __exprinfo_expr=source_result) - except Exception: - from_instance = True - if from_instance: - rep = self.frame.repr(result) - pattern = "%s\n{%s = %s\n}" - explanation = pattern % (rep, rep, explanation) - return explanation, result - - def visit_Assert(self, assrt): - test_explanation, test_result = self.visit(assrt.test) - if test_explanation.startswith("False\n{False =") and \ - test_explanation.endswith("\n"): - test_explanation = test_explanation[15:-2] - explanation = "assert %s" % (test_explanation,) - if not test_result: - try: - raise BuiltinAssertionError - except Exception: - raise Failure(explanation) - return explanation, test_result - - def visit_Assign(self, assign): - value_explanation, value_result = self.visit(assign.value) - explanation = "... = %s" % (value_explanation,) - name = ast.Name("__exprinfo_expr", ast.Load(), - lineno=assign.value.lineno, - col_offset=assign.value.col_offset) - new_assign = ast.Assign(assign.targets, name, lineno=assign.lineno, - col_offset=assign.col_offset) - mod = ast.Module([new_assign]) - co = self._compile(mod, "exec") - try: - self.frame.exec_(co, __exprinfo_expr=value_result) - except Exception: - raise Failure(explanation) - return explanation, value_result diff --git a/lib/spack/external/py/_code/_assertionold.py b/lib/spack/external/py/_code/_assertionold.py deleted file mode 100644 index 4e81fb3ef6..0000000000 --- a/lib/spack/external/py/_code/_assertionold.py +++ /dev/null @@ -1,555 +0,0 @@ -import py -import sys, inspect -from compiler import parse, ast, pycodegen -from py._code.assertion import BuiltinAssertionError, _format_explanation - -passthroughex = py.builtin._sysex - -class Failure: - def __init__(self, node): - self.exc, self.value, self.tb = sys.exc_info() - self.node = node - -class View(object): - """View base class. - - If C is a subclass of View, then C(x) creates a proxy object around - the object x. The actual class of the proxy is not C in general, - but a *subclass* of C determined by the rules below. To avoid confusion - we call view class the class of the proxy (a subclass of C, so of View) - and object class the class of x. - - Attributes and methods not found in the proxy are automatically read on x. - Other operations like setting attributes are performed on the proxy, as - determined by its view class. The object x is available from the proxy - as its __obj__ attribute. - - The view class selection is determined by the __view__ tuples and the - optional __viewkey__ method. By default, the selected view class is the - most specific subclass of C whose __view__ mentions the class of x. - If no such subclass is found, the search proceeds with the parent - object classes. For example, C(True) will first look for a subclass - of C with __view__ = (..., bool, ...) and only if it doesn't find any - look for one with __view__ = (..., int, ...), and then ..., object,... - If everything fails the class C itself is considered to be the default. - - Alternatively, the view class selection can be driven by another aspect - of the object x, instead of the class of x, by overriding __viewkey__. - See last example at the end of this module. - """ - - _viewcache = {} - __view__ = () - - def __new__(rootclass, obj, *args, **kwds): - self = object.__new__(rootclass) - self.__obj__ = obj - self.__rootclass__ = rootclass - key = self.__viewkey__() - try: - self.__class__ = self._viewcache[key] - except KeyError: - self.__class__ = self._selectsubclass(key) - return self - - def __getattr__(self, attr): - # attributes not found in the normal hierarchy rooted on View - # are looked up in the object's real class - return getattr(self.__obj__, attr) - - def __viewkey__(self): - return self.__obj__.__class__ - - def __matchkey__(self, key, subclasses): - if inspect.isclass(key): - keys = inspect.getmro(key) - else: - keys = [key] - for key in keys: - result = [C for C in subclasses if key in C.__view__] - if result: - return result - return [] - - def _selectsubclass(self, key): - subclasses = list(enumsubclasses(self.__rootclass__)) - for C in subclasses: - if not isinstance(C.__view__, tuple): - C.__view__ = (C.__view__,) - choices = self.__matchkey__(key, subclasses) - if not choices: - return self.__rootclass__ - elif len(choices) == 1: - return choices[0] - else: - # combine the multiple choices - return type('?', tuple(choices), {}) - - def __repr__(self): - return '%s(%r)' % (self.__rootclass__.__name__, self.__obj__) - - -def enumsubclasses(cls): - for subcls in cls.__subclasses__(): - for subsubclass in enumsubclasses(subcls): - yield subsubclass - yield cls - - -class Interpretable(View): - """A parse tree node with a few extra methods.""" - explanation = None - - def is_builtin(self, frame): - return False - - def eval(self, frame): - # fall-back for unknown expression nodes - try: - expr = ast.Expression(self.__obj__) - expr.filename = '' - self.__obj__.filename = '' - co = pycodegen.ExpressionCodeGenerator(expr).getCode() - result = frame.eval(co) - except passthroughex: - raise - except: - raise Failure(self) - self.result = result - self.explanation = self.explanation or frame.repr(self.result) - - def run(self, frame): - # fall-back for unknown statement nodes - try: - expr = ast.Module(None, ast.Stmt([self.__obj__])) - expr.filename = '' - co = pycodegen.ModuleCodeGenerator(expr).getCode() - frame.exec_(co) - except passthroughex: - raise - except: - raise Failure(self) - - def nice_explanation(self): - return _format_explanation(self.explanation) - - -class Name(Interpretable): - __view__ = ast.Name - - def is_local(self, frame): - source = '%r in locals() is not globals()' % self.name - try: - return frame.is_true(frame.eval(source)) - except passthroughex: - raise - except: - return False - - def is_global(self, frame): - source = '%r in globals()' % self.name - try: - return frame.is_true(frame.eval(source)) - except passthroughex: - raise - except: - return False - - def is_builtin(self, frame): - source = '%r not in locals() and %r not in globals()' % ( - self.name, self.name) - try: - return frame.is_true(frame.eval(source)) - except passthroughex: - raise - except: - return False - - def eval(self, frame): - super(Name, self).eval(frame) - if not self.is_local(frame): - self.explanation = self.name - -class Compare(Interpretable): - __view__ = ast.Compare - - def eval(self, frame): - expr = Interpretable(self.expr) - expr.eval(frame) - for operation, expr2 in self.ops: - if hasattr(self, 'result'): - # shortcutting in chained expressions - if not frame.is_true(self.result): - break - expr2 = Interpretable(expr2) - expr2.eval(frame) - self.explanation = "%s %s %s" % ( - expr.explanation, operation, expr2.explanation) - source = "__exprinfo_left %s __exprinfo_right" % operation - try: - self.result = frame.eval(source, - __exprinfo_left=expr.result, - __exprinfo_right=expr2.result) - except passthroughex: - raise - except: - raise Failure(self) - expr = expr2 - -class And(Interpretable): - __view__ = ast.And - - def eval(self, frame): - explanations = [] - for expr in self.nodes: - expr = Interpretable(expr) - expr.eval(frame) - explanations.append(expr.explanation) - self.result = expr.result - if not frame.is_true(expr.result): - break - self.explanation = '(' + ' and '.join(explanations) + ')' - -class Or(Interpretable): - __view__ = ast.Or - - def eval(self, frame): - explanations = [] - for expr in self.nodes: - expr = Interpretable(expr) - expr.eval(frame) - explanations.append(expr.explanation) - self.result = expr.result - if frame.is_true(expr.result): - break - self.explanation = '(' + ' or '.join(explanations) + ')' - - -# == Unary operations == -keepalive = [] -for astclass, astpattern in { - ast.Not : 'not __exprinfo_expr', - ast.Invert : '(~__exprinfo_expr)', - }.items(): - - class UnaryArith(Interpretable): - __view__ = astclass - - def eval(self, frame, astpattern=astpattern): - expr = Interpretable(self.expr) - expr.eval(frame) - self.explanation = astpattern.replace('__exprinfo_expr', - expr.explanation) - try: - self.result = frame.eval(astpattern, - __exprinfo_expr=expr.result) - except passthroughex: - raise - except: - raise Failure(self) - - keepalive.append(UnaryArith) - -# == Binary operations == -for astclass, astpattern in { - ast.Add : '(__exprinfo_left + __exprinfo_right)', - ast.Sub : '(__exprinfo_left - __exprinfo_right)', - ast.Mul : '(__exprinfo_left * __exprinfo_right)', - ast.Div : '(__exprinfo_left / __exprinfo_right)', - ast.Mod : '(__exprinfo_left % __exprinfo_right)', - ast.Power : '(__exprinfo_left ** __exprinfo_right)', - }.items(): - - class BinaryArith(Interpretable): - __view__ = astclass - - def eval(self, frame, astpattern=astpattern): - left = Interpretable(self.left) - left.eval(frame) - right = Interpretable(self.right) - right.eval(frame) - self.explanation = (astpattern - .replace('__exprinfo_left', left .explanation) - .replace('__exprinfo_right', right.explanation)) - try: - self.result = frame.eval(astpattern, - __exprinfo_left=left.result, - __exprinfo_right=right.result) - except passthroughex: - raise - except: - raise Failure(self) - - keepalive.append(BinaryArith) - - -class CallFunc(Interpretable): - __view__ = ast.CallFunc - - def is_bool(self, frame): - source = 'isinstance(__exprinfo_value, bool)' - try: - return frame.is_true(frame.eval(source, - __exprinfo_value=self.result)) - except passthroughex: - raise - except: - return False - - def eval(self, frame): - node = Interpretable(self.node) - node.eval(frame) - explanations = [] - vars = {'__exprinfo_fn': node.result} - source = '__exprinfo_fn(' - for a in self.args: - if isinstance(a, ast.Keyword): - keyword = a.name - a = a.expr - else: - keyword = None - a = Interpretable(a) - a.eval(frame) - argname = '__exprinfo_%d' % len(vars) - vars[argname] = a.result - if keyword is None: - source += argname + ',' - explanations.append(a.explanation) - else: - source += '%s=%s,' % (keyword, argname) - explanations.append('%s=%s' % (keyword, a.explanation)) - if self.star_args: - star_args = Interpretable(self.star_args) - star_args.eval(frame) - argname = '__exprinfo_star' - vars[argname] = star_args.result - source += '*' + argname + ',' - explanations.append('*' + star_args.explanation) - if self.dstar_args: - dstar_args = Interpretable(self.dstar_args) - dstar_args.eval(frame) - argname = '__exprinfo_kwds' - vars[argname] = dstar_args.result - source += '**' + argname + ',' - explanations.append('**' + dstar_args.explanation) - self.explanation = "%s(%s)" % ( - node.explanation, ', '.join(explanations)) - if source.endswith(','): - source = source[:-1] - source += ')' - try: - self.result = frame.eval(source, **vars) - except passthroughex: - raise - except: - raise Failure(self) - if not node.is_builtin(frame) or not self.is_bool(frame): - r = frame.repr(self.result) - self.explanation = '%s\n{%s = %s\n}' % (r, r, self.explanation) - -class Getattr(Interpretable): - __view__ = ast.Getattr - - def eval(self, frame): - expr = Interpretable(self.expr) - expr.eval(frame) - source = '__exprinfo_expr.%s' % self.attrname - try: - self.result = frame.eval(source, __exprinfo_expr=expr.result) - except passthroughex: - raise - except: - raise Failure(self) - self.explanation = '%s.%s' % (expr.explanation, self.attrname) - # if the attribute comes from the instance, its value is interesting - source = ('hasattr(__exprinfo_expr, "__dict__") and ' - '%r in __exprinfo_expr.__dict__' % self.attrname) - try: - from_instance = frame.is_true( - frame.eval(source, __exprinfo_expr=expr.result)) - except passthroughex: - raise - except: - from_instance = True - if from_instance: - r = frame.repr(self.result) - self.explanation = '%s\n{%s = %s\n}' % (r, r, self.explanation) - -# == Re-interpretation of full statements == - -class Assert(Interpretable): - __view__ = ast.Assert - - def run(self, frame): - test = Interpretable(self.test) - test.eval(frame) - # simplify 'assert False where False = ...' - if (test.explanation.startswith('False\n{False = ') and - test.explanation.endswith('\n}')): - test.explanation = test.explanation[15:-2] - # print the result as 'assert ' - self.result = test.result - self.explanation = 'assert ' + test.explanation - if not frame.is_true(test.result): - try: - raise BuiltinAssertionError - except passthroughex: - raise - except: - raise Failure(self) - -class Assign(Interpretable): - __view__ = ast.Assign - - def run(self, frame): - expr = Interpretable(self.expr) - expr.eval(frame) - self.result = expr.result - self.explanation = '... = ' + expr.explanation - # fall-back-run the rest of the assignment - ass = ast.Assign(self.nodes, ast.Name('__exprinfo_expr')) - mod = ast.Module(None, ast.Stmt([ass])) - mod.filename = '' - co = pycodegen.ModuleCodeGenerator(mod).getCode() - try: - frame.exec_(co, __exprinfo_expr=expr.result) - except passthroughex: - raise - except: - raise Failure(self) - -class Discard(Interpretable): - __view__ = ast.Discard - - def run(self, frame): - expr = Interpretable(self.expr) - expr.eval(frame) - self.result = expr.result - self.explanation = expr.explanation - -class Stmt(Interpretable): - __view__ = ast.Stmt - - def run(self, frame): - for stmt in self.nodes: - stmt = Interpretable(stmt) - stmt.run(frame) - - -def report_failure(e): - explanation = e.node.nice_explanation() - if explanation: - explanation = ", in: " + explanation - else: - explanation = "" - sys.stdout.write("%s: %s%s\n" % (e.exc.__name__, e.value, explanation)) - -def check(s, frame=None): - if frame is None: - frame = sys._getframe(1) - frame = py.code.Frame(frame) - expr = parse(s, 'eval') - assert isinstance(expr, ast.Expression) - node = Interpretable(expr.node) - try: - node.eval(frame) - except passthroughex: - raise - except Failure: - e = sys.exc_info()[1] - report_failure(e) - else: - if not frame.is_true(node.result): - sys.stderr.write("assertion failed: %s\n" % node.nice_explanation()) - - -########################################################### -# API / Entry points -# ######################################################### - -def interpret(source, frame, should_fail=False): - module = Interpretable(parse(source, 'exec').node) - #print "got module", module - if isinstance(frame, py.std.types.FrameType): - frame = py.code.Frame(frame) - try: - module.run(frame) - except Failure: - e = sys.exc_info()[1] - return getfailure(e) - except passthroughex: - raise - except: - import traceback - traceback.print_exc() - if should_fail: - return ("(assertion failed, but when it was re-run for " - "printing intermediate values, it did not fail. Suggestions: " - "compute assert expression before the assert or use --nomagic)") - else: - return None - -def getmsg(excinfo): - if isinstance(excinfo, tuple): - excinfo = py.code.ExceptionInfo(excinfo) - #frame, line = gettbline(tb) - #frame = py.code.Frame(frame) - #return interpret(line, frame) - - tb = excinfo.traceback[-1] - source = str(tb.statement).strip() - x = interpret(source, tb.frame, should_fail=True) - if not isinstance(x, str): - raise TypeError("interpret returned non-string %r" % (x,)) - return x - -def getfailure(e): - explanation = e.node.nice_explanation() - if str(e.value): - lines = explanation.split('\n') - lines[0] += " << %s" % (e.value,) - explanation = '\n'.join(lines) - text = "%s: %s" % (e.exc.__name__, explanation) - if text.startswith('AssertionError: assert '): - text = text[16:] - return text - -def run(s, frame=None): - if frame is None: - frame = sys._getframe(1) - frame = py.code.Frame(frame) - module = Interpretable(parse(s, 'exec').node) - try: - module.run(frame) - except Failure: - e = sys.exc_info()[1] - report_failure(e) - - -if __name__ == '__main__': - # example: - def f(): - return 5 - def g(): - return 3 - def h(x): - return 'never' - check("f() * g() == 5") - check("not f()") - check("not (f() and g() or 0)") - check("f() == g()") - i = 4 - check("i == f()") - check("len(f()) == 0") - check("isinstance(2+3+4, float)") - - run("x = i") - check("x == 5") - - run("assert not f(), 'oops'") - run("a, b, c = 1, 2") - run("a, b, c = f()") - - check("max([f(),g()]) == 4") - check("'hello'[g()] == 'h'") - run("'guk%d' % h(f())") diff --git a/lib/spack/external/py/_code/_py2traceback.py b/lib/spack/external/py/_code/_py2traceback.py deleted file mode 100644 index d65e27cb73..0000000000 --- a/lib/spack/external/py/_code/_py2traceback.py +++ /dev/null @@ -1,79 +0,0 @@ -# copied from python-2.7.3's traceback.py -# CHANGES: -# - some_str is replaced, trying to create unicode strings -# -import types - -def format_exception_only(etype, value): - """Format the exception part of a traceback. - - The arguments are the exception type and value such as given by - sys.last_type and sys.last_value. The return value is a list of - strings, each ending in a newline. - - Normally, the list contains a single string; however, for - SyntaxError exceptions, it contains several lines that (when - printed) display detailed information about where the syntax - error occurred. - - The message indicating which exception occurred is always the last - string in the list. - - """ - - # An instance should not have a meaningful value parameter, but - # sometimes does, particularly for string exceptions, such as - # >>> raise string1, string2 # deprecated - # - # Clear these out first because issubtype(string1, SyntaxError) - # would throw another exception and mask the original problem. - if (isinstance(etype, BaseException) or - isinstance(etype, types.InstanceType) or - etype is None or type(etype) is str): - return [_format_final_exc_line(etype, value)] - - stype = etype.__name__ - - if not issubclass(etype, SyntaxError): - return [_format_final_exc_line(stype, value)] - - # It was a syntax error; show exactly where the problem was found. - lines = [] - try: - msg, (filename, lineno, offset, badline) = value.args - except Exception: - pass - else: - filename = filename or "" - lines.append(' File "%s", line %d\n' % (filename, lineno)) - if badline is not None: - lines.append(' %s\n' % badline.strip()) - if offset is not None: - caretspace = badline.rstrip('\n')[:offset].lstrip() - # non-space whitespace (likes tabs) must be kept for alignment - caretspace = ((c.isspace() and c or ' ') for c in caretspace) - # only three spaces to account for offset1 == pos 0 - lines.append(' %s^\n' % ''.join(caretspace)) - value = msg - - lines.append(_format_final_exc_line(stype, value)) - return lines - -def _format_final_exc_line(etype, value): - """Return a list of a single line -- normal case for format_exception_only""" - valuestr = _some_str(value) - if value is None or not valuestr: - line = "%s\n" % etype - else: - line = "%s: %s\n" % (etype, valuestr) - return line - -def _some_str(value): - try: - return unicode(value) - except Exception: - try: - return str(value) - except Exception: - pass - return '' % type(value).__name__ diff --git a/lib/spack/external/py/_code/assertion.py b/lib/spack/external/py/_code/assertion.py deleted file mode 100644 index 4ce80c75b1..0000000000 --- a/lib/spack/external/py/_code/assertion.py +++ /dev/null @@ -1,94 +0,0 @@ -import sys -import py - -BuiltinAssertionError = py.builtin.builtins.AssertionError - -_reprcompare = None # if set, will be called by assert reinterp for comparison ops - -def _format_explanation(explanation): - """This formats an explanation - - Normally all embedded newlines are escaped, however there are - three exceptions: \n{, \n} and \n~. The first two are intended - cover nested explanations, see function and attribute explanations - for examples (.visit_Call(), visit_Attribute()). The last one is - for when one explanation needs to span multiple lines, e.g. when - displaying diffs. - """ - raw_lines = (explanation or '').split('\n') - # escape newlines not followed by {, } and ~ - lines = [raw_lines[0]] - for l in raw_lines[1:]: - if l.startswith('{') or l.startswith('}') or l.startswith('~'): - lines.append(l) - else: - lines[-1] += '\\n' + l - - result = lines[:1] - stack = [0] - stackcnt = [0] - for line in lines[1:]: - if line.startswith('{'): - if stackcnt[-1]: - s = 'and ' - else: - s = 'where ' - stack.append(len(result)) - stackcnt[-1] += 1 - stackcnt.append(0) - result.append(' +' + ' '*(len(stack)-1) + s + line[1:]) - elif line.startswith('}'): - assert line.startswith('}') - stack.pop() - stackcnt.pop() - result[stack[-1]] += line[1:] - else: - assert line.startswith('~') - result.append(' '*len(stack) + line[1:]) - assert len(stack) == 1 - return '\n'.join(result) - - -class AssertionError(BuiltinAssertionError): - def __init__(self, *args): - BuiltinAssertionError.__init__(self, *args) - if args: - try: - self.msg = str(args[0]) - except py.builtin._sysex: - raise - except: - self.msg = "<[broken __repr__] %s at %0xd>" %( - args[0].__class__, id(args[0])) - else: - f = py.code.Frame(sys._getframe(1)) - try: - source = f.code.fullsource - if source is not None: - try: - source = source.getstatement(f.lineno, assertion=True) - except IndexError: - source = None - else: - source = str(source.deindent()).strip() - except py.error.ENOENT: - source = None - # this can also occur during reinterpretation, when the - # co_filename is set to "". - if source: - self.msg = reinterpret(source, f, should_fail=True) - else: - self.msg = "" - if not self.args: - self.args = (self.msg,) - -if sys.version_info > (3, 0): - AssertionError.__module__ = "builtins" - reinterpret_old = "old reinterpretation not available for py3" -else: - from py._code._assertionold import interpret as reinterpret_old -if sys.version_info >= (2, 6) or (sys.platform.startswith("java")): - from py._code._assertionnew import interpret as reinterpret -else: - reinterpret = reinterpret_old - diff --git a/lib/spack/external/py/_code/code.py b/lib/spack/external/py/_code/code.py deleted file mode 100644 index 20fd965c97..0000000000 --- a/lib/spack/external/py/_code/code.py +++ /dev/null @@ -1,787 +0,0 @@ -import py -import sys -from inspect import CO_VARARGS, CO_VARKEYWORDS - -builtin_repr = repr - -reprlib = py.builtin._tryimport('repr', 'reprlib') - -if sys.version_info[0] >= 3: - from traceback import format_exception_only -else: - from py._code._py2traceback import format_exception_only - -class Code(object): - """ wrapper around Python code objects """ - def __init__(self, rawcode): - if not hasattr(rawcode, "co_filename"): - rawcode = py.code.getrawcode(rawcode) - try: - self.filename = rawcode.co_filename - self.firstlineno = rawcode.co_firstlineno - 1 - self.name = rawcode.co_name - except AttributeError: - raise TypeError("not a code object: %r" %(rawcode,)) - self.raw = rawcode - - def __eq__(self, other): - return self.raw == other.raw - - def __ne__(self, other): - return not self == other - - @property - def path(self): - """ return a path object pointing to source code (note that it - might not point to an actually existing file). """ - p = py.path.local(self.raw.co_filename) - # maybe don't try this checking - if not p.check(): - # XXX maybe try harder like the weird logic - # in the standard lib [linecache.updatecache] does? - p = self.raw.co_filename - return p - - @property - def fullsource(self): - """ return a py.code.Source object for the full source file of the code - """ - from py._code import source - full, _ = source.findsource(self.raw) - return full - - def source(self): - """ return a py.code.Source object for the code object's source only - """ - # return source only for that part of code - return py.code.Source(self.raw) - - def getargs(self, var=False): - """ return a tuple with the argument names for the code object - - if 'var' is set True also return the names of the variable and - keyword arguments when present - """ - # handfull shortcut for getting args - raw = self.raw - argcount = raw.co_argcount - if var: - argcount += raw.co_flags & CO_VARARGS - argcount += raw.co_flags & CO_VARKEYWORDS - return raw.co_varnames[:argcount] - -class Frame(object): - """Wrapper around a Python frame holding f_locals and f_globals - in which expressions can be evaluated.""" - - def __init__(self, frame): - self.lineno = frame.f_lineno - 1 - self.f_globals = frame.f_globals - self.f_locals = frame.f_locals - self.raw = frame - self.code = py.code.Code(frame.f_code) - - @property - def statement(self): - """ statement this frame is at """ - if self.code.fullsource is None: - return py.code.Source("") - return self.code.fullsource.getstatement(self.lineno) - - def eval(self, code, **vars): - """ evaluate 'code' in the frame - - 'vars' are optional additional local variables - - returns the result of the evaluation - """ - f_locals = self.f_locals.copy() - f_locals.update(vars) - return eval(code, self.f_globals, f_locals) - - def exec_(self, code, **vars): - """ exec 'code' in the frame - - 'vars' are optiona; additional local variables - """ - f_locals = self.f_locals.copy() - f_locals.update(vars) - py.builtin.exec_(code, self.f_globals, f_locals ) - - def repr(self, object): - """ return a 'safe' (non-recursive, one-line) string repr for 'object' - """ - return py.io.saferepr(object) - - def is_true(self, object): - return object - - def getargs(self, var=False): - """ return a list of tuples (name, value) for all arguments - - if 'var' is set True also include the variable and keyword - arguments when present - """ - retval = [] - for arg in self.code.getargs(var): - try: - retval.append((arg, self.f_locals[arg])) - except KeyError: - pass # this can occur when using Psyco - return retval - -class TracebackEntry(object): - """ a single entry in a traceback """ - - _repr_style = None - exprinfo = None - - def __init__(self, rawentry): - self._rawentry = rawentry - self.lineno = rawentry.tb_lineno - 1 - - def set_repr_style(self, mode): - assert mode in ("short", "long") - self._repr_style = mode - - @property - def frame(self): - return py.code.Frame(self._rawentry.tb_frame) - - @property - def relline(self): - return self.lineno - self.frame.code.firstlineno - - def __repr__(self): - return "" %(self.frame.code.path, self.lineno+1) - - @property - def statement(self): - """ py.code.Source object for the current statement """ - source = self.frame.code.fullsource - return source.getstatement(self.lineno) - - @property - def path(self): - """ path to the source code """ - return self.frame.code.path - - def getlocals(self): - return self.frame.f_locals - locals = property(getlocals, None, None, "locals of underlaying frame") - - def reinterpret(self): - """Reinterpret the failing statement and returns a detailed information - about what operations are performed.""" - if self.exprinfo is None: - source = str(self.statement).strip() - x = py.code._reinterpret(source, self.frame, should_fail=True) - if not isinstance(x, str): - raise TypeError("interpret returned non-string %r" % (x,)) - self.exprinfo = x - return self.exprinfo - - def getfirstlinesource(self): - # on Jython this firstlineno can be -1 apparently - return max(self.frame.code.firstlineno, 0) - - def getsource(self, astcache=None): - """ return failing source code. """ - # we use the passed in astcache to not reparse asttrees - # within exception info printing - from py._code.source import getstatementrange_ast - source = self.frame.code.fullsource - if source is None: - return None - key = astnode = None - if astcache is not None: - key = self.frame.code.path - if key is not None: - astnode = astcache.get(key, None) - start = self.getfirstlinesource() - try: - astnode, _, end = getstatementrange_ast(self.lineno, source, - astnode=astnode) - except SyntaxError: - end = self.lineno + 1 - else: - if key is not None: - astcache[key] = astnode - return source[start:end] - - source = property(getsource) - - def ishidden(self): - """ return True if the current frame has a var __tracebackhide__ - resolving to True - - mostly for internal use - """ - try: - return self.frame.f_locals['__tracebackhide__'] - except KeyError: - try: - return self.frame.f_globals['__tracebackhide__'] - except KeyError: - return False - - def __str__(self): - try: - fn = str(self.path) - except py.error.Error: - fn = '???' - name = self.frame.code.name - try: - line = str(self.statement).lstrip() - except KeyboardInterrupt: - raise - except: - line = "???" - return " File %r:%d in %s\n %s\n" %(fn, self.lineno+1, name, line) - - def name(self): - return self.frame.code.raw.co_name - name = property(name, None, None, "co_name of underlaying code") - -class Traceback(list): - """ Traceback objects encapsulate and offer higher level - access to Traceback entries. - """ - Entry = TracebackEntry - def __init__(self, tb): - """ initialize from given python traceback object. """ - if hasattr(tb, 'tb_next'): - def f(cur): - while cur is not None: - yield self.Entry(cur) - cur = cur.tb_next - list.__init__(self, f(tb)) - else: - list.__init__(self, tb) - - def cut(self, path=None, lineno=None, firstlineno=None, excludepath=None): - """ return a Traceback instance wrapping part of this Traceback - - by provding any combination of path, lineno and firstlineno, the - first frame to start the to-be-returned traceback is determined - - this allows cutting the first part of a Traceback instance e.g. - for formatting reasons (removing some uninteresting bits that deal - with handling of the exception/traceback) - """ - for x in self: - code = x.frame.code - codepath = code.path - if ((path is None or codepath == path) and - (excludepath is None or not hasattr(codepath, 'relto') or - not codepath.relto(excludepath)) and - (lineno is None or x.lineno == lineno) and - (firstlineno is None or x.frame.code.firstlineno == firstlineno)): - return Traceback(x._rawentry) - return self - - def __getitem__(self, key): - val = super(Traceback, self).__getitem__(key) - if isinstance(key, type(slice(0))): - val = self.__class__(val) - return val - - def filter(self, fn=lambda x: not x.ishidden()): - """ return a Traceback instance with certain items removed - - fn is a function that gets a single argument, a TracebackItem - instance, and should return True when the item should be added - to the Traceback, False when not - - by default this removes all the TracebackItems which are hidden - (see ishidden() above) - """ - return Traceback(filter(fn, self)) - - def getcrashentry(self): - """ return last non-hidden traceback entry that lead - to the exception of a traceback. - """ - for i in range(-1, -len(self)-1, -1): - entry = self[i] - if not entry.ishidden(): - return entry - return self[-1] - - def recursionindex(self): - """ return the index of the frame/TracebackItem where recursion - originates if appropriate, None if no recursion occurred - """ - cache = {} - for i, entry in enumerate(self): - # id for the code.raw is needed to work around - # the strange metaprogramming in the decorator lib from pypi - # which generates code objects that have hash/value equality - #XXX needs a test - key = entry.frame.code.path, id(entry.frame.code.raw), entry.lineno - #print "checking for recursion at", key - l = cache.setdefault(key, []) - if l: - f = entry.frame - loc = f.f_locals - for otherloc in l: - if f.is_true(f.eval(co_equal, - __recursioncache_locals_1=loc, - __recursioncache_locals_2=otherloc)): - return i - l.append(entry.frame.f_locals) - return None - -co_equal = compile('__recursioncache_locals_1 == __recursioncache_locals_2', - '?', 'eval') - -class ExceptionInfo(object): - """ wraps sys.exc_info() objects and offers - help for navigating the traceback. - """ - _striptext = '' - def __init__(self, tup=None, exprinfo=None): - if tup is None: - tup = sys.exc_info() - if exprinfo is None and isinstance(tup[1], AssertionError): - exprinfo = getattr(tup[1], 'msg', None) - if exprinfo is None: - exprinfo = str(tup[1]) - if exprinfo and exprinfo.startswith('assert '): - self._striptext = 'AssertionError: ' - self._excinfo = tup - #: the exception class - self.type = tup[0] - #: the exception instance - self.value = tup[1] - #: the exception raw traceback - self.tb = tup[2] - #: the exception type name - self.typename = self.type.__name__ - #: the exception traceback (py.code.Traceback instance) - self.traceback = py.code.Traceback(self.tb) - - def __repr__(self): - return "" % (self.typename, len(self.traceback)) - - def exconly(self, tryshort=False): - """ return the exception as a string - - when 'tryshort' resolves to True, and the exception is a - py.code._AssertionError, only the actual exception part of - the exception representation is returned (so 'AssertionError: ' is - removed from the beginning) - """ - lines = format_exception_only(self.type, self.value) - text = ''.join(lines) - text = text.rstrip() - if tryshort: - if text.startswith(self._striptext): - text = text[len(self._striptext):] - return text - - def errisinstance(self, exc): - """ return True if the exception is an instance of exc """ - return isinstance(self.value, exc) - - def _getreprcrash(self): - exconly = self.exconly(tryshort=True) - entry = self.traceback.getcrashentry() - path, lineno = entry.frame.code.raw.co_filename, entry.lineno - return ReprFileLocation(path, lineno+1, exconly) - - def getrepr(self, showlocals=False, style="long", - abspath=False, tbfilter=True, funcargs=False): - """ return str()able representation of this exception info. - showlocals: show locals per traceback entry - style: long|short|no|native traceback style - tbfilter: hide entries (where __tracebackhide__ is true) - - in case of style==native, tbfilter and showlocals is ignored. - """ - if style == 'native': - return ReprExceptionInfo(ReprTracebackNative( - py.std.traceback.format_exception( - self.type, - self.value, - self.traceback[0]._rawentry, - )), self._getreprcrash()) - - fmt = FormattedExcinfo(showlocals=showlocals, style=style, - abspath=abspath, tbfilter=tbfilter, funcargs=funcargs) - return fmt.repr_excinfo(self) - - def __str__(self): - entry = self.traceback[-1] - loc = ReprFileLocation(entry.path, entry.lineno + 1, self.exconly()) - return str(loc) - - def __unicode__(self): - entry = self.traceback[-1] - loc = ReprFileLocation(entry.path, entry.lineno + 1, self.exconly()) - return loc.__unicode__() - - -class FormattedExcinfo(object): - """ presenting information about failing Functions and Generators. """ - # for traceback entries - flow_marker = ">" - fail_marker = "E" - - def __init__(self, showlocals=False, style="long", abspath=True, tbfilter=True, funcargs=False): - self.showlocals = showlocals - self.style = style - self.tbfilter = tbfilter - self.funcargs = funcargs - self.abspath = abspath - self.astcache = {} - - def _getindent(self, source): - # figure out indent for given source - try: - s = str(source.getstatement(len(source)-1)) - except KeyboardInterrupt: - raise - except: - try: - s = str(source[-1]) - except KeyboardInterrupt: - raise - except: - return 0 - return 4 + (len(s) - len(s.lstrip())) - - def _getentrysource(self, entry): - source = entry.getsource(self.astcache) - if source is not None: - source = source.deindent() - return source - - def _saferepr(self, obj): - return py.io.saferepr(obj) - - def repr_args(self, entry): - if self.funcargs: - args = [] - for argname, argvalue in entry.frame.getargs(var=True): - args.append((argname, self._saferepr(argvalue))) - return ReprFuncArgs(args) - - def get_source(self, source, line_index=-1, excinfo=None, short=False): - """ return formatted and marked up source lines. """ - lines = [] - if source is None or line_index >= len(source.lines): - source = py.code.Source("???") - line_index = 0 - if line_index < 0: - line_index += len(source) - space_prefix = " " - if short: - lines.append(space_prefix + source.lines[line_index].strip()) - else: - for line in source.lines[:line_index]: - lines.append(space_prefix + line) - lines.append(self.flow_marker + " " + source.lines[line_index]) - for line in source.lines[line_index+1:]: - lines.append(space_prefix + line) - if excinfo is not None: - indent = 4 if short else self._getindent(source) - lines.extend(self.get_exconly(excinfo, indent=indent, markall=True)) - return lines - - def get_exconly(self, excinfo, indent=4, markall=False): - lines = [] - indent = " " * indent - # get the real exception information out - exlines = excinfo.exconly(tryshort=True).split('\n') - failindent = self.fail_marker + indent[1:] - for line in exlines: - lines.append(failindent + line) - if not markall: - failindent = indent - return lines - - def repr_locals(self, locals): - if self.showlocals: - lines = [] - keys = [loc for loc in locals if loc[0] != "@"] - keys.sort() - for name in keys: - value = locals[name] - if name == '__builtins__': - lines.append("__builtins__ = ") - else: - # This formatting could all be handled by the - # _repr() function, which is only reprlib.Repr in - # disguise, so is very configurable. - str_repr = self._saferepr(value) - #if len(str_repr) < 70 or not isinstance(value, - # (list, tuple, dict)): - lines.append("%-10s = %s" %(name, str_repr)) - #else: - # self._line("%-10s =\\" % (name,)) - # # XXX - # py.std.pprint.pprint(value, stream=self.excinfowriter) - return ReprLocals(lines) - - def repr_traceback_entry(self, entry, excinfo=None): - source = self._getentrysource(entry) - if source is None: - source = py.code.Source("???") - line_index = 0 - else: - # entry.getfirstlinesource() can be -1, should be 0 on jython - line_index = entry.lineno - max(entry.getfirstlinesource(), 0) - - lines = [] - style = entry._repr_style - if style is None: - style = self.style - if style in ("short", "long"): - short = style == "short" - reprargs = self.repr_args(entry) if not short else None - s = self.get_source(source, line_index, excinfo, short=short) - lines.extend(s) - if short: - message = "in %s" %(entry.name) - else: - message = excinfo and excinfo.typename or "" - path = self._makepath(entry.path) - filelocrepr = ReprFileLocation(path, entry.lineno+1, message) - localsrepr = None - if not short: - localsrepr = self.repr_locals(entry.locals) - return ReprEntry(lines, reprargs, localsrepr, filelocrepr, style) - if excinfo: - lines.extend(self.get_exconly(excinfo, indent=4)) - return ReprEntry(lines, None, None, None, style) - - def _makepath(self, path): - if not self.abspath: - try: - np = py.path.local().bestrelpath(path) - except OSError: - return path - if len(np) < len(str(path)): - path = np - return path - - def repr_traceback(self, excinfo): - traceback = excinfo.traceback - if self.tbfilter: - traceback = traceback.filter() - recursionindex = None - if excinfo.errisinstance(RuntimeError): - if "maximum recursion depth exceeded" in str(excinfo.value): - recursionindex = traceback.recursionindex() - last = traceback[-1] - entries = [] - extraline = None - for index, entry in enumerate(traceback): - einfo = (last == entry) and excinfo or None - reprentry = self.repr_traceback_entry(entry, einfo) - entries.append(reprentry) - if index == recursionindex: - extraline = "!!! Recursion detected (same locals & position)" - break - return ReprTraceback(entries, extraline, style=self.style) - - def repr_excinfo(self, excinfo): - reprtraceback = self.repr_traceback(excinfo) - reprcrash = excinfo._getreprcrash() - return ReprExceptionInfo(reprtraceback, reprcrash) - -class TerminalRepr: - def __str__(self): - s = self.__unicode__() - if sys.version_info[0] < 3: - s = s.encode('utf-8') - return s - - def __unicode__(self): - # FYI this is called from pytest-xdist's serialization of exception - # information. - io = py.io.TextIO() - tw = py.io.TerminalWriter(file=io) - self.toterminal(tw) - return io.getvalue().strip() - - def __repr__(self): - return "<%s instance at %0x>" %(self.__class__, id(self)) - - -class ReprExceptionInfo(TerminalRepr): - def __init__(self, reprtraceback, reprcrash): - self.reprtraceback = reprtraceback - self.reprcrash = reprcrash - self.sections = [] - - def addsection(self, name, content, sep="-"): - self.sections.append((name, content, sep)) - - def toterminal(self, tw): - self.reprtraceback.toterminal(tw) - for name, content, sep in self.sections: - tw.sep(sep, name) - tw.line(content) - -class ReprTraceback(TerminalRepr): - entrysep = "_ " - - def __init__(self, reprentries, extraline, style): - self.reprentries = reprentries - self.extraline = extraline - self.style = style - - def toterminal(self, tw): - # the entries might have different styles - last_style = None - for i, entry in enumerate(self.reprentries): - if entry.style == "long": - tw.line("") - entry.toterminal(tw) - if i < len(self.reprentries) - 1: - next_entry = self.reprentries[i+1] - if entry.style == "long" or \ - entry.style == "short" and next_entry.style == "long": - tw.sep(self.entrysep) - - if self.extraline: - tw.line(self.extraline) - -class ReprTracebackNative(ReprTraceback): - def __init__(self, tblines): - self.style = "native" - self.reprentries = [ReprEntryNative(tblines)] - self.extraline = None - -class ReprEntryNative(TerminalRepr): - style = "native" - - def __init__(self, tblines): - self.lines = tblines - - def toterminal(self, tw): - tw.write("".join(self.lines)) - -class ReprEntry(TerminalRepr): - localssep = "_ " - - def __init__(self, lines, reprfuncargs, reprlocals, filelocrepr, style): - self.lines = lines - self.reprfuncargs = reprfuncargs - self.reprlocals = reprlocals - self.reprfileloc = filelocrepr - self.style = style - - def toterminal(self, tw): - if self.style == "short": - self.reprfileloc.toterminal(tw) - for line in self.lines: - red = line.startswith("E ") - tw.line(line, bold=True, red=red) - #tw.line("") - return - if self.reprfuncargs: - self.reprfuncargs.toterminal(tw) - for line in self.lines: - red = line.startswith("E ") - tw.line(line, bold=True, red=red) - if self.reprlocals: - #tw.sep(self.localssep, "Locals") - tw.line("") - self.reprlocals.toterminal(tw) - if self.reprfileloc: - if self.lines: - tw.line("") - self.reprfileloc.toterminal(tw) - - def __str__(self): - return "%s\n%s\n%s" % ("\n".join(self.lines), - self.reprlocals, - self.reprfileloc) - -class ReprFileLocation(TerminalRepr): - def __init__(self, path, lineno, message): - self.path = str(path) - self.lineno = lineno - self.message = message - - def toterminal(self, tw): - # filename and lineno output for each entry, - # using an output format that most editors unterstand - msg = self.message - i = msg.find("\n") - if i != -1: - msg = msg[:i] - tw.line("%s:%s: %s" %(self.path, self.lineno, msg)) - -class ReprLocals(TerminalRepr): - def __init__(self, lines): - self.lines = lines - - def toterminal(self, tw): - for line in self.lines: - tw.line(line) - -class ReprFuncArgs(TerminalRepr): - def __init__(self, args): - self.args = args - - def toterminal(self, tw): - if self.args: - linesofar = "" - for name, value in self.args: - ns = "%s = %s" %(name, value) - if len(ns) + len(linesofar) + 2 > tw.fullwidth: - if linesofar: - tw.line(linesofar) - linesofar = ns - else: - if linesofar: - linesofar += ", " + ns - else: - linesofar = ns - if linesofar: - tw.line(linesofar) - tw.line("") - - - -oldbuiltins = {} - -def patch_builtins(assertion=True, compile=True): - """ put compile and AssertionError builtins to Python's builtins. """ - if assertion: - from py._code import assertion - l = oldbuiltins.setdefault('AssertionError', []) - l.append(py.builtin.builtins.AssertionError) - py.builtin.builtins.AssertionError = assertion.AssertionError - if compile: - l = oldbuiltins.setdefault('compile', []) - l.append(py.builtin.builtins.compile) - py.builtin.builtins.compile = py.code.compile - -def unpatch_builtins(assertion=True, compile=True): - """ remove compile and AssertionError builtins from Python builtins. """ - if assertion: - py.builtin.builtins.AssertionError = oldbuiltins['AssertionError'].pop() - if compile: - py.builtin.builtins.compile = oldbuiltins['compile'].pop() - -def getrawcode(obj, trycall=True): - """ return code object for given function. """ - try: - return obj.__code__ - except AttributeError: - obj = getattr(obj, 'im_func', obj) - obj = getattr(obj, 'func_code', obj) - obj = getattr(obj, 'f_code', obj) - obj = getattr(obj, '__code__', obj) - if trycall and not hasattr(obj, 'co_firstlineno'): - if hasattr(obj, '__call__') and not py.std.inspect.isclass(obj): - x = getrawcode(obj.__call__, trycall=False) - if hasattr(x, 'co_firstlineno'): - return x - return obj - diff --git a/lib/spack/external/py/_code/source.py b/lib/spack/external/py/_code/source.py deleted file mode 100644 index c8b668b2fb..0000000000 --- a/lib/spack/external/py/_code/source.py +++ /dev/null @@ -1,411 +0,0 @@ -from __future__ import generators - -from bisect import bisect_right -import sys -import inspect, tokenize -import py -from types import ModuleType -cpy_compile = compile - -try: - import _ast - from _ast import PyCF_ONLY_AST as _AST_FLAG -except ImportError: - _AST_FLAG = 0 - _ast = None - - -class Source(object): - """ a immutable object holding a source code fragment, - possibly deindenting it. - """ - _compilecounter = 0 - def __init__(self, *parts, **kwargs): - self.lines = lines = [] - de = kwargs.get('deindent', True) - rstrip = kwargs.get('rstrip', True) - for part in parts: - if not part: - partlines = [] - if isinstance(part, Source): - partlines = part.lines - elif isinstance(part, (tuple, list)): - partlines = [x.rstrip("\n") for x in part] - elif isinstance(part, py.builtin._basestring): - partlines = part.split('\n') - if rstrip: - while partlines: - if partlines[-1].strip(): - break - partlines.pop() - else: - partlines = getsource(part, deindent=de).lines - if de: - partlines = deindent(partlines) - lines.extend(partlines) - - def __eq__(self, other): - try: - return self.lines == other.lines - except AttributeError: - if isinstance(other, str): - return str(self) == other - return False - - def __getitem__(self, key): - if isinstance(key, int): - return self.lines[key] - else: - if key.step not in (None, 1): - raise IndexError("cannot slice a Source with a step") - return self.__getslice__(key.start, key.stop) - - def __len__(self): - return len(self.lines) - - def __getslice__(self, start, end): - newsource = Source() - newsource.lines = self.lines[start:end] - return newsource - - def strip(self): - """ return new source object with trailing - and leading blank lines removed. - """ - start, end = 0, len(self) - while start < end and not self.lines[start].strip(): - start += 1 - while end > start and not self.lines[end-1].strip(): - end -= 1 - source = Source() - source.lines[:] = self.lines[start:end] - return source - - def putaround(self, before='', after='', indent=' ' * 4): - """ return a copy of the source object with - 'before' and 'after' wrapped around it. - """ - before = Source(before) - after = Source(after) - newsource = Source() - lines = [ (indent + line) for line in self.lines] - newsource.lines = before.lines + lines + after.lines - return newsource - - def indent(self, indent=' ' * 4): - """ return a copy of the source object with - all lines indented by the given indent-string. - """ - newsource = Source() - newsource.lines = [(indent+line) for line in self.lines] - return newsource - - def getstatement(self, lineno, assertion=False): - """ return Source statement which contains the - given linenumber (counted from 0). - """ - start, end = self.getstatementrange(lineno, assertion) - return self[start:end] - - def getstatementrange(self, lineno, assertion=False): - """ return (start, end) tuple which spans the minimal - statement region which containing the given lineno. - """ - if not (0 <= lineno < len(self)): - raise IndexError("lineno out of range") - ast, start, end = getstatementrange_ast(lineno, self) - return start, end - - def deindent(self, offset=None): - """ return a new source object deindented by offset. - If offset is None then guess an indentation offset from - the first non-blank line. Subsequent lines which have a - lower indentation offset will be copied verbatim as - they are assumed to be part of multilines. - """ - # XXX maybe use the tokenizer to properly handle multiline - # strings etc.pp? - newsource = Source() - newsource.lines[:] = deindent(self.lines, offset) - return newsource - - def isparseable(self, deindent=True): - """ return True if source is parseable, heuristically - deindenting it by default. - """ - try: - import parser - except ImportError: - syntax_checker = lambda x: compile(x, 'asd', 'exec') - else: - syntax_checker = parser.suite - - if deindent: - source = str(self.deindent()) - else: - source = str(self) - try: - #compile(source+'\n', "x", "exec") - syntax_checker(source+'\n') - except KeyboardInterrupt: - raise - except Exception: - return False - else: - return True - - def __str__(self): - return "\n".join(self.lines) - - def compile(self, filename=None, mode='exec', - flag=generators.compiler_flag, - dont_inherit=0, _genframe=None): - """ return compiled code object. if filename is None - invent an artificial filename which displays - the source/line position of the caller frame. - """ - if not filename or py.path.local(filename).check(file=0): - if _genframe is None: - _genframe = sys._getframe(1) # the caller - fn,lineno = _genframe.f_code.co_filename, _genframe.f_lineno - base = "<%d-codegen " % self._compilecounter - self.__class__._compilecounter += 1 - if not filename: - filename = base + '%s:%d>' % (fn, lineno) - else: - filename = base + '%r %s:%d>' % (filename, fn, lineno) - source = "\n".join(self.lines) + '\n' - try: - co = cpy_compile(source, filename, mode, flag) - except SyntaxError: - ex = sys.exc_info()[1] - # re-represent syntax errors from parsing python strings - msglines = self.lines[:ex.lineno] - if ex.offset: - msglines.append(" "*ex.offset + '^') - msglines.append("(code was compiled probably from here: %s)" % filename) - newex = SyntaxError('\n'.join(msglines)) - newex.offset = ex.offset - newex.lineno = ex.lineno - newex.text = ex.text - raise newex - else: - if flag & _AST_FLAG: - return co - lines = [(x + "\n") for x in self.lines] - py.std.linecache.cache[filename] = (1, None, lines, filename) - return co - -# -# public API shortcut functions -# - -def compile_(source, filename=None, mode='exec', flags= - generators.compiler_flag, dont_inherit=0): - """ compile the given source to a raw code object, - and maintain an internal cache which allows later - retrieval of the source code for the code object - and any recursively created code objects. - """ - if _ast is not None and isinstance(source, _ast.AST): - # XXX should Source support having AST? - return cpy_compile(source, filename, mode, flags, dont_inherit) - _genframe = sys._getframe(1) # the caller - s = Source(source) - co = s.compile(filename, mode, flags, _genframe=_genframe) - return co - - -def getfslineno(obj): - """ Return source location (path, lineno) for the given object. - If the source cannot be determined return ("", -1) - """ - try: - code = py.code.Code(obj) - except TypeError: - try: - fn = (py.std.inspect.getsourcefile(obj) or - py.std.inspect.getfile(obj)) - except TypeError: - return "", -1 - - fspath = fn and py.path.local(fn) or None - lineno = -1 - if fspath: - try: - _, lineno = findsource(obj) - except IOError: - pass - else: - fspath = code.path - lineno = code.firstlineno - assert isinstance(lineno, int) - return fspath, lineno - -# -# helper functions -# - -def findsource(obj): - try: - sourcelines, lineno = py.std.inspect.findsource(obj) - except py.builtin._sysex: - raise - except: - return None, -1 - source = Source() - source.lines = [line.rstrip() for line in sourcelines] - return source, lineno - -def getsource(obj, **kwargs): - obj = py.code.getrawcode(obj) - try: - strsrc = inspect.getsource(obj) - except IndentationError: - strsrc = "\"Buggy python version consider upgrading, cannot get source\"" - assert isinstance(strsrc, str) - return Source(strsrc, **kwargs) - -def deindent(lines, offset=None): - if offset is None: - for line in lines: - line = line.expandtabs() - s = line.lstrip() - if s: - offset = len(line)-len(s) - break - else: - offset = 0 - if offset == 0: - return list(lines) - newlines = [] - def readline_generator(lines): - for line in lines: - yield line + '\n' - while True: - yield '' - - it = readline_generator(lines) - - try: - for _, _, (sline, _), (eline, _), _ in tokenize.generate_tokens(lambda: next(it)): - if sline > len(lines): - break # End of input reached - if sline > len(newlines): - line = lines[sline - 1].expandtabs() - if line.lstrip() and line[:offset].isspace(): - line = line[offset:] # Deindent - newlines.append(line) - - for i in range(sline, eline): - # Don't deindent continuing lines of - # multiline tokens (i.e. multiline strings) - newlines.append(lines[i]) - except (IndentationError, tokenize.TokenError): - pass - # Add any lines we didn't see. E.g. if an exception was raised. - newlines.extend(lines[len(newlines):]) - return newlines - - -def get_statement_startend2(lineno, node): - import ast - # flatten all statements and except handlers into one lineno-list - # AST's line numbers start indexing at 1 - l = [] - for x in ast.walk(node): - if isinstance(x, _ast.stmt) or isinstance(x, _ast.ExceptHandler): - l.append(x.lineno - 1) - for name in "finalbody", "orelse": - val = getattr(x, name, None) - if val: - # treat the finally/orelse part as its own statement - l.append(val[0].lineno - 1 - 1) - l.sort() - insert_index = bisect_right(l, lineno) - start = l[insert_index - 1] - if insert_index >= len(l): - end = None - else: - end = l[insert_index] - return start, end - - -def getstatementrange_ast(lineno, source, assertion=False, astnode=None): - if astnode is None: - content = str(source) - if sys.version_info < (2,7): - content += "\n" - try: - astnode = compile(content, "source", "exec", 1024) # 1024 for AST - except ValueError: - start, end = getstatementrange_old(lineno, source, assertion) - return None, start, end - start, end = get_statement_startend2(lineno, astnode) - # we need to correct the end: - # - ast-parsing strips comments - # - there might be empty lines - # - we might have lesser indented code blocks at the end - if end is None: - end = len(source.lines) - - if end > start + 1: - # make sure we don't span differently indented code blocks - # by using the BlockFinder helper used which inspect.getsource() uses itself - block_finder = inspect.BlockFinder() - # if we start with an indented line, put blockfinder to "started" mode - block_finder.started = source.lines[start][0].isspace() - it = ((x + "\n") for x in source.lines[start:end]) - try: - for tok in tokenize.generate_tokens(lambda: next(it)): - block_finder.tokeneater(*tok) - except (inspect.EndOfBlock, IndentationError): - end = block_finder.last + start - except Exception: - pass - - # the end might still point to a comment or empty line, correct it - while end: - line = source.lines[end - 1].lstrip() - if line.startswith("#") or not line: - end -= 1 - else: - break - return astnode, start, end - - -def getstatementrange_old(lineno, source, assertion=False): - """ return (start, end) tuple which spans the minimal - statement region which containing the given lineno. - raise an IndexError if no such statementrange can be found. - """ - # XXX this logic is only used on python2.4 and below - # 1. find the start of the statement - from codeop import compile_command - for start in range(lineno, -1, -1): - if assertion: - line = source.lines[start] - # the following lines are not fully tested, change with care - if 'super' in line and 'self' in line and '__init__' in line: - raise IndexError("likely a subclass") - if "assert" not in line and "raise" not in line: - continue - trylines = source.lines[start:lineno+1] - # quick hack to prepare parsing an indented line with - # compile_command() (which errors on "return" outside defs) - trylines.insert(0, 'def xxx():') - trysource = '\n '.join(trylines) - # ^ space here - try: - compile_command(trysource) - except (SyntaxError, OverflowError, ValueError): - continue - - # 2. find the end of the statement - for end in range(lineno+1, len(source)+1): - trysource = source[start:end] - if trysource.isparseable(): - return start, end - raise SyntaxError("no valid source range around line %d " % (lineno,)) - - diff --git a/lib/spack/external/py/_error.py b/lib/spack/external/py/_error.py deleted file mode 100644 index 8ca339beba..0000000000 --- a/lib/spack/external/py/_error.py +++ /dev/null @@ -1,89 +0,0 @@ -""" -create errno-specific classes for IO or os calls. - -""" -import sys, os, errno - -class Error(EnvironmentError): - def __repr__(self): - return "%s.%s %r: %s " %(self.__class__.__module__, - self.__class__.__name__, - self.__class__.__doc__, - " ".join(map(str, self.args)), - #repr(self.args) - ) - - def __str__(self): - s = "[%s]: %s" %(self.__class__.__doc__, - " ".join(map(str, self.args)), - ) - return s - -_winerrnomap = { - 2: errno.ENOENT, - 3: errno.ENOENT, - 17: errno.EEXIST, - 18: errno.EXDEV, - 13: errno.EBUSY, # empty cd drive, but ENOMEDIUM seems unavailiable - 22: errno.ENOTDIR, - 20: errno.ENOTDIR, - 267: errno.ENOTDIR, - 5: errno.EACCES, # anything better? -} - -class ErrorMaker(object): - """ lazily provides Exception classes for each possible POSIX errno - (as defined per the 'errno' module). All such instances - subclass EnvironmentError. - """ - Error = Error - _errno2class = {} - - def __getattr__(self, name): - if name[0] == "_": - raise AttributeError(name) - eno = getattr(errno, name) - cls = self._geterrnoclass(eno) - setattr(self, name, cls) - return cls - - def _geterrnoclass(self, eno): - try: - return self._errno2class[eno] - except KeyError: - clsname = errno.errorcode.get(eno, "UnknownErrno%d" %(eno,)) - errorcls = type(Error)(clsname, (Error,), - {'__module__':'py.error', - '__doc__': os.strerror(eno)}) - self._errno2class[eno] = errorcls - return errorcls - - def checked_call(self, func, *args, **kwargs): - """ call a function and raise an errno-exception if applicable. """ - __tracebackhide__ = True - try: - return func(*args, **kwargs) - except self.Error: - raise - except (OSError, EnvironmentError): - cls, value, tb = sys.exc_info() - if not hasattr(value, 'errno'): - raise - __tracebackhide__ = False - errno = value.errno - try: - if not isinstance(value, WindowsError): - raise NameError - except NameError: - # we are not on Windows, or we got a proper OSError - cls = self._geterrnoclass(errno) - else: - try: - cls = self._geterrnoclass(_winerrnomap[errno]) - except KeyError: - raise value - raise cls("%s%r" % (func.__name__, args)) - __tracebackhide__ = True - - -error = ErrorMaker() diff --git a/lib/spack/external/py/_iniconfig.py b/lib/spack/external/py/_iniconfig.py deleted file mode 100644 index 92b50bd853..0000000000 --- a/lib/spack/external/py/_iniconfig.py +++ /dev/null @@ -1,162 +0,0 @@ -""" brain-dead simple parser for ini-style files. -(C) Ronny Pfannschmidt, Holger Krekel -- MIT licensed -""" -__version__ = "0.2.dev2" - -__all__ = ['IniConfig', 'ParseError'] - -COMMENTCHARS = "#;" - -class ParseError(Exception): - def __init__(self, path, lineno, msg): - Exception.__init__(self, path, lineno, msg) - self.path = path - self.lineno = lineno - self.msg = msg - - def __str__(self): - return "%s:%s: %s" %(self.path, self.lineno+1, self.msg) - -class SectionWrapper(object): - def __init__(self, config, name): - self.config = config - self.name = name - - def lineof(self, name): - return self.config.lineof(self.name, name) - - def get(self, key, default=None, convert=str): - return self.config.get(self.name, key, convert=convert, default=default) - - def __getitem__(self, key): - return self.config.sections[self.name][key] - - def __iter__(self): - section = self.config.sections.get(self.name, []) - def lineof(key): - return self.config.lineof(self.name, key) - for name in sorted(section, key=lineof): - yield name - - def items(self): - for name in self: - yield name, self[name] - - -class IniConfig(object): - def __init__(self, path, data=None): - self.path = str(path) # convenience - if data is None: - f = open(self.path) - try: - tokens = self._parse(iter(f)) - finally: - f.close() - else: - tokens = self._parse(data.splitlines(True)) - - self._sources = {} - self.sections = {} - - for lineno, section, name, value in tokens: - if section is None: - self._raise(lineno, 'no section header defined') - self._sources[section, name] = lineno - if name is None: - if section in self.sections: - self._raise(lineno, 'duplicate section %r'%(section, )) - self.sections[section] = {} - else: - if name in self.sections[section]: - self._raise(lineno, 'duplicate name %r'%(name, )) - self.sections[section][name] = value - - def _raise(self, lineno, msg): - raise ParseError(self.path, lineno, msg) - - def _parse(self, line_iter): - result = [] - section = None - for lineno, line in enumerate(line_iter): - name, data = self._parseline(line, lineno) - # new value - if name is not None and data is not None: - result.append((lineno, section, name, data)) - # new section - elif name is not None and data is None: - if not name: - self._raise(lineno, 'empty section name') - section = name - result.append((lineno, section, None, None)) - # continuation - elif name is None and data is not None: - if not result: - self._raise(lineno, 'unexpected value continuation') - last = result.pop() - last_name, last_data = last[-2:] - if last_name is None: - self._raise(lineno, 'unexpected value continuation') - - if last_data: - data = '%s\n%s' % (last_data, data) - result.append(last[:-1] + (data,)) - return result - - def _parseline(self, line, lineno): - # blank lines - if iscommentline(line): - line = "" - else: - line = line.rstrip() - if not line: - return None, None - # section - if line[0] == '[': - realline = line - for c in COMMENTCHARS: - line = line.split(c)[0].rstrip() - if line[-1] == "]": - return line[1:-1], None - return None, realline.strip() - # value - elif not line[0].isspace(): - try: - name, value = line.split('=', 1) - if ":" in name: - raise ValueError() - except ValueError: - try: - name, value = line.split(":", 1) - except ValueError: - self._raise(lineno, 'unexpected line: %r' % line) - return name.strip(), value.strip() - # continuation - else: - return None, line.strip() - - def lineof(self, section, name=None): - lineno = self._sources.get((section, name)) - if lineno is not None: - return lineno + 1 - - def get(self, section, name, default=None, convert=str): - try: - return convert(self.sections[section][name]) - except KeyError: - return default - - def __getitem__(self, name): - if name not in self.sections: - raise KeyError(name) - return SectionWrapper(self, name) - - def __iter__(self): - for name in sorted(self.sections, key=self.lineof): - yield SectionWrapper(self, name) - - def __contains__(self, arg): - return arg in self.sections - -def iscommentline(line): - c = line.lstrip()[:1] - return c in COMMENTCHARS diff --git a/lib/spack/external/py/_io/__init__.py b/lib/spack/external/py/_io/__init__.py deleted file mode 100644 index 835f01f3ab..0000000000 --- a/lib/spack/external/py/_io/__init__.py +++ /dev/null @@ -1 +0,0 @@ -""" input/output helping """ diff --git a/lib/spack/external/py/_io/capture.py b/lib/spack/external/py/_io/capture.py deleted file mode 100644 index bc157ed978..0000000000 --- a/lib/spack/external/py/_io/capture.py +++ /dev/null @@ -1,371 +0,0 @@ -import os -import sys -import py -import tempfile - -try: - from io import StringIO -except ImportError: - from StringIO import StringIO - -if sys.version_info < (3,0): - class TextIO(StringIO): - def write(self, data): - if not isinstance(data, unicode): - data = unicode(data, getattr(self, '_encoding', 'UTF-8'), 'replace') - StringIO.write(self, data) -else: - TextIO = StringIO - -try: - from io import BytesIO -except ImportError: - class BytesIO(StringIO): - def write(self, data): - if isinstance(data, unicode): - raise TypeError("not a byte value: %r" %(data,)) - StringIO.write(self, data) - -patchsysdict = {0: 'stdin', 1: 'stdout', 2: 'stderr'} - -class FDCapture: - """ Capture IO to/from a given os-level filedescriptor. """ - - def __init__(self, targetfd, tmpfile=None, now=True, patchsys=False): - """ save targetfd descriptor, and open a new - temporary file there. If no tmpfile is - specified a tempfile.Tempfile() will be opened - in text mode. - """ - self.targetfd = targetfd - if tmpfile is None and targetfd != 0: - f = tempfile.TemporaryFile('wb+') - tmpfile = dupfile(f, encoding="UTF-8") - f.close() - self.tmpfile = tmpfile - self._savefd = os.dup(self.targetfd) - if patchsys: - self._oldsys = getattr(sys, patchsysdict[targetfd]) - if now: - self.start() - - def start(self): - try: - os.fstat(self._savefd) - except OSError: - raise ValueError("saved filedescriptor not valid, " - "did you call start() twice?") - if self.targetfd == 0 and not self.tmpfile: - fd = os.open(devnullpath, os.O_RDONLY) - os.dup2(fd, 0) - os.close(fd) - if hasattr(self, '_oldsys'): - setattr(sys, patchsysdict[self.targetfd], DontReadFromInput()) - else: - os.dup2(self.tmpfile.fileno(), self.targetfd) - if hasattr(self, '_oldsys'): - setattr(sys, patchsysdict[self.targetfd], self.tmpfile) - - def done(self): - """ unpatch and clean up, returns the self.tmpfile (file object) - """ - os.dup2(self._savefd, self.targetfd) - os.close(self._savefd) - if self.targetfd != 0: - self.tmpfile.seek(0) - if hasattr(self, '_oldsys'): - setattr(sys, patchsysdict[self.targetfd], self._oldsys) - return self.tmpfile - - def writeorg(self, data): - """ write a string to the original file descriptor - """ - tempfp = tempfile.TemporaryFile() - try: - os.dup2(self._savefd, tempfp.fileno()) - tempfp.write(data) - finally: - tempfp.close() - - -def dupfile(f, mode=None, buffering=0, raising=False, encoding=None): - """ return a new open file object that's a duplicate of f - - mode is duplicated if not given, 'buffering' controls - buffer size (defaulting to no buffering) and 'raising' - defines whether an exception is raised when an incompatible - file object is passed in (if raising is False, the file - object itself will be returned) - """ - try: - fd = f.fileno() - mode = mode or f.mode - except AttributeError: - if raising: - raise - return f - newfd = os.dup(fd) - if sys.version_info >= (3,0): - if encoding is not None: - mode = mode.replace("b", "") - buffering = True - return os.fdopen(newfd, mode, buffering, encoding, closefd=True) - else: - f = os.fdopen(newfd, mode, buffering) - if encoding is not None: - return EncodedFile(f, encoding) - return f - -class EncodedFile(object): - def __init__(self, _stream, encoding): - self._stream = _stream - self.encoding = encoding - - def write(self, obj): - if isinstance(obj, unicode): - obj = obj.encode(self.encoding) - elif isinstance(obj, str): - pass - else: - obj = str(obj) - self._stream.write(obj) - - def writelines(self, linelist): - data = ''.join(linelist) - self.write(data) - - def __getattr__(self, name): - return getattr(self._stream, name) - -class Capture(object): - def call(cls, func, *args, **kwargs): - """ return a (res, out, err) tuple where - out and err represent the output/error output - during function execution. - call the given function with args/kwargs - and capture output/error during its execution. - """ - so = cls() - try: - res = func(*args, **kwargs) - finally: - out, err = so.reset() - return res, out, err - call = classmethod(call) - - def reset(self): - """ reset sys.stdout/stderr and return captured output as strings. """ - if hasattr(self, '_reset'): - raise ValueError("was already reset") - self._reset = True - outfile, errfile = self.done(save=False) - out, err = "", "" - if outfile and not outfile.closed: - out = outfile.read() - outfile.close() - if errfile and errfile != outfile and not errfile.closed: - err = errfile.read() - errfile.close() - return out, err - - def suspend(self): - """ return current snapshot captures, memorize tempfiles. """ - outerr = self.readouterr() - outfile, errfile = self.done() - return outerr - - -class StdCaptureFD(Capture): - """ This class allows to capture writes to FD1 and FD2 - and may connect a NULL file to FD0 (and prevent - reads from sys.stdin). If any of the 0,1,2 file descriptors - is invalid it will not be captured. - """ - def __init__(self, out=True, err=True, mixed=False, - in_=True, patchsys=True, now=True): - self._options = { - "out": out, - "err": err, - "mixed": mixed, - "in_": in_, - "patchsys": patchsys, - "now": now, - } - self._save() - if now: - self.startall() - - def _save(self): - in_ = self._options['in_'] - out = self._options['out'] - err = self._options['err'] - mixed = self._options['mixed'] - patchsys = self._options['patchsys'] - if in_: - try: - self.in_ = FDCapture(0, tmpfile=None, now=False, - patchsys=patchsys) - except OSError: - pass - if out: - tmpfile = None - if hasattr(out, 'write'): - tmpfile = out - try: - self.out = FDCapture(1, tmpfile=tmpfile, - now=False, patchsys=patchsys) - self._options['out'] = self.out.tmpfile - except OSError: - pass - if err: - if out and mixed: - tmpfile = self.out.tmpfile - elif hasattr(err, 'write'): - tmpfile = err - else: - tmpfile = None - try: - self.err = FDCapture(2, tmpfile=tmpfile, - now=False, patchsys=patchsys) - self._options['err'] = self.err.tmpfile - except OSError: - pass - - def startall(self): - if hasattr(self, 'in_'): - self.in_.start() - if hasattr(self, 'out'): - self.out.start() - if hasattr(self, 'err'): - self.err.start() - - def resume(self): - """ resume capturing with original temp files. """ - self.startall() - - def done(self, save=True): - """ return (outfile, errfile) and stop capturing. """ - outfile = errfile = None - if hasattr(self, 'out') and not self.out.tmpfile.closed: - outfile = self.out.done() - if hasattr(self, 'err') and not self.err.tmpfile.closed: - errfile = self.err.done() - if hasattr(self, 'in_'): - tmpfile = self.in_.done() - if save: - self._save() - return outfile, errfile - - def readouterr(self): - """ return snapshot value of stdout/stderr capturings. """ - if hasattr(self, "out"): - out = self._readsnapshot(self.out.tmpfile) - else: - out = "" - if hasattr(self, "err"): - err = self._readsnapshot(self.err.tmpfile) - else: - err = "" - return [out, err] - - def _readsnapshot(self, f): - f.seek(0) - res = f.read() - enc = getattr(f, "encoding", None) - if enc: - res = py.builtin._totext(res, enc, "replace") - f.truncate(0) - f.seek(0) - return res - - -class StdCapture(Capture): - """ This class allows to capture writes to sys.stdout|stderr "in-memory" - and will raise errors on tries to read from sys.stdin. It only - modifies sys.stdout|stderr|stdin attributes and does not - touch underlying File Descriptors (use StdCaptureFD for that). - """ - def __init__(self, out=True, err=True, in_=True, mixed=False, now=True): - self._oldout = sys.stdout - self._olderr = sys.stderr - self._oldin = sys.stdin - if out and not hasattr(out, 'file'): - out = TextIO() - self.out = out - if err: - if mixed: - err = out - elif not hasattr(err, 'write'): - err = TextIO() - self.err = err - self.in_ = in_ - if now: - self.startall() - - def startall(self): - if self.out: - sys.stdout = self.out - if self.err: - sys.stderr = self.err - if self.in_: - sys.stdin = self.in_ = DontReadFromInput() - - def done(self, save=True): - """ return (outfile, errfile) and stop capturing. """ - outfile = errfile = None - if self.out and not self.out.closed: - sys.stdout = self._oldout - outfile = self.out - outfile.seek(0) - if self.err and not self.err.closed: - sys.stderr = self._olderr - errfile = self.err - errfile.seek(0) - if self.in_: - sys.stdin = self._oldin - return outfile, errfile - - def resume(self): - """ resume capturing with original temp files. """ - self.startall() - - def readouterr(self): - """ return snapshot value of stdout/stderr capturings. """ - out = err = "" - if self.out: - out = self.out.getvalue() - self.out.truncate(0) - self.out.seek(0) - if self.err: - err = self.err.getvalue() - self.err.truncate(0) - self.err.seek(0) - return out, err - -class DontReadFromInput: - """Temporary stub class. Ideally when stdin is accessed, the - capturing should be turned off, with possibly all data captured - so far sent to the screen. This should be configurable, though, - because in automated test runs it is better to crash than - hang indefinitely. - """ - def read(self, *args): - raise IOError("reading from stdin while output is captured") - readline = read - readlines = read - __iter__ = read - - def fileno(self): - raise ValueError("redirected Stdin is pseudofile, has no fileno()") - def isatty(self): - return False - def close(self): - pass - -try: - devnullpath = os.devnull -except AttributeError: - if os.name == 'nt': - devnullpath = 'NUL' - else: - devnullpath = '/dev/null' diff --git a/lib/spack/external/py/_io/saferepr.py b/lib/spack/external/py/_io/saferepr.py deleted file mode 100644 index 8518290efd..0000000000 --- a/lib/spack/external/py/_io/saferepr.py +++ /dev/null @@ -1,71 +0,0 @@ -import py -import sys - -builtin_repr = repr - -reprlib = py.builtin._tryimport('repr', 'reprlib') - -class SafeRepr(reprlib.Repr): - """ subclass of repr.Repr that limits the resulting size of repr() - and includes information on exceptions raised during the call. - """ - def repr(self, x): - return self._callhelper(reprlib.Repr.repr, self, x) - - def repr_unicode(self, x, level): - # Strictly speaking wrong on narrow builds - def repr(u): - if "'" not in u: - return py.builtin._totext("'%s'") % u - elif '"' not in u: - return py.builtin._totext('"%s"') % u - else: - return py.builtin._totext("'%s'") % u.replace("'", r"\'") - s = repr(x[:self.maxstring]) - if len(s) > self.maxstring: - i = max(0, (self.maxstring-3)//2) - j = max(0, self.maxstring-3-i) - s = repr(x[:i] + x[len(x)-j:]) - s = s[:i] + '...' + s[len(s)-j:] - return s - - def repr_instance(self, x, level): - return self._callhelper(builtin_repr, x) - - def _callhelper(self, call, x, *args): - try: - # Try the vanilla repr and make sure that the result is a string - s = call(x, *args) - except py.builtin._sysex: - raise - except: - cls, e, tb = sys.exc_info() - exc_name = getattr(cls, '__name__', 'unknown') - try: - exc_info = str(e) - except py.builtin._sysex: - raise - except: - exc_info = 'unknown' - return '<[%s("%s") raised in repr()] %s object at 0x%x>' % ( - exc_name, exc_info, x.__class__.__name__, id(x)) - else: - if len(s) > self.maxsize: - i = max(0, (self.maxsize-3)//2) - j = max(0, self.maxsize-3-i) - s = s[:i] + '...' + s[len(s)-j:] - return s - -def saferepr(obj, maxsize=240): - """ return a size-limited safe repr-string for the given object. - Failing __repr__ functions of user instances will be represented - with a short exception info and 'saferepr' generally takes - care to never raise exceptions itself. This function is a wrapper - around the Repr/reprlib functionality of the standard 2.6 lib. - """ - # review exception handling - srepr = SafeRepr() - srepr.maxstring = maxsize - srepr.maxsize = maxsize - srepr.maxother = 160 - return srepr.repr(obj) diff --git a/lib/spack/external/py/_io/terminalwriter.py b/lib/spack/external/py/_io/terminalwriter.py deleted file mode 100644 index 390e8ca7b9..0000000000 --- a/lib/spack/external/py/_io/terminalwriter.py +++ /dev/null @@ -1,357 +0,0 @@ -""" - -Helper functions for writing to terminals and files. - -""" - - -import sys, os -import py -py3k = sys.version_info[0] >= 3 -from py.builtin import text, bytes - -win32_and_ctypes = False -colorama = None -if sys.platform == "win32": - try: - import colorama - except ImportError: - try: - import ctypes - win32_and_ctypes = True - except ImportError: - pass - - -def _getdimensions(): - import termios,fcntl,struct - call = fcntl.ioctl(1,termios.TIOCGWINSZ,"\000"*8) - height,width = struct.unpack( "hhhh", call ) [:2] - return height, width - - -def get_terminal_width(): - height = width = 0 - try: - height, width = _getdimensions() - except py.builtin._sysex: - raise - except: - # pass to fallback below - pass - - if width == 0: - # FALLBACK: - # * some exception happened - # * or this is emacs terminal which reports (0,0) - width = int(os.environ.get('COLUMNS', 80)) - - # XXX the windows getdimensions may be bogus, let's sanify a bit - if width < 40: - width = 80 - return width - -terminal_width = get_terminal_width() - -# XXX unify with _escaped func below -def ansi_print(text, esc, file=None, newline=True, flush=False): - if file is None: - file = sys.stderr - text = text.rstrip() - if esc and not isinstance(esc, tuple): - esc = (esc,) - if esc and sys.platform != "win32" and file.isatty(): - text = (''.join(['\x1b[%sm' % cod for cod in esc]) + - text + - '\x1b[0m') # ANSI color code "reset" - if newline: - text += '\n' - - if esc and win32_and_ctypes and file.isatty(): - if 1 in esc: - bold = True - esc = tuple([x for x in esc if x != 1]) - else: - bold = False - esctable = {() : FOREGROUND_WHITE, # normal - (31,): FOREGROUND_RED, # red - (32,): FOREGROUND_GREEN, # green - (33,): FOREGROUND_GREEN|FOREGROUND_RED, # yellow - (34,): FOREGROUND_BLUE, # blue - (35,): FOREGROUND_BLUE|FOREGROUND_RED, # purple - (36,): FOREGROUND_BLUE|FOREGROUND_GREEN, # cyan - (37,): FOREGROUND_WHITE, # white - (39,): FOREGROUND_WHITE, # reset - } - attr = esctable.get(esc, FOREGROUND_WHITE) - if bold: - attr |= FOREGROUND_INTENSITY - STD_OUTPUT_HANDLE = -11 - STD_ERROR_HANDLE = -12 - if file is sys.stderr: - handle = GetStdHandle(STD_ERROR_HANDLE) - else: - handle = GetStdHandle(STD_OUTPUT_HANDLE) - oldcolors = GetConsoleInfo(handle).wAttributes - attr |= (oldcolors & 0x0f0) - SetConsoleTextAttribute(handle, attr) - while len(text) > 32768: - file.write(text[:32768]) - text = text[32768:] - if text: - file.write(text) - SetConsoleTextAttribute(handle, oldcolors) - else: - file.write(text) - - if flush: - file.flush() - -def should_do_markup(file): - if os.environ.get('PY_COLORS') == '1': - return True - if os.environ.get('PY_COLORS') == '0': - return False - return hasattr(file, 'isatty') and file.isatty() \ - and os.environ.get('TERM') != 'dumb' \ - and not (sys.platform.startswith('java') and os._name == 'nt') - -class TerminalWriter(object): - _esctable = dict(black=30, red=31, green=32, yellow=33, - blue=34, purple=35, cyan=36, white=37, - Black=40, Red=41, Green=42, Yellow=43, - Blue=44, Purple=45, Cyan=46, White=47, - bold=1, light=2, blink=5, invert=7) - - # XXX deprecate stringio argument - def __init__(self, file=None, stringio=False, encoding=None): - if file is None: - if stringio: - self.stringio = file = py.io.TextIO() - else: - file = py.std.sys.stdout - elif py.builtin.callable(file) and not ( - hasattr(file, "write") and hasattr(file, "flush")): - file = WriteFile(file, encoding=encoding) - if hasattr(file, "isatty") and file.isatty() and colorama: - file = colorama.AnsiToWin32(file).stream - self.encoding = encoding or getattr(file, 'encoding', "utf-8") - self._file = file - self.hasmarkup = should_do_markup(file) - self._lastlen = 0 - - @property - def fullwidth(self): - if hasattr(self, '_terminal_width'): - return self._terminal_width - return get_terminal_width() - - @fullwidth.setter - def fullwidth(self, value): - self._terminal_width = value - - def _escaped(self, text, esc): - if esc and self.hasmarkup: - text = (''.join(['\x1b[%sm' % cod for cod in esc]) + - text +'\x1b[0m') - return text - - def markup(self, text, **kw): - esc = [] - for name in kw: - if name not in self._esctable: - raise ValueError("unknown markup: %r" %(name,)) - if kw[name]: - esc.append(self._esctable[name]) - return self._escaped(text, tuple(esc)) - - def sep(self, sepchar, title=None, fullwidth=None, **kw): - if fullwidth is None: - fullwidth = self.fullwidth - # the goal is to have the line be as long as possible - # under the condition that len(line) <= fullwidth - if sys.platform == "win32": - # if we print in the last column on windows we are on a - # new line but there is no way to verify/neutralize this - # (we may not know the exact line width) - # so let's be defensive to avoid empty lines in the output - fullwidth -= 1 - if title is not None: - # we want 2 + 2*len(fill) + len(title) <= fullwidth - # i.e. 2 + 2*len(sepchar)*N + len(title) <= fullwidth - # 2*len(sepchar)*N <= fullwidth - len(title) - 2 - # N <= (fullwidth - len(title) - 2) // (2*len(sepchar)) - N = (fullwidth - len(title) - 2) // (2*len(sepchar)) - fill = sepchar * N - line = "%s %s %s" % (fill, title, fill) - else: - # we want len(sepchar)*N <= fullwidth - # i.e. N <= fullwidth // len(sepchar) - line = sepchar * (fullwidth // len(sepchar)) - # in some situations there is room for an extra sepchar at the right, - # in particular if we consider that with a sepchar like "_ " the - # trailing space is not important at the end of the line - if len(line) + len(sepchar.rstrip()) <= fullwidth: - line += sepchar.rstrip() - - self.line(line, **kw) - - def write(self, msg, **kw): - if msg: - if not isinstance(msg, (bytes, text)): - msg = text(msg) - if self.hasmarkup and kw: - markupmsg = self.markup(msg, **kw) - else: - markupmsg = msg - write_out(self._file, markupmsg) - - def line(self, s='', **kw): - self.write(s, **kw) - self._checkfill(s) - self.write('\n') - - def reline(self, line, **kw): - if not self.hasmarkup: - raise ValueError("cannot use rewrite-line without terminal") - self.write(line, **kw) - self._checkfill(line) - self.write('\r') - self._lastlen = len(line) - - def _checkfill(self, line): - diff2last = self._lastlen - len(line) - if diff2last > 0: - self.write(" " * diff2last) - -class Win32ConsoleWriter(TerminalWriter): - def write(self, msg, **kw): - if msg: - if not isinstance(msg, (bytes, text)): - msg = text(msg) - oldcolors = None - if self.hasmarkup and kw: - handle = GetStdHandle(STD_OUTPUT_HANDLE) - oldcolors = GetConsoleInfo(handle).wAttributes - default_bg = oldcolors & 0x00F0 - attr = default_bg - if kw.pop('bold', False): - attr |= FOREGROUND_INTENSITY - - if kw.pop('red', False): - attr |= FOREGROUND_RED - elif kw.pop('blue', False): - attr |= FOREGROUND_BLUE - elif kw.pop('green', False): - attr |= FOREGROUND_GREEN - elif kw.pop('yellow', False): - attr |= FOREGROUND_GREEN|FOREGROUND_RED - else: - attr |= oldcolors & 0x0007 - - SetConsoleTextAttribute(handle, attr) - write_out(self._file, msg) - if oldcolors: - SetConsoleTextAttribute(handle, oldcolors) - -class WriteFile(object): - def __init__(self, writemethod, encoding=None): - self.encoding = encoding - self._writemethod = writemethod - - def write(self, data): - if self.encoding: - data = data.encode(self.encoding, "replace") - self._writemethod(data) - - def flush(self): - return - - -if win32_and_ctypes: - TerminalWriter = Win32ConsoleWriter - import ctypes - from ctypes import wintypes - - # ctypes access to the Windows console - STD_OUTPUT_HANDLE = -11 - STD_ERROR_HANDLE = -12 - FOREGROUND_BLACK = 0x0000 # black text - FOREGROUND_BLUE = 0x0001 # text color contains blue. - FOREGROUND_GREEN = 0x0002 # text color contains green. - FOREGROUND_RED = 0x0004 # text color contains red. - FOREGROUND_WHITE = 0x0007 - FOREGROUND_INTENSITY = 0x0008 # text color is intensified. - BACKGROUND_BLACK = 0x0000 # background color black - BACKGROUND_BLUE = 0x0010 # background color contains blue. - BACKGROUND_GREEN = 0x0020 # background color contains green. - BACKGROUND_RED = 0x0040 # background color contains red. - BACKGROUND_WHITE = 0x0070 - BACKGROUND_INTENSITY = 0x0080 # background color is intensified. - - SHORT = ctypes.c_short - class COORD(ctypes.Structure): - _fields_ = [('X', SHORT), - ('Y', SHORT)] - class SMALL_RECT(ctypes.Structure): - _fields_ = [('Left', SHORT), - ('Top', SHORT), - ('Right', SHORT), - ('Bottom', SHORT)] - class CONSOLE_SCREEN_BUFFER_INFO(ctypes.Structure): - _fields_ = [('dwSize', COORD), - ('dwCursorPosition', COORD), - ('wAttributes', wintypes.WORD), - ('srWindow', SMALL_RECT), - ('dwMaximumWindowSize', COORD)] - - _GetStdHandle = ctypes.windll.kernel32.GetStdHandle - _GetStdHandle.argtypes = [wintypes.DWORD] - _GetStdHandle.restype = wintypes.HANDLE - def GetStdHandle(kind): - return _GetStdHandle(kind) - - SetConsoleTextAttribute = ctypes.windll.kernel32.SetConsoleTextAttribute - SetConsoleTextAttribute.argtypes = [wintypes.HANDLE, wintypes.WORD] - SetConsoleTextAttribute.restype = wintypes.BOOL - - _GetConsoleScreenBufferInfo = \ - ctypes.windll.kernel32.GetConsoleScreenBufferInfo - _GetConsoleScreenBufferInfo.argtypes = [wintypes.HANDLE, - ctypes.POINTER(CONSOLE_SCREEN_BUFFER_INFO)] - _GetConsoleScreenBufferInfo.restype = wintypes.BOOL - def GetConsoleInfo(handle): - info = CONSOLE_SCREEN_BUFFER_INFO() - _GetConsoleScreenBufferInfo(handle, ctypes.byref(info)) - return info - - def _getdimensions(): - handle = GetStdHandle(STD_OUTPUT_HANDLE) - info = GetConsoleInfo(handle) - # Substract one from the width, otherwise the cursor wraps - # and the ending \n causes an empty line to display. - return info.dwSize.Y, info.dwSize.X - 1 - -def write_out(fil, msg): - # XXX sometimes "msg" is of type bytes, sometimes text which - # complicates the situation. Should we try to enforce unicode? - try: - # on py27 and above writing out to sys.stdout with an encoding - # should usually work for unicode messages (if the encoding is - # capable of it) - fil.write(msg) - except UnicodeEncodeError: - # on py26 it might not work because stdout expects bytes - if fil.encoding: - try: - fil.write(msg.encode(fil.encoding)) - except UnicodeEncodeError: - # it might still fail if the encoding is not capable - pass - else: - fil.flush() - return - # fallback: escape all unicode characters - msg = msg.encode("unicode-escape").decode("ascii") - fil.write(msg) - fil.flush() diff --git a/lib/spack/external/py/_log/__init__.py b/lib/spack/external/py/_log/__init__.py deleted file mode 100644 index fad62e960d..0000000000 --- a/lib/spack/external/py/_log/__init__.py +++ /dev/null @@ -1,2 +0,0 @@ -""" logging API ('producers' and 'consumers' connected via keywords) """ - diff --git a/lib/spack/external/py/_log/log.py b/lib/spack/external/py/_log/log.py deleted file mode 100644 index ce47e8c754..0000000000 --- a/lib/spack/external/py/_log/log.py +++ /dev/null @@ -1,186 +0,0 @@ -""" -basic logging functionality based on a producer/consumer scheme. - -XXX implement this API: (maybe put it into slogger.py?) - - log = Logger( - info=py.log.STDOUT, - debug=py.log.STDOUT, - command=None) - log.info("hello", "world") - log.command("hello", "world") - - log = Logger(info=Logger(something=...), - debug=py.log.STDOUT, - command=None) -""" -import py, sys - -class Message(object): - def __init__(self, keywords, args): - self.keywords = keywords - self.args = args - - def content(self): - return " ".join(map(str, self.args)) - - def prefix(self): - return "[%s] " % (":".join(self.keywords)) - - def __str__(self): - return self.prefix() + self.content() - - -class Producer(object): - """ (deprecated) Log producer API which sends messages to be logged - to a 'consumer' object, which then prints them to stdout, - stderr, files, etc. Used extensively by PyPy-1.1. - """ - - Message = Message # to allow later customization - keywords2consumer = {} - - def __init__(self, keywords, keywordmapper=None, **kw): - if hasattr(keywords, 'split'): - keywords = tuple(keywords.split()) - self._keywords = keywords - if keywordmapper is None: - keywordmapper = default_keywordmapper - self._keywordmapper = keywordmapper - - def __repr__(self): - return "" % ":".join(self._keywords) - - def __getattr__(self, name): - if '_' in name: - raise AttributeError(name) - producer = self.__class__(self._keywords + (name,)) - setattr(self, name, producer) - return producer - - def __call__(self, *args): - """ write a message to the appropriate consumer(s) """ - func = self._keywordmapper.getconsumer(self._keywords) - if func is not None: - func(self.Message(self._keywords, args)) - -class KeywordMapper: - def __init__(self): - self.keywords2consumer = {} - - def getstate(self): - return self.keywords2consumer.copy() - def setstate(self, state): - self.keywords2consumer.clear() - self.keywords2consumer.update(state) - - def getconsumer(self, keywords): - """ return a consumer matching the given keywords. - - tries to find the most suitable consumer by walking, starting from - the back, the list of keywords, the first consumer matching a - keyword is returned (falling back to py.log.default) - """ - for i in range(len(keywords), 0, -1): - try: - return self.keywords2consumer[keywords[:i]] - except KeyError: - continue - return self.keywords2consumer.get('default', default_consumer) - - def setconsumer(self, keywords, consumer): - """ set a consumer for a set of keywords. """ - # normalize to tuples - if isinstance(keywords, str): - keywords = tuple(filter(None, keywords.split())) - elif hasattr(keywords, '_keywords'): - keywords = keywords._keywords - elif not isinstance(keywords, tuple): - raise TypeError("key %r is not a string or tuple" % (keywords,)) - if consumer is not None and not py.builtin.callable(consumer): - if not hasattr(consumer, 'write'): - raise TypeError( - "%r should be None, callable or file-like" % (consumer,)) - consumer = File(consumer) - self.keywords2consumer[keywords] = consumer - -def default_consumer(msg): - """ the default consumer, prints the message to stdout (using 'print') """ - sys.stderr.write(str(msg)+"\n") - -default_keywordmapper = KeywordMapper() - -def setconsumer(keywords, consumer): - default_keywordmapper.setconsumer(keywords, consumer) - -def setstate(state): - default_keywordmapper.setstate(state) -def getstate(): - return default_keywordmapper.getstate() - -# -# Consumers -# - -class File(object): - """ log consumer wrapping a file(-like) object """ - def __init__(self, f): - assert hasattr(f, 'write') - #assert isinstance(f, file) or not hasattr(f, 'open') - self._file = f - - def __call__(self, msg): - """ write a message to the log """ - self._file.write(str(msg) + "\n") - if hasattr(self._file, 'flush'): - self._file.flush() - -class Path(object): - """ log consumer that opens and writes to a Path """ - def __init__(self, filename, append=False, - delayed_create=False, buffering=False): - self._append = append - self._filename = str(filename) - self._buffering = buffering - if not delayed_create: - self._openfile() - - def _openfile(self): - mode = self._append and 'a' or 'w' - f = open(self._filename, mode) - self._file = f - - def __call__(self, msg): - """ write a message to the log """ - if not hasattr(self, "_file"): - self._openfile() - self._file.write(str(msg) + "\n") - if not self._buffering: - self._file.flush() - -def STDOUT(msg): - """ consumer that writes to sys.stdout """ - sys.stdout.write(str(msg)+"\n") - -def STDERR(msg): - """ consumer that writes to sys.stderr """ - sys.stderr.write(str(msg)+"\n") - -class Syslog: - """ consumer that writes to the syslog daemon """ - - def __init__(self, priority = None): - if priority is None: - priority = self.LOG_INFO - self.priority = priority - - def __call__(self, msg): - """ write a message to the log """ - py.std.syslog.syslog(self.priority, str(msg)) - -for _prio in "EMERG ALERT CRIT ERR WARNING NOTICE INFO DEBUG".split(): - _prio = "LOG_" + _prio - try: - setattr(Syslog, _prio, getattr(py.std.syslog, _prio)) - except AttributeError: - pass diff --git a/lib/spack/external/py/_log/warning.py b/lib/spack/external/py/_log/warning.py deleted file mode 100644 index 722e31e910..0000000000 --- a/lib/spack/external/py/_log/warning.py +++ /dev/null @@ -1,76 +0,0 @@ -import py, sys - -class DeprecationWarning(DeprecationWarning): - def __init__(self, msg, path, lineno): - self.msg = msg - self.path = path - self.lineno = lineno - def __repr__(self): - return "%s:%d: %s" %(self.path, self.lineno+1, self.msg) - def __str__(self): - return self.msg - -def _apiwarn(startversion, msg, stacklevel=2, function=None): - # below is mostly COPIED from python2.4/warnings.py's def warn() - # Get context information - if isinstance(stacklevel, str): - frame = sys._getframe(1) - level = 1 - found = frame.f_code.co_filename.find(stacklevel) != -1 - while frame: - co = frame.f_code - if co.co_filename.find(stacklevel) == -1: - if found: - stacklevel = level - break - else: - found = True - level += 1 - frame = frame.f_back - else: - stacklevel = 1 - msg = "%s (since version %s)" %(msg, startversion) - warn(msg, stacklevel=stacklevel+1, function=function) - -def warn(msg, stacklevel=1, function=None): - if function is not None: - filename = py.std.inspect.getfile(function) - lineno = py.code.getrawcode(function).co_firstlineno - else: - try: - caller = sys._getframe(stacklevel) - except ValueError: - globals = sys.__dict__ - lineno = 1 - else: - globals = caller.f_globals - lineno = caller.f_lineno - if '__name__' in globals: - module = globals['__name__'] - else: - module = "" - filename = globals.get('__file__') - if filename: - fnl = filename.lower() - if fnl.endswith(".pyc") or fnl.endswith(".pyo"): - filename = filename[:-1] - elif fnl.endswith("$py.class"): - filename = filename.replace('$py.class', '.py') - else: - if module == "__main__": - try: - filename = sys.argv[0] - except AttributeError: - # embedded interpreters don't have sys.argv, see bug #839151 - filename = '__main__' - if not filename: - filename = module - path = py.path.local(filename) - warning = DeprecationWarning(msg, path, lineno) - py.std.warnings.warn_explicit(warning, category=Warning, - filename=str(warning.path), - lineno=warning.lineno, - registry=py.std.warnings.__dict__.setdefault( - "__warningsregistry__", {}) - ) - diff --git a/lib/spack/external/py/_path/__init__.py b/lib/spack/external/py/_path/__init__.py deleted file mode 100644 index 51f3246f80..0000000000 --- a/lib/spack/external/py/_path/__init__.py +++ /dev/null @@ -1 +0,0 @@ -""" unified file system api """ diff --git a/lib/spack/external/py/_path/cacheutil.py b/lib/spack/external/py/_path/cacheutil.py deleted file mode 100644 index 9922504750..0000000000 --- a/lib/spack/external/py/_path/cacheutil.py +++ /dev/null @@ -1,114 +0,0 @@ -""" -This module contains multithread-safe cache implementations. - -All Caches have - - getorbuild(key, builder) - delentry(key) - -methods and allow configuration when instantiating the cache class. -""" -from time import time as gettime - -class BasicCache(object): - def __init__(self, maxentries=128): - self.maxentries = maxentries - self.prunenum = int(maxentries - maxentries/8) - self._dict = {} - - def clear(self): - self._dict.clear() - - def _getentry(self, key): - return self._dict[key] - - def _putentry(self, key, entry): - self._prunelowestweight() - self._dict[key] = entry - - def delentry(self, key, raising=False): - try: - del self._dict[key] - except KeyError: - if raising: - raise - - def getorbuild(self, key, builder): - try: - entry = self._getentry(key) - except KeyError: - entry = self._build(key, builder) - self._putentry(key, entry) - return entry.value - - def _prunelowestweight(self): - """ prune out entries with lowest weight. """ - numentries = len(self._dict) - if numentries >= self.maxentries: - # evict according to entry's weight - items = [(entry.weight, key) - for key, entry in self._dict.items()] - items.sort() - index = numentries - self.prunenum - if index > 0: - for weight, key in items[:index]: - # in MT situations the element might be gone - self.delentry(key, raising=False) - -class BuildcostAccessCache(BasicCache): - """ A BuildTime/Access-counting cache implementation. - the weight of a value is computed as the product of - - num-accesses-of-a-value * time-to-build-the-value - - The values with the least such weights are evicted - if the cache maxentries threshold is superceded. - For implementation flexibility more than one object - might be evicted at a time. - """ - # time function to use for measuring build-times - - def _build(self, key, builder): - start = gettime() - val = builder() - end = gettime() - return WeightedCountingEntry(val, end-start) - - -class WeightedCountingEntry(object): - def __init__(self, value, oneweight): - self._value = value - self.weight = self._oneweight = oneweight - - def value(self): - self.weight += self._oneweight - return self._value - value = property(value) - -class AgingCache(BasicCache): - """ This cache prunes out cache entries that are too old. - """ - def __init__(self, maxentries=128, maxseconds=10.0): - super(AgingCache, self).__init__(maxentries) - self.maxseconds = maxseconds - - def _getentry(self, key): - entry = self._dict[key] - if entry.isexpired(): - self.delentry(key) - raise KeyError(key) - return entry - - def _build(self, key, builder): - val = builder() - entry = AgingEntry(val, gettime() + self.maxseconds) - return entry - -class AgingEntry(object): - def __init__(self, value, expirationtime): - self.value = value - self.weight = expirationtime - - def isexpired(self): - t = gettime() - return t >= self.weight diff --git a/lib/spack/external/py/_path/common.py b/lib/spack/external/py/_path/common.py deleted file mode 100644 index 5512e51efe..0000000000 --- a/lib/spack/external/py/_path/common.py +++ /dev/null @@ -1,445 +0,0 @@ -""" -""" -import os, sys, posixpath -import fnmatch -import py - -# Moved from local.py. -iswin32 = sys.platform == "win32" or (getattr(os, '_name', False) == 'nt') - -try: - from os import fspath -except ImportError: - def fspath(path): - """ - Return the string representation of the path. - If str or bytes is passed in, it is returned unchanged. - This code comes from PEP 519, modified to support earlier versions of - python. - - This is required for python < 3.6. - """ - if isinstance(path, (py.builtin.text, py.builtin.bytes)): - return path - - # Work from the object's type to match method resolution of other magic - # methods. - path_type = type(path) - try: - return path_type.__fspath__(path) - except AttributeError: - if hasattr(path_type, '__fspath__'): - raise - try: - import pathlib - except ImportError: - pass - else: - if isinstance(path, pathlib.PurePath): - return py.builtin.text(path) - - raise TypeError("expected str, bytes or os.PathLike object, not " - + path_type.__name__) - -class Checkers: - _depend_on_existence = 'exists', 'link', 'dir', 'file' - - def __init__(self, path): - self.path = path - - def dir(self): - raise NotImplementedError - - def file(self): - raise NotImplementedError - - def dotfile(self): - return self.path.basename.startswith('.') - - def ext(self, arg): - if not arg.startswith('.'): - arg = '.' + arg - return self.path.ext == arg - - def exists(self): - raise NotImplementedError - - def basename(self, arg): - return self.path.basename == arg - - def basestarts(self, arg): - return self.path.basename.startswith(arg) - - def relto(self, arg): - return self.path.relto(arg) - - def fnmatch(self, arg): - return self.path.fnmatch(arg) - - def endswith(self, arg): - return str(self.path).endswith(arg) - - def _evaluate(self, kw): - for name, value in kw.items(): - invert = False - meth = None - try: - meth = getattr(self, name) - except AttributeError: - if name[:3] == 'not': - invert = True - try: - meth = getattr(self, name[3:]) - except AttributeError: - pass - if meth is None: - raise TypeError( - "no %r checker available for %r" % (name, self.path)) - try: - if py.code.getrawcode(meth).co_argcount > 1: - if (not meth(value)) ^ invert: - return False - else: - if bool(value) ^ bool(meth()) ^ invert: - return False - except (py.error.ENOENT, py.error.ENOTDIR, py.error.EBUSY): - # EBUSY feels not entirely correct, - # but its kind of necessary since ENOMEDIUM - # is not accessible in python - for name in self._depend_on_existence: - if name in kw: - if kw.get(name): - return False - name = 'not' + name - if name in kw: - if not kw.get(name): - return False - return True - -class NeverRaised(Exception): - pass - -class PathBase(object): - """ shared implementation for filesystem path objects.""" - Checkers = Checkers - - def __div__(self, other): - return self.join(fspath(other)) - __truediv__ = __div__ # py3k - - def basename(self): - """ basename part of path. """ - return self._getbyspec('basename')[0] - basename = property(basename, None, None, basename.__doc__) - - def dirname(self): - """ dirname part of path. """ - return self._getbyspec('dirname')[0] - dirname = property(dirname, None, None, dirname.__doc__) - - def purebasename(self): - """ pure base name of the path.""" - return self._getbyspec('purebasename')[0] - purebasename = property(purebasename, None, None, purebasename.__doc__) - - def ext(self): - """ extension of the path (including the '.').""" - return self._getbyspec('ext')[0] - ext = property(ext, None, None, ext.__doc__) - - def dirpath(self, *args, **kwargs): - """ return the directory path joined with any given path arguments. """ - return self.new(basename='').join(*args, **kwargs) - - def read_binary(self): - """ read and return a bytestring from reading the path. """ - with self.open('rb') as f: - return f.read() - - def read_text(self, encoding): - """ read and return a Unicode string from reading the path. """ - with self.open("r", encoding=encoding) as f: - return f.read() - - - def read(self, mode='r'): - """ read and return a bytestring from reading the path. """ - with self.open(mode) as f: - return f.read() - - def readlines(self, cr=1): - """ read and return a list of lines from the path. if cr is False, the -newline will be removed from the end of each line. """ - if sys.version_info < (3, ): - mode = 'rU' - else: # python 3 deprecates mode "U" in favor of "newline" option - mode = 'r' - - if not cr: - content = self.read(mode) - return content.split('\n') - else: - f = self.open(mode) - try: - return f.readlines() - finally: - f.close() - - def load(self): - """ (deprecated) return object unpickled from self.read() """ - f = self.open('rb') - try: - return py.error.checked_call(py.std.pickle.load, f) - finally: - f.close() - - def move(self, target): - """ move this path to target. """ - if target.relto(self): - raise py.error.EINVAL(target, - "cannot move path into a subdirectory of itself") - try: - self.rename(target) - except py.error.EXDEV: # invalid cross-device link - self.copy(target) - self.remove() - - def __repr__(self): - """ return a string representation of this path. """ - return repr(str(self)) - - def check(self, **kw): - """ check a path for existence and properties. - - Without arguments, return True if the path exists, otherwise False. - - valid checkers:: - - file=1 # is a file - file=0 # is not a file (may not even exist) - dir=1 # is a dir - link=1 # is a link - exists=1 # exists - - You can specify multiple checker definitions, for example:: - - path.check(file=1, link=1) # a link pointing to a file - """ - if not kw: - kw = {'exists' : 1} - return self.Checkers(self)._evaluate(kw) - - def fnmatch(self, pattern): - """return true if the basename/fullname matches the glob-'pattern'. - - valid pattern characters:: - - * matches everything - ? matches any single character - [seq] matches any character in seq - [!seq] matches any char not in seq - - If the pattern contains a path-separator then the full path - is used for pattern matching and a '*' is prepended to the - pattern. - - if the pattern doesn't contain a path-separator the pattern - is only matched against the basename. - """ - return FNMatcher(pattern)(self) - - def relto(self, relpath): - """ return a string which is the relative part of the path - to the given 'relpath'. - """ - if not isinstance(relpath, (str, PathBase)): - raise TypeError("%r: not a string or path object" %(relpath,)) - strrelpath = str(relpath) - if strrelpath and strrelpath[-1] != self.sep: - strrelpath += self.sep - #assert strrelpath[-1] == self.sep - #assert strrelpath[-2] != self.sep - strself = self.strpath - if sys.platform == "win32" or getattr(os, '_name', None) == 'nt': - if os.path.normcase(strself).startswith( - os.path.normcase(strrelpath)): - return strself[len(strrelpath):] - elif strself.startswith(strrelpath): - return strself[len(strrelpath):] - return "" - - def ensure_dir(self, *args): - """ ensure the path joined with args is a directory. """ - return self.ensure(*args, **{"dir": True}) - - def bestrelpath(self, dest): - """ return a string which is a relative path from self - (assumed to be a directory) to dest such that - self.join(bestrelpath) == dest and if not such - path can be determined return dest. - """ - try: - if self == dest: - return os.curdir - base = self.common(dest) - if not base: # can be the case on windows - return str(dest) - self2base = self.relto(base) - reldest = dest.relto(base) - if self2base: - n = self2base.count(self.sep) + 1 - else: - n = 0 - l = [os.pardir] * n - if reldest: - l.append(reldest) - target = dest.sep.join(l) - return target - except AttributeError: - return str(dest) - - def exists(self): - return self.check() - - def isdir(self): - return self.check(dir=1) - - def isfile(self): - return self.check(file=1) - - def parts(self, reverse=False): - """ return a root-first list of all ancestor directories - plus the path itself. - """ - current = self - l = [self] - while 1: - last = current - current = current.dirpath() - if last == current: - break - l.append(current) - if not reverse: - l.reverse() - return l - - def common(self, other): - """ return the common part shared with the other path - or None if there is no common part. - """ - last = None - for x, y in zip(self.parts(), other.parts()): - if x != y: - return last - last = x - return last - - def __add__(self, other): - """ return new path object with 'other' added to the basename""" - return self.new(basename=self.basename+str(other)) - - def __cmp__(self, other): - """ return sort value (-1, 0, +1). """ - try: - return cmp(self.strpath, other.strpath) - except AttributeError: - return cmp(str(self), str(other)) # self.path, other.path) - - def __lt__(self, other): - try: - return self.strpath < other.strpath - except AttributeError: - return str(self) < str(other) - - def visit(self, fil=None, rec=None, ignore=NeverRaised, bf=False, sort=False): - """ yields all paths below the current one - - fil is a filter (glob pattern or callable), if not matching the - path will not be yielded, defaulting to None (everything is - returned) - - rec is a filter (glob pattern or callable) that controls whether - a node is descended, defaulting to None - - ignore is an Exception class that is ignoredwhen calling dirlist() - on any of the paths (by default, all exceptions are reported) - - bf if True will cause a breadthfirst search instead of the - default depthfirst. Default: False - - sort if True will sort entries within each directory level. - """ - for x in Visitor(fil, rec, ignore, bf, sort).gen(self): - yield x - - def _sortlist(self, res, sort): - if sort: - if hasattr(sort, '__call__'): - res.sort(sort) - else: - res.sort() - - def samefile(self, other): - """ return True if other refers to the same stat object as self. """ - return self.strpath == str(other) - - def __fspath__(self): - return self.strpath - -class Visitor: - def __init__(self, fil, rec, ignore, bf, sort): - if isinstance(fil, py.builtin._basestring): - fil = FNMatcher(fil) - if isinstance(rec, py.builtin._basestring): - self.rec = FNMatcher(rec) - elif not hasattr(rec, '__call__') and rec: - self.rec = lambda path: True - else: - self.rec = rec - self.fil = fil - self.ignore = ignore - self.breadthfirst = bf - self.optsort = sort and sorted or (lambda x: x) - - def gen(self, path): - try: - entries = path.listdir() - except self.ignore: - return - rec = self.rec - dirs = self.optsort([p for p in entries - if p.check(dir=1) and (rec is None or rec(p))]) - if not self.breadthfirst: - for subdir in dirs: - for p in self.gen(subdir): - yield p - for p in self.optsort(entries): - if self.fil is None or self.fil(p): - yield p - if self.breadthfirst: - for subdir in dirs: - for p in self.gen(subdir): - yield p - -class FNMatcher: - def __init__(self, pattern): - self.pattern = pattern - - def __call__(self, path): - pattern = self.pattern - - if (pattern.find(path.sep) == -1 and - iswin32 and - pattern.find(posixpath.sep) != -1): - # Running on Windows, the pattern has no Windows path separators, - # and the pattern has one or more Posix path separators. Replace - # the Posix path separators with the Windows path separator. - pattern = pattern.replace(posixpath.sep, path.sep) - - if pattern.find(path.sep) == -1: - name = path.basename - else: - name = str(path) # path.strpath # XXX svn? - if not os.path.isabs(pattern): - pattern = '*' + path.sep + pattern - return fnmatch.fnmatch(name, pattern) diff --git a/lib/spack/external/py/_path/local.py b/lib/spack/external/py/_path/local.py deleted file mode 100644 index d2f16b993e..0000000000 --- a/lib/spack/external/py/_path/local.py +++ /dev/null @@ -1,930 +0,0 @@ -""" -local path implementation. -""" -from __future__ import with_statement - -from contextlib import contextmanager -import sys, os, re, atexit, io -import py -from py._path import common -from py._path.common import iswin32, fspath -from stat import S_ISLNK, S_ISDIR, S_ISREG - -from os.path import abspath, normpath, isabs, exists, isdir, isfile, islink, dirname - -if sys.version_info > (3,0): - def map_as_list(func, iter): - return list(map(func, iter)) -else: - map_as_list = map - -class Stat(object): - def __getattr__(self, name): - return getattr(self._osstatresult, "st_" + name) - - def __init__(self, path, osstatresult): - self.path = path - self._osstatresult = osstatresult - - @property - def owner(self): - if iswin32: - raise NotImplementedError("XXX win32") - import pwd - entry = py.error.checked_call(pwd.getpwuid, self.uid) - return entry[0] - - @property - def group(self): - """ return group name of file. """ - if iswin32: - raise NotImplementedError("XXX win32") - import grp - entry = py.error.checked_call(grp.getgrgid, self.gid) - return entry[0] - - def isdir(self): - return S_ISDIR(self._osstatresult.st_mode) - - def isfile(self): - return S_ISREG(self._osstatresult.st_mode) - - def islink(self): - st = self.path.lstat() - return S_ISLNK(self._osstatresult.st_mode) - -class PosixPath(common.PathBase): - def chown(self, user, group, rec=0): - """ change ownership to the given user and group. - user and group may be specified by a number or - by a name. if rec is True change ownership - recursively. - """ - uid = getuserid(user) - gid = getgroupid(group) - if rec: - for x in self.visit(rec=lambda x: x.check(link=0)): - if x.check(link=0): - py.error.checked_call(os.chown, str(x), uid, gid) - py.error.checked_call(os.chown, str(self), uid, gid) - - def readlink(self): - """ return value of a symbolic link. """ - return py.error.checked_call(os.readlink, self.strpath) - - def mklinkto(self, oldname): - """ posix style hard link to another name. """ - py.error.checked_call(os.link, str(oldname), str(self)) - - def mksymlinkto(self, value, absolute=1): - """ create a symbolic link with the given value (pointing to another name). """ - if absolute: - py.error.checked_call(os.symlink, str(value), self.strpath) - else: - base = self.common(value) - # with posix local paths '/' is always a common base - relsource = self.__class__(value).relto(base) - reldest = self.relto(base) - n = reldest.count(self.sep) - target = self.sep.join(('..', )*n + (relsource, )) - py.error.checked_call(os.symlink, target, self.strpath) - -def getuserid(user): - import pwd - if not isinstance(user, int): - user = pwd.getpwnam(user)[2] - return user - -def getgroupid(group): - import grp - if not isinstance(group, int): - group = grp.getgrnam(group)[2] - return group - -FSBase = not iswin32 and PosixPath or common.PathBase - -class LocalPath(FSBase): - """ object oriented interface to os.path and other local filesystem - related information. - """ - class ImportMismatchError(ImportError): - """ raised on pyimport() if there is a mismatch of __file__'s""" - - sep = os.sep - class Checkers(common.Checkers): - def _stat(self): - try: - return self._statcache - except AttributeError: - try: - self._statcache = self.path.stat() - except py.error.ELOOP: - self._statcache = self.path.lstat() - return self._statcache - - def dir(self): - return S_ISDIR(self._stat().mode) - - def file(self): - return S_ISREG(self._stat().mode) - - def exists(self): - return self._stat() - - def link(self): - st = self.path.lstat() - return S_ISLNK(st.mode) - - def __init__(self, path=None, expanduser=False): - """ Initialize and return a local Path instance. - - Path can be relative to the current directory. - If path is None it defaults to the current working directory. - If expanduser is True, tilde-expansion is performed. - Note that Path instances always carry an absolute path. - Note also that passing in a local path object will simply return - the exact same path object. Use new() to get a new copy. - """ - if path is None: - self.strpath = py.error.checked_call(os.getcwd) - else: - try: - path = fspath(path) - except TypeError: - raise ValueError("can only pass None, Path instances " - "or non-empty strings to LocalPath") - if expanduser: - path = os.path.expanduser(path) - self.strpath = abspath(path) - - def __hash__(self): - return hash(self.strpath) - - def __eq__(self, other): - s1 = fspath(self) - try: - s2 = fspath(other) - except TypeError: - return False - if iswin32: - s1 = s1.lower() - try: - s2 = s2.lower() - except AttributeError: - return False - return s1 == s2 - - def __ne__(self, other): - return not (self == other) - - def __lt__(self, other): - return fspath(self) < fspath(other) - - def __gt__(self, other): - return fspath(self) > fspath(other) - - def samefile(self, other): - """ return True if 'other' references the same file as 'self'. - """ - other = fspath(other) - if not isabs(other): - other = abspath(other) - if self == other: - return True - if iswin32: - return False # there is no samefile - return py.error.checked_call( - os.path.samefile, self.strpath, other) - - def remove(self, rec=1, ignore_errors=False): - """ remove a file or directory (or a directory tree if rec=1). - if ignore_errors is True, errors while removing directories will - be ignored. - """ - if self.check(dir=1, link=0): - if rec: - # force remove of readonly files on windows - if iswin32: - self.chmod(0o700, rec=1) - py.error.checked_call(py.std.shutil.rmtree, self.strpath, - ignore_errors=ignore_errors) - else: - py.error.checked_call(os.rmdir, self.strpath) - else: - if iswin32: - self.chmod(0o700) - py.error.checked_call(os.remove, self.strpath) - - def computehash(self, hashtype="md5", chunksize=524288): - """ return hexdigest of hashvalue for this file. """ - try: - try: - import hashlib as mod - except ImportError: - if hashtype == "sha1": - hashtype = "sha" - mod = __import__(hashtype) - hash = getattr(mod, hashtype)() - except (AttributeError, ImportError): - raise ValueError("Don't know how to compute %r hash" %(hashtype,)) - f = self.open('rb') - try: - while 1: - buf = f.read(chunksize) - if not buf: - return hash.hexdigest() - hash.update(buf) - finally: - f.close() - - def new(self, **kw): - """ create a modified version of this path. - the following keyword arguments modify various path parts:: - - a:/some/path/to/a/file.ext - xx drive - xxxxxxxxxxxxxxxxx dirname - xxxxxxxx basename - xxxx purebasename - xxx ext - """ - obj = object.__new__(self.__class__) - if not kw: - obj.strpath = self.strpath - return obj - drive, dirname, basename, purebasename,ext = self._getbyspec( - "drive,dirname,basename,purebasename,ext") - if 'basename' in kw: - if 'purebasename' in kw or 'ext' in kw: - raise ValueError("invalid specification %r" % kw) - else: - pb = kw.setdefault('purebasename', purebasename) - try: - ext = kw['ext'] - except KeyError: - pass - else: - if ext and not ext.startswith('.'): - ext = '.' + ext - kw['basename'] = pb + ext - - if ('dirname' in kw and not kw['dirname']): - kw['dirname'] = drive - else: - kw.setdefault('dirname', dirname) - kw.setdefault('sep', self.sep) - obj.strpath = normpath( - "%(dirname)s%(sep)s%(basename)s" % kw) - return obj - - def _getbyspec(self, spec): - """ see new for what 'spec' can be. """ - res = [] - parts = self.strpath.split(self.sep) - - args = filter(None, spec.split(',') ) - append = res.append - for name in args: - if name == 'drive': - append(parts[0]) - elif name == 'dirname': - append(self.sep.join(parts[:-1])) - else: - basename = parts[-1] - if name == 'basename': - append(basename) - else: - i = basename.rfind('.') - if i == -1: - purebasename, ext = basename, '' - else: - purebasename, ext = basename[:i], basename[i:] - if name == 'purebasename': - append(purebasename) - elif name == 'ext': - append(ext) - else: - raise ValueError("invalid part specification %r" % name) - return res - - def dirpath(self, *args, **kwargs): - """ return the directory path joined with any given path arguments. """ - if not kwargs: - path = object.__new__(self.__class__) - path.strpath = dirname(self.strpath) - if args: - path = path.join(*args) - return path - return super(LocalPath, self).dirpath(*args, **kwargs) - - def join(self, *args, **kwargs): - """ return a new path by appending all 'args' as path - components. if abs=1 is used restart from root if any - of the args is an absolute path. - """ - sep = self.sep - strargs = [fspath(arg) for arg in args] - strpath = self.strpath - if kwargs.get('abs'): - newargs = [] - for arg in reversed(strargs): - if isabs(arg): - strpath = arg - strargs = newargs - break - newargs.insert(0, arg) - for arg in strargs: - arg = arg.strip(sep) - if iswin32: - # allow unix style paths even on windows. - arg = arg.strip('/') - arg = arg.replace('/', sep) - strpath = strpath + sep + arg - obj = object.__new__(self.__class__) - obj.strpath = normpath(strpath) - return obj - - def open(self, mode='r', ensure=False, encoding=None): - """ return an opened file with the given mode. - - If ensure is True, create parent directories if needed. - """ - if ensure: - self.dirpath().ensure(dir=1) - if encoding: - return py.error.checked_call(io.open, self.strpath, mode, encoding=encoding) - return py.error.checked_call(open, self.strpath, mode) - - def _fastjoin(self, name): - child = object.__new__(self.__class__) - child.strpath = self.strpath + self.sep + name - return child - - def islink(self): - return islink(self.strpath) - - def check(self, **kw): - if not kw: - return exists(self.strpath) - if len(kw) == 1: - if "dir" in kw: - return not kw["dir"] ^ isdir(self.strpath) - if "file" in kw: - return not kw["file"] ^ isfile(self.strpath) - return super(LocalPath, self).check(**kw) - - _patternchars = set("*?[" + os.path.sep) - def listdir(self, fil=None, sort=None): - """ list directory contents, possibly filter by the given fil func - and possibly sorted. - """ - if fil is None and sort is None: - names = py.error.checked_call(os.listdir, self.strpath) - return map_as_list(self._fastjoin, names) - if isinstance(fil, py.builtin._basestring): - if not self._patternchars.intersection(fil): - child = self._fastjoin(fil) - if exists(child.strpath): - return [child] - return [] - fil = common.FNMatcher(fil) - names = py.error.checked_call(os.listdir, self.strpath) - res = [] - for name in names: - child = self._fastjoin(name) - if fil is None or fil(child): - res.append(child) - self._sortlist(res, sort) - return res - - def size(self): - """ return size of the underlying file object """ - return self.stat().size - - def mtime(self): - """ return last modification time of the path. """ - return self.stat().mtime - - def copy(self, target, mode=False, stat=False): - """ copy path to target. - - If mode is True, will copy copy permission from path to target. - If stat is True, copy permission, last modification - time, last access time, and flags from path to target. - """ - if self.check(file=1): - if target.check(dir=1): - target = target.join(self.basename) - assert self!=target - copychunked(self, target) - if mode: - copymode(self.strpath, target.strpath) - if stat: - copystat(self, target) - else: - def rec(p): - return p.check(link=0) - for x in self.visit(rec=rec): - relpath = x.relto(self) - newx = target.join(relpath) - newx.dirpath().ensure(dir=1) - if x.check(link=1): - newx.mksymlinkto(x.readlink()) - continue - elif x.check(file=1): - copychunked(x, newx) - elif x.check(dir=1): - newx.ensure(dir=1) - if mode: - copymode(x.strpath, newx.strpath) - if stat: - copystat(x, newx) - - def rename(self, target): - """ rename this path to target. """ - target = fspath(target) - return py.error.checked_call(os.rename, self.strpath, target) - - def dump(self, obj, bin=1): - """ pickle object into path location""" - f = self.open('wb') - try: - py.error.checked_call(py.std.pickle.dump, obj, f, bin) - finally: - f.close() - - def mkdir(self, *args): - """ create & return the directory joined with args. """ - p = self.join(*args) - py.error.checked_call(os.mkdir, fspath(p)) - return p - - def write_binary(self, data, ensure=False): - """ write binary data into path. If ensure is True create - missing parent directories. - """ - if ensure: - self.dirpath().ensure(dir=1) - with self.open('wb') as f: - f.write(data) - - def write_text(self, data, encoding, ensure=False): - """ write text data into path using the specified encoding. - If ensure is True create missing parent directories. - """ - if ensure: - self.dirpath().ensure(dir=1) - with self.open('w', encoding=encoding) as f: - f.write(data) - - def write(self, data, mode='w', ensure=False): - """ write data into path. If ensure is True create - missing parent directories. - """ - if ensure: - self.dirpath().ensure(dir=1) - if 'b' in mode: - if not py.builtin._isbytes(data): - raise ValueError("can only process bytes") - else: - if not py.builtin._istext(data): - if not py.builtin._isbytes(data): - data = str(data) - else: - data = py.builtin._totext(data, sys.getdefaultencoding()) - f = self.open(mode) - try: - f.write(data) - finally: - f.close() - - def _ensuredirs(self): - parent = self.dirpath() - if parent == self: - return self - if parent.check(dir=0): - parent._ensuredirs() - if self.check(dir=0): - try: - self.mkdir() - except py.error.EEXIST: - # race condition: file/dir created by another thread/process. - # complain if it is not a dir - if self.check(dir=0): - raise - return self - - def ensure(self, *args, **kwargs): - """ ensure that an args-joined path exists (by default as - a file). if you specify a keyword argument 'dir=True' - then the path is forced to be a directory path. - """ - p = self.join(*args) - if kwargs.get('dir', 0): - return p._ensuredirs() - else: - p.dirpath()._ensuredirs() - if not p.check(file=1): - p.open('w').close() - return p - - def stat(self, raising=True): - """ Return an os.stat() tuple. """ - if raising == True: - return Stat(self, py.error.checked_call(os.stat, self.strpath)) - try: - return Stat(self, os.stat(self.strpath)) - except KeyboardInterrupt: - raise - except Exception: - return None - - def lstat(self): - """ Return an os.lstat() tuple. """ - return Stat(self, py.error.checked_call(os.lstat, self.strpath)) - - def setmtime(self, mtime=None): - """ set modification time for the given path. if 'mtime' is None - (the default) then the file's mtime is set to current time. - - Note that the resolution for 'mtime' is platform dependent. - """ - if mtime is None: - return py.error.checked_call(os.utime, self.strpath, mtime) - try: - return py.error.checked_call(os.utime, self.strpath, (-1, mtime)) - except py.error.EINVAL: - return py.error.checked_call(os.utime, self.strpath, (self.atime(), mtime)) - - def chdir(self): - """ change directory to self and return old current directory """ - try: - old = self.__class__() - except py.error.ENOENT: - old = None - py.error.checked_call(os.chdir, self.strpath) - return old - - - @contextmanager - def as_cwd(self): - """ return context manager which changes to current dir during the - managed "with" context. On __enter__ it returns the old dir. - """ - old = self.chdir() - try: - yield old - finally: - old.chdir() - - def realpath(self): - """ return a new path which contains no symbolic links.""" - return self.__class__(os.path.realpath(self.strpath)) - - def atime(self): - """ return last access time of the path. """ - return self.stat().atime - - def __repr__(self): - return 'local(%r)' % self.strpath - - def __str__(self): - """ return string representation of the Path. """ - return self.strpath - - def chmod(self, mode, rec=0): - """ change permissions to the given mode. If mode is an - integer it directly encodes the os-specific modes. - if rec is True perform recursively. - """ - if not isinstance(mode, int): - raise TypeError("mode %r must be an integer" % (mode,)) - if rec: - for x in self.visit(rec=rec): - py.error.checked_call(os.chmod, str(x), mode) - py.error.checked_call(os.chmod, self.strpath, mode) - - def pypkgpath(self): - """ return the Python package path by looking for the last - directory upwards which still contains an __init__.py. - Return None if a pkgpath can not be determined. - """ - pkgpath = None - for parent in self.parts(reverse=True): - if parent.isdir(): - if not parent.join('__init__.py').exists(): - break - if not isimportable(parent.basename): - break - pkgpath = parent - return pkgpath - - def _ensuresyspath(self, ensuremode, path): - if ensuremode: - s = str(path) - if ensuremode == "append": - if s not in sys.path: - sys.path.append(s) - else: - if s != sys.path[0]: - sys.path.insert(0, s) - - def pyimport(self, modname=None, ensuresyspath=True): - """ return path as an imported python module. - - If modname is None, look for the containing package - and construct an according module name. - The module will be put/looked up in sys.modules. - if ensuresyspath is True then the root dir for importing - the file (taking __init__.py files into account) will - be prepended to sys.path if it isn't there already. - If ensuresyspath=="append" the root dir will be appended - if it isn't already contained in sys.path. - if ensuresyspath is False no modification of syspath happens. - """ - if not self.check(): - raise py.error.ENOENT(self) - - pkgpath = None - if modname is None: - pkgpath = self.pypkgpath() - if pkgpath is not None: - pkgroot = pkgpath.dirpath() - names = self.new(ext="").relto(pkgroot).split(self.sep) - if names[-1] == "__init__": - names.pop() - modname = ".".join(names) - else: - pkgroot = self.dirpath() - modname = self.purebasename - - self._ensuresyspath(ensuresyspath, pkgroot) - __import__(modname) - mod = sys.modules[modname] - if self.basename == "__init__.py": - return mod # we don't check anything as we might - # we in a namespace package ... too icky to check - modfile = mod.__file__ - if modfile[-4:] in ('.pyc', '.pyo'): - modfile = modfile[:-1] - elif modfile.endswith('$py.class'): - modfile = modfile[:-9] + '.py' - if modfile.endswith(os.path.sep + "__init__.py"): - if self.basename != "__init__.py": - modfile = modfile[:-12] - try: - issame = self.samefile(modfile) - except py.error.ENOENT: - issame = False - if not issame: - raise self.ImportMismatchError(modname, modfile, self) - return mod - else: - try: - return sys.modules[modname] - except KeyError: - # we have a custom modname, do a pseudo-import - mod = py.std.types.ModuleType(modname) - mod.__file__ = str(self) - sys.modules[modname] = mod - try: - py.builtin.execfile(str(self), mod.__dict__) - except: - del sys.modules[modname] - raise - return mod - - def sysexec(self, *argv, **popen_opts): - """ return stdout text from executing a system child process, - where the 'self' path points to executable. - The process is directly invoked and not through a system shell. - """ - from subprocess import Popen, PIPE - argv = map_as_list(str, argv) - popen_opts['stdout'] = popen_opts['stderr'] = PIPE - proc = Popen([str(self)] + argv, **popen_opts) - stdout, stderr = proc.communicate() - ret = proc.wait() - if py.builtin._isbytes(stdout): - stdout = py.builtin._totext(stdout, sys.getdefaultencoding()) - if ret != 0: - if py.builtin._isbytes(stderr): - stderr = py.builtin._totext(stderr, sys.getdefaultencoding()) - raise py.process.cmdexec.Error(ret, ret, str(self), - stdout, stderr,) - return stdout - - def sysfind(cls, name, checker=None, paths=None): - """ return a path object found by looking at the systems - underlying PATH specification. If the checker is not None - it will be invoked to filter matching paths. If a binary - cannot be found, None is returned - Note: This is probably not working on plain win32 systems - but may work on cygwin. - """ - if isabs(name): - p = py.path.local(name) - if p.check(file=1): - return p - else: - if paths is None: - if iswin32: - paths = py.std.os.environ['Path'].split(';') - if '' not in paths and '.' not in paths: - paths.append('.') - try: - systemroot = os.environ['SYSTEMROOT'] - except KeyError: - pass - else: - paths = [re.sub('%SystemRoot%', systemroot, path) - for path in paths] - else: - paths = py.std.os.environ['PATH'].split(':') - tryadd = [] - if iswin32: - tryadd += os.environ['PATHEXT'].split(os.pathsep) - tryadd.append("") - - for x in paths: - for addext in tryadd: - p = py.path.local(x).join(name, abs=True) + addext - try: - if p.check(file=1): - if checker: - if not checker(p): - continue - return p - except py.error.EACCES: - pass - return None - sysfind = classmethod(sysfind) - - def _gethomedir(cls): - try: - x = os.environ['HOME'] - except KeyError: - try: - x = os.environ["HOMEDRIVE"] + os.environ['HOMEPATH'] - except KeyError: - return None - return cls(x) - _gethomedir = classmethod(_gethomedir) - - #""" - #special class constructors for local filesystem paths - #""" - def get_temproot(cls): - """ return the system's temporary directory - (where tempfiles are usually created in) - """ - return py.path.local(py.std.tempfile.gettempdir()) - get_temproot = classmethod(get_temproot) - - def mkdtemp(cls, rootdir=None): - """ return a Path object pointing to a fresh new temporary directory - (which we created ourself). - """ - import tempfile - if rootdir is None: - rootdir = cls.get_temproot() - return cls(py.error.checked_call(tempfile.mkdtemp, dir=str(rootdir))) - mkdtemp = classmethod(mkdtemp) - - def make_numbered_dir(cls, prefix='session-', rootdir=None, keep=3, - lock_timeout = 172800): # two days - """ return unique directory with a number greater than the current - maximum one. The number is assumed to start directly after prefix. - if keep is true directories with a number less than (maxnum-keep) - will be removed. - """ - if rootdir is None: - rootdir = cls.get_temproot() - - nprefix = prefix.lower() - def parse_num(path): - """ parse the number out of a path (if it matches the prefix) """ - nbasename = path.basename.lower() - if nbasename.startswith(nprefix): - try: - return int(nbasename[len(nprefix):]) - except ValueError: - pass - - # compute the maximum number currently in use with the - # prefix - lastmax = None - while True: - maxnum = -1 - for path in rootdir.listdir(): - num = parse_num(path) - if num is not None: - maxnum = max(maxnum, num) - - # make the new directory - try: - udir = rootdir.mkdir(prefix + str(maxnum+1)) - except py.error.EEXIST: - # race condition: another thread/process created the dir - # in the meantime. Try counting again - if lastmax == maxnum: - raise - lastmax = maxnum - continue - break - - # put a .lock file in the new directory that will be removed at - # process exit - if lock_timeout: - lockfile = udir.join('.lock') - mypid = os.getpid() - if hasattr(lockfile, 'mksymlinkto'): - lockfile.mksymlinkto(str(mypid)) - else: - lockfile.write(str(mypid)) - def try_remove_lockfile(): - # in a fork() situation, only the last process should - # remove the .lock, otherwise the other processes run the - # risk of seeing their temporary dir disappear. For now - # we remove the .lock in the parent only (i.e. we assume - # that the children finish before the parent). - if os.getpid() != mypid: - return - try: - lockfile.remove() - except py.error.Error: - pass - atexit.register(try_remove_lockfile) - - # prune old directories - if keep: - for path in rootdir.listdir(): - num = parse_num(path) - if num is not None and num <= (maxnum - keep): - lf = path.join('.lock') - try: - t1 = lf.lstat().mtime - t2 = lockfile.lstat().mtime - if not lock_timeout or abs(t2-t1) < lock_timeout: - continue # skip directories still locked - except py.error.Error: - pass # assume that it means that there is no 'lf' - try: - path.remove(rec=1) - except KeyboardInterrupt: - raise - except: # this might be py.error.Error, WindowsError ... - pass - - # make link... - try: - username = os.environ['USER'] #linux, et al - except KeyError: - try: - username = os.environ['USERNAME'] #windows - except KeyError: - username = 'current' - - src = str(udir) - dest = src[:src.rfind('-')] + '-' + username - try: - os.unlink(dest) - except OSError: - pass - try: - os.symlink(src, dest) - except (OSError, AttributeError, NotImplementedError): - pass - - return udir - make_numbered_dir = classmethod(make_numbered_dir) - - -def copymode(src, dest): - """ copy permission from src to dst. """ - py.std.shutil.copymode(src, dest) - -def copystat(src, dest): - """ copy permission, last modification time, last access time, and flags from src to dst.""" - py.std.shutil.copystat(str(src), str(dest)) - -def copychunked(src, dest): - chunksize = 524288 # half a meg of bytes - fsrc = src.open('rb') - try: - fdest = dest.open('wb') - try: - while 1: - buf = fsrc.read(chunksize) - if not buf: - break - fdest.write(buf) - finally: - fdest.close() - finally: - fsrc.close() - -def isimportable(name): - if name and (name[0].isalpha() or name[0] == '_'): - name = name.replace("_", '') - return not name or name.isalnum() diff --git a/lib/spack/external/py/_path/svnurl.py b/lib/spack/external/py/_path/svnurl.py deleted file mode 100644 index 6589a71d09..0000000000 --- a/lib/spack/external/py/_path/svnurl.py +++ /dev/null @@ -1,380 +0,0 @@ -""" -module defining a subversion path object based on the external -command 'svn'. This modules aims to work with svn 1.3 and higher -but might also interact well with earlier versions. -""" - -import os, sys, time, re -import py -from py import path, process -from py._path import common -from py._path import svnwc as svncommon -from py._path.cacheutil import BuildcostAccessCache, AgingCache - -DEBUG=False - -class SvnCommandPath(svncommon.SvnPathBase): - """ path implementation that offers access to (possibly remote) subversion - repositories. """ - - _lsrevcache = BuildcostAccessCache(maxentries=128) - _lsnorevcache = AgingCache(maxentries=1000, maxseconds=60.0) - - def __new__(cls, path, rev=None, auth=None): - self = object.__new__(cls) - if isinstance(path, cls): - rev = path.rev - auth = path.auth - path = path.strpath - svncommon.checkbadchars(path) - path = path.rstrip('/') - self.strpath = path - self.rev = rev - self.auth = auth - return self - - def __repr__(self): - if self.rev == -1: - return 'svnurl(%r)' % self.strpath - else: - return 'svnurl(%r, %r)' % (self.strpath, self.rev) - - def _svnwithrev(self, cmd, *args): - """ execute an svn command, append our own url and revision """ - if self.rev is None: - return self._svnwrite(cmd, *args) - else: - args = ['-r', self.rev] + list(args) - return self._svnwrite(cmd, *args) - - def _svnwrite(self, cmd, *args): - """ execute an svn command, append our own url """ - l = ['svn %s' % cmd] - args = ['"%s"' % self._escape(item) for item in args] - l.extend(args) - l.append('"%s"' % self._encodedurl()) - # fixing the locale because we can't otherwise parse - string = " ".join(l) - if DEBUG: - print("execing %s" % string) - out = self._svncmdexecauth(string) - return out - - def _svncmdexecauth(self, cmd): - """ execute an svn command 'as is' """ - cmd = svncommon.fixlocale() + cmd - if self.auth is not None: - cmd += ' ' + self.auth.makecmdoptions() - return self._cmdexec(cmd) - - def _cmdexec(self, cmd): - try: - out = process.cmdexec(cmd) - except py.process.cmdexec.Error: - e = sys.exc_info()[1] - if (e.err.find('File Exists') != -1 or - e.err.find('File already exists') != -1): - raise py.error.EEXIST(self) - raise - return out - - def _svnpopenauth(self, cmd): - """ execute an svn command, return a pipe for reading stdin """ - cmd = svncommon.fixlocale() + cmd - if self.auth is not None: - cmd += ' ' + self.auth.makecmdoptions() - return self._popen(cmd) - - def _popen(self, cmd): - return os.popen(cmd) - - def _encodedurl(self): - return self._escape(self.strpath) - - def _norev_delentry(self, path): - auth = self.auth and self.auth.makecmdoptions() or None - self._lsnorevcache.delentry((str(path), auth)) - - def open(self, mode='r'): - """ return an opened file with the given mode. """ - if mode not in ("r", "rU",): - raise ValueError("mode %r not supported" % (mode,)) - assert self.check(file=1) # svn cat returns an empty file otherwise - if self.rev is None: - return self._svnpopenauth('svn cat "%s"' % ( - self._escape(self.strpath), )) - else: - return self._svnpopenauth('svn cat -r %s "%s"' % ( - self.rev, self._escape(self.strpath))) - - def dirpath(self, *args, **kwargs): - """ return the directory path of the current path joined - with any given path arguments. - """ - l = self.strpath.split(self.sep) - if len(l) < 4: - raise py.error.EINVAL(self, "base is not valid") - elif len(l) == 4: - return self.join(*args, **kwargs) - else: - return self.new(basename='').join(*args, **kwargs) - - # modifying methods (cache must be invalidated) - def mkdir(self, *args, **kwargs): - """ create & return the directory joined with args. - pass a 'msg' keyword argument to set the commit message. - """ - commit_msg = kwargs.get('msg', "mkdir by py lib invocation") - createpath = self.join(*args) - createpath._svnwrite('mkdir', '-m', commit_msg) - self._norev_delentry(createpath.dirpath()) - return createpath - - def copy(self, target, msg='copied by py lib invocation'): - """ copy path to target with checkin message msg.""" - if getattr(target, 'rev', None) is not None: - raise py.error.EINVAL(target, "revisions are immutable") - self._svncmdexecauth('svn copy -m "%s" "%s" "%s"' %(msg, - self._escape(self), self._escape(target))) - self._norev_delentry(target.dirpath()) - - def rename(self, target, msg="renamed by py lib invocation"): - """ rename this path to target with checkin message msg. """ - if getattr(self, 'rev', None) is not None: - raise py.error.EINVAL(self, "revisions are immutable") - self._svncmdexecauth('svn move -m "%s" --force "%s" "%s"' %( - msg, self._escape(self), self._escape(target))) - self._norev_delentry(self.dirpath()) - self._norev_delentry(self) - - def remove(self, rec=1, msg='removed by py lib invocation'): - """ remove a file or directory (or a directory tree if rec=1) with -checkin message msg.""" - if self.rev is not None: - raise py.error.EINVAL(self, "revisions are immutable") - self._svncmdexecauth('svn rm -m "%s" "%s"' %(msg, self._escape(self))) - self._norev_delentry(self.dirpath()) - - def export(self, topath): - """ export to a local path - - topath should not exist prior to calling this, returns a - py.path.local instance - """ - topath = py.path.local(topath) - args = ['"%s"' % (self._escape(self),), - '"%s"' % (self._escape(topath),)] - if self.rev is not None: - args = ['-r', str(self.rev)] + args - self._svncmdexecauth('svn export %s' % (' '.join(args),)) - return topath - - def ensure(self, *args, **kwargs): - """ ensure that an args-joined path exists (by default as - a file). If you specify a keyword argument 'dir=True' - then the path is forced to be a directory path. - """ - if getattr(self, 'rev', None) is not None: - raise py.error.EINVAL(self, "revisions are immutable") - target = self.join(*args) - dir = kwargs.get('dir', 0) - for x in target.parts(reverse=True): - if x.check(): - break - else: - raise py.error.ENOENT(target, "has not any valid base!") - if x == target: - if not x.check(dir=dir): - raise dir and py.error.ENOTDIR(x) or py.error.EISDIR(x) - return x - tocreate = target.relto(x) - basename = tocreate.split(self.sep, 1)[0] - tempdir = py.path.local.mkdtemp() - try: - tempdir.ensure(tocreate, dir=dir) - cmd = 'svn import -m "%s" "%s" "%s"' % ( - "ensure %s" % self._escape(tocreate), - self._escape(tempdir.join(basename)), - x.join(basename)._encodedurl()) - self._svncmdexecauth(cmd) - self._norev_delentry(x) - finally: - tempdir.remove() - return target - - # end of modifying methods - def _propget(self, name): - res = self._svnwithrev('propget', name) - return res[:-1] # strip trailing newline - - def _proplist(self): - res = self._svnwithrev('proplist') - lines = res.split('\n') - lines = [x.strip() for x in lines[1:]] - return svncommon.PropListDict(self, lines) - - def info(self): - """ return an Info structure with svn-provided information. """ - parent = self.dirpath() - nameinfo_seq = parent._listdir_nameinfo() - bn = self.basename - for name, info in nameinfo_seq: - if name == bn: - return info - raise py.error.ENOENT(self) - - - def _listdir_nameinfo(self): - """ return sequence of name-info directory entries of self """ - def builder(): - try: - res = self._svnwithrev('ls', '-v') - except process.cmdexec.Error: - e = sys.exc_info()[1] - if e.err.find('non-existent in that revision') != -1: - raise py.error.ENOENT(self, e.err) - elif e.err.find("E200009:") != -1: - raise py.error.ENOENT(self, e.err) - elif e.err.find('File not found') != -1: - raise py.error.ENOENT(self, e.err) - elif e.err.find('not part of a repository')!=-1: - raise py.error.ENOENT(self, e.err) - elif e.err.find('Unable to open')!=-1: - raise py.error.ENOENT(self, e.err) - elif e.err.lower().find('method not allowed')!=-1: - raise py.error.EACCES(self, e.err) - raise py.error.Error(e.err) - lines = res.split('\n') - nameinfo_seq = [] - for lsline in lines: - if lsline: - info = InfoSvnCommand(lsline) - if info._name != '.': # svn 1.5 produces '.' dirs, - nameinfo_seq.append((info._name, info)) - nameinfo_seq.sort() - return nameinfo_seq - auth = self.auth and self.auth.makecmdoptions() or None - if self.rev is not None: - return self._lsrevcache.getorbuild((self.strpath, self.rev, auth), - builder) - else: - return self._lsnorevcache.getorbuild((self.strpath, auth), - builder) - - def listdir(self, fil=None, sort=None): - """ list directory contents, possibly filter by the given fil func - and possibly sorted. - """ - if isinstance(fil, str): - fil = common.FNMatcher(fil) - nameinfo_seq = self._listdir_nameinfo() - if len(nameinfo_seq) == 1: - name, info = nameinfo_seq[0] - if name == self.basename and info.kind == 'file': - #if not self.check(dir=1): - raise py.error.ENOTDIR(self) - paths = [self.join(name) for (name, info) in nameinfo_seq] - if fil: - paths = [x for x in paths if fil(x)] - self._sortlist(paths, sort) - return paths - - - def log(self, rev_start=None, rev_end=1, verbose=False): - """ return a list of LogEntry instances for this path. -rev_start is the starting revision (defaulting to the first one). -rev_end is the last revision (defaulting to HEAD). -if verbose is True, then the LogEntry instances also know which files changed. -""" - assert self.check() #make it simpler for the pipe - rev_start = rev_start is None and "HEAD" or rev_start - rev_end = rev_end is None and "HEAD" or rev_end - - if rev_start == "HEAD" and rev_end == 1: - rev_opt = "" - else: - rev_opt = "-r %s:%s" % (rev_start, rev_end) - verbose_opt = verbose and "-v" or "" - xmlpipe = self._svnpopenauth('svn log --xml %s %s "%s"' % - (rev_opt, verbose_opt, self.strpath)) - from xml.dom import minidom - tree = minidom.parse(xmlpipe) - result = [] - for logentry in filter(None, tree.firstChild.childNodes): - if logentry.nodeType == logentry.ELEMENT_NODE: - result.append(svncommon.LogEntry(logentry)) - return result - -#01234567890123456789012345678901234567890123467 -# 2256 hpk 165 Nov 24 17:55 __init__.py -# XXX spotted by Guido, SVN 1.3.0 has different aligning, breaks the code!!! -# 1312 johnny 1627 May 05 14:32 test_decorators.py -# -class InfoSvnCommand: - # the '0?' part in the middle is an indication of whether the resource is - # locked, see 'svn help ls' - lspattern = re.compile( - r'^ *(?P\d+) +(?P.+?) +(0? *(?P\d+))? ' - r'*(?P\w+ +\d{2} +[\d:]+) +(?P.*)$') - def __init__(self, line): - # this is a typical line from 'svn ls http://...' - #_ 1127 jum 0 Jul 13 15:28 branch/ - match = self.lspattern.match(line) - data = match.groupdict() - self._name = data['file'] - if self._name[-1] == '/': - self._name = self._name[:-1] - self.kind = 'dir' - else: - self.kind = 'file' - #self.has_props = l.pop(0) == 'P' - self.created_rev = int(data['rev']) - self.last_author = data['author'] - self.size = data['size'] and int(data['size']) or 0 - self.mtime = parse_time_with_missing_year(data['date']) - self.time = self.mtime * 1000000 - - def __eq__(self, other): - return self.__dict__ == other.__dict__ - - -#____________________________________________________ -# -# helper functions -#____________________________________________________ -def parse_time_with_missing_year(timestr): - """ analyze the time part from a single line of "svn ls -v" - the svn output doesn't show the year makes the 'timestr' - ambigous. - """ - import calendar - t_now = time.gmtime() - - tparts = timestr.split() - month = time.strptime(tparts.pop(0), '%b')[1] - day = time.strptime(tparts.pop(0), '%d')[2] - last = tparts.pop(0) # year or hour:minute - try: - if ":" in last: - raise ValueError() - year = time.strptime(last, '%Y')[0] - hour = minute = 0 - except ValueError: - hour, minute = time.strptime(last, '%H:%M')[3:5] - year = t_now[0] - - t_result = (year, month, day, hour, minute, 0,0,0,0) - if t_result > t_now: - year -= 1 - t_result = (year, month, day, hour, minute, 0,0,0,0) - return calendar.timegm(t_result) - -class PathEntry: - def __init__(self, ppart): - self.strpath = ppart.firstChild.nodeValue.encode('UTF-8') - self.action = ppart.getAttribute('action').encode('UTF-8') - if self.action == 'A': - self.copyfrom_path = ppart.getAttribute('copyfrom-path').encode('UTF-8') - if self.copyfrom_path: - self.copyfrom_rev = int(ppart.getAttribute('copyfrom-rev')) - diff --git a/lib/spack/external/py/_path/svnwc.py b/lib/spack/external/py/_path/svnwc.py deleted file mode 100644 index 992223c04a..0000000000 --- a/lib/spack/external/py/_path/svnwc.py +++ /dev/null @@ -1,1240 +0,0 @@ -""" -svn-Command based Implementation of a Subversion WorkingCopy Path. - - SvnWCCommandPath is the main class. - -""" - -import os, sys, time, re, calendar -import py -import subprocess -from py._path import common - -#----------------------------------------------------------- -# Caching latest repository revision and repo-paths -# (getting them is slow with the current implementations) -# -# XXX make mt-safe -#----------------------------------------------------------- - -class cache: - proplist = {} - info = {} - entries = {} - prop = {} - -class RepoEntry: - def __init__(self, url, rev, timestamp): - self.url = url - self.rev = rev - self.timestamp = timestamp - - def __str__(self): - return "repo: %s;%s %s" %(self.url, self.rev, self.timestamp) - -class RepoCache: - """ The Repocache manages discovered repository paths - and their revisions. If inside a timeout the cache - will even return the revision of the root. - """ - timeout = 20 # seconds after which we forget that we know the last revision - - def __init__(self): - self.repos = [] - - def clear(self): - self.repos = [] - - def put(self, url, rev, timestamp=None): - if rev is None: - return - if timestamp is None: - timestamp = time.time() - - for entry in self.repos: - if url == entry.url: - entry.timestamp = timestamp - entry.rev = rev - #print "set repo", entry - break - else: - entry = RepoEntry(url, rev, timestamp) - self.repos.append(entry) - #print "appended repo", entry - - def get(self, url): - now = time.time() - for entry in self.repos: - if url.startswith(entry.url): - if now < entry.timestamp + self.timeout: - #print "returning immediate Etrny", entry - return entry.url, entry.rev - return entry.url, -1 - return url, -1 - -repositories = RepoCache() - - -# svn support code - -ALLOWED_CHARS = "_ -/\\=$.~+%" #add characters as necessary when tested -if sys.platform == "win32": - ALLOWED_CHARS += ":" -ALLOWED_CHARS_HOST = ALLOWED_CHARS + '@:' - -def _getsvnversion(ver=[]): - try: - return ver[0] - except IndexError: - v = py.process.cmdexec("svn -q --version") - v.strip() - v = '.'.join(v.split('.')[:2]) - ver.append(v) - return v - -def _escape_helper(text): - text = str(text) - if py.std.sys.platform != 'win32': - text = str(text).replace('$', '\\$') - return text - -def _check_for_bad_chars(text, allowed_chars=ALLOWED_CHARS): - for c in str(text): - if c.isalnum(): - continue - if c in allowed_chars: - continue - return True - return False - -def checkbadchars(url): - # (hpk) not quite sure about the exact purpose, guido w.? - proto, uri = url.split("://", 1) - if proto != "file": - host, uripath = uri.split('/', 1) - # only check for bad chars in the non-protocol parts - if (_check_for_bad_chars(host, ALLOWED_CHARS_HOST) \ - or _check_for_bad_chars(uripath, ALLOWED_CHARS)): - raise ValueError("bad char in %r" % (url, )) - - -#_______________________________________________________________ - -class SvnPathBase(common.PathBase): - """ Base implementation for SvnPath implementations. """ - sep = '/' - - def _geturl(self): - return self.strpath - url = property(_geturl, None, None, "url of this svn-path.") - - def __str__(self): - """ return a string representation (including rev-number) """ - return self.strpath - - def __hash__(self): - return hash(self.strpath) - - def new(self, **kw): - """ create a modified version of this path. A 'rev' argument - indicates a new revision. - the following keyword arguments modify various path parts:: - - http://host.com/repo/path/file.ext - |-----------------------| dirname - |------| basename - |--| purebasename - |--| ext - """ - obj = object.__new__(self.__class__) - obj.rev = kw.get('rev', self.rev) - obj.auth = kw.get('auth', self.auth) - dirname, basename, purebasename, ext = self._getbyspec( - "dirname,basename,purebasename,ext") - if 'basename' in kw: - if 'purebasename' in kw or 'ext' in kw: - raise ValueError("invalid specification %r" % kw) - else: - pb = kw.setdefault('purebasename', purebasename) - ext = kw.setdefault('ext', ext) - if ext and not ext.startswith('.'): - ext = '.' + ext - kw['basename'] = pb + ext - - kw.setdefault('dirname', dirname) - kw.setdefault('sep', self.sep) - if kw['basename']: - obj.strpath = "%(dirname)s%(sep)s%(basename)s" % kw - else: - obj.strpath = "%(dirname)s" % kw - return obj - - def _getbyspec(self, spec): - """ get specified parts of the path. 'arg' is a string - with comma separated path parts. The parts are returned - in exactly the order of the specification. - - you may specify the following parts: - - http://host.com/repo/path/file.ext - |-----------------------| dirname - |------| basename - |--| purebasename - |--| ext - """ - res = [] - parts = self.strpath.split(self.sep) - for name in spec.split(','): - name = name.strip() - if name == 'dirname': - res.append(self.sep.join(parts[:-1])) - elif name == 'basename': - res.append(parts[-1]) - else: - basename = parts[-1] - i = basename.rfind('.') - if i == -1: - purebasename, ext = basename, '' - else: - purebasename, ext = basename[:i], basename[i:] - if name == 'purebasename': - res.append(purebasename) - elif name == 'ext': - res.append(ext) - else: - raise NameError("Don't know part %r" % name) - return res - - def __eq__(self, other): - """ return true if path and rev attributes each match """ - return (str(self) == str(other) and - (self.rev == other.rev or self.rev == other.rev)) - - def __ne__(self, other): - return not self == other - - def join(self, *args): - """ return a new Path (with the same revision) which is composed - of the self Path followed by 'args' path components. - """ - if not args: - return self - - args = tuple([arg.strip(self.sep) for arg in args]) - parts = (self.strpath, ) + args - newpath = self.__class__(self.sep.join(parts), self.rev, self.auth) - return newpath - - def propget(self, name): - """ return the content of the given property. """ - value = self._propget(name) - return value - - def proplist(self): - """ list all property names. """ - content = self._proplist() - return content - - def size(self): - """ Return the size of the file content of the Path. """ - return self.info().size - - def mtime(self): - """ Return the last modification time of the file. """ - return self.info().mtime - - # shared help methods - - def _escape(self, cmd): - return _escape_helper(cmd) - - - #def _childmaxrev(self): - # """ return maximum revision number of childs (or self.rev if no childs) """ - # rev = self.rev - # for name, info in self._listdir_nameinfo(): - # rev = max(rev, info.created_rev) - # return rev - - #def _getlatestrevision(self): - # """ return latest repo-revision for this path. """ - # url = self.strpath - # path = self.__class__(url, None) - # - # # we need a long walk to find the root-repo and revision - # while 1: - # try: - # rev = max(rev, path._childmaxrev()) - # previous = path - # path = path.dirpath() - # except (IOError, process.cmdexec.Error): - # break - # if rev is None: - # raise IOError, "could not determine newest repo revision for %s" % self - # return rev - - class Checkers(common.Checkers): - def dir(self): - try: - return self.path.info().kind == 'dir' - except py.error.Error: - return self._listdirworks() - - def _listdirworks(self): - try: - self.path.listdir() - except py.error.ENOENT: - return False - else: - return True - - def file(self): - try: - return self.path.info().kind == 'file' - except py.error.ENOENT: - return False - - def exists(self): - try: - return self.path.info() - except py.error.ENOENT: - return self._listdirworks() - -def parse_apr_time(timestr): - i = timestr.rfind('.') - if i == -1: - raise ValueError("could not parse %s" % timestr) - timestr = timestr[:i] - parsedtime = time.strptime(timestr, "%Y-%m-%dT%H:%M:%S") - return time.mktime(parsedtime) - -class PropListDict(dict): - """ a Dictionary which fetches values (InfoSvnCommand instances) lazily""" - def __init__(self, path, keynames): - dict.__init__(self, [(x, None) for x in keynames]) - self.path = path - - def __getitem__(self, key): - value = dict.__getitem__(self, key) - if value is None: - value = self.path.propget(key) - dict.__setitem__(self, key, value) - return value - -def fixlocale(): - if sys.platform != 'win32': - return 'LC_ALL=C ' - return '' - -# some nasty chunk of code to solve path and url conversion and quoting issues -ILLEGAL_CHARS = '* | \\ / : < > ? \t \n \x0b \x0c \r'.split(' ') -if os.sep in ILLEGAL_CHARS: - ILLEGAL_CHARS.remove(os.sep) -ISWINDOWS = sys.platform == 'win32' -_reg_allow_disk = re.compile(r'^([a-z]\:\\)?[^:]+$', re.I) -def _check_path(path): - illegal = ILLEGAL_CHARS[:] - sp = path.strpath - if ISWINDOWS: - illegal.remove(':') - if not _reg_allow_disk.match(sp): - raise ValueError('path may not contain a colon (:)') - for char in sp: - if char not in string.printable or char in illegal: - raise ValueError('illegal character %r in path' % (char,)) - -def path_to_fspath(path, addat=True): - _check_path(path) - sp = path.strpath - if addat and path.rev != -1: - sp = '%s@%s' % (sp, path.rev) - elif addat: - sp = '%s@HEAD' % (sp,) - return sp - -def url_from_path(path): - fspath = path_to_fspath(path, False) - quote = py.std.urllib.quote - if ISWINDOWS: - match = _reg_allow_disk.match(fspath) - fspath = fspath.replace('\\', '/') - if match.group(1): - fspath = '/%s%s' % (match.group(1).replace('\\', '/'), - quote(fspath[len(match.group(1)):])) - else: - fspath = quote(fspath) - else: - fspath = quote(fspath) - if path.rev != -1: - fspath = '%s@%s' % (fspath, path.rev) - else: - fspath = '%s@HEAD' % (fspath,) - return 'file://%s' % (fspath,) - -class SvnAuth(object): - """ container for auth information for Subversion """ - def __init__(self, username, password, cache_auth=True, interactive=True): - self.username = username - self.password = password - self.cache_auth = cache_auth - self.interactive = interactive - - def makecmdoptions(self): - uname = self.username.replace('"', '\\"') - passwd = self.password.replace('"', '\\"') - ret = [] - if uname: - ret.append('--username="%s"' % (uname,)) - if passwd: - ret.append('--password="%s"' % (passwd,)) - if not self.cache_auth: - ret.append('--no-auth-cache') - if not self.interactive: - ret.append('--non-interactive') - return ' '.join(ret) - - def __str__(self): - return "" %(self.username,) - -rex_blame = re.compile(r'\s*(\d+)\s*(\S+) (.*)') - -class SvnWCCommandPath(common.PathBase): - """ path implementation offering access/modification to svn working copies. - It has methods similar to the functions in os.path and similar to the - commands of the svn client. - """ - sep = os.sep - - def __new__(cls, wcpath=None, auth=None): - self = object.__new__(cls) - if isinstance(wcpath, cls): - if wcpath.__class__ == cls: - return wcpath - wcpath = wcpath.localpath - if _check_for_bad_chars(str(wcpath), - ALLOWED_CHARS): - raise ValueError("bad char in wcpath %s" % (wcpath, )) - self.localpath = py.path.local(wcpath) - self.auth = auth - return self - - strpath = property(lambda x: str(x.localpath), None, None, "string path") - rev = property(lambda x: x.info(usecache=0).rev, None, None, "revision") - - def __eq__(self, other): - return self.localpath == getattr(other, 'localpath', None) - - def _geturl(self): - if getattr(self, '_url', None) is None: - info = self.info() - self._url = info.url #SvnPath(info.url, info.rev) - assert isinstance(self._url, py.builtin._basestring) - return self._url - - url = property(_geturl, None, None, "url of this WC item") - - def _escape(self, cmd): - return _escape_helper(cmd) - - def dump(self, obj): - """ pickle object into path location""" - return self.localpath.dump(obj) - - def svnurl(self): - """ return current SvnPath for this WC-item. """ - info = self.info() - return py.path.svnurl(info.url) - - def __repr__(self): - return "svnwc(%r)" % (self.strpath) # , self._url) - - def __str__(self): - return str(self.localpath) - - def _makeauthoptions(self): - if self.auth is None: - return '' - return self.auth.makecmdoptions() - - def _authsvn(self, cmd, args=None): - args = args and list(args) or [] - args.append(self._makeauthoptions()) - return self._svn(cmd, *args) - - def _svn(self, cmd, *args): - l = ['svn %s' % cmd] - args = [self._escape(item) for item in args] - l.extend(args) - l.append('"%s"' % self._escape(self.strpath)) - # try fixing the locale because we can't otherwise parse - string = fixlocale() + " ".join(l) - try: - try: - key = 'LC_MESSAGES' - hold = os.environ.get(key) - os.environ[key] = 'C' - out = py.process.cmdexec(string) - finally: - if hold: - os.environ[key] = hold - else: - del os.environ[key] - except py.process.cmdexec.Error: - e = sys.exc_info()[1] - strerr = e.err.lower() - if strerr.find('not found') != -1: - raise py.error.ENOENT(self) - elif strerr.find("E200009:") != -1: - raise py.error.ENOENT(self) - if (strerr.find('file exists') != -1 or - strerr.find('file already exists') != -1 or - strerr.find('w150002:') != -1 or - strerr.find("can't create directory") != -1): - raise py.error.EEXIST(strerr) #self) - raise - return out - - def switch(self, url): - """ switch to given URL. """ - self._authsvn('switch', [url]) - - def checkout(self, url=None, rev=None): - """ checkout from url to local wcpath. """ - args = [] - if url is None: - url = self.url - if rev is None or rev == -1: - if (py.std.sys.platform != 'win32' and - _getsvnversion() == '1.3'): - url += "@HEAD" - else: - if _getsvnversion() == '1.3': - url += "@%d" % rev - else: - args.append('-r' + str(rev)) - args.append(url) - self._authsvn('co', args) - - def update(self, rev='HEAD', interactive=True): - """ update working copy item to given revision. (None -> HEAD). """ - opts = ['-r', rev] - if not interactive: - opts.append("--non-interactive") - self._authsvn('up', opts) - - def write(self, content, mode='w'): - """ write content into local filesystem wc. """ - self.localpath.write(content, mode) - - def dirpath(self, *args): - """ return the directory Path of the current Path. """ - return self.__class__(self.localpath.dirpath(*args), auth=self.auth) - - def _ensuredirs(self): - parent = self.dirpath() - if parent.check(dir=0): - parent._ensuredirs() - if self.check(dir=0): - self.mkdir() - return self - - def ensure(self, *args, **kwargs): - """ ensure that an args-joined path exists (by default as - a file). if you specify a keyword argument 'directory=True' - then the path is forced to be a directory path. - """ - p = self.join(*args) - if p.check(): - if p.check(versioned=False): - p.add() - return p - if kwargs.get('dir', 0): - return p._ensuredirs() - parent = p.dirpath() - parent._ensuredirs() - p.write("") - p.add() - return p - - def mkdir(self, *args): - """ create & return the directory joined with args. """ - if args: - return self.join(*args).mkdir() - else: - self._svn('mkdir') - return self - - def add(self): - """ add ourself to svn """ - self._svn('add') - - def remove(self, rec=1, force=1): - """ remove a file or a directory tree. 'rec'ursive is - ignored and considered always true (because of - underlying svn semantics. - """ - assert rec, "svn cannot remove non-recursively" - if not self.check(versioned=True): - # not added to svn (anymore?), just remove - py.path.local(self).remove() - return - flags = [] - if force: - flags.append('--force') - self._svn('remove', *flags) - - def copy(self, target): - """ copy path to target.""" - py.process.cmdexec("svn copy %s %s" %(str(self), str(target))) - - def rename(self, target): - """ rename this path to target. """ - py.process.cmdexec("svn move --force %s %s" %(str(self), str(target))) - - def lock(self): - """ set a lock (exclusive) on the resource """ - out = self._authsvn('lock').strip() - if not out: - # warning or error, raise exception - raise ValueError("unknown error in svn lock command") - - def unlock(self): - """ unset a previously set lock """ - out = self._authsvn('unlock').strip() - if out.startswith('svn:'): - # warning or error, raise exception - raise Exception(out[4:]) - - def cleanup(self): - """ remove any locks from the resource """ - # XXX should be fixed properly!!! - try: - self.unlock() - except: - pass - - def status(self, updates=0, rec=0, externals=0): - """ return (collective) Status object for this file. """ - # http://svnbook.red-bean.com/book.html#svn-ch-3-sect-4.3.1 - # 2201 2192 jum test - # XXX - if externals: - raise ValueError("XXX cannot perform status() " - "on external items yet") - else: - #1.2 supports: externals = '--ignore-externals' - externals = '' - if rec: - rec= '' - else: - rec = '--non-recursive' - - # XXX does not work on all subversion versions - #if not externals: - # externals = '--ignore-externals' - - if updates: - updates = '-u' - else: - updates = '' - - try: - cmd = 'status -v --xml --no-ignore %s %s %s' % ( - updates, rec, externals) - out = self._authsvn(cmd) - except py.process.cmdexec.Error: - cmd = 'status -v --no-ignore %s %s %s' % ( - updates, rec, externals) - out = self._authsvn(cmd) - rootstatus = WCStatus(self).fromstring(out, self) - else: - rootstatus = XMLWCStatus(self).fromstring(out, self) - return rootstatus - - def diff(self, rev=None): - """ return a diff of the current path against revision rev (defaulting - to the last one). - """ - args = [] - if rev is not None: - args.append("-r %d" % rev) - out = self._authsvn('diff', args) - return out - - def blame(self): - """ return a list of tuples of three elements: - (revision, commiter, line) - """ - out = self._svn('blame') - result = [] - blamelines = out.splitlines() - reallines = py.path.svnurl(self.url).readlines() - for i, (blameline, line) in enumerate( - zip(blamelines, reallines)): - m = rex_blame.match(blameline) - if not m: - raise ValueError("output line %r of svn blame does not match " - "expected format" % (line, )) - rev, name, _ = m.groups() - result.append((int(rev), name, line)) - return result - - _rex_commit = re.compile(r'.*Committed revision (\d+)\.$', re.DOTALL) - def commit(self, msg='', rec=1): - """ commit with support for non-recursive commits """ - # XXX i guess escaping should be done better here?!? - cmd = 'commit -m "%s" --force-log' % (msg.replace('"', '\\"'),) - if not rec: - cmd += ' -N' - out = self._authsvn(cmd) - try: - del cache.info[self] - except KeyError: - pass - if out: - m = self._rex_commit.match(out) - return int(m.group(1)) - - def propset(self, name, value, *args): - """ set property name to value on this path. """ - d = py.path.local.mkdtemp() - try: - p = d.join('value') - p.write(value) - self._svn('propset', name, '--file', str(p), *args) - finally: - d.remove() - - def propget(self, name): - """ get property name on this path. """ - res = self._svn('propget', name) - return res[:-1] # strip trailing newline - - def propdel(self, name): - """ delete property name on this path. """ - res = self._svn('propdel', name) - return res[:-1] # strip trailing newline - - def proplist(self, rec=0): - """ return a mapping of property names to property values. -If rec is True, then return a dictionary mapping sub-paths to such mappings. -""" - if rec: - res = self._svn('proplist -R') - return make_recursive_propdict(self, res) - else: - res = self._svn('proplist') - lines = res.split('\n') - lines = [x.strip() for x in lines[1:]] - return PropListDict(self, lines) - - def revert(self, rec=0): - """ revert the local changes of this path. if rec is True, do so -recursively. """ - if rec: - result = self._svn('revert -R') - else: - result = self._svn('revert') - return result - - def new(self, **kw): - """ create a modified version of this path. A 'rev' argument - indicates a new revision. - the following keyword arguments modify various path parts: - - http://host.com/repo/path/file.ext - |-----------------------| dirname - |------| basename - |--| purebasename - |--| ext - """ - if kw: - localpath = self.localpath.new(**kw) - else: - localpath = self.localpath - return self.__class__(localpath, auth=self.auth) - - def join(self, *args, **kwargs): - """ return a new Path (with the same revision) which is composed - of the self Path followed by 'args' path components. - """ - if not args: - return self - localpath = self.localpath.join(*args, **kwargs) - return self.__class__(localpath, auth=self.auth) - - def info(self, usecache=1): - """ return an Info structure with svn-provided information. """ - info = usecache and cache.info.get(self) - if not info: - try: - output = self._svn('info') - except py.process.cmdexec.Error: - e = sys.exc_info()[1] - if e.err.find('Path is not a working copy directory') != -1: - raise py.error.ENOENT(self, e.err) - elif e.err.find("is not under version control") != -1: - raise py.error.ENOENT(self, e.err) - raise - # XXX SVN 1.3 has output on stderr instead of stdout (while it does - # return 0!), so a bit nasty, but we assume no output is output - # to stderr... - if (output.strip() == '' or - output.lower().find('not a versioned resource') != -1): - raise py.error.ENOENT(self, output) - info = InfoSvnWCCommand(output) - - # Can't reliably compare on Windows without access to win32api - if py.std.sys.platform != 'win32': - if info.path != self.localpath: - raise py.error.ENOENT(self, "not a versioned resource:" + - " %s != %s" % (info.path, self.localpath)) - cache.info[self] = info - return info - - def listdir(self, fil=None, sort=None): - """ return a sequence of Paths. - - listdir will return either a tuple or a list of paths - depending on implementation choices. - """ - if isinstance(fil, str): - fil = common.FNMatcher(fil) - # XXX unify argument naming with LocalPath.listdir - def notsvn(path): - return path.basename != '.svn' - - paths = [] - for localpath in self.localpath.listdir(notsvn): - p = self.__class__(localpath, auth=self.auth) - if notsvn(p) and (not fil or fil(p)): - paths.append(p) - self._sortlist(paths, sort) - return paths - - def open(self, mode='r'): - """ return an opened file with the given mode. """ - return open(self.strpath, mode) - - def _getbyspec(self, spec): - return self.localpath._getbyspec(spec) - - class Checkers(py.path.local.Checkers): - def __init__(self, path): - self.svnwcpath = path - self.path = path.localpath - def versioned(self): - try: - s = self.svnwcpath.info() - except (py.error.ENOENT, py.error.EEXIST): - return False - except py.process.cmdexec.Error: - e = sys.exc_info()[1] - if e.err.find('is not a working copy')!=-1: - return False - if e.err.lower().find('not a versioned resource') != -1: - return False - raise - else: - return True - - def log(self, rev_start=None, rev_end=1, verbose=False): - """ return a list of LogEntry instances for this path. -rev_start is the starting revision (defaulting to the first one). -rev_end is the last revision (defaulting to HEAD). -if verbose is True, then the LogEntry instances also know which files changed. -""" - assert self.check() # make it simpler for the pipe - rev_start = rev_start is None and "HEAD" or rev_start - rev_end = rev_end is None and "HEAD" or rev_end - if rev_start == "HEAD" and rev_end == 1: - rev_opt = "" - else: - rev_opt = "-r %s:%s" % (rev_start, rev_end) - verbose_opt = verbose and "-v" or "" - locale_env = fixlocale() - # some blather on stderr - auth_opt = self._makeauthoptions() - #stdin, stdout, stderr = os.popen3(locale_env + - # 'svn log --xml %s %s %s "%s"' % ( - # rev_opt, verbose_opt, auth_opt, - # self.strpath)) - cmd = locale_env + 'svn log --xml %s %s %s "%s"' % ( - rev_opt, verbose_opt, auth_opt, self.strpath) - - popen = subprocess.Popen(cmd, - stdout=subprocess.PIPE, - stderr=subprocess.PIPE, - shell=True, - ) - stdout, stderr = popen.communicate() - stdout = py.builtin._totext(stdout, sys.getdefaultencoding()) - minidom,ExpatError = importxml() - try: - tree = minidom.parseString(stdout) - except ExpatError: - raise ValueError('no such revision') - result = [] - for logentry in filter(None, tree.firstChild.childNodes): - if logentry.nodeType == logentry.ELEMENT_NODE: - result.append(LogEntry(logentry)) - return result - - def size(self): - """ Return the size of the file content of the Path. """ - return self.info().size - - def mtime(self): - """ Return the last modification time of the file. """ - return self.info().mtime - - def __hash__(self): - return hash((self.strpath, self.__class__, self.auth)) - - -class WCStatus: - attrnames = ('modified','added', 'conflict', 'unchanged', 'external', - 'deleted', 'prop_modified', 'unknown', 'update_available', - 'incomplete', 'kindmismatch', 'ignored', 'locked', 'replaced' - ) - - def __init__(self, wcpath, rev=None, modrev=None, author=None): - self.wcpath = wcpath - self.rev = rev - self.modrev = modrev - self.author = author - - for name in self.attrnames: - setattr(self, name, []) - - def allpath(self, sort=True, **kw): - d = {} - for name in self.attrnames: - if name not in kw or kw[name]: - for path in getattr(self, name): - d[path] = 1 - l = d.keys() - if sort: - l.sort() - return l - - # XXX a bit scary to assume there's always 2 spaces between username and - # path, however with win32 allowing spaces in user names there doesn't - # seem to be a more solid approach :( - _rex_status = re.compile(r'\s+(\d+|-)\s+(\S+)\s+(.+?)\s{2,}(.*)') - - def fromstring(data, rootwcpath, rev=None, modrev=None, author=None): - """ return a new WCStatus object from data 's' - """ - rootstatus = WCStatus(rootwcpath, rev, modrev, author) - update_rev = None - for line in data.split('\n'): - if not line.strip(): - continue - #print "processing %r" % line - flags, rest = line[:8], line[8:] - # first column - c0,c1,c2,c3,c4,c5,x6,c7 = flags - #if '*' in line: - # print "flags", repr(flags), "rest", repr(rest) - - if c0 in '?XI': - fn = line.split(None, 1)[1] - if c0 == '?': - wcpath = rootwcpath.join(fn, abs=1) - rootstatus.unknown.append(wcpath) - elif c0 == 'X': - wcpath = rootwcpath.__class__( - rootwcpath.localpath.join(fn, abs=1), - auth=rootwcpath.auth) - rootstatus.external.append(wcpath) - elif c0 == 'I': - wcpath = rootwcpath.join(fn, abs=1) - rootstatus.ignored.append(wcpath) - - continue - - #elif c0 in '~!' or c4 == 'S': - # raise NotImplementedError("received flag %r" % c0) - - m = WCStatus._rex_status.match(rest) - if not m: - if c7 == '*': - fn = rest.strip() - wcpath = rootwcpath.join(fn, abs=1) - rootstatus.update_available.append(wcpath) - continue - if line.lower().find('against revision:')!=-1: - update_rev = int(rest.split(':')[1].strip()) - continue - if line.lower().find('status on external') > -1: - # XXX not sure what to do here... perhaps we want to - # store some state instead of just continuing, as right - # now it makes the top-level external get added twice - # (once as external, once as 'normal' unchanged item) - # because of the way SVN presents external items - continue - # keep trying - raise ValueError("could not parse line %r" % line) - else: - rev, modrev, author, fn = m.groups() - wcpath = rootwcpath.join(fn, abs=1) - #assert wcpath.check() - if c0 == 'M': - assert wcpath.check(file=1), "didn't expect a directory with changed content here" - rootstatus.modified.append(wcpath) - elif c0 == 'A' or c3 == '+' : - rootstatus.added.append(wcpath) - elif c0 == 'D': - rootstatus.deleted.append(wcpath) - elif c0 == 'C': - rootstatus.conflict.append(wcpath) - elif c0 == '~': - rootstatus.kindmismatch.append(wcpath) - elif c0 == '!': - rootstatus.incomplete.append(wcpath) - elif c0 == 'R': - rootstatus.replaced.append(wcpath) - elif not c0.strip(): - rootstatus.unchanged.append(wcpath) - else: - raise NotImplementedError("received flag %r" % c0) - - if c1 == 'M': - rootstatus.prop_modified.append(wcpath) - # XXX do we cover all client versions here? - if c2 == 'L' or c5 == 'K': - rootstatus.locked.append(wcpath) - if c7 == '*': - rootstatus.update_available.append(wcpath) - - if wcpath == rootwcpath: - rootstatus.rev = rev - rootstatus.modrev = modrev - rootstatus.author = author - if update_rev: - rootstatus.update_rev = update_rev - continue - return rootstatus - fromstring = staticmethod(fromstring) - -class XMLWCStatus(WCStatus): - def fromstring(data, rootwcpath, rev=None, modrev=None, author=None): - """ parse 'data' (XML string as outputted by svn st) into a status obj - """ - # XXX for externals, the path is shown twice: once - # with external information, and once with full info as if - # the item was a normal non-external... the current way of - # dealing with this issue is by ignoring it - this does make - # externals appear as external items as well as 'normal', - # unchanged ones in the status object so this is far from ideal - rootstatus = WCStatus(rootwcpath, rev, modrev, author) - update_rev = None - minidom, ExpatError = importxml() - try: - doc = minidom.parseString(data) - except ExpatError: - e = sys.exc_info()[1] - raise ValueError(str(e)) - urevels = doc.getElementsByTagName('against') - if urevels: - rootstatus.update_rev = urevels[-1].getAttribute('revision') - for entryel in doc.getElementsByTagName('entry'): - path = entryel.getAttribute('path') - statusel = entryel.getElementsByTagName('wc-status')[0] - itemstatus = statusel.getAttribute('item') - - if itemstatus == 'unversioned': - wcpath = rootwcpath.join(path, abs=1) - rootstatus.unknown.append(wcpath) - continue - elif itemstatus == 'external': - wcpath = rootwcpath.__class__( - rootwcpath.localpath.join(path, abs=1), - auth=rootwcpath.auth) - rootstatus.external.append(wcpath) - continue - elif itemstatus == 'ignored': - wcpath = rootwcpath.join(path, abs=1) - rootstatus.ignored.append(wcpath) - continue - elif itemstatus == 'incomplete': - wcpath = rootwcpath.join(path, abs=1) - rootstatus.incomplete.append(wcpath) - continue - - rev = statusel.getAttribute('revision') - if itemstatus == 'added' or itemstatus == 'none': - rev = '0' - modrev = '?' - author = '?' - date = '' - elif itemstatus == "replaced": - pass - else: - #print entryel.toxml() - commitel = entryel.getElementsByTagName('commit')[0] - if commitel: - modrev = commitel.getAttribute('revision') - author = '' - author_els = commitel.getElementsByTagName('author') - if author_els: - for c in author_els[0].childNodes: - author += c.nodeValue - date = '' - for c in commitel.getElementsByTagName('date')[0]\ - .childNodes: - date += c.nodeValue - - wcpath = rootwcpath.join(path, abs=1) - - assert itemstatus != 'modified' or wcpath.check(file=1), ( - 'did\'t expect a directory with changed content here') - - itemattrname = { - 'normal': 'unchanged', - 'unversioned': 'unknown', - 'conflicted': 'conflict', - 'none': 'added', - }.get(itemstatus, itemstatus) - - attr = getattr(rootstatus, itemattrname) - attr.append(wcpath) - - propsstatus = statusel.getAttribute('props') - if propsstatus not in ('none', 'normal'): - rootstatus.prop_modified.append(wcpath) - - if wcpath == rootwcpath: - rootstatus.rev = rev - rootstatus.modrev = modrev - rootstatus.author = author - rootstatus.date = date - - # handle repos-status element (remote info) - rstatusels = entryel.getElementsByTagName('repos-status') - if rstatusels: - rstatusel = rstatusels[0] - ritemstatus = rstatusel.getAttribute('item') - if ritemstatus in ('added', 'modified'): - rootstatus.update_available.append(wcpath) - - lockels = entryel.getElementsByTagName('lock') - if len(lockels): - rootstatus.locked.append(wcpath) - - return rootstatus - fromstring = staticmethod(fromstring) - -class InfoSvnWCCommand: - def __init__(self, output): - # Path: test - # URL: http://codespeak.net/svn/std.path/trunk/dist/std.path/test - # Repository UUID: fd0d7bf2-dfb6-0310-8d31-b7ecfe96aada - # Revision: 2151 - # Node Kind: directory - # Schedule: normal - # Last Changed Author: hpk - # Last Changed Rev: 2100 - # Last Changed Date: 2003-10-27 20:43:14 +0100 (Mon, 27 Oct 2003) - # Properties Last Updated: 2003-11-03 14:47:48 +0100 (Mon, 03 Nov 2003) - - d = {} - for line in output.split('\n'): - if not line.strip(): - continue - key, value = line.split(':', 1) - key = key.lower().replace(' ', '') - value = value.strip() - d[key] = value - try: - self.url = d['url'] - except KeyError: - raise ValueError("Not a versioned resource") - #raise ValueError, "Not a versioned resource %r" % path - self.kind = d['nodekind'] == 'directory' and 'dir' or d['nodekind'] - try: - self.rev = int(d['revision']) - except KeyError: - self.rev = None - - self.path = py.path.local(d['path']) - self.size = self.path.size() - if 'lastchangedrev' in d: - self.created_rev = int(d['lastchangedrev']) - if 'lastchangedauthor' in d: - self.last_author = d['lastchangedauthor'] - if 'lastchangeddate' in d: - self.mtime = parse_wcinfotime(d['lastchangeddate']) - self.time = self.mtime * 1000000 - - def __eq__(self, other): - return self.__dict__ == other.__dict__ - -def parse_wcinfotime(timestr): - """ Returns seconds since epoch, UTC. """ - # example: 2003-10-27 20:43:14 +0100 (Mon, 27 Oct 2003) - m = re.match(r'(\d+-\d+-\d+ \d+:\d+:\d+) ([+-]\d+) .*', timestr) - if not m: - raise ValueError("timestring %r does not match" % timestr) - timestr, timezone = m.groups() - # do not handle timezone specially, return value should be UTC - parsedtime = time.strptime(timestr, "%Y-%m-%d %H:%M:%S") - return calendar.timegm(parsedtime) - -def make_recursive_propdict(wcroot, - output, - rex = re.compile("Properties on '(.*)':")): - """ Return a dictionary of path->PropListDict mappings. """ - lines = [x for x in output.split('\n') if x] - pdict = {} - while lines: - line = lines.pop(0) - m = rex.match(line) - if not m: - raise ValueError("could not parse propget-line: %r" % line) - path = m.groups()[0] - wcpath = wcroot.join(path, abs=1) - propnames = [] - while lines and lines[0].startswith(' '): - propname = lines.pop(0).strip() - propnames.append(propname) - assert propnames, "must have found properties!" - pdict[wcpath] = PropListDict(wcpath, propnames) - return pdict - - -def importxml(cache=[]): - if cache: - return cache - from xml.dom import minidom - from xml.parsers.expat import ExpatError - cache.extend([minidom, ExpatError]) - return cache - -class LogEntry: - def __init__(self, logentry): - self.rev = int(logentry.getAttribute('revision')) - for lpart in filter(None, logentry.childNodes): - if lpart.nodeType == lpart.ELEMENT_NODE: - if lpart.nodeName == 'author': - self.author = lpart.firstChild.nodeValue - elif lpart.nodeName == 'msg': - if lpart.firstChild: - self.msg = lpart.firstChild.nodeValue - else: - self.msg = '' - elif lpart.nodeName == 'date': - #2003-07-29T20:05:11.598637Z - timestr = lpart.firstChild.nodeValue - self.date = parse_apr_time(timestr) - elif lpart.nodeName == 'paths': - self.strpaths = [] - for ppart in filter(None, lpart.childNodes): - if ppart.nodeType == ppart.ELEMENT_NODE: - self.strpaths.append(PathEntry(ppart)) - def __repr__(self): - return '' % ( - self.rev, self.author, self.date) - - diff --git a/lib/spack/external/py/_process/__init__.py b/lib/spack/external/py/_process/__init__.py deleted file mode 100644 index 86c714ad1a..0000000000 --- a/lib/spack/external/py/_process/__init__.py +++ /dev/null @@ -1 +0,0 @@ -""" high-level sub-process handling """ diff --git a/lib/spack/external/py/_process/cmdexec.py b/lib/spack/external/py/_process/cmdexec.py deleted file mode 100644 index f83a249402..0000000000 --- a/lib/spack/external/py/_process/cmdexec.py +++ /dev/null @@ -1,49 +0,0 @@ -import sys -import subprocess -import py -from subprocess import Popen, PIPE - -def cmdexec(cmd): - """ return unicode output of executing 'cmd' in a separate process. - - raise cmdexec.Error exeception if the command failed. - the exception will provide an 'err' attribute containing - the error-output from the command. - if the subprocess module does not provide a proper encoding/unicode strings - sys.getdefaultencoding() will be used, if that does not exist, 'UTF-8'. - """ - process = subprocess.Popen(cmd, shell=True, - universal_newlines=True, - stdout=subprocess.PIPE, stderr=subprocess.PIPE) - out, err = process.communicate() - if sys.version_info[0] < 3: # on py3 we get unicode strings, on py2 not - try: - default_encoding = sys.getdefaultencoding() # jython may not have it - except AttributeError: - default_encoding = sys.stdout.encoding or 'UTF-8' - out = unicode(out, process.stdout.encoding or default_encoding) - err = unicode(err, process.stderr.encoding or default_encoding) - status = process.poll() - if status: - raise ExecutionFailed(status, status, cmd, out, err) - return out - -class ExecutionFailed(py.error.Error): - def __init__(self, status, systemstatus, cmd, out, err): - Exception.__init__(self) - self.status = status - self.systemstatus = systemstatus - self.cmd = cmd - self.err = err - self.out = out - - def __str__(self): - return "ExecutionFailed: %d %s\n%s" %(self.status, self.cmd, self.err) - -# export the exception under the name 'py.process.cmdexec.Error' -cmdexec.Error = ExecutionFailed -try: - ExecutionFailed.__module__ = 'py.process.cmdexec' - ExecutionFailed.__name__ = 'Error' -except (AttributeError, TypeError): - pass diff --git a/lib/spack/external/py/_process/forkedfunc.py b/lib/spack/external/py/_process/forkedfunc.py deleted file mode 100644 index 1c28530688..0000000000 --- a/lib/spack/external/py/_process/forkedfunc.py +++ /dev/null @@ -1,120 +0,0 @@ - -""" - ForkedFunc provides a way to run a function in a forked process - and get at its return value, stdout and stderr output as well - as signals and exitstatusus. -""" - -import py -import os -import sys -import marshal - - -def get_unbuffered_io(fd, filename): - f = open(str(filename), "w") - if fd != f.fileno(): - os.dup2(f.fileno(), fd) - class AutoFlush: - def write(self, data): - f.write(data) - f.flush() - def __getattr__(self, name): - return getattr(f, name) - return AutoFlush() - - -class ForkedFunc: - EXITSTATUS_EXCEPTION = 3 - - - def __init__(self, fun, args=None, kwargs=None, nice_level=0, - child_on_start=None, child_on_exit=None): - if args is None: - args = [] - if kwargs is None: - kwargs = {} - self.fun = fun - self.args = args - self.kwargs = kwargs - self.tempdir = tempdir = py.path.local.mkdtemp() - self.RETVAL = tempdir.ensure('retval') - self.STDOUT = tempdir.ensure('stdout') - self.STDERR = tempdir.ensure('stderr') - - pid = os.fork() - if pid: # in parent process - self.pid = pid - else: # in child process - self.pid = None - self._child(nice_level, child_on_start, child_on_exit) - - def _child(self, nice_level, child_on_start, child_on_exit): - # right now we need to call a function, but first we need to - # map all IO that might happen - sys.stdout = stdout = get_unbuffered_io(1, self.STDOUT) - sys.stderr = stderr = get_unbuffered_io(2, self.STDERR) - retvalf = self.RETVAL.open("wb") - EXITSTATUS = 0 - try: - if nice_level: - os.nice(nice_level) - try: - if child_on_start is not None: - child_on_start() - retval = self.fun(*self.args, **self.kwargs) - retvalf.write(marshal.dumps(retval)) - if child_on_exit is not None: - child_on_exit() - except: - excinfo = py.code.ExceptionInfo() - stderr.write(str(excinfo._getreprcrash())) - EXITSTATUS = self.EXITSTATUS_EXCEPTION - finally: - stdout.close() - stderr.close() - retvalf.close() - os.close(1) - os.close(2) - os._exit(EXITSTATUS) - - def waitfinish(self, waiter=os.waitpid): - pid, systemstatus = waiter(self.pid, 0) - if systemstatus: - if os.WIFSIGNALED(systemstatus): - exitstatus = os.WTERMSIG(systemstatus) + 128 - else: - exitstatus = os.WEXITSTATUS(systemstatus) - else: - exitstatus = 0 - signal = systemstatus & 0x7f - if not exitstatus and not signal: - retval = self.RETVAL.open('rb') - try: - retval_data = retval.read() - finally: - retval.close() - retval = marshal.loads(retval_data) - else: - retval = None - stdout = self.STDOUT.read() - stderr = self.STDERR.read() - self._removetemp() - return Result(exitstatus, signal, retval, stdout, stderr) - - def _removetemp(self): - if self.tempdir.check(): - self.tempdir.remove() - - def __del__(self): - if self.pid is not None: # only clean up in main process - self._removetemp() - - -class Result(object): - def __init__(self, exitstatus, signal, retval, stdout, stderr): - self.exitstatus = exitstatus - self.signal = signal - self.retval = retval - self.out = stdout - self.err = stderr diff --git a/lib/spack/external/py/_process/killproc.py b/lib/spack/external/py/_process/killproc.py deleted file mode 100644 index 18e8310b5f..0000000000 --- a/lib/spack/external/py/_process/killproc.py +++ /dev/null @@ -1,23 +0,0 @@ -import py -import os, sys - -if sys.platform == "win32" or getattr(os, '_name', '') == 'nt': - try: - import ctypes - except ImportError: - def dokill(pid): - py.process.cmdexec("taskkill /F /PID %d" %(pid,)) - else: - def dokill(pid): - PROCESS_TERMINATE = 1 - handle = ctypes.windll.kernel32.OpenProcess( - PROCESS_TERMINATE, False, pid) - ctypes.windll.kernel32.TerminateProcess(handle, -1) - ctypes.windll.kernel32.CloseHandle(handle) -else: - def dokill(pid): - os.kill(pid, 15) - -def kill(pid): - """ kill process by id. """ - dokill(pid) diff --git a/lib/spack/external/py/_std.py b/lib/spack/external/py/_std.py deleted file mode 100644 index 97a9853323..0000000000 --- a/lib/spack/external/py/_std.py +++ /dev/null @@ -1,18 +0,0 @@ -import sys - -class Std(object): - """ makes top-level python modules available as an attribute, - importing them on first access. - """ - - def __init__(self): - self.__dict__ = sys.modules - - def __getattr__(self, name): - try: - m = __import__(name) - except ImportError: - raise AttributeError("py.std: could not import %s" % name) - return m - -std = Std() diff --git a/lib/spack/external/py/_xmlgen.py b/lib/spack/external/py/_xmlgen.py deleted file mode 100644 index 1c83545884..0000000000 --- a/lib/spack/external/py/_xmlgen.py +++ /dev/null @@ -1,255 +0,0 @@ -""" -module for generating and serializing xml and html structures -by using simple python objects. - -(c) holger krekel, holger at merlinux eu. 2009 -""" -import sys, re - -if sys.version_info >= (3,0): - def u(s): - return s - def unicode(x, errors=None): - if hasattr(x, '__unicode__'): - return x.__unicode__() - return str(x) -else: - def u(s): - return unicode(s) - unicode = unicode - - -class NamespaceMetaclass(type): - def __getattr__(self, name): - if name[:1] == '_': - raise AttributeError(name) - if self == Namespace: - raise ValueError("Namespace class is abstract") - tagspec = self.__tagspec__ - if tagspec is not None and name not in tagspec: - raise AttributeError(name) - classattr = {} - if self.__stickyname__: - classattr['xmlname'] = name - cls = type(name, (self.__tagclass__,), classattr) - setattr(self, name, cls) - return cls - -class Tag(list): - class Attr(object): - def __init__(self, **kwargs): - self.__dict__.update(kwargs) - - def __init__(self, *args, **kwargs): - super(Tag, self).__init__(args) - self.attr = self.Attr(**kwargs) - - def __unicode__(self): - return self.unicode(indent=0) - __str__ = __unicode__ - - def unicode(self, indent=2): - l = [] - SimpleUnicodeVisitor(l.append, indent).visit(self) - return u("").join(l) - - def __repr__(self): - name = self.__class__.__name__ - return "<%r tag object %d>" % (name, id(self)) - -Namespace = NamespaceMetaclass('Namespace', (object, ), { - '__tagspec__': None, - '__tagclass__': Tag, - '__stickyname__': False, -}) - -class HtmlTag(Tag): - def unicode(self, indent=2): - l = [] - HtmlVisitor(l.append, indent, shortempty=False).visit(self) - return u("").join(l) - -# exported plain html namespace -class html(Namespace): - __tagclass__ = HtmlTag - __stickyname__ = True - __tagspec__ = dict([(x,1) for x in ( - 'a,abbr,acronym,address,applet,area,article,aside,audio,b,' - 'base,basefont,bdi,bdo,big,blink,blockquote,body,br,button,' - 'canvas,caption,center,cite,code,col,colgroup,command,comment,' - 'datalist,dd,del,details,dfn,dir,div,dl,dt,em,embed,' - 'fieldset,figcaption,figure,footer,font,form,frame,frameset,h1,' - 'h2,h3,h4,h5,h6,head,header,hgroup,hr,html,i,iframe,img,input,' - 'ins,isindex,kbd,keygen,label,legend,li,link,listing,map,mark,' - 'marquee,menu,meta,meter,multicol,nav,nobr,noembed,noframes,' - 'noscript,object,ol,optgroup,option,output,p,param,pre,progress,' - 'q,rp,rt,ruby,s,samp,script,section,select,small,source,span,' - 'strike,strong,style,sub,summary,sup,table,tbody,td,textarea,' - 'tfoot,th,thead,time,title,tr,track,tt,u,ul,xmp,var,video,wbr' - ).split(',') if x]) - - class Style(object): - def __init__(self, **kw): - for x, y in kw.items(): - x = x.replace('_', '-') - setattr(self, x, y) - - -class raw(object): - """just a box that can contain a unicode string that will be - included directly in the output""" - def __init__(self, uniobj): - self.uniobj = uniobj - -class SimpleUnicodeVisitor(object): - """ recursive visitor to write unicode. """ - def __init__(self, write, indent=0, curindent=0, shortempty=True): - self.write = write - self.cache = {} - self.visited = {} # for detection of recursion - self.indent = indent - self.curindent = curindent - self.parents = [] - self.shortempty = shortempty # short empty tags or not - - def visit(self, node): - """ dispatcher on node's class/bases name. """ - cls = node.__class__ - try: - visitmethod = self.cache[cls] - except KeyError: - for subclass in cls.__mro__: - visitmethod = getattr(self, subclass.__name__, None) - if visitmethod is not None: - break - else: - visitmethod = self.__object - self.cache[cls] = visitmethod - visitmethod(node) - - # the default fallback handler is marked private - # to avoid clashes with the tag name object - def __object(self, obj): - #self.write(obj) - self.write(escape(unicode(obj))) - - def raw(self, obj): - self.write(obj.uniobj) - - def list(self, obj): - assert id(obj) not in self.visited - self.visited[id(obj)] = 1 - for elem in obj: - self.visit(elem) - - def Tag(self, tag): - assert id(tag) not in self.visited - try: - tag.parent = self.parents[-1] - except IndexError: - tag.parent = None - self.visited[id(tag)] = 1 - tagname = getattr(tag, 'xmlname', tag.__class__.__name__) - if self.curindent and not self._isinline(tagname): - self.write("\n" + u(' ') * self.curindent) - if tag: - self.curindent += self.indent - self.write(u('<%s%s>') % (tagname, self.attributes(tag))) - self.parents.append(tag) - for x in tag: - self.visit(x) - self.parents.pop() - self.write(u('') % tagname) - self.curindent -= self.indent - else: - nameattr = tagname+self.attributes(tag) - if self._issingleton(tagname): - self.write(u('<%s/>') % (nameattr,)) - else: - self.write(u('<%s>') % (nameattr, tagname)) - - def attributes(self, tag): - # serialize attributes - attrlist = dir(tag.attr) - attrlist.sort() - l = [] - for name in attrlist: - res = self.repr_attribute(tag.attr, name) - if res is not None: - l.append(res) - l.extend(self.getstyle(tag)) - return u("").join(l) - - def repr_attribute(self, attrs, name): - if name[:2] != '__': - value = getattr(attrs, name) - if name.endswith('_'): - name = name[:-1] - if isinstance(value, raw): - insert = value.uniobj - else: - insert = escape(unicode(value)) - return ' %s="%s"' % (name, insert) - - def getstyle(self, tag): - """ return attribute list suitable for styling. """ - try: - styledict = tag.style.__dict__ - except AttributeError: - return [] - else: - stylelist = [x+': ' + y for x,y in styledict.items()] - return [u(' style="%s"') % u('; ').join(stylelist)] - - def _issingleton(self, tagname): - """can (and will) be overridden in subclasses""" - return self.shortempty - - def _isinline(self, tagname): - """can (and will) be overridden in subclasses""" - return False - -class HtmlVisitor(SimpleUnicodeVisitor): - - single = dict([(x, 1) for x in - ('br,img,area,param,col,hr,meta,link,base,' - 'input,frame').split(',')]) - inline = dict([(x, 1) for x in - ('a abbr acronym b basefont bdo big br cite code dfn em font ' - 'i img input kbd label q s samp select small span strike ' - 'strong sub sup textarea tt u var'.split(' '))]) - - def repr_attribute(self, attrs, name): - if name == 'class_': - value = getattr(attrs, name) - if value is None: - return - return super(HtmlVisitor, self).repr_attribute(attrs, name) - - def _issingleton(self, tagname): - return tagname in self.single - - def _isinline(self, tagname): - return tagname in self.inline - - -class _escape: - def __init__(self): - self.escape = { - u('"') : u('"'), u('<') : u('<'), u('>') : u('>'), - u('&') : u('&'), u("'") : u('''), - } - self.charef_rex = re.compile(u("|").join(self.escape.keys())) - - def _replacer(self, match): - return self.escape[match.group(0)] - - def __call__(self, ustring): - """ xml-escape the given unicode string. """ - try: - ustring = unicode(ustring) - except UnicodeDecodeError: - ustring = unicode(ustring, 'utf-8', errors='replace') - return self.charef_rex.sub(self._replacer, ustring) - -escape = _escape() diff --git a/lib/spack/external/py/test.py b/lib/spack/external/py/test.py deleted file mode 100644 index aa5beb1789..0000000000 --- a/lib/spack/external/py/test.py +++ /dev/null @@ -1,10 +0,0 @@ -import sys -if __name__ == '__main__': - import pytest - sys.exit(pytest.main()) -else: - import sys, pytest - sys.modules['py.test'] = pytest - -# for more API entry points see the 'tests' definition -# in __init__.py diff --git a/lib/spack/external/pytest-fallback/_pytest/LICENSE b/lib/spack/external/pytest-fallback/_pytest/LICENSE new file mode 100644 index 0000000000..629df45ac4 --- /dev/null +++ b/lib/spack/external/pytest-fallback/_pytest/LICENSE @@ -0,0 +1,21 @@ +The MIT License (MIT) + +Copyright (c) 2004-2017 Holger Krekel and others + +Permission is hereby granted, free of charge, to any person obtaining a copy of +this software and associated documentation files (the "Software"), to deal in +the Software without restriction, including without limitation the rights to +use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies +of the Software, and to permit persons to whom the Software is furnished to do +so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all +copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE +SOFTWARE. diff --git a/lib/spack/external/pytest-fallback/_pytest/__init__.py b/lib/spack/external/pytest-fallback/_pytest/__init__.py new file mode 100644 index 0000000000..6e41f0504e --- /dev/null +++ b/lib/spack/external/pytest-fallback/_pytest/__init__.py @@ -0,0 +1,8 @@ +__all__ = ['__version__'] + +try: + from ._version import version as __version__ +except ImportError: + # broken installation, we don't even try + # unknown only works because we do poor mans version compare + __version__ = 'unknown' diff --git a/lib/spack/external/pytest-fallback/_pytest/_argcomplete.py b/lib/spack/external/pytest-fallback/_pytest/_argcomplete.py new file mode 100644 index 0000000000..965ec79513 --- /dev/null +++ b/lib/spack/external/pytest-fallback/_pytest/_argcomplete.py @@ -0,0 +1,106 @@ + +"""allow bash-completion for argparse with argcomplete if installed +needs argcomplete>=0.5.6 for python 3.2/3.3 (older versions fail +to find the magic string, so _ARGCOMPLETE env. var is never set, and +this does not need special code. + +argcomplete does not support python 2.5 (although the changes for that +are minor). + +Function try_argcomplete(parser) should be called directly before +the call to ArgumentParser.parse_args(). + +The filescompleter is what you normally would use on the positional +arguments specification, in order to get "dirname/" after "dirn" +instead of the default "dirname ": + + optparser.add_argument(Config._file_or_dir, nargs='*' + ).completer=filescompleter + +Other, application specific, completers should go in the file +doing the add_argument calls as they need to be specified as .completer +attributes as well. (If argcomplete is not installed, the function the +attribute points to will not be used). + +SPEEDUP +======= +The generic argcomplete script for bash-completion +(/etc/bash_completion.d/python-argcomplete.sh ) +uses a python program to determine startup script generated by pip. +You can speed up completion somewhat by changing this script to include + # PYTHON_ARGCOMPLETE_OK +so the the python-argcomplete-check-easy-install-script does not +need to be called to find the entry point of the code and see if that is +marked with PYTHON_ARGCOMPLETE_OK + +INSTALL/DEBUGGING +================= +To include this support in another application that has setup.py generated +scripts: +- add the line: + # PYTHON_ARGCOMPLETE_OK + near the top of the main python entry point +- include in the file calling parse_args(): + from _argcomplete import try_argcomplete, filescompleter + , call try_argcomplete just before parse_args(), and optionally add + filescompleter to the positional arguments' add_argument() +If things do not work right away: +- switch on argcomplete debugging with (also helpful when doing custom + completers): + export _ARC_DEBUG=1 +- run: + python-argcomplete-check-easy-install-script $(which appname) + echo $? + will echo 0 if the magic line has been found, 1 if not +- sometimes it helps to find early on errors using: + _ARGCOMPLETE=1 _ARC_DEBUG=1 appname + which should throw a KeyError: 'COMPLINE' (which is properly set by the + global argcomplete script). +""" +from __future__ import absolute_import, division, print_function +import sys +import os +from glob import glob + + +class FastFilesCompleter: + 'Fast file completer class' + + def __init__(self, directories=True): + self.directories = directories + + def __call__(self, prefix, **kwargs): + """only called on non option completions""" + if os.path.sep in prefix[1:]: + prefix_dir = len(os.path.dirname(prefix) + os.path.sep) + else: + prefix_dir = 0 + completion = [] + globbed = [] + if '*' not in prefix and '?' not in prefix: + # we are on unix, otherwise no bash + if not prefix or prefix[-1] == os.path.sep: + globbed.extend(glob(prefix + '.*')) + prefix += '*' + globbed.extend(glob(prefix)) + for x in sorted(globbed): + if os.path.isdir(x): + x += '/' + # append stripping the prefix (like bash, not like compgen) + completion.append(x[prefix_dir:]) + return completion + + +if os.environ.get('_ARGCOMPLETE'): + try: + import argcomplete.completers + except ImportError: + sys.exit(-1) + filescompleter = FastFilesCompleter() + + def try_argcomplete(parser): + argcomplete.autocomplete(parser, always_complete_options=False) +else: + def try_argcomplete(parser): + pass + filescompleter = None diff --git a/lib/spack/external/pytest-fallback/_pytest/_code/__init__.py b/lib/spack/external/pytest-fallback/_pytest/_code/__init__.py new file mode 100644 index 0000000000..815c13b42c --- /dev/null +++ b/lib/spack/external/pytest-fallback/_pytest/_code/__init__.py @@ -0,0 +1,10 @@ +""" python inspection/code generation API """ +from __future__ import absolute_import, division, print_function +from .code import Code # noqa +from .code import ExceptionInfo # noqa +from .code import Frame # noqa +from .code import Traceback # noqa +from .code import getrawcode # noqa +from .source import Source # noqa +from .source import compile_ as compile # noqa +from .source import getfslineno # noqa diff --git a/lib/spack/external/pytest-fallback/_pytest/_code/_py2traceback.py b/lib/spack/external/pytest-fallback/_pytest/_code/_py2traceback.py new file mode 100644 index 0000000000..5aacf0a428 --- /dev/null +++ b/lib/spack/external/pytest-fallback/_pytest/_code/_py2traceback.py @@ -0,0 +1,85 @@ +# copied from python-2.7.3's traceback.py +# CHANGES: +# - some_str is replaced, trying to create unicode strings +# +from __future__ import absolute_import, division, print_function +import types + + +def format_exception_only(etype, value): + """Format the exception part of a traceback. + + The arguments are the exception type and value such as given by + sys.last_type and sys.last_value. The return value is a list of + strings, each ending in a newline. + + Normally, the list contains a single string; however, for + SyntaxError exceptions, it contains several lines that (when + printed) display detailed information about where the syntax + error occurred. + + The message indicating which exception occurred is always the last + string in the list. + + """ + + # An instance should not have a meaningful value parameter, but + # sometimes does, particularly for string exceptions, such as + # >>> raise string1, string2 # deprecated + # + # Clear these out first because issubtype(string1, SyntaxError) + # would throw another exception and mask the original problem. + if (isinstance(etype, BaseException) or + isinstance(etype, types.InstanceType) or + etype is None or type(etype) is str): + return [_format_final_exc_line(etype, value)] + + stype = etype.__name__ + + if not issubclass(etype, SyntaxError): + return [_format_final_exc_line(stype, value)] + + # It was a syntax error; show exactly where the problem was found. + lines = [] + try: + msg, (filename, lineno, offset, badline) = value.args + except Exception: + pass + else: + filename = filename or "" + lines.append(' File "%s", line %d\n' % (filename, lineno)) + if badline is not None: + if isinstance(badline, bytes): # python 2 only + badline = badline.decode('utf-8', 'replace') + lines.append(u' %s\n' % badline.strip()) + if offset is not None: + caretspace = badline.rstrip('\n')[:offset].lstrip() + # non-space whitespace (likes tabs) must be kept for alignment + caretspace = ((c.isspace() and c or ' ') for c in caretspace) + # only three spaces to account for offset1 == pos 0 + lines.append(' %s^\n' % ''.join(caretspace)) + value = msg + + lines.append(_format_final_exc_line(stype, value)) + return lines + + +def _format_final_exc_line(etype, value): + """Return a list of a single line -- normal case for format_exception_only""" + valuestr = _some_str(value) + if value is None or not valuestr: + line = "%s\n" % etype + else: + line = "%s: %s\n" % (etype, valuestr) + return line + + +def _some_str(value): + try: + return unicode(value) + except Exception: + try: + return str(value) + except Exception: + pass + return '' % type(value).__name__ diff --git a/lib/spack/external/pytest-fallback/_pytest/_code/code.py b/lib/spack/external/pytest-fallback/_pytest/_code/code.py new file mode 100644 index 0000000000..f3b7eedfce --- /dev/null +++ b/lib/spack/external/pytest-fallback/_pytest/_code/code.py @@ -0,0 +1,908 @@ +from __future__ import absolute_import, division, print_function +import sys +from inspect import CO_VARARGS, CO_VARKEYWORDS +import re +from weakref import ref +from _pytest.compat import _PY2, _PY3, PY35, safe_str + +import py +builtin_repr = repr + +reprlib = py.builtin._tryimport('repr', 'reprlib') + +if _PY3: + from traceback import format_exception_only +else: + from ._py2traceback import format_exception_only + + +class Code(object): + """ wrapper around Python code objects """ + + def __init__(self, rawcode): + if not hasattr(rawcode, "co_filename"): + rawcode = getrawcode(rawcode) + try: + self.filename = rawcode.co_filename + self.firstlineno = rawcode.co_firstlineno - 1 + self.name = rawcode.co_name + except AttributeError: + raise TypeError("not a code object: %r" % (rawcode,)) + self.raw = rawcode + + def __eq__(self, other): + return self.raw == other.raw + + __hash__ = None + + def __ne__(self, other): + return not self == other + + @property + def path(self): + """ return a path object pointing to source code (note that it + might not point to an actually existing file). """ + try: + p = py.path.local(self.raw.co_filename) + # maybe don't try this checking + if not p.check(): + raise OSError("py.path check failed.") + except OSError: + # XXX maybe try harder like the weird logic + # in the standard lib [linecache.updatecache] does? + p = self.raw.co_filename + + return p + + @property + def fullsource(self): + """ return a _pytest._code.Source object for the full source file of the code + """ + from _pytest._code import source + full, _ = source.findsource(self.raw) + return full + + def source(self): + """ return a _pytest._code.Source object for the code object's source only + """ + # return source only for that part of code + import _pytest._code + return _pytest._code.Source(self.raw) + + def getargs(self, var=False): + """ return a tuple with the argument names for the code object + + if 'var' is set True also return the names of the variable and + keyword arguments when present + """ + # handfull shortcut for getting args + raw = self.raw + argcount = raw.co_argcount + if var: + argcount += raw.co_flags & CO_VARARGS + argcount += raw.co_flags & CO_VARKEYWORDS + return raw.co_varnames[:argcount] + + +class Frame(object): + """Wrapper around a Python frame holding f_locals and f_globals + in which expressions can be evaluated.""" + + def __init__(self, frame): + self.lineno = frame.f_lineno - 1 + self.f_globals = frame.f_globals + self.f_locals = frame.f_locals + self.raw = frame + self.code = Code(frame.f_code) + + @property + def statement(self): + """ statement this frame is at """ + import _pytest._code + if self.code.fullsource is None: + return _pytest._code.Source("") + return self.code.fullsource.getstatement(self.lineno) + + def eval(self, code, **vars): + """ evaluate 'code' in the frame + + 'vars' are optional additional local variables + + returns the result of the evaluation + """ + f_locals = self.f_locals.copy() + f_locals.update(vars) + return eval(code, self.f_globals, f_locals) + + def exec_(self, code, **vars): + """ exec 'code' in the frame + + 'vars' are optiona; additional local variables + """ + f_locals = self.f_locals.copy() + f_locals.update(vars) + py.builtin.exec_(code, self.f_globals, f_locals) + + def repr(self, object): + """ return a 'safe' (non-recursive, one-line) string repr for 'object' + """ + return py.io.saferepr(object) + + def is_true(self, object): + return object + + def getargs(self, var=False): + """ return a list of tuples (name, value) for all arguments + + if 'var' is set True also include the variable and keyword + arguments when present + """ + retval = [] + for arg in self.code.getargs(var): + try: + retval.append((arg, self.f_locals[arg])) + except KeyError: + pass # this can occur when using Psyco + return retval + + +class TracebackEntry(object): + """ a single entry in a traceback """ + + _repr_style = None + exprinfo = None + + def __init__(self, rawentry, excinfo=None): + self._excinfo = excinfo + self._rawentry = rawentry + self.lineno = rawentry.tb_lineno - 1 + + def set_repr_style(self, mode): + assert mode in ("short", "long") + self._repr_style = mode + + @property + def frame(self): + import _pytest._code + return _pytest._code.Frame(self._rawentry.tb_frame) + + @property + def relline(self): + return self.lineno - self.frame.code.firstlineno + + def __repr__(self): + return "" % (self.frame.code.path, self.lineno + 1) + + @property + def statement(self): + """ _pytest._code.Source object for the current statement """ + source = self.frame.code.fullsource + return source.getstatement(self.lineno) + + @property + def path(self): + """ path to the source code """ + return self.frame.code.path + + def getlocals(self): + return self.frame.f_locals + locals = property(getlocals, None, None, "locals of underlaying frame") + + def getfirstlinesource(self): + # on Jython this firstlineno can be -1 apparently + return max(self.frame.code.firstlineno, 0) + + def getsource(self, astcache=None): + """ return failing source code. """ + # we use the passed in astcache to not reparse asttrees + # within exception info printing + from _pytest._code.source import getstatementrange_ast + source = self.frame.code.fullsource + if source is None: + return None + key = astnode = None + if astcache is not None: + key = self.frame.code.path + if key is not None: + astnode = astcache.get(key, None) + start = self.getfirstlinesource() + try: + astnode, _, end = getstatementrange_ast(self.lineno, source, + astnode=astnode) + except SyntaxError: + end = self.lineno + 1 + else: + if key is not None: + astcache[key] = astnode + return source[start:end] + + source = property(getsource) + + def ishidden(self): + """ return True if the current frame has a var __tracebackhide__ + resolving to True + + If __tracebackhide__ is a callable, it gets called with the + ExceptionInfo instance and can decide whether to hide the traceback. + + mostly for internal use + """ + try: + tbh = self.frame.f_locals['__tracebackhide__'] + except KeyError: + try: + tbh = self.frame.f_globals['__tracebackhide__'] + except KeyError: + return False + + if py.builtin.callable(tbh): + return tbh(None if self._excinfo is None else self._excinfo()) + else: + return tbh + + def __str__(self): + try: + fn = str(self.path) + except py.error.Error: + fn = '???' + name = self.frame.code.name + try: + line = str(self.statement).lstrip() + except KeyboardInterrupt: + raise + except: # noqa + line = "???" + return " File %r:%d in %s\n %s\n" % (fn, self.lineno + 1, name, line) + + def name(self): + return self.frame.code.raw.co_name + name = property(name, None, None, "co_name of underlaying code") + + +class Traceback(list): + """ Traceback objects encapsulate and offer higher level + access to Traceback entries. + """ + Entry = TracebackEntry + + def __init__(self, tb, excinfo=None): + """ initialize from given python traceback object and ExceptionInfo """ + self._excinfo = excinfo + if hasattr(tb, 'tb_next'): + def f(cur): + while cur is not None: + yield self.Entry(cur, excinfo=excinfo) + cur = cur.tb_next + list.__init__(self, f(tb)) + else: + list.__init__(self, tb) + + def cut(self, path=None, lineno=None, firstlineno=None, excludepath=None): + """ return a Traceback instance wrapping part of this Traceback + + by provding any combination of path, lineno and firstlineno, the + first frame to start the to-be-returned traceback is determined + + this allows cutting the first part of a Traceback instance e.g. + for formatting reasons (removing some uninteresting bits that deal + with handling of the exception/traceback) + """ + for x in self: + code = x.frame.code + codepath = code.path + if ((path is None or codepath == path) and + (excludepath is None or not hasattr(codepath, 'relto') or + not codepath.relto(excludepath)) and + (lineno is None or x.lineno == lineno) and + (firstlineno is None or x.frame.code.firstlineno == firstlineno)): + return Traceback(x._rawentry, self._excinfo) + return self + + def __getitem__(self, key): + val = super(Traceback, self).__getitem__(key) + if isinstance(key, type(slice(0))): + val = self.__class__(val) + return val + + def filter(self, fn=lambda x: not x.ishidden()): + """ return a Traceback instance with certain items removed + + fn is a function that gets a single argument, a TracebackEntry + instance, and should return True when the item should be added + to the Traceback, False when not + + by default this removes all the TracebackEntries which are hidden + (see ishidden() above) + """ + return Traceback(filter(fn, self), self._excinfo) + + def getcrashentry(self): + """ return last non-hidden traceback entry that lead + to the exception of a traceback. + """ + for i in range(-1, -len(self) - 1, -1): + entry = self[i] + if not entry.ishidden(): + return entry + return self[-1] + + def recursionindex(self): + """ return the index of the frame/TracebackEntry where recursion + originates if appropriate, None if no recursion occurred + """ + cache = {} + for i, entry in enumerate(self): + # id for the code.raw is needed to work around + # the strange metaprogramming in the decorator lib from pypi + # which generates code objects that have hash/value equality + # XXX needs a test + key = entry.frame.code.path, id(entry.frame.code.raw), entry.lineno + # print "checking for recursion at", key + values = cache.setdefault(key, []) + if values: + f = entry.frame + loc = f.f_locals + for otherloc in values: + if f.is_true(f.eval(co_equal, + __recursioncache_locals_1=loc, + __recursioncache_locals_2=otherloc)): + return i + values.append(entry.frame.f_locals) + return None + + +co_equal = compile('__recursioncache_locals_1 == __recursioncache_locals_2', + '?', 'eval') + + +class ExceptionInfo(object): + """ wraps sys.exc_info() objects and offers + help for navigating the traceback. + """ + _striptext = '' + _assert_start_repr = "AssertionError(u\'assert " if _PY2 else "AssertionError(\'assert " + + def __init__(self, tup=None, exprinfo=None): + import _pytest._code + if tup is None: + tup = sys.exc_info() + if exprinfo is None and isinstance(tup[1], AssertionError): + exprinfo = getattr(tup[1], 'msg', None) + if exprinfo is None: + exprinfo = py.io.saferepr(tup[1]) + if exprinfo and exprinfo.startswith(self._assert_start_repr): + self._striptext = 'AssertionError: ' + self._excinfo = tup + #: the exception class + self.type = tup[0] + #: the exception instance + self.value = tup[1] + #: the exception raw traceback + self.tb = tup[2] + #: the exception type name + self.typename = self.type.__name__ + #: the exception traceback (_pytest._code.Traceback instance) + self.traceback = _pytest._code.Traceback(self.tb, excinfo=ref(self)) + + def __repr__(self): + return "" % (self.typename, len(self.traceback)) + + def exconly(self, tryshort=False): + """ return the exception as a string + + when 'tryshort' resolves to True, and the exception is a + _pytest._code._AssertionError, only the actual exception part of + the exception representation is returned (so 'AssertionError: ' is + removed from the beginning) + """ + lines = format_exception_only(self.type, self.value) + text = ''.join(lines) + text = text.rstrip() + if tryshort: + if text.startswith(self._striptext): + text = text[len(self._striptext):] + return text + + def errisinstance(self, exc): + """ return True if the exception is an instance of exc """ + return isinstance(self.value, exc) + + def _getreprcrash(self): + exconly = self.exconly(tryshort=True) + entry = self.traceback.getcrashentry() + path, lineno = entry.frame.code.raw.co_filename, entry.lineno + return ReprFileLocation(path, lineno + 1, exconly) + + def getrepr(self, showlocals=False, style="long", + abspath=False, tbfilter=True, funcargs=False): + """ return str()able representation of this exception info. + showlocals: show locals per traceback entry + style: long|short|no|native traceback style + tbfilter: hide entries (where __tracebackhide__ is true) + + in case of style==native, tbfilter and showlocals is ignored. + """ + if style == 'native': + return ReprExceptionInfo(ReprTracebackNative( + py.std.traceback.format_exception( + self.type, + self.value, + self.traceback[0]._rawentry, + )), self._getreprcrash()) + + fmt = FormattedExcinfo(showlocals=showlocals, style=style, + abspath=abspath, tbfilter=tbfilter, funcargs=funcargs) + return fmt.repr_excinfo(self) + + def __str__(self): + entry = self.traceback[-1] + loc = ReprFileLocation(entry.path, entry.lineno + 1, self.exconly()) + return str(loc) + + def __unicode__(self): + entry = self.traceback[-1] + loc = ReprFileLocation(entry.path, entry.lineno + 1, self.exconly()) + return unicode(loc) + + def match(self, regexp): + """ + Match the regular expression 'regexp' on the string representation of + the exception. If it matches then True is returned (so that it is + possible to write 'assert excinfo.match()'). If it doesn't match an + AssertionError is raised. + """ + __tracebackhide__ = True + if not re.search(regexp, str(self.value)): + assert 0, "Pattern '{0!s}' not found in '{1!s}'".format( + regexp, self.value) + return True + + +class FormattedExcinfo(object): + """ presenting information about failing Functions and Generators. """ + # for traceback entries + flow_marker = ">" + fail_marker = "E" + + def __init__(self, showlocals=False, style="long", abspath=True, tbfilter=True, funcargs=False): + self.showlocals = showlocals + self.style = style + self.tbfilter = tbfilter + self.funcargs = funcargs + self.abspath = abspath + self.astcache = {} + + def _getindent(self, source): + # figure out indent for given source + try: + s = str(source.getstatement(len(source) - 1)) + except KeyboardInterrupt: + raise + except: # noqa + try: + s = str(source[-1]) + except KeyboardInterrupt: + raise + except: # noqa + return 0 + return 4 + (len(s) - len(s.lstrip())) + + def _getentrysource(self, entry): + source = entry.getsource(self.astcache) + if source is not None: + source = source.deindent() + return source + + def _saferepr(self, obj): + return py.io.saferepr(obj) + + def repr_args(self, entry): + if self.funcargs: + args = [] + for argname, argvalue in entry.frame.getargs(var=True): + args.append((argname, self._saferepr(argvalue))) + return ReprFuncArgs(args) + + def get_source(self, source, line_index=-1, excinfo=None, short=False): + """ return formatted and marked up source lines. """ + import _pytest._code + lines = [] + if source is None or line_index >= len(source.lines): + source = _pytest._code.Source("???") + line_index = 0 + if line_index < 0: + line_index += len(source) + space_prefix = " " + if short: + lines.append(space_prefix + source.lines[line_index].strip()) + else: + for line in source.lines[:line_index]: + lines.append(space_prefix + line) + lines.append(self.flow_marker + " " + source.lines[line_index]) + for line in source.lines[line_index + 1:]: + lines.append(space_prefix + line) + if excinfo is not None: + indent = 4 if short else self._getindent(source) + lines.extend(self.get_exconly(excinfo, indent=indent, markall=True)) + return lines + + def get_exconly(self, excinfo, indent=4, markall=False): + lines = [] + indent = " " * indent + # get the real exception information out + exlines = excinfo.exconly(tryshort=True).split('\n') + failindent = self.fail_marker + indent[1:] + for line in exlines: + lines.append(failindent + line) + if not markall: + failindent = indent + return lines + + def repr_locals(self, locals): + if self.showlocals: + lines = [] + keys = [loc for loc in locals if loc[0] != "@"] + keys.sort() + for name in keys: + value = locals[name] + if name == '__builtins__': + lines.append("__builtins__ = ") + else: + # This formatting could all be handled by the + # _repr() function, which is only reprlib.Repr in + # disguise, so is very configurable. + str_repr = self._saferepr(value) + # if len(str_repr) < 70 or not isinstance(value, + # (list, tuple, dict)): + lines.append("%-10s = %s" % (name, str_repr)) + # else: + # self._line("%-10s =\\" % (name,)) + # # XXX + # py.std.pprint.pprint(value, stream=self.excinfowriter) + return ReprLocals(lines) + + def repr_traceback_entry(self, entry, excinfo=None): + import _pytest._code + source = self._getentrysource(entry) + if source is None: + source = _pytest._code.Source("???") + line_index = 0 + else: + # entry.getfirstlinesource() can be -1, should be 0 on jython + line_index = entry.lineno - max(entry.getfirstlinesource(), 0) + + lines = [] + style = entry._repr_style + if style is None: + style = self.style + if style in ("short", "long"): + short = style == "short" + reprargs = self.repr_args(entry) if not short else None + s = self.get_source(source, line_index, excinfo, short=short) + lines.extend(s) + if short: + message = "in %s" % (entry.name) + else: + message = excinfo and excinfo.typename or "" + path = self._makepath(entry.path) + filelocrepr = ReprFileLocation(path, entry.lineno + 1, message) + localsrepr = None + if not short: + localsrepr = self.repr_locals(entry.locals) + return ReprEntry(lines, reprargs, localsrepr, filelocrepr, style) + if excinfo: + lines.extend(self.get_exconly(excinfo, indent=4)) + return ReprEntry(lines, None, None, None, style) + + def _makepath(self, path): + if not self.abspath: + try: + np = py.path.local().bestrelpath(path) + except OSError: + return path + if len(np) < len(str(path)): + path = np + return path + + def repr_traceback(self, excinfo): + traceback = excinfo.traceback + if self.tbfilter: + traceback = traceback.filter() + + if is_recursion_error(excinfo): + traceback, extraline = self._truncate_recursive_traceback(traceback) + else: + extraline = None + + last = traceback[-1] + entries = [] + for index, entry in enumerate(traceback): + einfo = (last == entry) and excinfo or None + reprentry = self.repr_traceback_entry(entry, einfo) + entries.append(reprentry) + return ReprTraceback(entries, extraline, style=self.style) + + def _truncate_recursive_traceback(self, traceback): + """ + Truncate the given recursive traceback trying to find the starting point + of the recursion. + + The detection is done by going through each traceback entry and finding the + point in which the locals of the frame are equal to the locals of a previous frame (see ``recursionindex()``. + + Handle the situation where the recursion process might raise an exception (for example + comparing numpy arrays using equality raises a TypeError), in which case we do our best to + warn the user of the error and show a limited traceback. + """ + try: + recursionindex = traceback.recursionindex() + except Exception as e: + max_frames = 10 + extraline = ( + '!!! Recursion error detected, but an error occurred locating the origin of recursion.\n' + ' The following exception happened when comparing locals in the stack frame:\n' + ' {exc_type}: {exc_msg}\n' + ' Displaying first and last {max_frames} stack frames out of {total}.' + ).format(exc_type=type(e).__name__, exc_msg=safe_str(e), max_frames=max_frames, total=len(traceback)) + traceback = traceback[:max_frames] + traceback[-max_frames:] + else: + if recursionindex is not None: + extraline = "!!! Recursion detected (same locals & position)" + traceback = traceback[:recursionindex + 1] + else: + extraline = None + + return traceback, extraline + + def repr_excinfo(self, excinfo): + if _PY2: + reprtraceback = self.repr_traceback(excinfo) + reprcrash = excinfo._getreprcrash() + + return ReprExceptionInfo(reprtraceback, reprcrash) + else: + repr_chain = [] + e = excinfo.value + descr = None + while e is not None: + if excinfo: + reprtraceback = self.repr_traceback(excinfo) + reprcrash = excinfo._getreprcrash() + else: + # fallback to native repr if the exception doesn't have a traceback: + # ExceptionInfo objects require a full traceback to work + reprtraceback = ReprTracebackNative(py.std.traceback.format_exception(type(e), e, None)) + reprcrash = None + + repr_chain += [(reprtraceback, reprcrash, descr)] + if e.__cause__ is not None: + e = e.__cause__ + excinfo = ExceptionInfo((type(e), e, e.__traceback__)) if e.__traceback__ else None + descr = 'The above exception was the direct cause of the following exception:' + elif (e.__context__ is not None and not e.__suppress_context__): + e = e.__context__ + excinfo = ExceptionInfo((type(e), e, e.__traceback__)) if e.__traceback__ else None + descr = 'During handling of the above exception, another exception occurred:' + else: + e = None + repr_chain.reverse() + return ExceptionChainRepr(repr_chain) + + +class TerminalRepr(object): + def __str__(self): + s = self.__unicode__() + if _PY2: + s = s.encode('utf-8') + return s + + def __unicode__(self): + # FYI this is called from pytest-xdist's serialization of exception + # information. + io = py.io.TextIO() + tw = py.io.TerminalWriter(file=io) + self.toterminal(tw) + return io.getvalue().strip() + + def __repr__(self): + return "<%s instance at %0x>" % (self.__class__, id(self)) + + +class ExceptionRepr(TerminalRepr): + def __init__(self): + self.sections = [] + + def addsection(self, name, content, sep="-"): + self.sections.append((name, content, sep)) + + def toterminal(self, tw): + for name, content, sep in self.sections: + tw.sep(sep, name) + tw.line(content) + + +class ExceptionChainRepr(ExceptionRepr): + def __init__(self, chain): + super(ExceptionChainRepr, self).__init__() + self.chain = chain + # reprcrash and reprtraceback of the outermost (the newest) exception + # in the chain + self.reprtraceback = chain[-1][0] + self.reprcrash = chain[-1][1] + + def toterminal(self, tw): + for element in self.chain: + element[0].toterminal(tw) + if element[2] is not None: + tw.line("") + tw.line(element[2], yellow=True) + super(ExceptionChainRepr, self).toterminal(tw) + + +class ReprExceptionInfo(ExceptionRepr): + def __init__(self, reprtraceback, reprcrash): + super(ReprExceptionInfo, self).__init__() + self.reprtraceback = reprtraceback + self.reprcrash = reprcrash + + def toterminal(self, tw): + self.reprtraceback.toterminal(tw) + super(ReprExceptionInfo, self).toterminal(tw) + + +class ReprTraceback(TerminalRepr): + entrysep = "_ " + + def __init__(self, reprentries, extraline, style): + self.reprentries = reprentries + self.extraline = extraline + self.style = style + + def toterminal(self, tw): + # the entries might have different styles + for i, entry in enumerate(self.reprentries): + if entry.style == "long": + tw.line("") + entry.toterminal(tw) + if i < len(self.reprentries) - 1: + next_entry = self.reprentries[i + 1] + if entry.style == "long" or \ + entry.style == "short" and next_entry.style == "long": + tw.sep(self.entrysep) + + if self.extraline: + tw.line(self.extraline) + + +class ReprTracebackNative(ReprTraceback): + def __init__(self, tblines): + self.style = "native" + self.reprentries = [ReprEntryNative(tblines)] + self.extraline = None + + +class ReprEntryNative(TerminalRepr): + style = "native" + + def __init__(self, tblines): + self.lines = tblines + + def toterminal(self, tw): + tw.write("".join(self.lines)) + + +class ReprEntry(TerminalRepr): + localssep = "_ " + + def __init__(self, lines, reprfuncargs, reprlocals, filelocrepr, style): + self.lines = lines + self.reprfuncargs = reprfuncargs + self.reprlocals = reprlocals + self.reprfileloc = filelocrepr + self.style = style + + def toterminal(self, tw): + if self.style == "short": + self.reprfileloc.toterminal(tw) + for line in self.lines: + red = line.startswith("E ") + tw.line(line, bold=True, red=red) + # tw.line("") + return + if self.reprfuncargs: + self.reprfuncargs.toterminal(tw) + for line in self.lines: + red = line.startswith("E ") + tw.line(line, bold=True, red=red) + if self.reprlocals: + # tw.sep(self.localssep, "Locals") + tw.line("") + self.reprlocals.toterminal(tw) + if self.reprfileloc: + if self.lines: + tw.line("") + self.reprfileloc.toterminal(tw) + + def __str__(self): + return "%s\n%s\n%s" % ("\n".join(self.lines), + self.reprlocals, + self.reprfileloc) + + +class ReprFileLocation(TerminalRepr): + def __init__(self, path, lineno, message): + self.path = str(path) + self.lineno = lineno + self.message = message + + def toterminal(self, tw): + # filename and lineno output for each entry, + # using an output format that most editors unterstand + msg = self.message + i = msg.find("\n") + if i != -1: + msg = msg[:i] + tw.write(self.path, bold=True, red=True) + tw.line(":%s: %s" % (self.lineno, msg)) + + +class ReprLocals(TerminalRepr): + def __init__(self, lines): + self.lines = lines + + def toterminal(self, tw): + for line in self.lines: + tw.line(line) + + +class ReprFuncArgs(TerminalRepr): + def __init__(self, args): + self.args = args + + def toterminal(self, tw): + if self.args: + linesofar = "" + for name, value in self.args: + ns = "%s = %s" % (safe_str(name), safe_str(value)) + if len(ns) + len(linesofar) + 2 > tw.fullwidth: + if linesofar: + tw.line(linesofar) + linesofar = ns + else: + if linesofar: + linesofar += ", " + ns + else: + linesofar = ns + if linesofar: + tw.line(linesofar) + tw.line("") + + +def getrawcode(obj, trycall=True): + """ return code object for given function. """ + try: + return obj.__code__ + except AttributeError: + obj = getattr(obj, 'im_func', obj) + obj = getattr(obj, 'func_code', obj) + obj = getattr(obj, 'f_code', obj) + obj = getattr(obj, '__code__', obj) + if trycall and not hasattr(obj, 'co_firstlineno'): + if hasattr(obj, '__call__') and not py.std.inspect.isclass(obj): + x = getrawcode(obj.__call__, trycall=False) + if hasattr(x, 'co_firstlineno'): + return x + return obj + + +if PY35: # RecursionError introduced in 3.5 + def is_recursion_error(excinfo): + return excinfo.errisinstance(RecursionError) # noqa +else: + def is_recursion_error(excinfo): + if not excinfo.errisinstance(RuntimeError): + return False + try: + return "maximum recursion depth exceeded" in str(excinfo.value) + except UnicodeError: + return False diff --git a/lib/spack/external/pytest-fallback/_pytest/_code/source.py b/lib/spack/external/pytest-fallback/_pytest/_code/source.py new file mode 100644 index 0000000000..fc41712649 --- /dev/null +++ b/lib/spack/external/pytest-fallback/_pytest/_code/source.py @@ -0,0 +1,416 @@ +from __future__ import absolute_import, division, generators, print_function + +from bisect import bisect_right +import sys +import inspect +import tokenize +import py +cpy_compile = compile + +try: + import _ast + from _ast import PyCF_ONLY_AST as _AST_FLAG +except ImportError: + _AST_FLAG = 0 + _ast = None + + +class Source(object): + """ a immutable object holding a source code fragment, + possibly deindenting it. + """ + _compilecounter = 0 + + def __init__(self, *parts, **kwargs): + self.lines = lines = [] + de = kwargs.get('deindent', True) + rstrip = kwargs.get('rstrip', True) + for part in parts: + if not part: + partlines = [] + if isinstance(part, Source): + partlines = part.lines + elif isinstance(part, (tuple, list)): + partlines = [x.rstrip("\n") for x in part] + elif isinstance(part, py.builtin._basestring): + partlines = part.split('\n') + if rstrip: + while partlines: + if partlines[-1].strip(): + break + partlines.pop() + else: + partlines = getsource(part, deindent=de).lines + if de: + partlines = deindent(partlines) + lines.extend(partlines) + + def __eq__(self, other): + try: + return self.lines == other.lines + except AttributeError: + if isinstance(other, str): + return str(self) == other + return False + + __hash__ = None + + def __getitem__(self, key): + if isinstance(key, int): + return self.lines[key] + else: + if key.step not in (None, 1): + raise IndexError("cannot slice a Source with a step") + newsource = Source() + newsource.lines = self.lines[key.start:key.stop] + return newsource + + def __len__(self): + return len(self.lines) + + def strip(self): + """ return new source object with trailing + and leading blank lines removed. + """ + start, end = 0, len(self) + while start < end and not self.lines[start].strip(): + start += 1 + while end > start and not self.lines[end - 1].strip(): + end -= 1 + source = Source() + source.lines[:] = self.lines[start:end] + return source + + def putaround(self, before='', after='', indent=' ' * 4): + """ return a copy of the source object with + 'before' and 'after' wrapped around it. + """ + before = Source(before) + after = Source(after) + newsource = Source() + lines = [(indent + line) for line in self.lines] + newsource.lines = before.lines + lines + after.lines + return newsource + + def indent(self, indent=' ' * 4): + """ return a copy of the source object with + all lines indented by the given indent-string. + """ + newsource = Source() + newsource.lines = [(indent + line) for line in self.lines] + return newsource + + def getstatement(self, lineno, assertion=False): + """ return Source statement which contains the + given linenumber (counted from 0). + """ + start, end = self.getstatementrange(lineno, assertion) + return self[start:end] + + def getstatementrange(self, lineno, assertion=False): + """ return (start, end) tuple which spans the minimal + statement region which containing the given lineno. + """ + if not (0 <= lineno < len(self)): + raise IndexError("lineno out of range") + ast, start, end = getstatementrange_ast(lineno, self) + return start, end + + def deindent(self, offset=None): + """ return a new source object deindented by offset. + If offset is None then guess an indentation offset from + the first non-blank line. Subsequent lines which have a + lower indentation offset will be copied verbatim as + they are assumed to be part of multilines. + """ + # XXX maybe use the tokenizer to properly handle multiline + # strings etc.pp? + newsource = Source() + newsource.lines[:] = deindent(self.lines, offset) + return newsource + + def isparseable(self, deindent=True): + """ return True if source is parseable, heuristically + deindenting it by default. + """ + try: + import parser + except ImportError: + def syntax_checker(x): + return compile(x, 'asd', 'exec') + else: + syntax_checker = parser.suite + + if deindent: + source = str(self.deindent()) + else: + source = str(self) + try: + # compile(source+'\n', "x", "exec") + syntax_checker(source + '\n') + except KeyboardInterrupt: + raise + except Exception: + return False + else: + return True + + def __str__(self): + return "\n".join(self.lines) + + def compile(self, filename=None, mode='exec', + flag=generators.compiler_flag, + dont_inherit=0, _genframe=None): + """ return compiled code object. if filename is None + invent an artificial filename which displays + the source/line position of the caller frame. + """ + if not filename or py.path.local(filename).check(file=0): + if _genframe is None: + _genframe = sys._getframe(1) # the caller + fn, lineno = _genframe.f_code.co_filename, _genframe.f_lineno + base = "<%d-codegen " % self._compilecounter + self.__class__._compilecounter += 1 + if not filename: + filename = base + '%s:%d>' % (fn, lineno) + else: + filename = base + '%r %s:%d>' % (filename, fn, lineno) + source = "\n".join(self.lines) + '\n' + try: + co = cpy_compile(source, filename, mode, flag) + except SyntaxError: + ex = sys.exc_info()[1] + # re-represent syntax errors from parsing python strings + msglines = self.lines[:ex.lineno] + if ex.offset: + msglines.append(" " * ex.offset + '^') + msglines.append("(code was compiled probably from here: %s)" % filename) + newex = SyntaxError('\n'.join(msglines)) + newex.offset = ex.offset + newex.lineno = ex.lineno + newex.text = ex.text + raise newex + else: + if flag & _AST_FLAG: + return co + lines = [(x + "\n") for x in self.lines] + py.std.linecache.cache[filename] = (1, None, lines, filename) + return co + +# +# public API shortcut functions +# + + +def compile_(source, filename=None, mode='exec', flags=generators.compiler_flag, dont_inherit=0): + """ compile the given source to a raw code object, + and maintain an internal cache which allows later + retrieval of the source code for the code object + and any recursively created code objects. + """ + if _ast is not None and isinstance(source, _ast.AST): + # XXX should Source support having AST? + return cpy_compile(source, filename, mode, flags, dont_inherit) + _genframe = sys._getframe(1) # the caller + s = Source(source) + co = s.compile(filename, mode, flags, _genframe=_genframe) + return co + + +def getfslineno(obj): + """ Return source location (path, lineno) for the given object. + If the source cannot be determined return ("", -1) + """ + import _pytest._code + try: + code = _pytest._code.Code(obj) + except TypeError: + try: + fn = (py.std.inspect.getsourcefile(obj) or + py.std.inspect.getfile(obj)) + except TypeError: + return "", -1 + + fspath = fn and py.path.local(fn) or None + lineno = -1 + if fspath: + try: + _, lineno = findsource(obj) + except IOError: + pass + else: + fspath = code.path + lineno = code.firstlineno + assert isinstance(lineno, int) + return fspath, lineno + +# +# helper functions +# + + +def findsource(obj): + try: + sourcelines, lineno = py.std.inspect.findsource(obj) + except py.builtin._sysex: + raise + except: # noqa + return None, -1 + source = Source() + source.lines = [line.rstrip() for line in sourcelines] + return source, lineno + + +def getsource(obj, **kwargs): + import _pytest._code + obj = _pytest._code.getrawcode(obj) + try: + strsrc = inspect.getsource(obj) + except IndentationError: + strsrc = "\"Buggy python version consider upgrading, cannot get source\"" + assert isinstance(strsrc, str) + return Source(strsrc, **kwargs) + + +def deindent(lines, offset=None): + if offset is None: + for line in lines: + line = line.expandtabs() + s = line.lstrip() + if s: + offset = len(line) - len(s) + break + else: + offset = 0 + if offset == 0: + return list(lines) + newlines = [] + + def readline_generator(lines): + for line in lines: + yield line + '\n' + while True: + yield '' + + it = readline_generator(lines) + + try: + for _, _, (sline, _), (eline, _), _ in tokenize.generate_tokens(lambda: next(it)): + if sline > len(lines): + break # End of input reached + if sline > len(newlines): + line = lines[sline - 1].expandtabs() + if line.lstrip() and line[:offset].isspace(): + line = line[offset:] # Deindent + newlines.append(line) + + for i in range(sline, eline): + # Don't deindent continuing lines of + # multiline tokens (i.e. multiline strings) + newlines.append(lines[i]) + except (IndentationError, tokenize.TokenError): + pass + # Add any lines we didn't see. E.g. if an exception was raised. + newlines.extend(lines[len(newlines):]) + return newlines + + +def get_statement_startend2(lineno, node): + import ast + # flatten all statements and except handlers into one lineno-list + # AST's line numbers start indexing at 1 + values = [] + for x in ast.walk(node): + if isinstance(x, _ast.stmt) or isinstance(x, _ast.ExceptHandler): + values.append(x.lineno - 1) + for name in "finalbody", "orelse": + val = getattr(x, name, None) + if val: + # treat the finally/orelse part as its own statement + values.append(val[0].lineno - 1 - 1) + values.sort() + insert_index = bisect_right(values, lineno) + start = values[insert_index - 1] + if insert_index >= len(values): + end = None + else: + end = values[insert_index] + return start, end + + +def getstatementrange_ast(lineno, source, assertion=False, astnode=None): + if astnode is None: + content = str(source) + if sys.version_info < (2, 7): + content += "\n" + try: + astnode = compile(content, "source", "exec", 1024) # 1024 for AST + except ValueError: + start, end = getstatementrange_old(lineno, source, assertion) + return None, start, end + start, end = get_statement_startend2(lineno, astnode) + # we need to correct the end: + # - ast-parsing strips comments + # - there might be empty lines + # - we might have lesser indented code blocks at the end + if end is None: + end = len(source.lines) + + if end > start + 1: + # make sure we don't span differently indented code blocks + # by using the BlockFinder helper used which inspect.getsource() uses itself + block_finder = inspect.BlockFinder() + # if we start with an indented line, put blockfinder to "started" mode + block_finder.started = source.lines[start][0].isspace() + it = ((x + "\n") for x in source.lines[start:end]) + try: + for tok in tokenize.generate_tokens(lambda: next(it)): + block_finder.tokeneater(*tok) + except (inspect.EndOfBlock, IndentationError): + end = block_finder.last + start + except Exception: + pass + + # the end might still point to a comment or empty line, correct it + while end: + line = source.lines[end - 1].lstrip() + if line.startswith("#") or not line: + end -= 1 + else: + break + return astnode, start, end + + +def getstatementrange_old(lineno, source, assertion=False): + """ return (start, end) tuple which spans the minimal + statement region which containing the given lineno. + raise an IndexError if no such statementrange can be found. + """ + # XXX this logic is only used on python2.4 and below + # 1. find the start of the statement + from codeop import compile_command + for start in range(lineno, -1, -1): + if assertion: + line = source.lines[start] + # the following lines are not fully tested, change with care + if 'super' in line and 'self' in line and '__init__' in line: + raise IndexError("likely a subclass") + if "assert" not in line and "raise" not in line: + continue + trylines = source.lines[start:lineno + 1] + # quick hack to prepare parsing an indented line with + # compile_command() (which errors on "return" outside defs) + trylines.insert(0, 'def xxx():') + trysource = '\n '.join(trylines) + # ^ space here + try: + compile_command(trysource) + except (SyntaxError, OverflowError, ValueError): + continue + + # 2. find the end of the statement + for end in range(lineno + 1, len(source) + 1): + trysource = source[start:end] + if trysource.isparseable(): + return start, end + raise SyntaxError("no valid source range around line %d " % (lineno,)) diff --git a/lib/spack/external/pytest-fallback/_pytest/_pluggy.py b/lib/spack/external/pytest-fallback/_pytest/_pluggy.py new file mode 100644 index 0000000000..6cc1d3d54a --- /dev/null +++ b/lib/spack/external/pytest-fallback/_pytest/_pluggy.py @@ -0,0 +1,11 @@ +""" +imports symbols from vendored "pluggy" if available, otherwise +falls back to importing "pluggy" from the default namespace. +""" +from __future__ import absolute_import, division, print_function +try: + from _pytest.vendored_packages.pluggy import * # noqa + from _pytest.vendored_packages.pluggy import __version__ # noqa +except ImportError: + from pluggy import * # noqa + from pluggy import __version__ # noqa diff --git a/lib/spack/external/pytest-fallback/_pytest/_version.py b/lib/spack/external/pytest-fallback/_pytest/_version.py new file mode 100644 index 0000000000..3edb7da9ad --- /dev/null +++ b/lib/spack/external/pytest-fallback/_pytest/_version.py @@ -0,0 +1,4 @@ +# coding: utf-8 +# file generated by setuptools_scm +# don't change, don't track in version control +version = '3.2.5' diff --git a/lib/spack/external/pytest-fallback/_pytest/assertion/__init__.py b/lib/spack/external/pytest-fallback/_pytest/assertion/__init__.py new file mode 100644 index 0000000000..b0ef667d56 --- /dev/null +++ b/lib/spack/external/pytest-fallback/_pytest/assertion/__init__.py @@ -0,0 +1,148 @@ +""" +support for presenting detailed information in failing assertions. +""" +from __future__ import absolute_import, division, print_function +import py +import sys + +from _pytest.assertion import util +from _pytest.assertion import rewrite +from _pytest.assertion import truncate + + +def pytest_addoption(parser): + group = parser.getgroup("debugconfig") + group.addoption('--assert', + action="store", + dest="assertmode", + choices=("rewrite", "plain",), + default="rewrite", + metavar="MODE", + help="""Control assertion debugging tools. 'plain' + performs no assertion debugging. 'rewrite' + (the default) rewrites assert statements in + test modules on import to provide assert + expression information.""") + + +def register_assert_rewrite(*names): + """Register one or more module names to be rewritten on import. + + This function will make sure that this module or all modules inside + the package will get their assert statements rewritten. + Thus you should make sure to call this before the module is + actually imported, usually in your __init__.py if you are a plugin + using a package. + + :raise TypeError: if the given module names are not strings. + """ + for name in names: + if not isinstance(name, str): + msg = 'expected module names as *args, got {0} instead' + raise TypeError(msg.format(repr(names))) + for hook in sys.meta_path: + if isinstance(hook, rewrite.AssertionRewritingHook): + importhook = hook + break + else: + importhook = DummyRewriteHook() + importhook.mark_rewrite(*names) + + +class DummyRewriteHook(object): + """A no-op import hook for when rewriting is disabled.""" + + def mark_rewrite(self, *names): + pass + + +class AssertionState: + """State for the assertion plugin.""" + + def __init__(self, config, mode): + self.mode = mode + self.trace = config.trace.root.get("assertion") + self.hook = None + + +def install_importhook(config): + """Try to install the rewrite hook, raise SystemError if it fails.""" + # Both Jython and CPython 2.6.0 have AST bugs that make the + # assertion rewriting hook malfunction. + if (sys.platform.startswith('java') or + sys.version_info[:3] == (2, 6, 0)): + raise SystemError('rewrite not supported') + + config._assertstate = AssertionState(config, 'rewrite') + config._assertstate.hook = hook = rewrite.AssertionRewritingHook(config) + sys.meta_path.insert(0, hook) + config._assertstate.trace('installed rewrite import hook') + + def undo(): + hook = config._assertstate.hook + if hook is not None and hook in sys.meta_path: + sys.meta_path.remove(hook) + + config.add_cleanup(undo) + return hook + + +def pytest_collection(session): + # this hook is only called when test modules are collected + # so for example not in the master process of pytest-xdist + # (which does not collect test modules) + assertstate = getattr(session.config, '_assertstate', None) + if assertstate: + if assertstate.hook is not None: + assertstate.hook.set_session(session) + + +def pytest_runtest_setup(item): + """Setup the pytest_assertrepr_compare hook + + The newinterpret and rewrite modules will use util._reprcompare if + it exists to use custom reporting via the + pytest_assertrepr_compare hook. This sets up this custom + comparison for the test. + """ + def callbinrepr(op, left, right): + """Call the pytest_assertrepr_compare hook and prepare the result + + This uses the first result from the hook and then ensures the + following: + * Overly verbose explanations are truncated unless configured otherwise + (eg. if running in verbose mode). + * Embedded newlines are escaped to help util.format_explanation() + later. + * If the rewrite mode is used embedded %-characters are replaced + to protect later % formatting. + + The result can be formatted by util.format_explanation() for + pretty printing. + """ + hook_result = item.ihook.pytest_assertrepr_compare( + config=item.config, op=op, left=left, right=right) + for new_expl in hook_result: + if new_expl: + new_expl = truncate.truncate_if_required(new_expl, item) + new_expl = [line.replace("\n", "\\n") for line in new_expl] + res = py.builtin._totext("\n~").join(new_expl) + if item.config.getvalue("assertmode") == "rewrite": + res = res.replace("%", "%%") + return res + util._reprcompare = callbinrepr + + +def pytest_runtest_teardown(item): + util._reprcompare = None + + +def pytest_sessionfinish(session): + assertstate = getattr(session.config, '_assertstate', None) + if assertstate: + if assertstate.hook is not None: + assertstate.hook.set_session(None) + + +# Expose this plugin's implementation for the pytest_assertrepr_compare hook +pytest_assertrepr_compare = util.assertrepr_compare diff --git a/lib/spack/external/pytest-fallback/_pytest/assertion/rewrite.py b/lib/spack/external/pytest-fallback/_pytest/assertion/rewrite.py new file mode 100644 index 0000000000..d48b6648fb --- /dev/null +++ b/lib/spack/external/pytest-fallback/_pytest/assertion/rewrite.py @@ -0,0 +1,952 @@ +"""Rewrite assertion AST to produce nice error messages""" +from __future__ import absolute_import, division, print_function +import ast +import _ast +import errno +import itertools +import imp +import marshal +import os +import re +import struct +import sys +import types + +import py +from _pytest.assertion import util + + +# pytest caches rewritten pycs in __pycache__. +if hasattr(imp, "get_tag"): + PYTEST_TAG = imp.get_tag() + "-PYTEST" +else: + if hasattr(sys, "pypy_version_info"): + impl = "pypy" + elif sys.platform == "java": + impl = "jython" + else: + impl = "cpython" + ver = sys.version_info + PYTEST_TAG = "%s-%s%s-PYTEST" % (impl, ver[0], ver[1]) + del ver, impl + +PYC_EXT = ".py" + (__debug__ and "c" or "o") +PYC_TAIL = "." + PYTEST_TAG + PYC_EXT + +REWRITE_NEWLINES = sys.version_info[:2] != (2, 7) and sys.version_info < (3, 2) +ASCII_IS_DEFAULT_ENCODING = sys.version_info[0] < 3 + +if sys.version_info >= (3, 5): + ast_Call = ast.Call +else: + def ast_Call(a, b, c): + return ast.Call(a, b, c, None, None) + + +class AssertionRewritingHook(object): + """PEP302 Import hook which rewrites asserts.""" + + def __init__(self, config): + self.config = config + self.fnpats = config.getini("python_files") + self.session = None + self.modules = {} + self._rewritten_names = set() + self._register_with_pkg_resources() + self._must_rewrite = set() + + def set_session(self, session): + self.session = session + + def find_module(self, name, path=None): + state = self.config._assertstate + state.trace("find_module called for: %s" % name) + names = name.rsplit(".", 1) + lastname = names[-1] + pth = None + if path is not None: + # Starting with Python 3.3, path is a _NamespacePath(), which + # causes problems if not converted to list. + path = list(path) + if len(path) == 1: + pth = path[0] + if pth is None: + try: + fd, fn, desc = imp.find_module(lastname, path) + except ImportError: + return None + if fd is not None: + fd.close() + tp = desc[2] + if tp == imp.PY_COMPILED: + if hasattr(imp, "source_from_cache"): + try: + fn = imp.source_from_cache(fn) + except ValueError: + # Python 3 doesn't like orphaned but still-importable + # .pyc files. + fn = fn[:-1] + else: + fn = fn[:-1] + elif tp != imp.PY_SOURCE: + # Don't know what this is. + return None + else: + fn = os.path.join(pth, name.rpartition(".")[2] + ".py") + + fn_pypath = py.path.local(fn) + if not self._should_rewrite(name, fn_pypath, state): + return None + + self._rewritten_names.add(name) + + # The requested module looks like a test file, so rewrite it. This is + # the most magical part of the process: load the source, rewrite the + # asserts, and load the rewritten source. We also cache the rewritten + # module code in a special pyc. We must be aware of the possibility of + # concurrent pytest processes rewriting and loading pycs. To avoid + # tricky race conditions, we maintain the following invariant: The + # cached pyc is always a complete, valid pyc. Operations on it must be + # atomic. POSIX's atomic rename comes in handy. + write = not sys.dont_write_bytecode + cache_dir = os.path.join(fn_pypath.dirname, "__pycache__") + if write: + try: + os.mkdir(cache_dir) + except OSError: + e = sys.exc_info()[1].errno + if e == errno.EEXIST: + # Either the __pycache__ directory already exists (the + # common case) or it's blocked by a non-dir node. In the + # latter case, we'll ignore it in _write_pyc. + pass + elif e in [errno.ENOENT, errno.ENOTDIR]: + # One of the path components was not a directory, likely + # because we're in a zip file. + write = False + elif e in [errno.EACCES, errno.EROFS, errno.EPERM]: + state.trace("read only directory: %r" % fn_pypath.dirname) + write = False + else: + raise + cache_name = fn_pypath.basename[:-3] + PYC_TAIL + pyc = os.path.join(cache_dir, cache_name) + # Notice that even if we're in a read-only directory, I'm going + # to check for a cached pyc. This may not be optimal... + co = _read_pyc(fn_pypath, pyc, state.trace) + if co is None: + state.trace("rewriting %r" % (fn,)) + source_stat, co = _rewrite_test(self.config, fn_pypath) + if co is None: + # Probably a SyntaxError in the test. + return None + if write: + _make_rewritten_pyc(state, source_stat, pyc, co) + else: + state.trace("found cached rewritten pyc for %r" % (fn,)) + self.modules[name] = co, pyc + return self + + def _should_rewrite(self, name, fn_pypath, state): + # always rewrite conftest files + fn = str(fn_pypath) + if fn_pypath.basename == 'conftest.py': + state.trace("rewriting conftest file: %r" % (fn,)) + return True + + if self.session is not None: + if self.session.isinitpath(fn): + state.trace("matched test file (was specified on cmdline): %r" % + (fn,)) + return True + + # modules not passed explicitly on the command line are only + # rewritten if they match the naming convention for test files + for pat in self.fnpats: + if fn_pypath.fnmatch(pat): + state.trace("matched test file %r" % (fn,)) + return True + + for marked in self._must_rewrite: + if name.startswith(marked): + state.trace("matched marked file %r (from %r)" % (name, marked)) + return True + + return False + + def mark_rewrite(self, *names): + """Mark import names as needing to be re-written. + + The named module or package as well as any nested modules will + be re-written on import. + """ + already_imported = set(names).intersection(set(sys.modules)) + if already_imported: + for name in already_imported: + if name not in self._rewritten_names: + self._warn_already_imported(name) + self._must_rewrite.update(names) + + def _warn_already_imported(self, name): + self.config.warn( + 'P1', + 'Module already imported so can not be re-written: %s' % name) + + def load_module(self, name): + # If there is an existing module object named 'fullname' in + # sys.modules, the loader must use that existing module. (Otherwise, + # the reload() builtin will not work correctly.) + if name in sys.modules: + return sys.modules[name] + + co, pyc = self.modules.pop(name) + # I wish I could just call imp.load_compiled here, but __file__ has to + # be set properly. In Python 3.2+, this all would be handled correctly + # by load_compiled. + mod = sys.modules[name] = imp.new_module(name) + try: + mod.__file__ = co.co_filename + # Normally, this attribute is 3.2+. + mod.__cached__ = pyc + mod.__loader__ = self + py.builtin.exec_(co, mod.__dict__) + except: # noqa + if name in sys.modules: + del sys.modules[name] + raise + return sys.modules[name] + + def is_package(self, name): + try: + fd, fn, desc = imp.find_module(name) + except ImportError: + return False + if fd is not None: + fd.close() + tp = desc[2] + return tp == imp.PKG_DIRECTORY + + @classmethod + def _register_with_pkg_resources(cls): + """ + Ensure package resources can be loaded from this loader. May be called + multiple times, as the operation is idempotent. + """ + try: + import pkg_resources + # access an attribute in case a deferred importer is present + pkg_resources.__name__ + except ImportError: + return + + # Since pytest tests are always located in the file system, the + # DefaultProvider is appropriate. + pkg_resources.register_loader_type(cls, pkg_resources.DefaultProvider) + + def get_data(self, pathname): + """Optional PEP302 get_data API. + """ + with open(pathname, 'rb') as f: + return f.read() + + +def _write_pyc(state, co, source_stat, pyc): + # Technically, we don't have to have the same pyc format as + # (C)Python, since these "pycs" should never be seen by builtin + # import. However, there's little reason deviate, and I hope + # sometime to be able to use imp.load_compiled to load them. (See + # the comment in load_module above.) + try: + fp = open(pyc, "wb") + except IOError: + err = sys.exc_info()[1].errno + state.trace("error writing pyc file at %s: errno=%s" % (pyc, err)) + # we ignore any failure to write the cache file + # there are many reasons, permission-denied, __pycache__ being a + # file etc. + return False + try: + fp.write(imp.get_magic()) + mtime = int(source_stat.mtime) + size = source_stat.size & 0xFFFFFFFF + fp.write(struct.pack(">", + ast.Add: "+", + ast.Sub: "-", + ast.Mult: "*", + ast.Div: "/", + ast.FloorDiv: "//", + ast.Mod: "%%", # escaped for string formatting + ast.Eq: "==", + ast.NotEq: "!=", + ast.Lt: "<", + ast.LtE: "<=", + ast.Gt: ">", + ast.GtE: ">=", + ast.Pow: "**", + ast.Is: "is", + ast.IsNot: "is not", + ast.In: "in", + ast.NotIn: "not in" +} +# Python 3.5+ compatibility +try: + binop_map[ast.MatMult] = "@" +except AttributeError: + pass + +# Python 3.4+ compatibility +if hasattr(ast, "NameConstant"): + _NameConstant = ast.NameConstant +else: + def _NameConstant(c): + return ast.Name(str(c), ast.Load()) + + +def set_location(node, lineno, col_offset): + """Set node location information recursively.""" + def _fix(node, lineno, col_offset): + if "lineno" in node._attributes: + node.lineno = lineno + if "col_offset" in node._attributes: + node.col_offset = col_offset + for child in ast.iter_child_nodes(node): + _fix(child, lineno, col_offset) + _fix(node, lineno, col_offset) + return node + + +class AssertionRewriter(ast.NodeVisitor): + """Assertion rewriting implementation. + + The main entrypoint is to call .run() with an ast.Module instance, + this will then find all the assert statements and re-write them to + provide intermediate values and a detailed assertion error. See + http://pybites.blogspot.be/2011/07/behind-scenes-of-pytests-new-assertion.html + for an overview of how this works. + + The entry point here is .run() which will iterate over all the + statements in an ast.Module and for each ast.Assert statement it + finds call .visit() with it. Then .visit_Assert() takes over and + is responsible for creating new ast statements to replace the + original assert statement: it re-writes the test of an assertion + to provide intermediate values and replace it with an if statement + which raises an assertion error with a detailed explanation in + case the expression is false. + + For this .visit_Assert() uses the visitor pattern to visit all the + AST nodes of the ast.Assert.test field, each visit call returning + an AST node and the corresponding explanation string. During this + state is kept in several instance attributes: + + :statements: All the AST statements which will replace the assert + statement. + + :variables: This is populated by .variable() with each variable + used by the statements so that they can all be set to None at + the end of the statements. + + :variable_counter: Counter to create new unique variables needed + by statements. Variables are created using .variable() and + have the form of "@py_assert0". + + :on_failure: The AST statements which will be executed if the + assertion test fails. This is the code which will construct + the failure message and raises the AssertionError. + + :explanation_specifiers: A dict filled by .explanation_param() + with %-formatting placeholders and their corresponding + expressions to use in the building of an assertion message. + This is used by .pop_format_context() to build a message. + + :stack: A stack of the explanation_specifiers dicts maintained by + .push_format_context() and .pop_format_context() which allows + to build another %-formatted string while already building one. + + This state is reset on every new assert statement visited and used + by the other visitors. + + """ + + def __init__(self, module_path, config): + super(AssertionRewriter, self).__init__() + self.module_path = module_path + self.config = config + + def run(self, mod): + """Find all assert statements in *mod* and rewrite them.""" + if not mod.body: + # Nothing to do. + return + # Insert some special imports at the top of the module but after any + # docstrings and __future__ imports. + aliases = [ast.alias(py.builtin.builtins.__name__, "@py_builtins"), + ast.alias("_pytest.assertion.rewrite", "@pytest_ar")] + doc = getattr(mod, "docstring", None) + expect_docstring = doc is None + if doc is not None and self.is_rewrite_disabled(doc): + return + pos = 0 + lineno = 1 + for item in mod.body: + if (expect_docstring and isinstance(item, ast.Expr) and + isinstance(item.value, ast.Str)): + doc = item.value.s + if self.is_rewrite_disabled(doc): + return + expect_docstring = False + elif (not isinstance(item, ast.ImportFrom) or item.level > 0 or + item.module != "__future__"): + lineno = item.lineno + break + pos += 1 + else: + lineno = item.lineno + imports = [ast.Import([alias], lineno=lineno, col_offset=0) + for alias in aliases] + mod.body[pos:pos] = imports + # Collect asserts. + nodes = [mod] + while nodes: + node = nodes.pop() + for name, field in ast.iter_fields(node): + if isinstance(field, list): + new = [] + for i, child in enumerate(field): + if isinstance(child, ast.Assert): + # Transform assert. + new.extend(self.visit(child)) + else: + new.append(child) + if isinstance(child, ast.AST): + nodes.append(child) + setattr(node, name, new) + elif (isinstance(field, ast.AST) and + # Don't recurse into expressions as they can't contain + # asserts. + not isinstance(field, ast.expr)): + nodes.append(field) + + def is_rewrite_disabled(self, docstring): + return "PYTEST_DONT_REWRITE" in docstring + + def variable(self): + """Get a new variable.""" + # Use a character invalid in python identifiers to avoid clashing. + name = "@py_assert" + str(next(self.variable_counter)) + self.variables.append(name) + return name + + def assign(self, expr): + """Give *expr* a name.""" + name = self.variable() + self.statements.append(ast.Assign([ast.Name(name, ast.Store())], expr)) + return ast.Name(name, ast.Load()) + + def display(self, expr): + """Call py.io.saferepr on the expression.""" + return self.helper("saferepr", expr) + + def helper(self, name, *args): + """Call a helper in this module.""" + py_name = ast.Name("@pytest_ar", ast.Load()) + attr = ast.Attribute(py_name, "_" + name, ast.Load()) + return ast_Call(attr, list(args), []) + + def builtin(self, name): + """Return the builtin called *name*.""" + builtin_name = ast.Name("@py_builtins", ast.Load()) + return ast.Attribute(builtin_name, name, ast.Load()) + + def explanation_param(self, expr): + """Return a new named %-formatting placeholder for expr. + + This creates a %-formatting placeholder for expr in the + current formatting context, e.g. ``%(py0)s``. The placeholder + and expr are placed in the current format context so that it + can be used on the next call to .pop_format_context(). + + """ + specifier = "py" + str(next(self.variable_counter)) + self.explanation_specifiers[specifier] = expr + return "%(" + specifier + ")s" + + def push_format_context(self): + """Create a new formatting context. + + The format context is used for when an explanation wants to + have a variable value formatted in the assertion message. In + this case the value required can be added using + .explanation_param(). Finally .pop_format_context() is used + to format a string of %-formatted values as added by + .explanation_param(). + + """ + self.explanation_specifiers = {} + self.stack.append(self.explanation_specifiers) + + def pop_format_context(self, expl_expr): + """Format the %-formatted string with current format context. + + The expl_expr should be an ast.Str instance constructed from + the %-placeholders created by .explanation_param(). This will + add the required code to format said string to .on_failure and + return the ast.Name instance of the formatted string. + + """ + current = self.stack.pop() + if self.stack: + self.explanation_specifiers = self.stack[-1] + keys = [ast.Str(key) for key in current.keys()] + format_dict = ast.Dict(keys, list(current.values())) + form = ast.BinOp(expl_expr, ast.Mod(), format_dict) + name = "@py_format" + str(next(self.variable_counter)) + self.on_failure.append(ast.Assign([ast.Name(name, ast.Store())], form)) + return ast.Name(name, ast.Load()) + + def generic_visit(self, node): + """Handle expressions we don't have custom code for.""" + assert isinstance(node, ast.expr) + res = self.assign(node) + return res, self.explanation_param(self.display(res)) + + def visit_Assert(self, assert_): + """Return the AST statements to replace the ast.Assert instance. + + This re-writes the test of an assertion to provide + intermediate values and replace it with an if statement which + raises an assertion error with a detailed explanation in case + the expression is false. + + """ + if isinstance(assert_.test, ast.Tuple) and self.config is not None: + fslocation = (self.module_path, assert_.lineno) + self.config.warn('R1', 'assertion is always true, perhaps ' + 'remove parentheses?', fslocation=fslocation) + self.statements = [] + self.variables = [] + self.variable_counter = itertools.count() + self.stack = [] + self.on_failure = [] + self.push_format_context() + # Rewrite assert into a bunch of statements. + top_condition, explanation = self.visit(assert_.test) + # Create failure message. + body = self.on_failure + negation = ast.UnaryOp(ast.Not(), top_condition) + self.statements.append(ast.If(negation, body, [])) + if assert_.msg: + assertmsg = self.helper('format_assertmsg', assert_.msg) + explanation = "\n>assert " + explanation + else: + assertmsg = ast.Str("") + explanation = "assert " + explanation + template = ast.BinOp(assertmsg, ast.Add(), ast.Str(explanation)) + msg = self.pop_format_context(template) + fmt = self.helper("format_explanation", msg) + err_name = ast.Name("AssertionError", ast.Load()) + exc = ast_Call(err_name, [fmt], []) + if sys.version_info[0] >= 3: + raise_ = ast.Raise(exc, None) + else: + raise_ = ast.Raise(exc, None, None) + body.append(raise_) + # Clear temporary variables by setting them to None. + if self.variables: + variables = [ast.Name(name, ast.Store()) + for name in self.variables] + clear = ast.Assign(variables, _NameConstant(None)) + self.statements.append(clear) + # Fix line numbers. + for stmt in self.statements: + set_location(stmt, assert_.lineno, assert_.col_offset) + return self.statements + + def visit_Name(self, name): + # Display the repr of the name if it's a local variable or + # _should_repr_global_name() thinks it's acceptable. + locs = ast_Call(self.builtin("locals"), [], []) + inlocs = ast.Compare(ast.Str(name.id), [ast.In()], [locs]) + dorepr = self.helper("should_repr_global_name", name) + test = ast.BoolOp(ast.Or(), [inlocs, dorepr]) + expr = ast.IfExp(test, self.display(name), ast.Str(name.id)) + return name, self.explanation_param(expr) + + def visit_BoolOp(self, boolop): + res_var = self.variable() + expl_list = self.assign(ast.List([], ast.Load())) + app = ast.Attribute(expl_list, "append", ast.Load()) + is_or = int(isinstance(boolop.op, ast.Or)) + body = save = self.statements + fail_save = self.on_failure + levels = len(boolop.values) - 1 + self.push_format_context() + # Process each operand, short-circuting if needed. + for i, v in enumerate(boolop.values): + if i: + fail_inner = [] + # cond is set in a prior loop iteration below + self.on_failure.append(ast.If(cond, fail_inner, [])) # noqa + self.on_failure = fail_inner + self.push_format_context() + res, expl = self.visit(v) + body.append(ast.Assign([ast.Name(res_var, ast.Store())], res)) + expl_format = self.pop_format_context(ast.Str(expl)) + call = ast_Call(app, [expl_format], []) + self.on_failure.append(ast.Expr(call)) + if i < levels: + cond = res + if is_or: + cond = ast.UnaryOp(ast.Not(), cond) + inner = [] + self.statements.append(ast.If(cond, inner, [])) + self.statements = body = inner + self.statements = save + self.on_failure = fail_save + expl_template = self.helper("format_boolop", expl_list, ast.Num(is_or)) + expl = self.pop_format_context(expl_template) + return ast.Name(res_var, ast.Load()), self.explanation_param(expl) + + def visit_UnaryOp(self, unary): + pattern = unary_map[unary.op.__class__] + operand_res, operand_expl = self.visit(unary.operand) + res = self.assign(ast.UnaryOp(unary.op, operand_res)) + return res, pattern % (operand_expl,) + + def visit_BinOp(self, binop): + symbol = binop_map[binop.op.__class__] + left_expr, left_expl = self.visit(binop.left) + right_expr, right_expl = self.visit(binop.right) + explanation = "(%s %s %s)" % (left_expl, symbol, right_expl) + res = self.assign(ast.BinOp(left_expr, binop.op, right_expr)) + return res, explanation + + def visit_Call_35(self, call): + """ + visit `ast.Call` nodes on Python3.5 and after + """ + new_func, func_expl = self.visit(call.func) + arg_expls = [] + new_args = [] + new_kwargs = [] + for arg in call.args: + res, expl = self.visit(arg) + arg_expls.append(expl) + new_args.append(res) + for keyword in call.keywords: + res, expl = self.visit(keyword.value) + new_kwargs.append(ast.keyword(keyword.arg, res)) + if keyword.arg: + arg_expls.append(keyword.arg + "=" + expl) + else: # **args have `arg` keywords with an .arg of None + arg_expls.append("**" + expl) + + expl = "%s(%s)" % (func_expl, ', '.join(arg_expls)) + new_call = ast.Call(new_func, new_args, new_kwargs) + res = self.assign(new_call) + res_expl = self.explanation_param(self.display(res)) + outer_expl = "%s\n{%s = %s\n}" % (res_expl, res_expl, expl) + return res, outer_expl + + def visit_Starred(self, starred): + # From Python 3.5, a Starred node can appear in a function call + res, expl = self.visit(starred.value) + return starred, '*' + expl + + def visit_Call_legacy(self, call): + """ + visit `ast.Call nodes on 3.4 and below` + """ + new_func, func_expl = self.visit(call.func) + arg_expls = [] + new_args = [] + new_kwargs = [] + new_star = new_kwarg = None + for arg in call.args: + res, expl = self.visit(arg) + new_args.append(res) + arg_expls.append(expl) + for keyword in call.keywords: + res, expl = self.visit(keyword.value) + new_kwargs.append(ast.keyword(keyword.arg, res)) + arg_expls.append(keyword.arg + "=" + expl) + if call.starargs: + new_star, expl = self.visit(call.starargs) + arg_expls.append("*" + expl) + if call.kwargs: + new_kwarg, expl = self.visit(call.kwargs) + arg_expls.append("**" + expl) + expl = "%s(%s)" % (func_expl, ', '.join(arg_expls)) + new_call = ast.Call(new_func, new_args, new_kwargs, + new_star, new_kwarg) + res = self.assign(new_call) + res_expl = self.explanation_param(self.display(res)) + outer_expl = "%s\n{%s = %s\n}" % (res_expl, res_expl, expl) + return res, outer_expl + + # ast.Call signature changed on 3.5, + # conditionally change which methods is named + # visit_Call depending on Python version + if sys.version_info >= (3, 5): + visit_Call = visit_Call_35 + else: + visit_Call = visit_Call_legacy + + def visit_Attribute(self, attr): + if not isinstance(attr.ctx, ast.Load): + return self.generic_visit(attr) + value, value_expl = self.visit(attr.value) + res = self.assign(ast.Attribute(value, attr.attr, ast.Load())) + res_expl = self.explanation_param(self.display(res)) + pat = "%s\n{%s = %s.%s\n}" + expl = pat % (res_expl, res_expl, value_expl, attr.attr) + return res, expl + + def visit_Compare(self, comp): + self.push_format_context() + left_res, left_expl = self.visit(comp.left) + if isinstance(comp.left, (_ast.Compare, _ast.BoolOp)): + left_expl = "({0})".format(left_expl) + res_variables = [self.variable() for i in range(len(comp.ops))] + load_names = [ast.Name(v, ast.Load()) for v in res_variables] + store_names = [ast.Name(v, ast.Store()) for v in res_variables] + it = zip(range(len(comp.ops)), comp.ops, comp.comparators) + expls = [] + syms = [] + results = [left_res] + for i, op, next_operand in it: + next_res, next_expl = self.visit(next_operand) + if isinstance(next_operand, (_ast.Compare, _ast.BoolOp)): + next_expl = "({0})".format(next_expl) + results.append(next_res) + sym = binop_map[op.__class__] + syms.append(ast.Str(sym)) + expl = "%s %s %s" % (left_expl, sym, next_expl) + expls.append(ast.Str(expl)) + res_expr = ast.Compare(left_res, [op], [next_res]) + self.statements.append(ast.Assign([store_names[i]], res_expr)) + left_res, left_expl = next_res, next_expl + # Use pytest.assertion.util._reprcompare if that's available. + expl_call = self.helper("call_reprcompare", + ast.Tuple(syms, ast.Load()), + ast.Tuple(load_names, ast.Load()), + ast.Tuple(expls, ast.Load()), + ast.Tuple(results, ast.Load())) + if len(comp.ops) > 1: + res = ast.BoolOp(ast.And(), load_names) + else: + res = load_names[0] + return res, self.explanation_param(self.pop_format_context(expl_call)) diff --git a/lib/spack/external/pytest-fallback/_pytest/assertion/truncate.py b/lib/spack/external/pytest-fallback/_pytest/assertion/truncate.py new file mode 100644 index 0000000000..1e13063569 --- /dev/null +++ b/lib/spack/external/pytest-fallback/_pytest/assertion/truncate.py @@ -0,0 +1,102 @@ +""" +Utilities for truncating assertion output. + +Current default behaviour is to truncate assertion explanations at +~8 terminal lines, unless running in "-vv" mode or running on CI. +""" +from __future__ import absolute_import, division, print_function +import os + +import py + + +DEFAULT_MAX_LINES = 8 +DEFAULT_MAX_CHARS = 8 * 80 +USAGE_MSG = "use '-vv' to show" + + +def truncate_if_required(explanation, item, max_length=None): + """ + Truncate this assertion explanation if the given test item is eligible. + """ + if _should_truncate_item(item): + return _truncate_explanation(explanation) + return explanation + + +def _should_truncate_item(item): + """ + Whether or not this test item is eligible for truncation. + """ + verbose = item.config.option.verbose + return verbose < 2 and not _running_on_ci() + + +def _running_on_ci(): + """Check if we're currently running on a CI system.""" + env_vars = ['CI', 'BUILD_NUMBER'] + return any(var in os.environ for var in env_vars) + + +def _truncate_explanation(input_lines, max_lines=None, max_chars=None): + """ + Truncate given list of strings that makes up the assertion explanation. + + Truncates to either 8 lines, or 640 characters - whichever the input reaches + first. The remaining lines will be replaced by a usage message. + """ + + if max_lines is None: + max_lines = DEFAULT_MAX_LINES + if max_chars is None: + max_chars = DEFAULT_MAX_CHARS + + # Check if truncation required + input_char_count = len("".join(input_lines)) + if len(input_lines) <= max_lines and input_char_count <= max_chars: + return input_lines + + # Truncate first to max_lines, and then truncate to max_chars if max_chars + # is exceeded. + truncated_explanation = input_lines[:max_lines] + truncated_explanation = _truncate_by_char_count(truncated_explanation, max_chars) + + # Add ellipsis to final line + truncated_explanation[-1] = truncated_explanation[-1] + "..." + + # Append useful message to explanation + truncated_line_count = len(input_lines) - len(truncated_explanation) + truncated_line_count += 1 # Account for the part-truncated final line + msg = '...Full output truncated' + if truncated_line_count == 1: + msg += ' ({0} line hidden)'.format(truncated_line_count) + else: + msg += ' ({0} lines hidden)'.format(truncated_line_count) + msg += ", {0}" .format(USAGE_MSG) + truncated_explanation.extend([ + py.builtin._totext(""), + py.builtin._totext(msg), + ]) + return truncated_explanation + + +def _truncate_by_char_count(input_lines, max_chars): + # Check if truncation required + if len("".join(input_lines)) <= max_chars: + return input_lines + + # Find point at which input length exceeds total allowed length + iterated_char_count = 0 + for iterated_index, input_line in enumerate(input_lines): + if iterated_char_count + len(input_line) > max_chars: + break + iterated_char_count += len(input_line) + + # Create truncated explanation with modified final line + truncated_result = input_lines[:iterated_index] + final_line = input_lines[iterated_index] + if final_line: + final_line_truncate_point = max_chars - iterated_char_count + final_line = final_line[:final_line_truncate_point] + truncated_result.append(final_line) + return truncated_result diff --git a/lib/spack/external/pytest-fallback/_pytest/assertion/util.py b/lib/spack/external/pytest-fallback/_pytest/assertion/util.py new file mode 100644 index 0000000000..c09eff06b0 --- /dev/null +++ b/lib/spack/external/pytest-fallback/_pytest/assertion/util.py @@ -0,0 +1,310 @@ +"""Utilities for assertion debugging""" +from __future__ import absolute_import, division, print_function +import pprint + +import _pytest._code +import py +try: + from collections.abc import Sequence +except ImportError: + try: + from collections import Sequence + except ImportError: + Sequence = list + + +u = py.builtin._totext + +# The _reprcompare attribute on the util module is used by the new assertion +# interpretation code and assertion rewriter to detect this plugin was +# loaded and in turn call the hooks defined here as part of the +# DebugInterpreter. +_reprcompare = None + + +# the re-encoding is needed for python2 repr +# with non-ascii characters (see issue 877 and 1379) +def ecu(s): + try: + return u(s, 'utf-8', 'replace') + except TypeError: + return s + + +def format_explanation(explanation): + """This formats an explanation + + Normally all embedded newlines are escaped, however there are + three exceptions: \n{, \n} and \n~. The first two are intended + cover nested explanations, see function and attribute explanations + for examples (.visit_Call(), visit_Attribute()). The last one is + for when one explanation needs to span multiple lines, e.g. when + displaying diffs. + """ + explanation = ecu(explanation) + lines = _split_explanation(explanation) + result = _format_lines(lines) + return u('\n').join(result) + + +def _split_explanation(explanation): + """Return a list of individual lines in the explanation + + This will return a list of lines split on '\n{', '\n}' and '\n~'. + Any other newlines will be escaped and appear in the line as the + literal '\n' characters. + """ + raw_lines = (explanation or u('')).split('\n') + lines = [raw_lines[0]] + for values in raw_lines[1:]: + if values and values[0] in ['{', '}', '~', '>']: + lines.append(values) + else: + lines[-1] += '\\n' + values + return lines + + +def _format_lines(lines): + """Format the individual lines + + This will replace the '{', '}' and '~' characters of our mini + formatting language with the proper 'where ...', 'and ...' and ' + + ...' text, taking care of indentation along the way. + + Return a list of formatted lines. + """ + result = lines[:1] + stack = [0] + stackcnt = [0] + for line in lines[1:]: + if line.startswith('{'): + if stackcnt[-1]: + s = u('and ') + else: + s = u('where ') + stack.append(len(result)) + stackcnt[-1] += 1 + stackcnt.append(0) + result.append(u(' +') + u(' ') * (len(stack) - 1) + s + line[1:]) + elif line.startswith('}'): + stack.pop() + stackcnt.pop() + result[stack[-1]] += line[1:] + else: + assert line[0] in ['~', '>'] + stack[-1] += 1 + indent = len(stack) if line.startswith('~') else len(stack) - 1 + result.append(u(' ') * indent + line[1:]) + assert len(stack) == 1 + return result + + +# Provide basestring in python3 +try: + basestring = basestring +except NameError: + basestring = str + + +def assertrepr_compare(config, op, left, right): + """Return specialised explanations for some operators/operands""" + width = 80 - 15 - len(op) - 2 # 15 chars indentation, 1 space around op + left_repr = py.io.saferepr(left, maxsize=int(width // 2)) + right_repr = py.io.saferepr(right, maxsize=width - len(left_repr)) + + summary = u('%s %s %s') % (ecu(left_repr), op, ecu(right_repr)) + + def issequence(x): + return (isinstance(x, (list, tuple, Sequence)) and not isinstance(x, basestring)) + + def istext(x): + return isinstance(x, basestring) + + def isdict(x): + return isinstance(x, dict) + + def isset(x): + return isinstance(x, (set, frozenset)) + + def isiterable(obj): + try: + iter(obj) + return not istext(obj) + except TypeError: + return False + + verbose = config.getoption('verbose') + explanation = None + try: + if op == '==': + if istext(left) and istext(right): + explanation = _diff_text(left, right, verbose) + else: + if issequence(left) and issequence(right): + explanation = _compare_eq_sequence(left, right, verbose) + elif isset(left) and isset(right): + explanation = _compare_eq_set(left, right, verbose) + elif isdict(left) and isdict(right): + explanation = _compare_eq_dict(left, right, verbose) + if isiterable(left) and isiterable(right): + expl = _compare_eq_iterable(left, right, verbose) + if explanation is not None: + explanation.extend(expl) + else: + explanation = expl + elif op == 'not in': + if istext(left) and istext(right): + explanation = _notin_text(left, right, verbose) + except Exception: + explanation = [ + u('(pytest_assertion plugin: representation of details failed. ' + 'Probably an object has a faulty __repr__.)'), + u(_pytest._code.ExceptionInfo())] + + if not explanation: + return None + + return [summary] + explanation + + +def _diff_text(left, right, verbose=False): + """Return the explanation for the diff between text or bytes + + Unless --verbose is used this will skip leading and trailing + characters which are identical to keep the diff minimal. + + If the input are bytes they will be safely converted to text. + """ + from difflib import ndiff + explanation = [] + if isinstance(left, py.builtin.bytes): + left = u(repr(left)[1:-1]).replace(r'\n', '\n') + if isinstance(right, py.builtin.bytes): + right = u(repr(right)[1:-1]).replace(r'\n', '\n') + if not verbose: + i = 0 # just in case left or right has zero length + for i in range(min(len(left), len(right))): + if left[i] != right[i]: + break + if i > 42: + i -= 10 # Provide some context + explanation = [u('Skipping %s identical leading ' + 'characters in diff, use -v to show') % i] + left = left[i:] + right = right[i:] + if len(left) == len(right): + for i in range(len(left)): + if left[-i] != right[-i]: + break + if i > 42: + i -= 10 # Provide some context + explanation += [u('Skipping %s identical trailing ' + 'characters in diff, use -v to show') % i] + left = left[:-i] + right = right[:-i] + keepends = True + explanation += [line.strip('\n') + for line in ndiff(left.splitlines(keepends), + right.splitlines(keepends))] + return explanation + + +def _compare_eq_iterable(left, right, verbose=False): + if not verbose: + return [u('Use -v to get the full diff')] + # dynamic import to speedup pytest + import difflib + + try: + left_formatting = pprint.pformat(left).splitlines() + right_formatting = pprint.pformat(right).splitlines() + explanation = [u('Full diff:')] + except Exception: + # hack: PrettyPrinter.pformat() in python 2 fails when formatting items that can't be sorted(), ie, calling + # sorted() on a list would raise. See issue #718. + # As a workaround, the full diff is generated by using the repr() string of each item of each container. + left_formatting = sorted(repr(x) for x in left) + right_formatting = sorted(repr(x) for x in right) + explanation = [u('Full diff (fallback to calling repr on each item):')] + explanation.extend(line.strip() for line in difflib.ndiff(left_formatting, right_formatting)) + return explanation + + +def _compare_eq_sequence(left, right, verbose=False): + explanation = [] + for i in range(min(len(left), len(right))): + if left[i] != right[i]: + explanation += [u('At index %s diff: %r != %r') + % (i, left[i], right[i])] + break + if len(left) > len(right): + explanation += [u('Left contains more items, first extra item: %s') + % py.io.saferepr(left[len(right)],)] + elif len(left) < len(right): + explanation += [ + u('Right contains more items, first extra item: %s') % + py.io.saferepr(right[len(left)],)] + return explanation + + +def _compare_eq_set(left, right, verbose=False): + explanation = [] + diff_left = left - right + diff_right = right - left + if diff_left: + explanation.append(u('Extra items in the left set:')) + for item in diff_left: + explanation.append(py.io.saferepr(item)) + if diff_right: + explanation.append(u('Extra items in the right set:')) + for item in diff_right: + explanation.append(py.io.saferepr(item)) + return explanation + + +def _compare_eq_dict(left, right, verbose=False): + explanation = [] + common = set(left).intersection(set(right)) + same = dict((k, left[k]) for k in common if left[k] == right[k]) + if same and verbose < 2: + explanation += [u('Omitting %s identical items, use -vv to show') % + len(same)] + elif same: + explanation += [u('Common items:')] + explanation += pprint.pformat(same).splitlines() + diff = set(k for k in common if left[k] != right[k]) + if diff: + explanation += [u('Differing items:')] + for k in diff: + explanation += [py.io.saferepr({k: left[k]}) + ' != ' + + py.io.saferepr({k: right[k]})] + extra_left = set(left) - set(right) + if extra_left: + explanation.append(u('Left contains more items:')) + explanation.extend(pprint.pformat( + dict((k, left[k]) for k in extra_left)).splitlines()) + extra_right = set(right) - set(left) + if extra_right: + explanation.append(u('Right contains more items:')) + explanation.extend(pprint.pformat( + dict((k, right[k]) for k in extra_right)).splitlines()) + return explanation + + +def _notin_text(term, text, verbose=False): + index = text.find(term) + head = text[:index] + tail = text[index + len(term):] + correct_text = head + tail + diff = _diff_text(correct_text, text, verbose) + newdiff = [u('%s is contained here:') % py.io.saferepr(term, maxsize=42)] + for line in diff: + if line.startswith(u('Skipping')): + continue + if line.startswith(u('- ')): + continue + if line.startswith(u('+ ')): + newdiff.append(u(' ') + line[2:]) + else: + newdiff.append(line) + return newdiff diff --git a/lib/spack/external/pytest-fallback/_pytest/cacheprovider.py b/lib/spack/external/pytest-fallback/_pytest/cacheprovider.py new file mode 100755 index 0000000000..c537c14472 --- /dev/null +++ b/lib/spack/external/pytest-fallback/_pytest/cacheprovider.py @@ -0,0 +1,260 @@ +""" +merged implementation of the cache provider + +the name cache was not chosen to ensure pluggy automatically +ignores the external pytest-cache +""" +from __future__ import absolute_import, division, print_function +import py +import pytest +import json +import os +from os.path import sep as _sep, altsep as _altsep + + +class Cache(object): + def __init__(self, config): + self.config = config + self._cachedir = Cache.cache_dir_from_config(config) + self.trace = config.trace.root.get("cache") + if config.getvalue("cacheclear"): + self.trace("clearing cachedir") + if self._cachedir.check(): + self._cachedir.remove() + self._cachedir.mkdir() + + @staticmethod + def cache_dir_from_config(config): + cache_dir = config.getini("cache_dir") + cache_dir = os.path.expanduser(cache_dir) + cache_dir = os.path.expandvars(cache_dir) + if os.path.isabs(cache_dir): + return py.path.local(cache_dir) + else: + return config.rootdir.join(cache_dir) + + def makedir(self, name): + """ return a directory path object with the given name. If the + directory does not yet exist, it will be created. You can use it + to manage files likes e. g. store/retrieve database + dumps across test sessions. + + :param name: must be a string not containing a ``/`` separator. + Make sure the name contains your plugin or application + identifiers to prevent clashes with other cache users. + """ + if _sep in name or _altsep is not None and _altsep in name: + raise ValueError("name is not allowed to contain path separators") + return self._cachedir.ensure_dir("d", name) + + def _getvaluepath(self, key): + return self._cachedir.join('v', *key.split('/')) + + def get(self, key, default): + """ return cached value for the given key. If no value + was yet cached or the value cannot be read, the specified + default is returned. + + :param key: must be a ``/`` separated value. Usually the first + name is the name of your plugin or your application. + :param default: must be provided in case of a cache-miss or + invalid cache values. + + """ + path = self._getvaluepath(key) + if path.check(): + try: + with path.open("r") as f: + return json.load(f) + except ValueError: + self.trace("cache-invalid at %s" % (path,)) + return default + + def set(self, key, value): + """ save value for the given key. + + :param key: must be a ``/`` separated value. Usually the first + name is the name of your plugin or your application. + :param value: must be of any combination of basic + python types, including nested types + like e. g. lists of dictionaries. + """ + path = self._getvaluepath(key) + try: + path.dirpath().ensure_dir() + except (py.error.EEXIST, py.error.EACCES): + self.config.warn( + code='I9', message='could not create cache path %s' % (path,) + ) + return + try: + f = path.open('w') + except py.error.ENOTDIR: + self.config.warn( + code='I9', message='cache could not write path %s' % (path,)) + else: + with f: + self.trace("cache-write %s: %r" % (key, value,)) + json.dump(value, f, indent=2, sort_keys=True) + + +class LFPlugin: + """ Plugin which implements the --lf (run last-failing) option """ + + def __init__(self, config): + self.config = config + active_keys = 'lf', 'failedfirst' + self.active = any(config.getvalue(key) for key in active_keys) + self.lastfailed = config.cache.get("cache/lastfailed", {}) + self._previously_failed_count = None + + def pytest_report_collectionfinish(self): + if self.active: + if not self._previously_failed_count: + mode = "run all (no recorded failures)" + else: + noun = 'failure' if self._previously_failed_count == 1 else 'failures' + suffix = " first" if self.config.getvalue("failedfirst") else "" + mode = "rerun previous {count} {noun}{suffix}".format( + count=self._previously_failed_count, suffix=suffix, noun=noun + ) + return "run-last-failure: %s" % mode + + def pytest_runtest_logreport(self, report): + if (report.when == 'call' and report.passed) or report.skipped: + self.lastfailed.pop(report.nodeid, None) + elif report.failed: + self.lastfailed[report.nodeid] = True + + def pytest_collectreport(self, report): + passed = report.outcome in ('passed', 'skipped') + if passed: + if report.nodeid in self.lastfailed: + self.lastfailed.pop(report.nodeid) + self.lastfailed.update( + (item.nodeid, True) + for item in report.result) + else: + self.lastfailed[report.nodeid] = True + + def pytest_collection_modifyitems(self, session, config, items): + if self.active and self.lastfailed: + previously_failed = [] + previously_passed = [] + for item in items: + if item.nodeid in self.lastfailed: + previously_failed.append(item) + else: + previously_passed.append(item) + self._previously_failed_count = len(previously_failed) + if not previously_failed: + # running a subset of all tests with recorded failures outside + # of the set of tests currently executing + return + if self.config.getvalue("lf"): + items[:] = previously_failed + config.hook.pytest_deselected(items=previously_passed) + else: + items[:] = previously_failed + previously_passed + + def pytest_sessionfinish(self, session): + config = self.config + if config.getvalue("cacheshow") or hasattr(config, "slaveinput"): + return + + saved_lastfailed = config.cache.get("cache/lastfailed", {}) + if saved_lastfailed != self.lastfailed: + config.cache.set("cache/lastfailed", self.lastfailed) + + +def pytest_addoption(parser): + group = parser.getgroup("general") + group.addoption( + '--lf', '--last-failed', action='store_true', dest="lf", + help="rerun only the tests that failed " + "at the last run (or all if none failed)") + group.addoption( + '--ff', '--failed-first', action='store_true', dest="failedfirst", + help="run all tests but run the last failures first. " + "This may re-order tests and thus lead to " + "repeated fixture setup/teardown") + group.addoption( + '--cache-show', action='store_true', dest="cacheshow", + help="show cache contents, don't perform collection or tests") + group.addoption( + '--cache-clear', action='store_true', dest="cacheclear", + help="remove all cache contents at start of test run.") + parser.addini( + "cache_dir", default='.cache', + help="cache directory path.") + + +def pytest_cmdline_main(config): + if config.option.cacheshow: + from _pytest.main import wrap_session + return wrap_session(config, cacheshow) + + +@pytest.hookimpl(tryfirst=True) +def pytest_configure(config): + config.cache = Cache(config) + config.pluginmanager.register(LFPlugin(config), "lfplugin") + + +@pytest.fixture +def cache(request): + """ + Return a cache object that can persist state between testing sessions. + + cache.get(key, default) + cache.set(key, value) + + Keys must be a ``/`` separated value, where the first part is usually the + name of your plugin or application to avoid clashes with other cache users. + + Values can be any object handled by the json stdlib module. + """ + return request.config.cache + + +def pytest_report_header(config): + if config.option.verbose: + relpath = py.path.local().bestrelpath(config.cache._cachedir) + return "cachedir: %s" % relpath + + +def cacheshow(config, session): + from pprint import pprint + tw = py.io.TerminalWriter() + tw.line("cachedir: " + str(config.cache._cachedir)) + if not config.cache._cachedir.check(): + tw.line("cache is empty") + return 0 + dummy = object() + basedir = config.cache._cachedir + vdir = basedir.join("v") + tw.sep("-", "cache values") + for valpath in sorted(vdir.visit(lambda x: x.isfile())): + key = valpath.relto(vdir).replace(valpath.sep, "/") + val = config.cache.get(key, dummy) + if val is dummy: + tw.line("%s contains unreadable content, " + "will be ignored" % key) + else: + tw.line("%s contains:" % key) + stream = py.io.TextIO() + pprint(val, stream=stream) + for line in stream.getvalue().splitlines(): + tw.line(" " + line) + + ddir = basedir.join("d") + if ddir.isdir() and ddir.listdir(): + tw.sep("-", "cache directories") + for p in sorted(basedir.join("d").visit()): + # if p.check(dir=1): + # print("%s/" % p.relto(basedir)) + if p.isfile(): + key = p.relto(basedir) + tw.line("%s is a file of length %d" % ( + key, p.size())) + return 0 diff --git a/lib/spack/external/pytest-fallback/_pytest/capture.py b/lib/spack/external/pytest-fallback/_pytest/capture.py new file mode 100644 index 0000000000..cb5af6fcb3 --- /dev/null +++ b/lib/spack/external/pytest-fallback/_pytest/capture.py @@ -0,0 +1,577 @@ +""" +per-test stdout/stderr capturing mechanism. + +""" +from __future__ import absolute_import, division, print_function + +import contextlib +import sys +import os +import io +from io import UnsupportedOperation +from tempfile import TemporaryFile + +import py +import pytest +from _pytest.compat import CaptureIO + +unicode = py.builtin.text + +patchsysdict = {0: 'stdin', 1: 'stdout', 2: 'stderr'} + + +def pytest_addoption(parser): + group = parser.getgroup("general") + group._addoption( + '--capture', action="store", + default="fd" if hasattr(os, "dup") else "sys", + metavar="method", choices=['fd', 'sys', 'no'], + help="per-test capturing method: one of fd|sys|no.") + group._addoption( + '-s', action="store_const", const="no", dest="capture", + help="shortcut for --capture=no.") + + +@pytest.hookimpl(hookwrapper=True) +def pytest_load_initial_conftests(early_config, parser, args): + ns = early_config.known_args_namespace + if ns.capture == "fd": + _py36_windowsconsoleio_workaround(sys.stdout) + _colorama_workaround() + _readline_workaround() + pluginmanager = early_config.pluginmanager + capman = CaptureManager(ns.capture) + pluginmanager.register(capman, "capturemanager") + + # make sure that capturemanager is properly reset at final shutdown + early_config.add_cleanup(capman.reset_capturings) + + # make sure logging does not raise exceptions at the end + def silence_logging_at_shutdown(): + if "logging" in sys.modules: + sys.modules["logging"].raiseExceptions = False + early_config.add_cleanup(silence_logging_at_shutdown) + + # finally trigger conftest loading but while capturing (issue93) + capman.init_capturings() + outcome = yield + out, err = capman.suspendcapture() + if outcome.excinfo is not None: + sys.stdout.write(out) + sys.stderr.write(err) + + +class CaptureManager: + def __init__(self, method): + self._method = method + + def _getcapture(self, method): + if method == "fd": + return MultiCapture(out=True, err=True, Capture=FDCapture) + elif method == "sys": + return MultiCapture(out=True, err=True, Capture=SysCapture) + elif method == "no": + return MultiCapture(out=False, err=False, in_=False) + else: + raise ValueError("unknown capturing method: %r" % method) + + def init_capturings(self): + assert not hasattr(self, "_capturing") + self._capturing = self._getcapture(self._method) + self._capturing.start_capturing() + + def reset_capturings(self): + cap = self.__dict__.pop("_capturing", None) + if cap is not None: + cap.pop_outerr_to_orig() + cap.stop_capturing() + + def resumecapture(self): + self._capturing.resume_capturing() + + def suspendcapture(self, in_=False): + self.deactivate_funcargs() + cap = getattr(self, "_capturing", None) + if cap is not None: + try: + outerr = cap.readouterr() + finally: + cap.suspend_capturing(in_=in_) + return outerr + + def activate_funcargs(self, pyfuncitem): + capfuncarg = pyfuncitem.__dict__.pop("_capfuncarg", None) + if capfuncarg is not None: + capfuncarg._start() + self._capfuncarg = capfuncarg + + def deactivate_funcargs(self): + capfuncarg = self.__dict__.pop("_capfuncarg", None) + if capfuncarg is not None: + capfuncarg.close() + + @pytest.hookimpl(hookwrapper=True) + def pytest_make_collect_report(self, collector): + if isinstance(collector, pytest.File): + self.resumecapture() + outcome = yield + out, err = self.suspendcapture() + rep = outcome.get_result() + if out: + rep.sections.append(("Captured stdout", out)) + if err: + rep.sections.append(("Captured stderr", err)) + else: + yield + + @pytest.hookimpl(hookwrapper=True) + def pytest_runtest_setup(self, item): + self.resumecapture() + yield + self.suspendcapture_item(item, "setup") + + @pytest.hookimpl(hookwrapper=True) + def pytest_runtest_call(self, item): + self.resumecapture() + self.activate_funcargs(item) + yield + # self.deactivate_funcargs() called from suspendcapture() + self.suspendcapture_item(item, "call") + + @pytest.hookimpl(hookwrapper=True) + def pytest_runtest_teardown(self, item): + self.resumecapture() + yield + self.suspendcapture_item(item, "teardown") + + @pytest.hookimpl(tryfirst=True) + def pytest_keyboard_interrupt(self, excinfo): + self.reset_capturings() + + @pytest.hookimpl(tryfirst=True) + def pytest_internalerror(self, excinfo): + self.reset_capturings() + + def suspendcapture_item(self, item, when, in_=False): + out, err = self.suspendcapture(in_=in_) + item.add_report_section(when, "stdout", out) + item.add_report_section(when, "stderr", err) + + +error_capsysfderror = "cannot use capsys and capfd at the same time" + + +@pytest.fixture +def capsys(request): + """Enable capturing of writes to sys.stdout/sys.stderr and make + captured output available via ``capsys.readouterr()`` method calls + which return a ``(out, err)`` tuple. + """ + if "capfd" in request.fixturenames: + raise request.raiseerror(error_capsysfderror) + request.node._capfuncarg = c = CaptureFixture(SysCapture, request) + return c + + +@pytest.fixture +def capfd(request): + """Enable capturing of writes to file descriptors 1 and 2 and make + captured output available via ``capfd.readouterr()`` method calls + which return a ``(out, err)`` tuple. + """ + if "capsys" in request.fixturenames: + request.raiseerror(error_capsysfderror) + if not hasattr(os, 'dup'): + pytest.skip("capfd funcarg needs os.dup") + request.node._capfuncarg = c = CaptureFixture(FDCapture, request) + return c + + +class CaptureFixture: + def __init__(self, captureclass, request): + self.captureclass = captureclass + self.request = request + + def _start(self): + self._capture = MultiCapture(out=True, err=True, in_=False, + Capture=self.captureclass) + self._capture.start_capturing() + + def close(self): + cap = self.__dict__.pop("_capture", None) + if cap is not None: + self._outerr = cap.pop_outerr_to_orig() + cap.stop_capturing() + + def readouterr(self): + try: + return self._capture.readouterr() + except AttributeError: + return self._outerr + + @contextlib.contextmanager + def disabled(self): + capmanager = self.request.config.pluginmanager.getplugin('capturemanager') + capmanager.suspendcapture_item(self.request.node, "call", in_=True) + try: + yield + finally: + capmanager.resumecapture() + + +def safe_text_dupfile(f, mode, default_encoding="UTF8"): + """ return a open text file object that's a duplicate of f on the + FD-level if possible. + """ + encoding = getattr(f, "encoding", None) + try: + fd = f.fileno() + except Exception: + if "b" not in getattr(f, "mode", "") and hasattr(f, "encoding"): + # we seem to have a text stream, let's just use it + return f + else: + newfd = os.dup(fd) + if "b" not in mode: + mode += "b" + f = os.fdopen(newfd, mode, 0) # no buffering + return EncodedFile(f, encoding or default_encoding) + + +class EncodedFile(object): + errors = "strict" # possibly needed by py3 code (issue555) + + def __init__(self, buffer, encoding): + self.buffer = buffer + self.encoding = encoding + + def write(self, obj): + if isinstance(obj, unicode): + obj = obj.encode(self.encoding, "replace") + self.buffer.write(obj) + + def writelines(self, linelist): + data = ''.join(linelist) + self.write(data) + + @property + def name(self): + """Ensure that file.name is a string.""" + return repr(self.buffer) + + def __getattr__(self, name): + return getattr(object.__getattribute__(self, "buffer"), name) + + +class MultiCapture(object): + out = err = in_ = None + + def __init__(self, out=True, err=True, in_=True, Capture=None): + if in_: + self.in_ = Capture(0) + if out: + self.out = Capture(1) + if err: + self.err = Capture(2) + + def start_capturing(self): + if self.in_: + self.in_.start() + if self.out: + self.out.start() + if self.err: + self.err.start() + + def pop_outerr_to_orig(self): + """ pop current snapshot out/err capture and flush to orig streams. """ + out, err = self.readouterr() + if out: + self.out.writeorg(out) + if err: + self.err.writeorg(err) + return out, err + + def suspend_capturing(self, in_=False): + if self.out: + self.out.suspend() + if self.err: + self.err.suspend() + if in_ and self.in_: + self.in_.suspend() + self._in_suspended = True + + def resume_capturing(self): + if self.out: + self.out.resume() + if self.err: + self.err.resume() + if hasattr(self, "_in_suspended"): + self.in_.resume() + del self._in_suspended + + def stop_capturing(self): + """ stop capturing and reset capturing streams """ + if hasattr(self, '_reset'): + raise ValueError("was already stopped") + self._reset = True + if self.out: + self.out.done() + if self.err: + self.err.done() + if self.in_: + self.in_.done() + + def readouterr(self): + """ return snapshot unicode value of stdout/stderr capturings. """ + return (self.out.snap() if self.out is not None else "", + self.err.snap() if self.err is not None else "") + + +class NoCapture: + __init__ = start = done = suspend = resume = lambda *args: None + + +class FDCapture: + """ Capture IO to/from a given os-level filedescriptor. """ + + def __init__(self, targetfd, tmpfile=None): + self.targetfd = targetfd + try: + self.targetfd_save = os.dup(self.targetfd) + except OSError: + self.start = lambda: None + self.done = lambda: None + else: + if targetfd == 0: + assert not tmpfile, "cannot set tmpfile with stdin" + tmpfile = open(os.devnull, "r") + self.syscapture = SysCapture(targetfd) + else: + if tmpfile is None: + f = TemporaryFile() + with f: + tmpfile = safe_text_dupfile(f, mode="wb+") + if targetfd in patchsysdict: + self.syscapture = SysCapture(targetfd, tmpfile) + else: + self.syscapture = NoCapture() + self.tmpfile = tmpfile + self.tmpfile_fd = tmpfile.fileno() + + def __repr__(self): + return "" % (self.targetfd, self.targetfd_save) + + def start(self): + """ Start capturing on targetfd using memorized tmpfile. """ + try: + os.fstat(self.targetfd_save) + except (AttributeError, OSError): + raise ValueError("saved filedescriptor not valid anymore") + os.dup2(self.tmpfile_fd, self.targetfd) + self.syscapture.start() + + def snap(self): + f = self.tmpfile + f.seek(0) + res = f.read() + if res: + enc = getattr(f, "encoding", None) + if enc and isinstance(res, bytes): + res = py.builtin._totext(res, enc, "replace") + f.truncate(0) + f.seek(0) + return res + return '' + + def done(self): + """ stop capturing, restore streams, return original capture file, + seeked to position zero. """ + targetfd_save = self.__dict__.pop("targetfd_save") + os.dup2(targetfd_save, self.targetfd) + os.close(targetfd_save) + self.syscapture.done() + self.tmpfile.close() + + def suspend(self): + self.syscapture.suspend() + os.dup2(self.targetfd_save, self.targetfd) + + def resume(self): + self.syscapture.resume() + os.dup2(self.tmpfile_fd, self.targetfd) + + def writeorg(self, data): + """ write to original file descriptor. """ + if py.builtin._istext(data): + data = data.encode("utf8") # XXX use encoding of original stream + os.write(self.targetfd_save, data) + + +class SysCapture: + def __init__(self, fd, tmpfile=None): + name = patchsysdict[fd] + self._old = getattr(sys, name) + self.name = name + if tmpfile is None: + if name == "stdin": + tmpfile = DontReadFromInput() + else: + tmpfile = CaptureIO() + self.tmpfile = tmpfile + + def start(self): + setattr(sys, self.name, self.tmpfile) + + def snap(self): + f = self.tmpfile + res = f.getvalue() + f.truncate(0) + f.seek(0) + return res + + def done(self): + setattr(sys, self.name, self._old) + del self._old + self.tmpfile.close() + + def suspend(self): + setattr(sys, self.name, self._old) + + def resume(self): + setattr(sys, self.name, self.tmpfile) + + def writeorg(self, data): + self._old.write(data) + self._old.flush() + + +class DontReadFromInput: + """Temporary stub class. Ideally when stdin is accessed, the + capturing should be turned off, with possibly all data captured + so far sent to the screen. This should be configurable, though, + because in automated test runs it is better to crash than + hang indefinitely. + """ + + encoding = None + + def read(self, *args): + raise IOError("reading from stdin while output is captured") + readline = read + readlines = read + __iter__ = read + + def fileno(self): + raise UnsupportedOperation("redirected stdin is pseudofile, " + "has no fileno()") + + def isatty(self): + return False + + def close(self): + pass + + @property + def buffer(self): + if sys.version_info >= (3, 0): + return self + else: + raise AttributeError('redirected stdin has no attribute buffer') + + +def _colorama_workaround(): + """ + Ensure colorama is imported so that it attaches to the correct stdio + handles on Windows. + + colorama uses the terminal on import time. So if something does the + first import of colorama while I/O capture is active, colorama will + fail in various ways. + """ + + if not sys.platform.startswith('win32'): + return + try: + import colorama # noqa + except ImportError: + pass + + +def _readline_workaround(): + """ + Ensure readline is imported so that it attaches to the correct stdio + handles on Windows. + + Pdb uses readline support where available--when not running from the Python + prompt, the readline module is not imported until running the pdb REPL. If + running pytest with the --pdb option this means the readline module is not + imported until after I/O capture has been started. + + This is a problem for pyreadline, which is often used to implement readline + support on Windows, as it does not attach to the correct handles for stdout + and/or stdin if they have been redirected by the FDCapture mechanism. This + workaround ensures that readline is imported before I/O capture is setup so + that it can attach to the actual stdin/out for the console. + + See https://github.com/pytest-dev/pytest/pull/1281 + """ + + if not sys.platform.startswith('win32'): + return + try: + import readline # noqa + except ImportError: + pass + + +def _py36_windowsconsoleio_workaround(stream): + """ + Python 3.6 implemented unicode console handling for Windows. This works + by reading/writing to the raw console handle using + ``{Read,Write}ConsoleW``. + + The problem is that we are going to ``dup2`` over the stdio file + descriptors when doing ``FDCapture`` and this will ``CloseHandle`` the + handles used by Python to write to the console. Though there is still some + weirdness and the console handle seems to only be closed randomly and not + on the first call to ``CloseHandle``, or maybe it gets reopened with the + same handle value when we suspend capturing. + + The workaround in this case will reopen stdio with a different fd which + also means a different handle by replicating the logic in + "Py_lifecycle.c:initstdio/create_stdio". + + :param stream: in practice ``sys.stdout`` or ``sys.stderr``, but given + here as parameter for unittesting purposes. + + See https://github.com/pytest-dev/py/issues/103 + """ + if not sys.platform.startswith('win32') or sys.version_info[:2] < (3, 6): + return + + # bail out if ``stream`` doesn't seem like a proper ``io`` stream (#2666) + if not hasattr(stream, 'buffer'): + return + + buffered = hasattr(stream.buffer, 'raw') + raw_stdout = stream.buffer.raw if buffered else stream.buffer + + if not isinstance(raw_stdout, io._WindowsConsoleIO): + return + + def _reopen_stdio(f, mode): + if not buffered and mode[0] == 'w': + buffering = 0 + else: + buffering = -1 + + return io.TextIOWrapper( + open(os.dup(f.fileno()), mode, buffering), + f.encoding, + f.errors, + f.newlines, + f.line_buffering) + + sys.__stdin__ = sys.stdin = _reopen_stdio(sys.stdin, 'rb') + sys.__stdout__ = sys.stdout = _reopen_stdio(sys.stdout, 'wb') + sys.__stderr__ = sys.stderr = _reopen_stdio(sys.stderr, 'wb') diff --git a/lib/spack/external/pytest-fallback/_pytest/compat.py b/lib/spack/external/pytest-fallback/_pytest/compat.py new file mode 100644 index 0000000000..255f69ce0d --- /dev/null +++ b/lib/spack/external/pytest-fallback/_pytest/compat.py @@ -0,0 +1,326 @@ +""" +python version compatibility code +""" +from __future__ import absolute_import, division, print_function +import sys +import inspect +import types +import re +import functools + +import py + +import _pytest +from _pytest.outcomes import TEST_OUTCOME + + +try: + import enum +except ImportError: # pragma: no cover + # Only available in Python 3.4+ or as a backport + enum = None + + +_PY3 = sys.version_info > (3, 0) +_PY2 = not _PY3 + + +NoneType = type(None) +NOTSET = object() + +PY35 = sys.version_info[:2] >= (3, 5) +PY36 = sys.version_info[:2] >= (3, 6) +MODULE_NOT_FOUND_ERROR = 'ModuleNotFoundError' if PY36 else 'ImportError' + +if hasattr(inspect, 'signature'): + def _format_args(func): + return str(inspect.signature(func)) +else: + def _format_args(func): + return inspect.formatargspec(*inspect.getargspec(func)) + +isfunction = inspect.isfunction +isclass = inspect.isclass +# used to work around a python2 exception info leak +exc_clear = getattr(sys, 'exc_clear', lambda: None) +# The type of re.compile objects is not exposed in Python. +REGEX_TYPE = type(re.compile('')) + + +def is_generator(func): + genfunc = inspect.isgeneratorfunction(func) + return genfunc and not iscoroutinefunction(func) + + +def iscoroutinefunction(func): + """Return True if func is a decorated coroutine function. + + Note: copied and modified from Python 3.5's builtin couroutines.py to avoid import asyncio directly, + which in turns also initializes the "logging" module as side-effect (see issue #8). + """ + return (getattr(func, '_is_coroutine', False) or + (hasattr(inspect, 'iscoroutinefunction') and inspect.iscoroutinefunction(func))) + + +def getlocation(function, curdir): + import inspect + fn = py.path.local(inspect.getfile(function)) + lineno = py.builtin._getcode(function).co_firstlineno + if fn.relto(curdir): + fn = fn.relto(curdir) + return "%s:%d" % (fn, lineno + 1) + + +def num_mock_patch_args(function): + """ return number of arguments used up by mock arguments (if any) """ + patchings = getattr(function, "patchings", None) + if not patchings: + return 0 + mock = sys.modules.get("mock", sys.modules.get("unittest.mock", None)) + if mock is not None: + return len([p for p in patchings + if not p.attribute_name and p.new is mock.DEFAULT]) + return len(patchings) + + +def getfuncargnames(function, startindex=None, cls=None): + """ + @RonnyPfannschmidt: This function should be refactored when we revisit fixtures. The + fixture mechanism should ask the node for the fixture names, and not try to obtain + directly from the function object well after collection has occurred. + """ + if startindex is None and cls is not None: + is_staticmethod = isinstance(cls.__dict__.get(function.__name__, None), staticmethod) + startindex = 0 if is_staticmethod else 1 + # XXX merge with main.py's varnames + # assert not isclass(function) + realfunction = function + while hasattr(realfunction, "__wrapped__"): + realfunction = realfunction.__wrapped__ + if startindex is None: + startindex = inspect.ismethod(function) and 1 or 0 + if realfunction != function: + startindex += num_mock_patch_args(function) + function = realfunction + if isinstance(function, functools.partial): + argnames = inspect.getargs(_pytest._code.getrawcode(function.func))[0] + partial = function + argnames = argnames[len(partial.args):] + if partial.keywords: + for kw in partial.keywords: + argnames.remove(kw) + else: + argnames = inspect.getargs(_pytest._code.getrawcode(function))[0] + defaults = getattr(function, 'func_defaults', + getattr(function, '__defaults__', None)) or () + numdefaults = len(defaults) + if numdefaults: + return tuple(argnames[startindex:-numdefaults]) + return tuple(argnames[startindex:]) + + +if sys.version_info[:2] == (2, 6): + def isclass(object): + """ Return true if the object is a class. Overrides inspect.isclass for + python 2.6 because it will return True for objects which always return + something on __getattr__ calls (see #1035). + Backport of https://hg.python.org/cpython/rev/35bf8f7a8edc + """ + return isinstance(object, (type, types.ClassType)) + + +if _PY3: + import codecs + imap = map + izip = zip + STRING_TYPES = bytes, str + UNICODE_TYPES = str, + + def _ascii_escaped(val): + """If val is pure ascii, returns it as a str(). Otherwise, escapes + bytes objects into a sequence of escaped bytes: + + b'\xc3\xb4\xc5\xd6' -> u'\\xc3\\xb4\\xc5\\xd6' + + and escapes unicode objects into a sequence of escaped unicode + ids, e.g.: + + '4\\nV\\U00043efa\\x0eMXWB\\x1e\\u3028\\u15fd\\xcd\\U0007d944' + + note: + the obvious "v.decode('unicode-escape')" will return + valid utf-8 unicode if it finds them in bytes, but we + want to return escaped bytes for any byte, even if they match + a utf-8 string. + + """ + if isinstance(val, bytes): + if val: + # source: http://goo.gl/bGsnwC + encoded_bytes, _ = codecs.escape_encode(val) + return encoded_bytes.decode('ascii') + else: + # empty bytes crashes codecs.escape_encode (#1087) + return '' + else: + return val.encode('unicode_escape').decode('ascii') +else: + STRING_TYPES = bytes, str, unicode + UNICODE_TYPES = unicode, + + from itertools import imap, izip # NOQA + + def _ascii_escaped(val): + """In py2 bytes and str are the same type, so return if it's a bytes + object, return it unchanged if it is a full ascii string, + otherwise escape it into its binary form. + + If it's a unicode string, change the unicode characters into + unicode escapes. + + """ + if isinstance(val, bytes): + try: + return val.encode('ascii') + except UnicodeDecodeError: + return val.encode('string-escape') + else: + return val.encode('unicode-escape') + + +def get_real_func(obj): + """ gets the real function object of the (possibly) wrapped object by + functools.wraps or functools.partial. + """ + start_obj = obj + for i in range(100): + new_obj = getattr(obj, '__wrapped__', None) + if new_obj is None: + break + obj = new_obj + else: + raise ValueError( + ("could not find real function of {start}" + "\nstopped at {current}").format( + start=py.io.saferepr(start_obj), + current=py.io.saferepr(obj))) + if isinstance(obj, functools.partial): + obj = obj.func + return obj + + +def getfslineno(obj): + # xxx let decorators etc specify a sane ordering + obj = get_real_func(obj) + if hasattr(obj, 'place_as'): + obj = obj.place_as + fslineno = _pytest._code.getfslineno(obj) + assert isinstance(fslineno[1], int), obj + return fslineno + + +def getimfunc(func): + try: + return func.__func__ + except AttributeError: + try: + return func.im_func + except AttributeError: + return func + + +def safe_getattr(object, name, default): + """ Like getattr but return default upon any Exception or any OutcomeException. + + Attribute access can potentially fail for 'evil' Python objects. + See issue #214. + It catches OutcomeException because of #2490 (issue #580), new outcomes are derived from BaseException + instead of Exception (for more details check #2707) + """ + try: + return getattr(object, name, default) + except TEST_OUTCOME: + return default + + +def _is_unittest_unexpected_success_a_failure(): + """Return if the test suite should fail if a @expectedFailure unittest test PASSES. + + From https://docs.python.org/3/library/unittest.html?highlight=unittest#unittest.TestResult.wasSuccessful: + Changed in version 3.4: Returns False if there were any + unexpectedSuccesses from tests marked with the expectedFailure() decorator. + """ + return sys.version_info >= (3, 4) + + +if _PY3: + def safe_str(v): + """returns v as string""" + return str(v) +else: + def safe_str(v): + """returns v as string, converting to ascii if necessary""" + try: + return str(v) + except UnicodeError: + if not isinstance(v, unicode): + v = unicode(v) + errors = 'replace' + return v.encode('utf-8', errors) + + +COLLECT_FAKEMODULE_ATTRIBUTES = ( + 'Collector', + 'Module', + 'Generator', + 'Function', + 'Instance', + 'Session', + 'Item', + 'Class', + 'File', + '_fillfuncargs', +) + + +def _setup_collect_fakemodule(): + from types import ModuleType + import pytest + pytest.collect = ModuleType('pytest.collect') + pytest.collect.__all__ = [] # used for setns + for attr in COLLECT_FAKEMODULE_ATTRIBUTES: + setattr(pytest.collect, attr, getattr(pytest, attr)) + + +if _PY2: + # Without this the test_dupfile_on_textio will fail, otherwise CaptureIO could directly inherit from StringIO. + from py.io import TextIO + + class CaptureIO(TextIO): + + @property + def encoding(self): + return getattr(self, '_encoding', 'UTF-8') + +else: + import io + + class CaptureIO(io.TextIOWrapper): + def __init__(self): + super(CaptureIO, self).__init__( + io.BytesIO(), + encoding='UTF-8', newline='', write_through=True, + ) + + def getvalue(self): + return self.buffer.getvalue().decode('UTF-8') + + +class FuncargnamesCompatAttr(object): + """ helper class so that Metafunc, Function and FixtureRequest + don't need to each define the "funcargnames" compatibility attribute. + """ + @property + def funcargnames(self): + """ alias attribute for ``fixturenames`` for pre-2.3 compatibility""" + return self.fixturenames diff --git a/lib/spack/external/pytest-fallback/_pytest/config.py b/lib/spack/external/pytest-fallback/_pytest/config.py new file mode 100644 index 0000000000..513478a972 --- /dev/null +++ b/lib/spack/external/pytest-fallback/_pytest/config.py @@ -0,0 +1,1398 @@ +""" command line options, ini-file and conftest.py processing. """ +from __future__ import absolute_import, division, print_function +import argparse +import shlex +import traceback +import types +import warnings + +import py +# DON't import pytest here because it causes import cycle troubles +import sys +import os +import _pytest._code +import _pytest.hookspec # the extension point definitions +import _pytest.assertion +from _pytest._pluggy import PluginManager, HookimplMarker, HookspecMarker +from _pytest.compat import safe_str + +hookimpl = HookimplMarker("pytest") +hookspec = HookspecMarker("pytest") + +# pytest startup +# + + +class ConftestImportFailure(Exception): + def __init__(self, path, excinfo): + Exception.__init__(self, path, excinfo) + self.path = path + self.excinfo = excinfo + + def __str__(self): + etype, evalue, etb = self.excinfo + formatted = traceback.format_tb(etb) + # The level of the tracebacks we want to print is hand crafted :( + return repr(evalue) + '\n' + ''.join(formatted[2:]) + + +def main(args=None, plugins=None): + """ return exit code, after performing an in-process test run. + + :arg args: list of command line arguments. + + :arg plugins: list of plugin objects to be auto-registered during + initialization. + """ + try: + try: + config = _prepareconfig(args, plugins) + except ConftestImportFailure as e: + tw = py.io.TerminalWriter(sys.stderr) + for line in traceback.format_exception(*e.excinfo): + tw.line(line.rstrip(), red=True) + tw.line("ERROR: could not load %s\n" % (e.path), red=True) + return 4 + else: + try: + return config.hook.pytest_cmdline_main(config=config) + finally: + config._ensure_unconfigure() + except UsageError as e: + for msg in e.args: + sys.stderr.write("ERROR: %s\n" % (msg,)) + return 4 + + +class cmdline: # compatibility namespace + main = staticmethod(main) + + +class UsageError(Exception): + """ error in pytest usage or invocation""" + + +class PrintHelp(Exception): + """Raised when pytest should print it's help to skip the rest of the + argument parsing and validation.""" + pass + + +def filename_arg(path, optname): + """ Argparse type validator for filename arguments. + + :path: path of filename + :optname: name of the option + """ + if os.path.isdir(path): + raise UsageError("{0} must be a filename, given: {1}".format(optname, path)) + return path + + +def directory_arg(path, optname): + """Argparse type validator for directory arguments. + + :path: path of directory + :optname: name of the option + """ + if not os.path.isdir(path): + raise UsageError("{0} must be a directory, given: {1}".format(optname, path)) + return path + + +_preinit = [] + +default_plugins = ( + "mark main terminal runner python fixtures debugging unittest capture skipping " + "tmpdir monkeypatch recwarn pastebin helpconfig nose assertion " + "junitxml resultlog doctest cacheprovider freeze_support " + "setuponly setupplan warnings").split() + + +builtin_plugins = set(default_plugins) +builtin_plugins.add("pytester") + + +def _preloadplugins(): + assert not _preinit + _preinit.append(get_config()) + + +def get_config(): + if _preinit: + return _preinit.pop(0) + # subsequent calls to main will create a fresh instance + pluginmanager = PytestPluginManager() + config = Config(pluginmanager) + for spec in default_plugins: + pluginmanager.import_plugin(spec) + return config + + +def get_plugin_manager(): + """ + Obtain a new instance of the + :py:class:`_pytest.config.PytestPluginManager`, with default plugins + already loaded. + + This function can be used by integration with other tools, like hooking + into pytest to run tests into an IDE. + """ + return get_config().pluginmanager + + +def _prepareconfig(args=None, plugins=None): + warning = None + if args is None: + args = sys.argv[1:] + elif isinstance(args, py.path.local): + args = [str(args)] + elif not isinstance(args, (tuple, list)): + if not isinstance(args, str): + raise ValueError("not a string or argument list: %r" % (args,)) + args = shlex.split(args, posix=sys.platform != "win32") + from _pytest import deprecated + warning = deprecated.MAIN_STR_ARGS + config = get_config() + pluginmanager = config.pluginmanager + try: + if plugins: + for plugin in plugins: + if isinstance(plugin, py.builtin._basestring): + pluginmanager.consider_pluginarg(plugin) + else: + pluginmanager.register(plugin) + if warning: + config.warn('C1', warning) + return pluginmanager.hook.pytest_cmdline_parse( + pluginmanager=pluginmanager, args=args) + except BaseException: + config._ensure_unconfigure() + raise + + +class PytestPluginManager(PluginManager): + """ + Overwrites :py:class:`pluggy.PluginManager <_pytest.vendored_packages.pluggy.PluginManager>` to add pytest-specific + functionality: + + * loading plugins from the command line, ``PYTEST_PLUGIN`` env variable and + ``pytest_plugins`` global variables found in plugins being loaded; + * ``conftest.py`` loading during start-up; + """ + + def __init__(self): + super(PytestPluginManager, self).__init__("pytest", implprefix="pytest_") + self._conftest_plugins = set() + + # state related to local conftest plugins + self._path2confmods = {} + self._conftestpath2mod = {} + self._confcutdir = None + self._noconftest = False + self._duplicatepaths = set() + + self.add_hookspecs(_pytest.hookspec) + self.register(self) + if os.environ.get('PYTEST_DEBUG'): + err = sys.stderr + encoding = getattr(err, 'encoding', 'utf8') + try: + err = py.io.dupfile(err, encoding=encoding) + except Exception: + pass + self.trace.root.setwriter(err.write) + self.enable_tracing() + + # Config._consider_importhook will set a real object if required. + self.rewrite_hook = _pytest.assertion.DummyRewriteHook() + + def addhooks(self, module_or_class): + """ + .. deprecated:: 2.8 + + Use :py:meth:`pluggy.PluginManager.add_hookspecs <_pytest.vendored_packages.pluggy.PluginManager.add_hookspecs>` + instead. + """ + warning = dict(code="I2", + fslocation=_pytest._code.getfslineno(sys._getframe(1)), + nodeid=None, + message="use pluginmanager.add_hookspecs instead of " + "deprecated addhooks() method.") + self._warn(warning) + return self.add_hookspecs(module_or_class) + + def parse_hookimpl_opts(self, plugin, name): + # pytest hooks are always prefixed with pytest_ + # so we avoid accessing possibly non-readable attributes + # (see issue #1073) + if not name.startswith("pytest_"): + return + # ignore some historic special names which can not be hooks anyway + if name == "pytest_plugins" or name.startswith("pytest_funcarg__"): + return + + method = getattr(plugin, name) + opts = super(PytestPluginManager, self).parse_hookimpl_opts(plugin, name) + if opts is not None: + for name in ("tryfirst", "trylast", "optionalhook", "hookwrapper"): + opts.setdefault(name, hasattr(method, name)) + return opts + + def parse_hookspec_opts(self, module_or_class, name): + opts = super(PytestPluginManager, self).parse_hookspec_opts( + module_or_class, name) + if opts is None: + method = getattr(module_or_class, name) + if name.startswith("pytest_"): + opts = {"firstresult": hasattr(method, "firstresult"), + "historic": hasattr(method, "historic")} + return opts + + def _verify_hook(self, hook, hookmethod): + super(PytestPluginManager, self)._verify_hook(hook, hookmethod) + if "__multicall__" in hookmethod.argnames: + fslineno = _pytest._code.getfslineno(hookmethod.function) + warning = dict(code="I1", + fslocation=fslineno, + nodeid=None, + message="%r hook uses deprecated __multicall__ " + "argument" % (hook.name)) + self._warn(warning) + + def register(self, plugin, name=None): + ret = super(PytestPluginManager, self).register(plugin, name) + if ret: + self.hook.pytest_plugin_registered.call_historic( + kwargs=dict(plugin=plugin, manager=self)) + + if isinstance(plugin, types.ModuleType): + self.consider_module(plugin) + return ret + + def getplugin(self, name): + # support deprecated naming because plugins (xdist e.g.) use it + return self.get_plugin(name) + + def hasplugin(self, name): + """Return True if the plugin with the given name is registered.""" + return bool(self.get_plugin(name)) + + def pytest_configure(self, config): + # XXX now that the pluginmanager exposes hookimpl(tryfirst...) + # we should remove tryfirst/trylast as markers + config.addinivalue_line("markers", + "tryfirst: mark a hook implementation function such that the " + "plugin machinery will try to call it first/as early as possible.") + config.addinivalue_line("markers", + "trylast: mark a hook implementation function such that the " + "plugin machinery will try to call it last/as late as possible.") + + def _warn(self, message): + kwargs = message if isinstance(message, dict) else { + 'code': 'I1', + 'message': message, + 'fslocation': None, + 'nodeid': None, + } + self.hook.pytest_logwarning.call_historic(kwargs=kwargs) + + # + # internal API for local conftest plugin handling + # + def _set_initial_conftests(self, namespace): + """ load initial conftest files given a preparsed "namespace". + As conftest files may add their own command line options + which have arguments ('--my-opt somepath') we might get some + false positives. All builtin and 3rd party plugins will have + been loaded, however, so common options will not confuse our logic + here. + """ + current = py.path.local() + self._confcutdir = current.join(namespace.confcutdir, abs=True) \ + if namespace.confcutdir else None + self._noconftest = namespace.noconftest + testpaths = namespace.file_or_dir + foundanchor = False + for path in testpaths: + path = str(path) + # remove node-id syntax + i = path.find("::") + if i != -1: + path = path[:i] + anchor = current.join(path, abs=1) + if exists(anchor): # we found some file object + self._try_load_conftest(anchor) + foundanchor = True + if not foundanchor: + self._try_load_conftest(current) + + def _try_load_conftest(self, anchor): + self._getconftestmodules(anchor) + # let's also consider test* subdirs + if anchor.check(dir=1): + for x in anchor.listdir("test*"): + if x.check(dir=1): + self._getconftestmodules(x) + + def _getconftestmodules(self, path): + if self._noconftest: + return [] + try: + return self._path2confmods[path] + except KeyError: + if path.isfile(): + clist = self._getconftestmodules(path.dirpath()) + else: + # XXX these days we may rather want to use config.rootdir + # and allow users to opt into looking into the rootdir parent + # directories instead of requiring to specify confcutdir + clist = [] + for parent in path.parts(): + if self._confcutdir and self._confcutdir.relto(parent): + continue + conftestpath = parent.join("conftest.py") + if conftestpath.isfile(): + mod = self._importconftest(conftestpath) + clist.append(mod) + + self._path2confmods[path] = clist + return clist + + def _rget_with_confmod(self, name, path): + modules = self._getconftestmodules(path) + for mod in reversed(modules): + try: + return mod, getattr(mod, name) + except AttributeError: + continue + raise KeyError(name) + + def _importconftest(self, conftestpath): + try: + return self._conftestpath2mod[conftestpath] + except KeyError: + pkgpath = conftestpath.pypkgpath() + if pkgpath is None: + _ensure_removed_sysmodule(conftestpath.purebasename) + try: + mod = conftestpath.pyimport() + except Exception: + raise ConftestImportFailure(conftestpath, sys.exc_info()) + + self._conftest_plugins.add(mod) + self._conftestpath2mod[conftestpath] = mod + dirpath = conftestpath.dirpath() + if dirpath in self._path2confmods: + for path, mods in self._path2confmods.items(): + if path and path.relto(dirpath) or path == dirpath: + assert mod not in mods + mods.append(mod) + self.trace("loaded conftestmodule %r" % (mod)) + self.consider_conftest(mod) + return mod + + # + # API for bootstrapping plugin loading + # + # + + def consider_preparse(self, args): + for opt1, opt2 in zip(args, args[1:]): + if opt1 == "-p": + self.consider_pluginarg(opt2) + + def consider_pluginarg(self, arg): + if arg.startswith("no:"): + name = arg[3:] + self.set_blocked(name) + if not name.startswith("pytest_"): + self.set_blocked("pytest_" + name) + else: + self.import_plugin(arg) + + def consider_conftest(self, conftestmodule): + self.register(conftestmodule, name=conftestmodule.__file__) + + def consider_env(self): + self._import_plugin_specs(os.environ.get("PYTEST_PLUGINS")) + + def consider_module(self, mod): + self._import_plugin_specs(getattr(mod, 'pytest_plugins', [])) + + def _import_plugin_specs(self, spec): + plugins = _get_plugin_specs_as_list(spec) + for import_spec in plugins: + self.import_plugin(import_spec) + + def import_plugin(self, modname): + # most often modname refers to builtin modules, e.g. "pytester", + # "terminal" or "capture". Those plugins are registered under their + # basename for historic purposes but must be imported with the + # _pytest prefix. + assert isinstance(modname, (py.builtin.text, str)), "module name as text required, got %r" % modname + modname = str(modname) + if self.get_plugin(modname) is not None: + return + if modname in builtin_plugins: + importspec = "_pytest." + modname + else: + importspec = modname + self.rewrite_hook.mark_rewrite(importspec) + try: + __import__(importspec) + except ImportError as e: + new_exc = ImportError('Error importing plugin "%s": %s' % (modname, safe_str(e.args[0]))) + # copy over name and path attributes + for attr in ('name', 'path'): + if hasattr(e, attr): + setattr(new_exc, attr, getattr(e, attr)) + raise new_exc + except Exception as e: + import pytest + if not hasattr(pytest, 'skip') or not isinstance(e, pytest.skip.Exception): + raise + self._warn("skipped plugin %r: %s" % ((modname, e.msg))) + else: + mod = sys.modules[importspec] + self.register(mod, modname) + + +def _get_plugin_specs_as_list(specs): + """ + Parses a list of "plugin specs" and returns a list of plugin names. + + Plugin specs can be given as a list of strings separated by "," or already as a list/tuple in + which case it is returned as a list. Specs can also be `None` in which case an + empty list is returned. + """ + if specs is not None: + if isinstance(specs, str): + specs = specs.split(',') if specs else [] + if not isinstance(specs, (list, tuple)): + raise UsageError("Plugin specs must be a ','-separated string or a " + "list/tuple of strings for plugin names. Given: %r" % specs) + return list(specs) + return [] + + +class Parser: + """ Parser for command line arguments and ini-file values. + + :ivar extra_info: dict of generic param -> value to display in case + there's an error processing the command line arguments. + """ + + def __init__(self, usage=None, processopt=None): + self._anonymous = OptionGroup("custom options", parser=self) + self._groups = [] + self._processopt = processopt + self._usage = usage + self._inidict = {} + self._ininames = [] + self.extra_info = {} + + def processoption(self, option): + if self._processopt: + if option.dest: + self._processopt(option) + + def getgroup(self, name, description="", after=None): + """ get (or create) a named option Group. + + :name: name of the option group. + :description: long description for --help output. + :after: name of other group, used for ordering --help output. + + The returned group object has an ``addoption`` method with the same + signature as :py:func:`parser.addoption + <_pytest.config.Parser.addoption>` but will be shown in the + respective group in the output of ``pytest. --help``. + """ + for group in self._groups: + if group.name == name: + return group + group = OptionGroup(name, description, parser=self) + i = 0 + for i, grp in enumerate(self._groups): + if grp.name == after: + break + self._groups.insert(i + 1, group) + return group + + def addoption(self, *opts, **attrs): + """ register a command line option. + + :opts: option names, can be short or long options. + :attrs: same attributes which the ``add_option()`` function of the + `argparse library + `_ + accepts. + + After command line parsing options are available on the pytest config + object via ``config.option.NAME`` where ``NAME`` is usually set + by passing a ``dest`` attribute, for example + ``addoption("--long", dest="NAME", ...)``. + """ + self._anonymous.addoption(*opts, **attrs) + + def parse(self, args, namespace=None): + from _pytest._argcomplete import try_argcomplete + self.optparser = self._getparser() + try_argcomplete(self.optparser) + return self.optparser.parse_args([str(x) for x in args], namespace=namespace) + + def _getparser(self): + from _pytest._argcomplete import filescompleter + optparser = MyOptionParser(self, self.extra_info) + groups = self._groups + [self._anonymous] + for group in groups: + if group.options: + desc = group.description or group.name + arggroup = optparser.add_argument_group(desc) + for option in group.options: + n = option.names() + a = option.attrs() + arggroup.add_argument(*n, **a) + # bash like autocompletion for dirs (appending '/') + optparser.add_argument(FILE_OR_DIR, nargs='*').completer = filescompleter + return optparser + + def parse_setoption(self, args, option, namespace=None): + parsedoption = self.parse(args, namespace=namespace) + for name, value in parsedoption.__dict__.items(): + setattr(option, name, value) + return getattr(parsedoption, FILE_OR_DIR) + + def parse_known_args(self, args, namespace=None): + """parses and returns a namespace object with known arguments at this + point. + """ + return self.parse_known_and_unknown_args(args, namespace=namespace)[0] + + def parse_known_and_unknown_args(self, args, namespace=None): + """parses and returns a namespace object with known arguments, and + the remaining arguments unknown at this point. + """ + optparser = self._getparser() + args = [str(x) for x in args] + return optparser.parse_known_args(args, namespace=namespace) + + def addini(self, name, help, type=None, default=None): + """ register an ini-file option. + + :name: name of the ini-variable + :type: type of the variable, can be ``pathlist``, ``args``, ``linelist`` + or ``bool``. + :default: default value if no ini-file option exists but is queried. + + The value of ini-variables can be retrieved via a call to + :py:func:`config.getini(name) <_pytest.config.Config.getini>`. + """ + assert type in (None, "pathlist", "args", "linelist", "bool") + self._inidict[name] = (help, type, default) + self._ininames.append(name) + + +class ArgumentError(Exception): + """ + Raised if an Argument instance is created with invalid or + inconsistent arguments. + """ + + def __init__(self, msg, option): + self.msg = msg + self.option_id = str(option) + + def __str__(self): + if self.option_id: + return "option %s: %s" % (self.option_id, self.msg) + else: + return self.msg + + +class Argument: + """class that mimics the necessary behaviour of optparse.Option + + its currently a least effort implementation + and ignoring choices and integer prefixes + https://docs.python.org/3/library/optparse.html#optparse-standard-option-types + """ + _typ_map = { + 'int': int, + 'string': str, + 'float': float, + 'complex': complex, + } + + def __init__(self, *names, **attrs): + """store parms in private vars for use in add_argument""" + self._attrs = attrs + self._short_opts = [] + self._long_opts = [] + self.dest = attrs.get('dest') + if '%default' in (attrs.get('help') or ''): + warnings.warn( + 'pytest now uses argparse. "%default" should be' + ' changed to "%(default)s" ', + DeprecationWarning, + stacklevel=3) + try: + typ = attrs['type'] + except KeyError: + pass + else: + # this might raise a keyerror as well, don't want to catch that + if isinstance(typ, py.builtin._basestring): + if typ == 'choice': + warnings.warn( + 'type argument to addoption() is a string %r.' + ' For parsearg this is optional and when supplied' + ' should be a type.' + ' (options: %s)' % (typ, names), + DeprecationWarning, + stacklevel=3) + # argparse expects a type here take it from + # the type of the first element + attrs['type'] = type(attrs['choices'][0]) + else: + warnings.warn( + 'type argument to addoption() is a string %r.' + ' For parsearg this should be a type.' + ' (options: %s)' % (typ, names), + DeprecationWarning, + stacklevel=3) + attrs['type'] = Argument._typ_map[typ] + # used in test_parseopt -> test_parse_defaultgetter + self.type = attrs['type'] + else: + self.type = typ + try: + # attribute existence is tested in Config._processopt + self.default = attrs['default'] + except KeyError: + pass + self._set_opt_strings(names) + if not self.dest: + if self._long_opts: + self.dest = self._long_opts[0][2:].replace('-', '_') + else: + try: + self.dest = self._short_opts[0][1:] + except IndexError: + raise ArgumentError( + 'need a long or short option', self) + + def names(self): + return self._short_opts + self._long_opts + + def attrs(self): + # update any attributes set by processopt + attrs = 'default dest help'.split() + if self.dest: + attrs.append(self.dest) + for attr in attrs: + try: + self._attrs[attr] = getattr(self, attr) + except AttributeError: + pass + if self._attrs.get('help'): + a = self._attrs['help'] + a = a.replace('%default', '%(default)s') + # a = a.replace('%prog', '%(prog)s') + self._attrs['help'] = a + return self._attrs + + def _set_opt_strings(self, opts): + """directly from optparse + + might not be necessary as this is passed to argparse later on""" + for opt in opts: + if len(opt) < 2: + raise ArgumentError( + "invalid option string %r: " + "must be at least two characters long" % opt, self) + elif len(opt) == 2: + if not (opt[0] == "-" and opt[1] != "-"): + raise ArgumentError( + "invalid short option string %r: " + "must be of the form -x, (x any non-dash char)" % opt, + self) + self._short_opts.append(opt) + else: + if not (opt[0:2] == "--" and opt[2] != "-"): + raise ArgumentError( + "invalid long option string %r: " + "must start with --, followed by non-dash" % opt, + self) + self._long_opts.append(opt) + + def __repr__(self): + args = [] + if self._short_opts: + args += ['_short_opts: ' + repr(self._short_opts)] + if self._long_opts: + args += ['_long_opts: ' + repr(self._long_opts)] + args += ['dest: ' + repr(self.dest)] + if hasattr(self, 'type'): + args += ['type: ' + repr(self.type)] + if hasattr(self, 'default'): + args += ['default: ' + repr(self.default)] + return 'Argument({0})'.format(', '.join(args)) + + +class OptionGroup: + def __init__(self, name, description="", parser=None): + self.name = name + self.description = description + self.options = [] + self.parser = parser + + def addoption(self, *optnames, **attrs): + """ add an option to this group. + + if a shortened version of a long option is specified it will + be suppressed in the help. addoption('--twowords', '--two-words') + results in help showing '--two-words' only, but --twowords gets + accepted **and** the automatic destination is in args.twowords + """ + conflict = set(optnames).intersection( + name for opt in self.options for name in opt.names()) + if conflict: + raise ValueError("option names %s already added" % conflict) + option = Argument(*optnames, **attrs) + self._addoption_instance(option, shortupper=False) + + def _addoption(self, *optnames, **attrs): + option = Argument(*optnames, **attrs) + self._addoption_instance(option, shortupper=True) + + def _addoption_instance(self, option, shortupper=False): + if not shortupper: + for opt in option._short_opts: + if opt[0] == '-' and opt[1].islower(): + raise ValueError("lowercase shortoptions reserved") + if self.parser: + self.parser.processoption(option) + self.options.append(option) + + +class MyOptionParser(argparse.ArgumentParser): + def __init__(self, parser, extra_info=None): + if not extra_info: + extra_info = {} + self._parser = parser + argparse.ArgumentParser.__init__(self, usage=parser._usage, + add_help=False, formatter_class=DropShorterLongHelpFormatter) + # extra_info is a dict of (param -> value) to display if there's + # an usage error to provide more contextual information to the user + self.extra_info = extra_info + + def parse_args(self, args=None, namespace=None): + """allow splitting of positional arguments""" + args, argv = self.parse_known_args(args, namespace) + if argv: + for arg in argv: + if arg and arg[0] == '-': + lines = ['unrecognized arguments: %s' % (' '.join(argv))] + for k, v in sorted(self.extra_info.items()): + lines.append(' %s: %s' % (k, v)) + self.error('\n'.join(lines)) + getattr(args, FILE_OR_DIR).extend(argv) + return args + + +class DropShorterLongHelpFormatter(argparse.HelpFormatter): + """shorten help for long options that differ only in extra hyphens + + - collapse **long** options that are the same except for extra hyphens + - special action attribute map_long_option allows surpressing additional + long options + - shortcut if there are only two options and one of them is a short one + - cache result on action object as this is called at least 2 times + """ + + def _format_action_invocation(self, action): + orgstr = argparse.HelpFormatter._format_action_invocation(self, action) + if orgstr and orgstr[0] != '-': # only optional arguments + return orgstr + res = getattr(action, '_formatted_action_invocation', None) + if res: + return res + options = orgstr.split(', ') + if len(options) == 2 and (len(options[0]) == 2 or len(options[1]) == 2): + # a shortcut for '-h, --help' or '--abc', '-a' + action._formatted_action_invocation = orgstr + return orgstr + return_list = [] + option_map = getattr(action, 'map_long_option', {}) + if option_map is None: + option_map = {} + short_long = {} + for option in options: + if len(option) == 2 or option[2] == ' ': + continue + if not option.startswith('--'): + raise ArgumentError('long optional argument without "--": [%s]' + % (option), self) + xxoption = option[2:] + if xxoption.split()[0] not in option_map: + shortened = xxoption.replace('-', '') + if shortened not in short_long or \ + len(short_long[shortened]) < len(xxoption): + short_long[shortened] = xxoption + # now short_long has been filled out to the longest with dashes + # **and** we keep the right option ordering from add_argument + for option in options: + if len(option) == 2 or option[2] == ' ': + return_list.append(option) + if option[2:] == short_long.get(option.replace('-', '')): + return_list.append(option.replace(' ', '=', 1)) + action._formatted_action_invocation = ', '.join(return_list) + return action._formatted_action_invocation + + +def _ensure_removed_sysmodule(modname): + try: + del sys.modules[modname] + except KeyError: + pass + + +class CmdOptions(object): + """ holds cmdline options as attributes.""" + + def __init__(self, values=()): + self.__dict__.update(values) + + def __repr__(self): + return "" % (self.__dict__,) + + def copy(self): + return CmdOptions(self.__dict__) + + +class Notset: + def __repr__(self): + return "" + + +notset = Notset() +FILE_OR_DIR = 'file_or_dir' + + +def _iter_rewritable_modules(package_files): + for fn in package_files: + is_simple_module = '/' not in fn and fn.endswith('.py') + is_package = fn.count('/') == 1 and fn.endswith('__init__.py') + if is_simple_module: + module_name, _ = os.path.splitext(fn) + yield module_name + elif is_package: + package_name = os.path.dirname(fn) + yield package_name + + +class Config(object): + """ access to configuration values, pluginmanager and plugin hooks. """ + + def __init__(self, pluginmanager): + #: access to command line option as attributes. + #: (deprecated), use :py:func:`getoption() <_pytest.config.Config.getoption>` instead + self.option = CmdOptions() + _a = FILE_OR_DIR + self._parser = Parser( + usage="%%(prog)s [options] [%s] [%s] [...]" % (_a, _a), + processopt=self._processopt, + ) + #: a pluginmanager instance + self.pluginmanager = pluginmanager + self.trace = self.pluginmanager.trace.root.get("config") + self.hook = self.pluginmanager.hook + self._inicache = {} + self._override_ini = () + self._opt2dest = {} + self._cleanup = [] + self._warn = self.pluginmanager._warn + self.pluginmanager.register(self, "pytestconfig") + self._configured = False + + def do_setns(dic): + import pytest + setns(pytest, dic) + + self.hook.pytest_namespace.call_historic(do_setns, {}) + self.hook.pytest_addoption.call_historic(kwargs=dict(parser=self._parser)) + + def add_cleanup(self, func): + """ Add a function to be called when the config object gets out of + use (usually coninciding with pytest_unconfigure).""" + self._cleanup.append(func) + + def _do_configure(self): + assert not self._configured + self._configured = True + self.hook.pytest_configure.call_historic(kwargs=dict(config=self)) + + def _ensure_unconfigure(self): + if self._configured: + self._configured = False + self.hook.pytest_unconfigure(config=self) + self.hook.pytest_configure._call_history = [] + while self._cleanup: + fin = self._cleanup.pop() + fin() + + def warn(self, code, message, fslocation=None, nodeid=None): + """ generate a warning for this test session. """ + self.hook.pytest_logwarning.call_historic(kwargs=dict( + code=code, message=message, + fslocation=fslocation, nodeid=nodeid)) + + def get_terminal_writer(self): + return self.pluginmanager.get_plugin("terminalreporter")._tw + + def pytest_cmdline_parse(self, pluginmanager, args): + # REF1 assert self == pluginmanager.config, (self, pluginmanager.config) + self.parse(args) + return self + + def notify_exception(self, excinfo, option=None): + if option and option.fulltrace: + style = "long" + else: + style = "native" + excrepr = excinfo.getrepr(funcargs=True, + showlocals=getattr(option, 'showlocals', False), + style=style, + ) + res = self.hook.pytest_internalerror(excrepr=excrepr, + excinfo=excinfo) + if not py.builtin.any(res): + for line in str(excrepr).split("\n"): + sys.stderr.write("INTERNALERROR> %s\n" % line) + sys.stderr.flush() + + def cwd_relative_nodeid(self, nodeid): + # nodeid's are relative to the rootpath, compute relative to cwd + if self.invocation_dir != self.rootdir: + fullpath = self.rootdir.join(nodeid) + nodeid = self.invocation_dir.bestrelpath(fullpath) + return nodeid + + @classmethod + def fromdictargs(cls, option_dict, args): + """ constructor useable for subprocesses. """ + config = get_config() + config.option.__dict__.update(option_dict) + config.parse(args, addopts=False) + for x in config.option.plugins: + config.pluginmanager.consider_pluginarg(x) + return config + + def _processopt(self, opt): + for name in opt._short_opts + opt._long_opts: + self._opt2dest[name] = opt.dest + + if hasattr(opt, 'default') and opt.dest: + if not hasattr(self.option, opt.dest): + setattr(self.option, opt.dest, opt.default) + + @hookimpl(trylast=True) + def pytest_load_initial_conftests(self, early_config): + self.pluginmanager._set_initial_conftests(early_config.known_args_namespace) + + def _initini(self, args): + ns, unknown_args = self._parser.parse_known_and_unknown_args(args, namespace=self.option.copy()) + r = determine_setup(ns.inifilename, ns.file_or_dir + unknown_args, warnfunc=self.warn) + self.rootdir, self.inifile, self.inicfg = r + self._parser.extra_info['rootdir'] = self.rootdir + self._parser.extra_info['inifile'] = self.inifile + self.invocation_dir = py.path.local() + self._parser.addini('addopts', 'extra command line options', 'args') + self._parser.addini('minversion', 'minimally required pytest version') + self._override_ini = ns.override_ini or () + + def _consider_importhook(self, args): + """Install the PEP 302 import hook if using assertion re-writing. + + Needs to parse the --assert= option from the commandline + and find all the installed plugins to mark them for re-writing + by the importhook. + """ + ns, unknown_args = self._parser.parse_known_and_unknown_args(args) + mode = ns.assertmode + if mode == 'rewrite': + try: + hook = _pytest.assertion.install_importhook(self) + except SystemError: + mode = 'plain' + else: + # REMOVED FOR SPACK: This routine imports `pkg_resources` from + # `setuptools`, but we do not need it for Spack. We have removed + # it from Spack to avoid a dependency on setuptools. + # self._mark_plugins_for_rewrite(hook) + pass + self._warn_about_missing_assertion(mode) + + def _warn_about_missing_assertion(self, mode): + try: + assert False + except AssertionError: + pass + else: + if mode == 'plain': + sys.stderr.write("WARNING: ASSERTIONS ARE NOT EXECUTED" + " and FAILING TESTS WILL PASS. Are you" + " using python -O?") + else: + sys.stderr.write("WARNING: assertions not in test modules or" + " plugins will be ignored" + " because assert statements are not executed " + "by the underlying Python interpreter " + "(are you using python -O?)\n") + + def _preparse(self, args, addopts=True): + self._initini(args) + if addopts: + args[:] = shlex.split(os.environ.get('PYTEST_ADDOPTS', '')) + args + args[:] = self.getini("addopts") + args + self._checkversion() + self._consider_importhook(args) + self.pluginmanager.consider_preparse(args) + + # REMOVED FOR SPACK: This routine imports `pkg_resources` from + # `setuptools`, but we do not need it for Spack. We have removed + # it from Spack to avoid a dependency on setuptools. + # self.pluginmanager.load_setuptools_entrypoints('pytest11') + + self.pluginmanager.consider_env() + self.known_args_namespace = ns = self._parser.parse_known_args(args, namespace=self.option.copy()) + if self.known_args_namespace.confcutdir is None and self.inifile: + confcutdir = py.path.local(self.inifile).dirname + self.known_args_namespace.confcutdir = confcutdir + try: + self.hook.pytest_load_initial_conftests(early_config=self, + args=args, parser=self._parser) + except ConftestImportFailure: + e = sys.exc_info()[1] + if ns.help or ns.version: + # we don't want to prevent --help/--version to work + # so just let is pass and print a warning at the end + self._warn("could not load initial conftests (%s)\n" % e.path) + else: + raise + + def _checkversion(self): + import pytest + minver = self.inicfg.get('minversion', None) + if minver: + ver = minver.split(".") + myver = pytest.__version__.split(".") + if myver < ver: + raise pytest.UsageError( + "%s:%d: requires pytest-%s, actual pytest-%s'" % ( + self.inicfg.config.path, self.inicfg.lineof('minversion'), + minver, pytest.__version__)) + + def parse(self, args, addopts=True): + # parse given cmdline arguments into this config object. + assert not hasattr(self, 'args'), ( + "can only parse cmdline args at most once per Config object") + self._origargs = args + self.hook.pytest_addhooks.call_historic( + kwargs=dict(pluginmanager=self.pluginmanager)) + self._preparse(args, addopts=addopts) + # XXX deprecated hook: + self.hook.pytest_cmdline_preparse(config=self, args=args) + self._parser.after_preparse = True + try: + args = self._parser.parse_setoption(args, self.option, namespace=self.option) + if not args: + cwd = os.getcwd() + if cwd == self.rootdir: + args = self.getini('testpaths') + if not args: + args = [cwd] + self.args = args + except PrintHelp: + pass + + def addinivalue_line(self, name, line): + """ add a line to an ini-file option. The option must have been + declared but might not yet be set in which case the line becomes the + the first line in its value. """ + x = self.getini(name) + assert isinstance(x, list) + x.append(line) # modifies the cached list inline + + def getini(self, name): + """ return configuration value from an :ref:`ini file `. If the + specified name hasn't been registered through a prior + :py:func:`parser.addini <_pytest.config.Parser.addini>` + call (usually from a plugin), a ValueError is raised. """ + try: + return self._inicache[name] + except KeyError: + self._inicache[name] = val = self._getini(name) + return val + + def _getini(self, name): + try: + description, type, default = self._parser._inidict[name] + except KeyError: + raise ValueError("unknown configuration value: %r" % (name,)) + value = self._get_override_ini_value(name) + if value is None: + try: + value = self.inicfg[name] + except KeyError: + if default is not None: + return default + if type is None: + return '' + return [] + if type == "pathlist": + dp = py.path.local(self.inicfg.config.path).dirpath() + values = [] + for relpath in shlex.split(value): + values.append(dp.join(relpath, abs=True)) + return values + elif type == "args": + return shlex.split(value) + elif type == "linelist": + return [t for t in map(lambda x: x.strip(), value.split("\n")) if t] + elif type == "bool": + return bool(_strtobool(value.strip())) + else: + assert type is None + return value + + def _getconftest_pathlist(self, name, path): + try: + mod, relroots = self.pluginmanager._rget_with_confmod(name, path) + except KeyError: + return None + modpath = py.path.local(mod.__file__).dirpath() + values = [] + for relroot in relroots: + if not isinstance(relroot, py.path.local): + relroot = relroot.replace("/", py.path.local.sep) + relroot = modpath.join(relroot, abs=True) + values.append(relroot) + return values + + def _get_override_ini_value(self, name): + value = None + # override_ini is a list of list, to support both -o foo1=bar1 foo2=bar2 and + # and -o foo1=bar1 -o foo2=bar2 options + # always use the last item if multiple value set for same ini-name, + # e.g. -o foo=bar1 -o foo=bar2 will set foo to bar2 + for ini_config_list in self._override_ini: + for ini_config in ini_config_list: + try: + (key, user_ini_value) = ini_config.split("=", 1) + except ValueError: + raise UsageError("-o/--override-ini expects option=value style.") + if key == name: + value = user_ini_value + return value + + def getoption(self, name, default=notset, skip=False): + """ return command line option value. + + :arg name: name of the option. You may also specify + the literal ``--OPT`` option instead of the "dest" option name. + :arg default: default value if no option of that name exists. + :arg skip: if True raise pytest.skip if option does not exists + or has a None value. + """ + name = self._opt2dest.get(name, name) + try: + val = getattr(self.option, name) + if val is None and skip: + raise AttributeError(name) + return val + except AttributeError: + if default is not notset: + return default + if skip: + import pytest + pytest.skip("no %r option found" % (name,)) + raise ValueError("no option named %r" % (name,)) + + def getvalue(self, name, path=None): + """ (deprecated, use getoption()) """ + return self.getoption(name) + + def getvalueorskip(self, name, path=None): + """ (deprecated, use getoption(skip=True)) """ + return self.getoption(name, skip=True) + + +def exists(path, ignore=EnvironmentError): + try: + return path.check() + except ignore: + return False + + +def getcfg(args, warnfunc=None): + """ + Search the list of arguments for a valid ini-file for pytest, + and return a tuple of (rootdir, inifile, cfg-dict). + + note: warnfunc is an optional function used to warn + about ini-files that use deprecated features. + This parameter should be removed when pytest + adopts standard deprecation warnings (#1804). + """ + from _pytest.deprecated import SETUP_CFG_PYTEST + inibasenames = ["pytest.ini", "tox.ini", "setup.cfg"] + args = [x for x in args if not str(x).startswith("-")] + if not args: + args = [py.path.local()] + for arg in args: + arg = py.path.local(arg) + for base in arg.parts(reverse=True): + for inibasename in inibasenames: + p = base.join(inibasename) + if exists(p): + iniconfig = py.iniconfig.IniConfig(p) + if 'pytest' in iniconfig.sections: + if inibasename == 'setup.cfg' and warnfunc: + warnfunc('C1', SETUP_CFG_PYTEST) + return base, p, iniconfig['pytest'] + if inibasename == 'setup.cfg' and 'tool:pytest' in iniconfig.sections: + return base, p, iniconfig['tool:pytest'] + elif inibasename == "pytest.ini": + # allowed to be empty + return base, p, {} + return None, None, None + + +def get_common_ancestor(paths): + common_ancestor = None + for path in paths: + if not path.exists(): + continue + if common_ancestor is None: + common_ancestor = path + else: + if path.relto(common_ancestor) or path == common_ancestor: + continue + elif common_ancestor.relto(path): + common_ancestor = path + else: + shared = path.common(common_ancestor) + if shared is not None: + common_ancestor = shared + if common_ancestor is None: + common_ancestor = py.path.local() + elif common_ancestor.isfile(): + common_ancestor = common_ancestor.dirpath() + return common_ancestor + + +def get_dirs_from_args(args): + def is_option(x): + return str(x).startswith('-') + + def get_file_part_from_node_id(x): + return str(x).split('::')[0] + + def get_dir_from_path(path): + if path.isdir(): + return path + return py.path.local(path.dirname) + + # These look like paths but may not exist + possible_paths = ( + py.path.local(get_file_part_from_node_id(arg)) + for arg in args + if not is_option(arg) + ) + + return [ + get_dir_from_path(path) + for path in possible_paths + if path.exists() + ] + + +def determine_setup(inifile, args, warnfunc=None): + dirs = get_dirs_from_args(args) + if inifile: + iniconfig = py.iniconfig.IniConfig(inifile) + try: + inicfg = iniconfig["pytest"] + except KeyError: + inicfg = None + rootdir = get_common_ancestor(dirs) + else: + ancestor = get_common_ancestor(dirs) + rootdir, inifile, inicfg = getcfg([ancestor], warnfunc=warnfunc) + if rootdir is None: + for rootdir in ancestor.parts(reverse=True): + if rootdir.join("setup.py").exists(): + break + else: + rootdir, inifile, inicfg = getcfg(dirs, warnfunc=warnfunc) + if rootdir is None: + rootdir = get_common_ancestor([py.path.local(), ancestor]) + is_fs_root = os.path.splitdrive(str(rootdir))[1] == '/' + if is_fs_root: + rootdir = ancestor + return rootdir, inifile, inicfg or {} + + +def setns(obj, dic): + import pytest + for name, value in dic.items(): + if isinstance(value, dict): + mod = getattr(obj, name, None) + if mod is None: + modname = "pytest.%s" % name + mod = types.ModuleType(modname) + sys.modules[modname] = mod + mod.__all__ = [] + setattr(obj, name, mod) + obj.__all__.append(name) + setns(mod, value) + else: + setattr(obj, name, value) + obj.__all__.append(name) + # if obj != pytest: + # pytest.__all__.append(name) + setattr(pytest, name, value) + + +def create_terminal_writer(config, *args, **kwargs): + """Create a TerminalWriter instance configured according to the options + in the config object. Every code which requires a TerminalWriter object + and has access to a config object should use this function. + """ + tw = py.io.TerminalWriter(*args, **kwargs) + if config.option.color == 'yes': + tw.hasmarkup = True + if config.option.color == 'no': + tw.hasmarkup = False + return tw + + +def _strtobool(val): + """Convert a string representation of truth to true (1) or false (0). + + True values are 'y', 'yes', 't', 'true', 'on', and '1'; false values + are 'n', 'no', 'f', 'false', 'off', and '0'. Raises ValueError if + 'val' is anything else. + + .. note:: copied from distutils.util + """ + val = val.lower() + if val in ('y', 'yes', 't', 'true', 'on', '1'): + return 1 + elif val in ('n', 'no', 'f', 'false', 'off', '0'): + return 0 + else: + raise ValueError("invalid truth value %r" % (val,)) diff --git a/lib/spack/external/pytest-fallback/_pytest/debugging.py b/lib/spack/external/pytest-fallback/_pytest/debugging.py new file mode 100644 index 0000000000..aa9c9a3863 --- /dev/null +++ b/lib/spack/external/pytest-fallback/_pytest/debugging.py @@ -0,0 +1,123 @@ +""" interactive debugging with PDB, the Python Debugger. """ +from __future__ import absolute_import, division, print_function +import pdb +import sys + + +def pytest_addoption(parser): + group = parser.getgroup("general") + group._addoption( + '--pdb', dest="usepdb", action="store_true", + help="start the interactive Python debugger on errors.") + group._addoption( + '--pdbcls', dest="usepdb_cls", metavar="modulename:classname", + help="start a custom interactive Python debugger on errors. " + "For example: --pdbcls=IPython.terminal.debugger:TerminalPdb") + + +def pytest_configure(config): + if config.getvalue("usepdb_cls"): + modname, classname = config.getvalue("usepdb_cls").split(":") + __import__(modname) + pdb_cls = getattr(sys.modules[modname], classname) + else: + pdb_cls = pdb.Pdb + + if config.getvalue("usepdb"): + config.pluginmanager.register(PdbInvoke(), 'pdbinvoke') + + old = (pdb.set_trace, pytestPDB._pluginmanager) + + def fin(): + pdb.set_trace, pytestPDB._pluginmanager = old + pytestPDB._config = None + pytestPDB._pdb_cls = pdb.Pdb + + pdb.set_trace = pytestPDB.set_trace + pytestPDB._pluginmanager = config.pluginmanager + pytestPDB._config = config + pytestPDB._pdb_cls = pdb_cls + config._cleanup.append(fin) + + +class pytestPDB: + """ Pseudo PDB that defers to the real pdb. """ + _pluginmanager = None + _config = None + _pdb_cls = pdb.Pdb + + @classmethod + def set_trace(cls): + """ invoke PDB set_trace debugging, dropping any IO capturing. """ + import _pytest.config + frame = sys._getframe().f_back + if cls._pluginmanager is not None: + capman = cls._pluginmanager.getplugin("capturemanager") + if capman: + capman.suspendcapture(in_=True) + tw = _pytest.config.create_terminal_writer(cls._config) + tw.line() + tw.sep(">", "PDB set_trace (IO-capturing turned off)") + cls._pluginmanager.hook.pytest_enter_pdb(config=cls._config) + cls._pdb_cls().set_trace(frame) + + +class PdbInvoke: + def pytest_exception_interact(self, node, call, report): + capman = node.config.pluginmanager.getplugin("capturemanager") + if capman: + out, err = capman.suspendcapture(in_=True) + sys.stdout.write(out) + sys.stdout.write(err) + _enter_pdb(node, call.excinfo, report) + + def pytest_internalerror(self, excrepr, excinfo): + for line in str(excrepr).split("\n"): + sys.stderr.write("INTERNALERROR> %s\n" % line) + sys.stderr.flush() + tb = _postmortem_traceback(excinfo) + post_mortem(tb) + + +def _enter_pdb(node, excinfo, rep): + # XXX we re-use the TerminalReporter's terminalwriter + # because this seems to avoid some encoding related troubles + # for not completely clear reasons. + tw = node.config.pluginmanager.getplugin("terminalreporter")._tw + tw.line() + tw.sep(">", "traceback") + rep.toterminal(tw) + tw.sep(">", "entering PDB") + tb = _postmortem_traceback(excinfo) + post_mortem(tb) + rep._pdbshown = True + return rep + + +def _postmortem_traceback(excinfo): + # A doctest.UnexpectedException is not useful for post_mortem. + # Use the underlying exception instead: + from doctest import UnexpectedException + if isinstance(excinfo.value, UnexpectedException): + return excinfo.value.exc_info[2] + else: + return excinfo._excinfo[2] + + +def _find_last_non_hidden_frame(stack): + i = max(0, len(stack) - 1) + while i and stack[i][0].f_locals.get("__tracebackhide__", False): + i -= 1 + return i + + +def post_mortem(t): + class Pdb(pytestPDB._pdb_cls): + def get_stack(self, f, t): + stack, i = pdb.Pdb.get_stack(self, f, t) + if f is None: + i = _find_last_non_hidden_frame(stack) + return stack, i + p = Pdb() + p.reset() + p.interaction(None, t) diff --git a/lib/spack/external/pytest-fallback/_pytest/deprecated.py b/lib/spack/external/pytest-fallback/_pytest/deprecated.py new file mode 100644 index 0000000000..38e9496778 --- /dev/null +++ b/lib/spack/external/pytest-fallback/_pytest/deprecated.py @@ -0,0 +1,42 @@ +""" +This module contains deprecation messages and bits of code used elsewhere in the codebase +that is planned to be removed in the next pytest release. + +Keeping it in a central location makes it easy to track what is deprecated and should +be removed when the time comes. +""" +from __future__ import absolute_import, division, print_function + + +class RemovedInPytest4Warning(DeprecationWarning): + """warning class for features removed in pytest 4.0""" + + +MAIN_STR_ARGS = 'passing a string to pytest.main() is deprecated, ' \ + 'pass a list of arguments instead.' + +YIELD_TESTS = 'yield tests are deprecated, and scheduled to be removed in pytest 4.0' + +FUNCARG_PREFIX = ( + '{name}: declaring fixtures using "pytest_funcarg__" prefix is deprecated ' + 'and scheduled to be removed in pytest 4.0. ' + 'Please remove the prefix and use the @pytest.fixture decorator instead.') + +SETUP_CFG_PYTEST = '[pytest] section in setup.cfg files is deprecated, use [tool:pytest] instead.' + +GETFUNCARGVALUE = "use of getfuncargvalue is deprecated, use getfixturevalue" + +RESULT_LOG = ( + '--result-log is deprecated and scheduled for removal in pytest 4.0.\n' + 'See https://docs.pytest.org/en/latest/usage.html#creating-resultlog-format-files for more information.' +) + +MARK_INFO_ATTRIBUTE = RemovedInPytest4Warning( + "MarkInfo objects are deprecated as they contain the merged marks" +) + +MARK_PARAMETERSET_UNPACKING = RemovedInPytest4Warning( + "Applying marks directly to parameters is deprecated," + " please use pytest.param(..., marks=...) instead.\n" + "For more details, see: https://docs.pytest.org/en/latest/parametrize.html" +) diff --git a/lib/spack/external/pytest-fallback/_pytest/doctest.py b/lib/spack/external/pytest-fallback/_pytest/doctest.py new file mode 100644 index 0000000000..4c05acddf7 --- /dev/null +++ b/lib/spack/external/pytest-fallback/_pytest/doctest.py @@ -0,0 +1,362 @@ +""" discover and run doctests in modules and test files.""" +from __future__ import absolute_import, division, print_function + +import traceback + +import pytest +from _pytest._code.code import ExceptionInfo, ReprFileLocation, TerminalRepr +from _pytest.fixtures import FixtureRequest + + +DOCTEST_REPORT_CHOICE_NONE = 'none' +DOCTEST_REPORT_CHOICE_CDIFF = 'cdiff' +DOCTEST_REPORT_CHOICE_NDIFF = 'ndiff' +DOCTEST_REPORT_CHOICE_UDIFF = 'udiff' +DOCTEST_REPORT_CHOICE_ONLY_FIRST_FAILURE = 'only_first_failure' + +DOCTEST_REPORT_CHOICES = ( + DOCTEST_REPORT_CHOICE_NONE, + DOCTEST_REPORT_CHOICE_CDIFF, + DOCTEST_REPORT_CHOICE_NDIFF, + DOCTEST_REPORT_CHOICE_UDIFF, + DOCTEST_REPORT_CHOICE_ONLY_FIRST_FAILURE, +) + + +def pytest_addoption(parser): + parser.addini('doctest_optionflags', 'option flags for doctests', + type="args", default=["ELLIPSIS"]) + parser.addini("doctest_encoding", 'encoding used for doctest files', default="utf-8") + group = parser.getgroup("collect") + group.addoption("--doctest-modules", + action="store_true", default=False, + help="run doctests in all .py modules", + dest="doctestmodules") + group.addoption("--doctest-report", + type=str.lower, default="udiff", + help="choose another output format for diffs on doctest failure", + choices=DOCTEST_REPORT_CHOICES, + dest="doctestreport") + group.addoption("--doctest-glob", + action="append", default=[], metavar="pat", + help="doctests file matching pattern, default: test*.txt", + dest="doctestglob") + group.addoption("--doctest-ignore-import-errors", + action="store_true", default=False, + help="ignore doctest ImportErrors", + dest="doctest_ignore_import_errors") + + +def pytest_collect_file(path, parent): + config = parent.config + if path.ext == ".py": + if config.option.doctestmodules: + return DoctestModule(path, parent) + elif _is_doctest(config, path, parent): + return DoctestTextfile(path, parent) + + +def _is_doctest(config, path, parent): + if path.ext in ('.txt', '.rst') and parent.session.isinitpath(path): + return True + globs = config.getoption("doctestglob") or ['test*.txt'] + for glob in globs: + if path.check(fnmatch=glob): + return True + return False + + +class ReprFailDoctest(TerminalRepr): + + def __init__(self, reprlocation, lines): + self.reprlocation = reprlocation + self.lines = lines + + def toterminal(self, tw): + for line in self.lines: + tw.line(line) + self.reprlocation.toterminal(tw) + + +class DoctestItem(pytest.Item): + def __init__(self, name, parent, runner=None, dtest=None): + super(DoctestItem, self).__init__(name, parent) + self.runner = runner + self.dtest = dtest + self.obj = None + self.fixture_request = None + + def setup(self): + if self.dtest is not None: + self.fixture_request = _setup_fixtures(self) + globs = dict(getfixture=self.fixture_request.getfixturevalue) + for name, value in self.fixture_request.getfixturevalue('doctest_namespace').items(): + globs[name] = value + self.dtest.globs.update(globs) + + def runtest(self): + _check_all_skipped(self.dtest) + self.runner.run(self.dtest) + + def repr_failure(self, excinfo): + import doctest + if excinfo.errisinstance((doctest.DocTestFailure, + doctest.UnexpectedException)): + doctestfailure = excinfo.value + example = doctestfailure.example + test = doctestfailure.test + filename = test.filename + if test.lineno is None: + lineno = None + else: + lineno = test.lineno + example.lineno + 1 + message = excinfo.type.__name__ + reprlocation = ReprFileLocation(filename, lineno, message) + checker = _get_checker() + report_choice = _get_report_choice(self.config.getoption("doctestreport")) + if lineno is not None: + lines = doctestfailure.test.docstring.splitlines(False) + # add line numbers to the left of the error message + lines = ["%03d %s" % (i + test.lineno + 1, x) + for (i, x) in enumerate(lines)] + # trim docstring error lines to 10 + lines = lines[max(example.lineno - 9, 0):example.lineno + 1] + else: + lines = ['EXAMPLE LOCATION UNKNOWN, not showing all tests of that example'] + indent = '>>>' + for line in example.source.splitlines(): + lines.append('??? %s %s' % (indent, line)) + indent = '...' + if excinfo.errisinstance(doctest.DocTestFailure): + lines += checker.output_difference(example, + doctestfailure.got, report_choice).split("\n") + else: + inner_excinfo = ExceptionInfo(excinfo.value.exc_info) + lines += ["UNEXPECTED EXCEPTION: %s" % + repr(inner_excinfo.value)] + lines += traceback.format_exception(*excinfo.value.exc_info) + return ReprFailDoctest(reprlocation, lines) + else: + return super(DoctestItem, self).repr_failure(excinfo) + + def reportinfo(self): + return self.fspath, self.dtest.lineno, "[doctest] %s" % self.name + + +def _get_flag_lookup(): + import doctest + return dict(DONT_ACCEPT_TRUE_FOR_1=doctest.DONT_ACCEPT_TRUE_FOR_1, + DONT_ACCEPT_BLANKLINE=doctest.DONT_ACCEPT_BLANKLINE, + NORMALIZE_WHITESPACE=doctest.NORMALIZE_WHITESPACE, + ELLIPSIS=doctest.ELLIPSIS, + IGNORE_EXCEPTION_DETAIL=doctest.IGNORE_EXCEPTION_DETAIL, + COMPARISON_FLAGS=doctest.COMPARISON_FLAGS, + ALLOW_UNICODE=_get_allow_unicode_flag(), + ALLOW_BYTES=_get_allow_bytes_flag(), + ) + + +def get_optionflags(parent): + optionflags_str = parent.config.getini("doctest_optionflags") + flag_lookup_table = _get_flag_lookup() + flag_acc = 0 + for flag in optionflags_str: + flag_acc |= flag_lookup_table[flag] + return flag_acc + + +class DoctestTextfile(pytest.Module): + obj = None + + def collect(self): + import doctest + + # inspired by doctest.testfile; ideally we would use it directly, + # but it doesn't support passing a custom checker + encoding = self.config.getini("doctest_encoding") + text = self.fspath.read_text(encoding) + filename = str(self.fspath) + name = self.fspath.basename + globs = {'__name__': '__main__'} + + optionflags = get_optionflags(self) + runner = doctest.DebugRunner(verbose=0, optionflags=optionflags, + checker=_get_checker()) + _fix_spoof_python2(runner, encoding) + + parser = doctest.DocTestParser() + test = parser.get_doctest(text, globs, name, filename, 0) + if test.examples: + yield DoctestItem(test.name, self, runner, test) + + +def _check_all_skipped(test): + """raises pytest.skip() if all examples in the given DocTest have the SKIP + option set. + """ + import doctest + all_skipped = all(x.options.get(doctest.SKIP, False) for x in test.examples) + if all_skipped: + pytest.skip('all tests skipped by +SKIP option') + + +class DoctestModule(pytest.Module): + def collect(self): + import doctest + if self.fspath.basename == "conftest.py": + module = self.config.pluginmanager._importconftest(self.fspath) + else: + try: + module = self.fspath.pyimport() + except ImportError: + if self.config.getvalue('doctest_ignore_import_errors'): + pytest.skip('unable to import module %r' % self.fspath) + else: + raise + # uses internal doctest module parsing mechanism + finder = doctest.DocTestFinder() + optionflags = get_optionflags(self) + runner = doctest.DebugRunner(verbose=0, optionflags=optionflags, + checker=_get_checker()) + + for test in finder.find(module, module.__name__): + if test.examples: # skip empty doctests + yield DoctestItem(test.name, self, runner, test) + + +def _setup_fixtures(doctest_item): + """ + Used by DoctestTextfile and DoctestItem to setup fixture information. + """ + def func(): + pass + + doctest_item.funcargs = {} + fm = doctest_item.session._fixturemanager + doctest_item._fixtureinfo = fm.getfixtureinfo(node=doctest_item, func=func, + cls=None, funcargs=False) + fixture_request = FixtureRequest(doctest_item) + fixture_request._fillfixtures() + return fixture_request + + +def _get_checker(): + """ + Returns a doctest.OutputChecker subclass that takes in account the + ALLOW_UNICODE option to ignore u'' prefixes in strings and ALLOW_BYTES + to strip b'' prefixes. + Useful when the same doctest should run in Python 2 and Python 3. + + An inner class is used to avoid importing "doctest" at the module + level. + """ + if hasattr(_get_checker, 'LiteralsOutputChecker'): + return _get_checker.LiteralsOutputChecker() + + import doctest + import re + + class LiteralsOutputChecker(doctest.OutputChecker): + """ + Copied from doctest_nose_plugin.py from the nltk project: + https://github.com/nltk/nltk + + Further extended to also support byte literals. + """ + + _unicode_literal_re = re.compile(r"(\W|^)[uU]([rR]?[\'\"])", re.UNICODE) + _bytes_literal_re = re.compile(r"(\W|^)[bB]([rR]?[\'\"])", re.UNICODE) + + def check_output(self, want, got, optionflags): + res = doctest.OutputChecker.check_output(self, want, got, + optionflags) + if res: + return True + + allow_unicode = optionflags & _get_allow_unicode_flag() + allow_bytes = optionflags & _get_allow_bytes_flag() + if not allow_unicode and not allow_bytes: + return False + + else: # pragma: no cover + def remove_prefixes(regex, txt): + return re.sub(regex, r'\1\2', txt) + + if allow_unicode: + want = remove_prefixes(self._unicode_literal_re, want) + got = remove_prefixes(self._unicode_literal_re, got) + if allow_bytes: + want = remove_prefixes(self._bytes_literal_re, want) + got = remove_prefixes(self._bytes_literal_re, got) + res = doctest.OutputChecker.check_output(self, want, got, + optionflags) + return res + + _get_checker.LiteralsOutputChecker = LiteralsOutputChecker + return _get_checker.LiteralsOutputChecker() + + +def _get_allow_unicode_flag(): + """ + Registers and returns the ALLOW_UNICODE flag. + """ + import doctest + return doctest.register_optionflag('ALLOW_UNICODE') + + +def _get_allow_bytes_flag(): + """ + Registers and returns the ALLOW_BYTES flag. + """ + import doctest + return doctest.register_optionflag('ALLOW_BYTES') + + +def _get_report_choice(key): + """ + This function returns the actual `doctest` module flag value, we want to do it as late as possible to avoid + importing `doctest` and all its dependencies when parsing options, as it adds overhead and breaks tests. + """ + import doctest + + return { + DOCTEST_REPORT_CHOICE_UDIFF: doctest.REPORT_UDIFF, + DOCTEST_REPORT_CHOICE_CDIFF: doctest.REPORT_CDIFF, + DOCTEST_REPORT_CHOICE_NDIFF: doctest.REPORT_NDIFF, + DOCTEST_REPORT_CHOICE_ONLY_FIRST_FAILURE: doctest.REPORT_ONLY_FIRST_FAILURE, + DOCTEST_REPORT_CHOICE_NONE: 0, + }[key] + + +def _fix_spoof_python2(runner, encoding): + """ + Installs a "SpoofOut" into the given DebugRunner so it properly deals with unicode output. This + should patch only doctests for text files because they don't have a way to declare their + encoding. Doctests in docstrings from Python modules don't have the same problem given that + Python already decoded the strings. + + This fixes the problem related in issue #2434. + """ + from _pytest.compat import _PY2 + if not _PY2: + return + + from doctest import _SpoofOut + + class UnicodeSpoof(_SpoofOut): + + def getvalue(self): + result = _SpoofOut.getvalue(self) + if encoding: + result = result.decode(encoding) + return result + + runner._fakeout = UnicodeSpoof() + + +@pytest.fixture(scope='session') +def doctest_namespace(): + """ + Inject names into the doctest namespace. + """ + return dict() diff --git a/lib/spack/external/pytest-fallback/_pytest/fixtures.py b/lib/spack/external/pytest-fallback/_pytest/fixtures.py new file mode 100644 index 0000000000..98317a4889 --- /dev/null +++ b/lib/spack/external/pytest-fallback/_pytest/fixtures.py @@ -0,0 +1,1137 @@ +from __future__ import absolute_import, division, print_function + +import inspect +import sys +import warnings + +import py +from py._code.code import FormattedExcinfo + +import _pytest +from _pytest import nodes +from _pytest._code.code import TerminalRepr +from _pytest.compat import ( + NOTSET, exc_clear, _format_args, + getfslineno, get_real_func, + is_generator, isclass, getimfunc, + getlocation, getfuncargnames, + safe_getattr, + FuncargnamesCompatAttr, +) +from _pytest.outcomes import fail, TEST_OUTCOME + + +from ordereddict_backport import OrderedDict + + +def pytest_sessionstart(session): + import _pytest.python + scopename2class.update({ + 'class': _pytest.python.Class, + 'module': _pytest.python.Module, + 'function': _pytest.main.Item, + }) + session._fixturemanager = FixtureManager(session) + + +scopename2class = {} + + +scope2props = dict(session=()) +scope2props["module"] = ("fspath", "module") +scope2props["class"] = scope2props["module"] + ("cls",) +scope2props["instance"] = scope2props["class"] + ("instance", ) +scope2props["function"] = scope2props["instance"] + ("function", "keywords") + + +def scopeproperty(name=None, doc=None): + def decoratescope(func): + scopename = name or func.__name__ + + def provide(self): + if func.__name__ in scope2props[self.scope]: + return func(self) + raise AttributeError("%s not available in %s-scoped context" % ( + scopename, self.scope)) + + return property(provide, None, None, func.__doc__) + return decoratescope + + +def get_scope_node(node, scope): + cls = scopename2class.get(scope) + if cls is None: + if scope == "session": + return node.session + raise ValueError("unknown scope") + return node.getparent(cls) + + +def add_funcarg_pseudo_fixture_def(collector, metafunc, fixturemanager): + # this function will transform all collected calls to a functions + # if they use direct funcargs (i.e. direct parametrization) + # because we want later test execution to be able to rely on + # an existing FixtureDef structure for all arguments. + # XXX we can probably avoid this algorithm if we modify CallSpec2 + # to directly care for creating the fixturedefs within its methods. + if not metafunc._calls[0].funcargs: + return # this function call does not have direct parametrization + # collect funcargs of all callspecs into a list of values + arg2params = {} + arg2scope = {} + for callspec in metafunc._calls: + for argname, argvalue in callspec.funcargs.items(): + assert argname not in callspec.params + callspec.params[argname] = argvalue + arg2params_list = arg2params.setdefault(argname, []) + callspec.indices[argname] = len(arg2params_list) + arg2params_list.append(argvalue) + if argname not in arg2scope: + scopenum = callspec._arg2scopenum.get(argname, + scopenum_function) + arg2scope[argname] = scopes[scopenum] + callspec.funcargs.clear() + + # register artificial FixtureDef's so that later at test execution + # time we can rely on a proper FixtureDef to exist for fixture setup. + arg2fixturedefs = metafunc._arg2fixturedefs + for argname, valuelist in arg2params.items(): + # if we have a scope that is higher than function we need + # to make sure we only ever create an according fixturedef on + # a per-scope basis. We thus store and cache the fixturedef on the + # node related to the scope. + scope = arg2scope[argname] + node = None + if scope != "function": + node = get_scope_node(collector, scope) + if node is None: + assert scope == "class" and isinstance(collector, _pytest.python.Module) + # use module-level collector for class-scope (for now) + node = collector + if node and argname in node._name2pseudofixturedef: + arg2fixturedefs[argname] = [node._name2pseudofixturedef[argname]] + else: + fixturedef = FixtureDef(fixturemanager, '', argname, + get_direct_param_fixture_func, + arg2scope[argname], + valuelist, False, False) + arg2fixturedefs[argname] = [fixturedef] + if node is not None: + node._name2pseudofixturedef[argname] = fixturedef + + +def getfixturemarker(obj): + """ return fixturemarker or None if it doesn't exist or raised + exceptions.""" + try: + return getattr(obj, "_pytestfixturefunction", None) + except TEST_OUTCOME: + # some objects raise errors like request (from flask import request) + # we don't expect them to be fixture functions + return None + + +def get_parametrized_fixture_keys(item, scopenum): + """ return list of keys for all parametrized arguments which match + the specified scope. """ + assert scopenum < scopenum_function # function + try: + cs = item.callspec + except AttributeError: + pass + else: + # cs.indices.items() is random order of argnames. Need to + # sort this so that different calls to + # get_parametrized_fixture_keys will be deterministic. + for argname, param_index in sorted(cs.indices.items()): + if cs._arg2scopenum[argname] != scopenum: + continue + if scopenum == 0: # session + key = (argname, param_index) + elif scopenum == 1: # module + key = (argname, param_index, item.fspath) + elif scopenum == 2: # class + key = (argname, param_index, item.fspath, item.cls) + yield key + + +# algorithm for sorting on a per-parametrized resource setup basis +# it is called for scopenum==0 (session) first and performs sorting +# down to the lower scopes such as to minimize number of "high scope" +# setups and teardowns + +def reorder_items(items): + argkeys_cache = {} + for scopenum in range(0, scopenum_function): + argkeys_cache[scopenum] = d = {} + for item in items: + keys = OrderedDict.fromkeys(get_parametrized_fixture_keys(item, scopenum)) + if keys: + d[item] = keys + return reorder_items_atscope(items, set(), argkeys_cache, 0) + + +def reorder_items_atscope(items, ignore, argkeys_cache, scopenum): + if scopenum >= scopenum_function or len(items) < 3: + return items + items_done = [] + while 1: + items_before, items_same, items_other, newignore = \ + slice_items(items, ignore, argkeys_cache[scopenum]) + items_before = reorder_items_atscope( + items_before, ignore, argkeys_cache, scopenum + 1) + if items_same is None: + # nothing to reorder in this scope + assert items_other is None + return items_done + items_before + items_done.extend(items_before) + items = items_same + items_other + ignore = newignore + + +def slice_items(items, ignore, scoped_argkeys_cache): + # we pick the first item which uses a fixture instance in the + # requested scope and which we haven't seen yet. We slice the input + # items list into a list of items_nomatch, items_same and + # items_other + if scoped_argkeys_cache: # do we need to do work at all? + it = iter(items) + # first find a slicing key + for i, item in enumerate(it): + argkeys = scoped_argkeys_cache.get(item) + if argkeys is not None: + newargkeys = OrderedDict.fromkeys(k for k in argkeys if k not in ignore) + if newargkeys: # found a slicing key + slicing_argkey, _ = newargkeys.popitem() + items_before = items[:i] + items_same = [item] + items_other = [] + # now slice the remainder of the list + for item in it: + argkeys = scoped_argkeys_cache.get(item) + if argkeys and slicing_argkey in argkeys and \ + slicing_argkey not in ignore: + items_same.append(item) + else: + items_other.append(item) + newignore = ignore.copy() + newignore.add(slicing_argkey) + return (items_before, items_same, items_other, newignore) + return items, None, None, None + + +def fillfixtures(function): + """ fill missing funcargs for a test function. """ + try: + request = function._request + except AttributeError: + # XXX this special code path is only expected to execute + # with the oejskit plugin. It uses classes with funcargs + # and we thus have to work a bit to allow this. + fm = function.session._fixturemanager + fi = fm.getfixtureinfo(function.parent, function.obj, None) + function._fixtureinfo = fi + request = function._request = FixtureRequest(function) + request._fillfixtures() + # prune out funcargs for jstests + newfuncargs = {} + for name in fi.argnames: + newfuncargs[name] = function.funcargs[name] + function.funcargs = newfuncargs + else: + request._fillfixtures() + + +def get_direct_param_fixture_func(request): + return request.param + + +class FuncFixtureInfo: + def __init__(self, argnames, names_closure, name2fixturedefs): + self.argnames = argnames + self.names_closure = names_closure + self.name2fixturedefs = name2fixturedefs + + +class FixtureRequest(FuncargnamesCompatAttr): + """ A request for a fixture from a test or fixture function. + + A request object gives access to the requesting test context + and has an optional ``param`` attribute in case + the fixture is parametrized indirectly. + """ + + def __init__(self, pyfuncitem): + self._pyfuncitem = pyfuncitem + #: fixture for which this request is being performed + self.fixturename = None + #: Scope string, one of "function", "class", "module", "session" + self.scope = "function" + self._fixture_values = {} # argname -> fixture value + self._fixture_defs = {} # argname -> FixtureDef + fixtureinfo = pyfuncitem._fixtureinfo + self._arg2fixturedefs = fixtureinfo.name2fixturedefs.copy() + self._arg2index = {} + self._fixturemanager = pyfuncitem.session._fixturemanager + + @property + def fixturenames(self): + # backward incompatible note: now a readonly property + return list(self._pyfuncitem._fixtureinfo.names_closure) + + @property + def node(self): + """ underlying collection node (depends on current request scope)""" + return self._getscopeitem(self.scope) + + def _getnextfixturedef(self, argname): + fixturedefs = self._arg2fixturedefs.get(argname, None) + if fixturedefs is None: + # we arrive here because of a a dynamic call to + # getfixturevalue(argname) usage which was naturally + # not known at parsing/collection time + parentid = self._pyfuncitem.parent.nodeid + fixturedefs = self._fixturemanager.getfixturedefs(argname, parentid) + self._arg2fixturedefs[argname] = fixturedefs + # fixturedefs list is immutable so we maintain a decreasing index + index = self._arg2index.get(argname, 0) - 1 + if fixturedefs is None or (-index > len(fixturedefs)): + raise FixtureLookupError(argname, self) + self._arg2index[argname] = index + return fixturedefs[index] + + @property + def config(self): + """ the pytest config object associated with this request. """ + return self._pyfuncitem.config + + @scopeproperty() + def function(self): + """ test function object if the request has a per-function scope. """ + return self._pyfuncitem.obj + + @scopeproperty("class") + def cls(self): + """ class (can be None) where the test function was collected. """ + clscol = self._pyfuncitem.getparent(_pytest.python.Class) + if clscol: + return clscol.obj + + @property + def instance(self): + """ instance (can be None) on which test function was collected. """ + # unittest support hack, see _pytest.unittest.TestCaseFunction + try: + return self._pyfuncitem._testcase + except AttributeError: + function = getattr(self, "function", None) + if function is not None: + return py.builtin._getimself(function) + + @scopeproperty() + def module(self): + """ python module object where the test function was collected. """ + return self._pyfuncitem.getparent(_pytest.python.Module).obj + + @scopeproperty() + def fspath(self): + """ the file system path of the test module which collected this test. """ + return self._pyfuncitem.fspath + + @property + def keywords(self): + """ keywords/markers dictionary for the underlying node. """ + return self.node.keywords + + @property + def session(self): + """ pytest session object. """ + return self._pyfuncitem.session + + def addfinalizer(self, finalizer): + """ add finalizer/teardown function to be called after the + last test within the requesting test context finished + execution. """ + # XXX usually this method is shadowed by fixturedef specific ones + self._addfinalizer(finalizer, scope=self.scope) + + def _addfinalizer(self, finalizer, scope): + colitem = self._getscopeitem(scope) + self._pyfuncitem.session._setupstate.addfinalizer( + finalizer=finalizer, colitem=colitem) + + def applymarker(self, marker): + """ Apply a marker to a single test function invocation. + This method is useful if you don't want to have a keyword/marker + on all function invocations. + + :arg marker: a :py:class:`_pytest.mark.MarkDecorator` object + created by a call to ``pytest.mark.NAME(...)``. + """ + try: + self.node.keywords[marker.markname] = marker + except AttributeError: + raise ValueError(marker) + + def raiseerror(self, msg): + """ raise a FixtureLookupError with the given message. """ + raise self._fixturemanager.FixtureLookupError(None, self, msg) + + def _fillfixtures(self): + item = self._pyfuncitem + fixturenames = getattr(item, "fixturenames", self.fixturenames) + for argname in fixturenames: + if argname not in item.funcargs: + item.funcargs[argname] = self.getfixturevalue(argname) + + def cached_setup(self, setup, teardown=None, scope="module", extrakey=None): + """ (deprecated) Return a testing resource managed by ``setup`` & + ``teardown`` calls. ``scope`` and ``extrakey`` determine when the + ``teardown`` function will be called so that subsequent calls to + ``setup`` would recreate the resource. With pytest-2.3 you often + do not need ``cached_setup()`` as you can directly declare a scope + on a fixture function and register a finalizer through + ``request.addfinalizer()``. + + :arg teardown: function receiving a previously setup resource. + :arg setup: a no-argument function creating a resource. + :arg scope: a string value out of ``function``, ``class``, ``module`` + or ``session`` indicating the caching lifecycle of the resource. + :arg extrakey: added to internal caching key of (funcargname, scope). + """ + if not hasattr(self.config, '_setupcache'): + self.config._setupcache = {} # XXX weakref? + cachekey = (self.fixturename, self._getscopeitem(scope), extrakey) + cache = self.config._setupcache + try: + val = cache[cachekey] + except KeyError: + self._check_scope(self.fixturename, self.scope, scope) + val = setup() + cache[cachekey] = val + if teardown is not None: + def finalizer(): + del cache[cachekey] + teardown(val) + self._addfinalizer(finalizer, scope=scope) + return val + + def getfixturevalue(self, argname): + """ Dynamically run a named fixture function. + + Declaring fixtures via function argument is recommended where possible. + But if you can only decide whether to use another fixture at test + setup time, you may use this function to retrieve it inside a fixture + or test function body. + """ + return self._get_active_fixturedef(argname).cached_result[0] + + def getfuncargvalue(self, argname): + """ Deprecated, use getfixturevalue. """ + from _pytest import deprecated + warnings.warn( + deprecated.GETFUNCARGVALUE, + DeprecationWarning, + stacklevel=2) + return self.getfixturevalue(argname) + + def _get_active_fixturedef(self, argname): + try: + return self._fixture_defs[argname] + except KeyError: + try: + fixturedef = self._getnextfixturedef(argname) + except FixtureLookupError: + if argname == "request": + class PseudoFixtureDef: + cached_result = (self, [0], None) + scope = "function" + return PseudoFixtureDef + raise + # remove indent to prevent the python3 exception + # from leaking into the call + result = self._getfixturevalue(fixturedef) + self._fixture_values[argname] = result + self._fixture_defs[argname] = fixturedef + return fixturedef + + def _get_fixturestack(self): + current = self + values = [] + while 1: + fixturedef = getattr(current, "_fixturedef", None) + if fixturedef is None: + values.reverse() + return values + values.append(fixturedef) + current = current._parent_request + + def _getfixturevalue(self, fixturedef): + # prepare a subrequest object before calling fixture function + # (latter managed by fixturedef) + argname = fixturedef.argname + funcitem = self._pyfuncitem + scope = fixturedef.scope + try: + param = funcitem.callspec.getparam(argname) + except (AttributeError, ValueError): + param = NOTSET + param_index = 0 + if fixturedef.params is not None: + frame = inspect.stack()[3] + frameinfo = inspect.getframeinfo(frame[0]) + source_path = frameinfo.filename + source_lineno = frameinfo.lineno + source_path = py.path.local(source_path) + if source_path.relto(funcitem.config.rootdir): + source_path = source_path.relto(funcitem.config.rootdir) + msg = ( + "The requested fixture has no parameter defined for the " + "current test.\n\nRequested fixture '{0}' defined in:\n{1}" + "\n\nRequested here:\n{2}:{3}".format( + fixturedef.argname, + getlocation(fixturedef.func, funcitem.config.rootdir), + source_path, + source_lineno, + ) + ) + fail(msg) + else: + # indices might not be set if old-style metafunc.addcall() was used + param_index = funcitem.callspec.indices.get(argname, 0) + # if a parametrize invocation set a scope it will override + # the static scope defined with the fixture function + paramscopenum = funcitem.callspec._arg2scopenum.get(argname) + if paramscopenum is not None: + scope = scopes[paramscopenum] + + subrequest = SubRequest(self, scope, param, param_index, fixturedef) + + # check if a higher-level scoped fixture accesses a lower level one + subrequest._check_scope(argname, self.scope, scope) + + # clear sys.exc_info before invoking the fixture (python bug?) + # if its not explicitly cleared it will leak into the call + exc_clear() + try: + # call the fixture function + val = fixturedef.execute(request=subrequest) + finally: + # if fixture function failed it might have registered finalizers + self.session._setupstate.addfinalizer(fixturedef.finish, + subrequest.node) + return val + + def _check_scope(self, argname, invoking_scope, requested_scope): + if argname == "request": + return + if scopemismatch(invoking_scope, requested_scope): + # try to report something helpful + lines = self._factorytraceback() + fail("ScopeMismatch: You tried to access the %r scoped " + "fixture %r with a %r scoped request object, " + "involved factories\n%s" % ( + (requested_scope, argname, invoking_scope, "\n".join(lines))), + pytrace=False) + + def _factorytraceback(self): + lines = [] + for fixturedef in self._get_fixturestack(): + factory = fixturedef.func + fs, lineno = getfslineno(factory) + p = self._pyfuncitem.session.fspath.bestrelpath(fs) + args = _format_args(factory) + lines.append("%s:%d: def %s%s" % ( + p, lineno, factory.__name__, args)) + return lines + + def _getscopeitem(self, scope): + if scope == "function": + # this might also be a non-function Item despite its attribute name + return self._pyfuncitem + node = get_scope_node(self._pyfuncitem, scope) + if node is None and scope == "class": + # fallback to function item itself + node = self._pyfuncitem + assert node + return node + + def __repr__(self): + return "" % (self.node) + + +class SubRequest(FixtureRequest): + """ a sub request for handling getting a fixture from a + test function/fixture. """ + + def __init__(self, request, scope, param, param_index, fixturedef): + self._parent_request = request + self.fixturename = fixturedef.argname + if param is not NOTSET: + self.param = param + self.param_index = param_index + self.scope = scope + self._fixturedef = fixturedef + self._pyfuncitem = request._pyfuncitem + self._fixture_values = request._fixture_values + self._fixture_defs = request._fixture_defs + self._arg2fixturedefs = request._arg2fixturedefs + self._arg2index = request._arg2index + self._fixturemanager = request._fixturemanager + + def __repr__(self): + return "" % (self.fixturename, self._pyfuncitem) + + def addfinalizer(self, finalizer): + self._fixturedef.addfinalizer(finalizer) + + +class ScopeMismatchError(Exception): + """ A fixture function tries to use a different fixture function which + which has a lower scope (e.g. a Session one calls a function one) + """ + + +scopes = "session module class function".split() +scopenum_function = scopes.index("function") + + +def scopemismatch(currentscope, newscope): + return scopes.index(newscope) > scopes.index(currentscope) + + +def scope2index(scope, descr, where=None): + """Look up the index of ``scope`` and raise a descriptive value error + if not defined. + """ + try: + return scopes.index(scope) + except ValueError: + raise ValueError( + "{0} {1}has an unsupported scope value '{2}'".format( + descr, 'from {0} '.format(where) if where else '', + scope) + ) + + +class FixtureLookupError(LookupError): + """ could not return a requested Fixture (missing or invalid). """ + + def __init__(self, argname, request, msg=None): + self.argname = argname + self.request = request + self.fixturestack = request._get_fixturestack() + self.msg = msg + + def formatrepr(self): + tblines = [] + addline = tblines.append + stack = [self.request._pyfuncitem.obj] + stack.extend(map(lambda x: x.func, self.fixturestack)) + msg = self.msg + if msg is not None: + # the last fixture raise an error, let's present + # it at the requesting side + stack = stack[:-1] + for function in stack: + fspath, lineno = getfslineno(function) + try: + lines, _ = inspect.getsourcelines(get_real_func(function)) + except (IOError, IndexError, TypeError): + error_msg = "file %s, line %s: source code not available" + addline(error_msg % (fspath, lineno + 1)) + else: + addline("file %s, line %s" % (fspath, lineno + 1)) + for i, line in enumerate(lines): + line = line.rstrip() + addline(" " + line) + if line.lstrip().startswith('def'): + break + + if msg is None: + fm = self.request._fixturemanager + available = [] + parentid = self.request._pyfuncitem.parent.nodeid + for name, fixturedefs in fm._arg2fixturedefs.items(): + faclist = list(fm._matchfactories(fixturedefs, parentid)) + if faclist and name not in available: + available.append(name) + msg = "fixture %r not found" % (self.argname,) + msg += "\n available fixtures: %s" % (", ".join(sorted(available)),) + msg += "\n use 'pytest --fixtures [testpath]' for help on them." + + return FixtureLookupErrorRepr(fspath, lineno, tblines, msg, self.argname) + + +class FixtureLookupErrorRepr(TerminalRepr): + def __init__(self, filename, firstlineno, tblines, errorstring, argname): + self.tblines = tblines + self.errorstring = errorstring + self.filename = filename + self.firstlineno = firstlineno + self.argname = argname + + def toterminal(self, tw): + # tw.line("FixtureLookupError: %s" %(self.argname), red=True) + for tbline in self.tblines: + tw.line(tbline.rstrip()) + lines = self.errorstring.split("\n") + if lines: + tw.line('{0} {1}'.format(FormattedExcinfo.fail_marker, + lines[0].strip()), red=True) + for line in lines[1:]: + tw.line('{0} {1}'.format(FormattedExcinfo.flow_marker, + line.strip()), red=True) + tw.line() + tw.line("%s:%d" % (self.filename, self.firstlineno + 1)) + + +def fail_fixturefunc(fixturefunc, msg): + fs, lineno = getfslineno(fixturefunc) + location = "%s:%s" % (fs, lineno + 1) + source = _pytest._code.Source(fixturefunc) + fail(msg + ":\n\n" + str(source.indent()) + "\n" + location, + pytrace=False) + + +def call_fixture_func(fixturefunc, request, kwargs): + yieldctx = is_generator(fixturefunc) + if yieldctx: + it = fixturefunc(**kwargs) + res = next(it) + + def teardown(): + try: + next(it) + except StopIteration: + pass + else: + fail_fixturefunc(fixturefunc, + "yield_fixture function has more than one 'yield'") + + request.addfinalizer(teardown) + else: + res = fixturefunc(**kwargs) + return res + + +class FixtureDef: + """ A container for a factory definition. """ + + def __init__(self, fixturemanager, baseid, argname, func, scope, params, + unittest=False, ids=None): + self._fixturemanager = fixturemanager + self.baseid = baseid or '' + self.has_location = baseid is not None + self.func = func + self.argname = argname + self.scope = scope + self.scopenum = scope2index( + scope or "function", + descr='fixture {0}'.format(func.__name__), + where=baseid + ) + self.params = params + startindex = unittest and 1 or None + self.argnames = getfuncargnames(func, startindex=startindex) + self.unittest = unittest + self.ids = ids + self._finalizer = [] + + def addfinalizer(self, finalizer): + self._finalizer.append(finalizer) + + def finish(self): + exceptions = [] + try: + while self._finalizer: + try: + func = self._finalizer.pop() + func() + except: # noqa + exceptions.append(sys.exc_info()) + if exceptions: + e = exceptions[0] + del exceptions # ensure we don't keep all frames alive because of the traceback + py.builtin._reraise(*e) + + finally: + ihook = self._fixturemanager.session.ihook + ihook.pytest_fixture_post_finalizer(fixturedef=self) + # even if finalization fails, we invalidate + # the cached fixture value + if hasattr(self, "cached_result"): + del self.cached_result + + def execute(self, request): + # get required arguments and register our own finish() + # with their finalization + for argname in self.argnames: + fixturedef = request._get_active_fixturedef(argname) + if argname != "request": + fixturedef.addfinalizer(self.finish) + + my_cache_key = request.param_index + cached_result = getattr(self, "cached_result", None) + if cached_result is not None: + result, cache_key, err = cached_result + if my_cache_key == cache_key: + if err is not None: + py.builtin._reraise(*err) + else: + return result + # we have a previous but differently parametrized fixture instance + # so we need to tear it down before creating a new one + self.finish() + assert not hasattr(self, "cached_result") + + ihook = self._fixturemanager.session.ihook + return ihook.pytest_fixture_setup(fixturedef=self, request=request) + + def __repr__(self): + return ("" % + (self.argname, self.scope, self.baseid)) + + +def pytest_fixture_setup(fixturedef, request): + """ Execution of fixture setup. """ + kwargs = {} + for argname in fixturedef.argnames: + fixdef = request._get_active_fixturedef(argname) + result, arg_cache_key, exc = fixdef.cached_result + request._check_scope(argname, request.scope, fixdef.scope) + kwargs[argname] = result + + fixturefunc = fixturedef.func + if fixturedef.unittest: + if request.instance is not None: + # bind the unbound method to the TestCase instance + fixturefunc = fixturedef.func.__get__(request.instance) + else: + # the fixture function needs to be bound to the actual + # request.instance so that code working with "fixturedef" behaves + # as expected. + if request.instance is not None: + fixturefunc = getimfunc(fixturedef.func) + if fixturefunc != fixturedef.func: + fixturefunc = fixturefunc.__get__(request.instance) + my_cache_key = request.param_index + try: + result = call_fixture_func(fixturefunc, request, kwargs) + except TEST_OUTCOME: + fixturedef.cached_result = (None, my_cache_key, sys.exc_info()) + raise + fixturedef.cached_result = (result, my_cache_key, None) + return result + + +class FixtureFunctionMarker: + def __init__(self, scope, params, autouse=False, ids=None, name=None): + self.scope = scope + self.params = params + self.autouse = autouse + self.ids = ids + self.name = name + + def __call__(self, function): + if isclass(function): + raise ValueError( + "class fixtures not supported (may be in the future)") + function._pytestfixturefunction = self + return function + + +def fixture(scope="function", params=None, autouse=False, ids=None, name=None): + """ (return a) decorator to mark a fixture factory function. + + This decorator can be used (with or without parameters) to define a + fixture function. The name of the fixture function can later be + referenced to cause its invocation ahead of running tests: test + modules or classes can use the pytest.mark.usefixtures(fixturename) + marker. Test functions can directly use fixture names as input + arguments in which case the fixture instance returned from the fixture + function will be injected. + + :arg scope: the scope for which this fixture is shared, one of + "function" (default), "class", "module" or "session". + + :arg params: an optional list of parameters which will cause multiple + invocations of the fixture function and all of the tests + using it. + + :arg autouse: if True, the fixture func is activated for all tests that + can see it. If False (the default) then an explicit + reference is needed to activate the fixture. + + :arg ids: list of string ids each corresponding to the params + so that they are part of the test id. If no ids are provided + they will be generated automatically from the params. + + :arg name: the name of the fixture. This defaults to the name of the + decorated function. If a fixture is used in the same module in + which it is defined, the function name of the fixture will be + shadowed by the function arg that requests the fixture; one way + to resolve this is to name the decorated function + ``fixture_`` and then use + ``@pytest.fixture(name='')``. + + Fixtures can optionally provide their values to test functions using a ``yield`` statement, + instead of ``return``. In this case, the code block after the ``yield`` statement is executed + as teardown code regardless of the test outcome. A fixture function must yield exactly once. + """ + if callable(scope) and params is None and autouse is False: + # direct decoration + return FixtureFunctionMarker( + "function", params, autouse, name=name)(scope) + if params is not None and not isinstance(params, (list, tuple)): + params = list(params) + return FixtureFunctionMarker(scope, params, autouse, ids=ids, name=name) + + +def yield_fixture(scope="function", params=None, autouse=False, ids=None, name=None): + """ (return a) decorator to mark a yield-fixture factory function. + + .. deprecated:: 3.0 + Use :py:func:`pytest.fixture` directly instead. + """ + if callable(scope) and params is None and not autouse: + # direct decoration + return FixtureFunctionMarker( + "function", params, autouse, ids=ids, name=name)(scope) + else: + return FixtureFunctionMarker(scope, params, autouse, ids=ids, name=name) + + +defaultfuncargprefixmarker = fixture() + + +@fixture(scope="session") +def pytestconfig(request): + """ the pytest config object with access to command line opts.""" + return request.config + + +class FixtureManager: + """ + pytest fixtures definitions and information is stored and managed + from this class. + + During collection fm.parsefactories() is called multiple times to parse + fixture function definitions into FixtureDef objects and internal + data structures. + + During collection of test functions, metafunc-mechanics instantiate + a FuncFixtureInfo object which is cached per node/func-name. + This FuncFixtureInfo object is later retrieved by Function nodes + which themselves offer a fixturenames attribute. + + The FuncFixtureInfo object holds information about fixtures and FixtureDefs + relevant for a particular function. An initial list of fixtures is + assembled like this: + + - ini-defined usefixtures + - autouse-marked fixtures along the collection chain up from the function + - usefixtures markers at module/class/function level + - test function funcargs + + Subsequently the funcfixtureinfo.fixturenames attribute is computed + as the closure of the fixtures needed to setup the initial fixtures, + i. e. fixtures needed by fixture functions themselves are appended + to the fixturenames list. + + Upon the test-setup phases all fixturenames are instantiated, retrieved + by a lookup of their FuncFixtureInfo. + """ + + _argprefix = "pytest_funcarg__" + FixtureLookupError = FixtureLookupError + FixtureLookupErrorRepr = FixtureLookupErrorRepr + + def __init__(self, session): + self.session = session + self.config = session.config + self._arg2fixturedefs = {} + self._holderobjseen = set() + self._arg2finish = {} + self._nodeid_and_autousenames = [("", self.config.getini("usefixtures"))] + session.config.pluginmanager.register(self, "funcmanage") + + def getfixtureinfo(self, node, func, cls, funcargs=True): + if funcargs and not hasattr(node, "nofuncargs"): + argnames = getfuncargnames(func, cls=cls) + else: + argnames = () + usefixtures = getattr(func, "usefixtures", None) + initialnames = argnames + if usefixtures is not None: + initialnames = usefixtures.args + initialnames + fm = node.session._fixturemanager + names_closure, arg2fixturedefs = fm.getfixtureclosure(initialnames, + node) + return FuncFixtureInfo(argnames, names_closure, arg2fixturedefs) + + def pytest_plugin_registered(self, plugin): + nodeid = None + try: + p = py.path.local(plugin.__file__) + except AttributeError: + pass + else: + # construct the base nodeid which is later used to check + # what fixtures are visible for particular tests (as denoted + # by their test id) + if p.basename.startswith("conftest.py"): + nodeid = p.dirpath().relto(self.config.rootdir) + if p.sep != nodes.SEP: + nodeid = nodeid.replace(p.sep, nodes.SEP) + self.parsefactories(plugin, nodeid) + + def _getautousenames(self, nodeid): + """ return a tuple of fixture names to be used. """ + autousenames = [] + for baseid, basenames in self._nodeid_and_autousenames: + if nodeid.startswith(baseid): + if baseid: + i = len(baseid) + nextchar = nodeid[i:i + 1] + if nextchar and nextchar not in ":/": + continue + autousenames.extend(basenames) + # make sure autousenames are sorted by scope, scopenum 0 is session + autousenames.sort( + key=lambda x: self._arg2fixturedefs[x][-1].scopenum) + return autousenames + + def getfixtureclosure(self, fixturenames, parentnode): + # collect the closure of all fixtures , starting with the given + # fixturenames as the initial set. As we have to visit all + # factory definitions anyway, we also return a arg2fixturedefs + # mapping so that the caller can reuse it and does not have + # to re-discover fixturedefs again for each fixturename + # (discovering matching fixtures for a given name/node is expensive) + + parentid = parentnode.nodeid + fixturenames_closure = self._getautousenames(parentid) + + def merge(otherlist): + for arg in otherlist: + if arg not in fixturenames_closure: + fixturenames_closure.append(arg) + + merge(fixturenames) + arg2fixturedefs = {} + lastlen = -1 + while lastlen != len(fixturenames_closure): + lastlen = len(fixturenames_closure) + for argname in fixturenames_closure: + if argname in arg2fixturedefs: + continue + fixturedefs = self.getfixturedefs(argname, parentid) + if fixturedefs: + arg2fixturedefs[argname] = fixturedefs + merge(fixturedefs[-1].argnames) + return fixturenames_closure, arg2fixturedefs + + def pytest_generate_tests(self, metafunc): + for argname in metafunc.fixturenames: + faclist = metafunc._arg2fixturedefs.get(argname) + if faclist: + fixturedef = faclist[-1] + if fixturedef.params is not None: + parametrize_func = getattr(metafunc.function, 'parametrize', None) + func_params = getattr(parametrize_func, 'args', [[None]]) + func_kwargs = getattr(parametrize_func, 'kwargs', {}) + # skip directly parametrized arguments + if "argnames" in func_kwargs: + argnames = parametrize_func.kwargs["argnames"] + else: + argnames = func_params[0] + if not isinstance(argnames, (tuple, list)): + argnames = [x.strip() for x in argnames.split(",") if x.strip()] + if argname not in func_params and argname not in argnames: + metafunc.parametrize(argname, fixturedef.params, + indirect=True, scope=fixturedef.scope, + ids=fixturedef.ids) + else: + continue # will raise FixtureLookupError at setup time + + def pytest_collection_modifyitems(self, items): + # separate parametrized setups + items[:] = reorder_items(items) + + def parsefactories(self, node_or_obj, nodeid=NOTSET, unittest=False): + if nodeid is not NOTSET: + holderobj = node_or_obj + else: + holderobj = node_or_obj.obj + nodeid = node_or_obj.nodeid + if holderobj in self._holderobjseen: + return + self._holderobjseen.add(holderobj) + autousenames = [] + for name in dir(holderobj): + # The attribute can be an arbitrary descriptor, so the attribute + # access below can raise. safe_getatt() ignores such exceptions. + obj = safe_getattr(holderobj, name, None) + # fixture functions have a pytest_funcarg__ prefix (pre-2.3 style) + # or are "@pytest.fixture" marked + marker = getfixturemarker(obj) + if marker is None: + if not name.startswith(self._argprefix): + continue + if not callable(obj): + continue + marker = defaultfuncargprefixmarker + from _pytest import deprecated + self.config.warn('C1', deprecated.FUNCARG_PREFIX.format(name=name), nodeid=nodeid) + name = name[len(self._argprefix):] + elif not isinstance(marker, FixtureFunctionMarker): + # magic globals with __getattr__ might have got us a wrong + # fixture attribute + continue + else: + if marker.name: + name = marker.name + msg = 'fixtures cannot have "pytest_funcarg__" prefix ' \ + 'and be decorated with @pytest.fixture:\n%s' % name + assert not name.startswith(self._argprefix), msg + + fixture_def = FixtureDef(self, nodeid, name, obj, + marker.scope, marker.params, + unittest=unittest, ids=marker.ids) + + faclist = self._arg2fixturedefs.setdefault(name, []) + if fixture_def.has_location: + faclist.append(fixture_def) + else: + # fixturedefs with no location are at the front + # so this inserts the current fixturedef after the + # existing fixturedefs from external plugins but + # before the fixturedefs provided in conftests. + i = len([f for f in faclist if not f.has_location]) + faclist.insert(i, fixture_def) + if marker.autouse: + autousenames.append(name) + + if autousenames: + self._nodeid_and_autousenames.append((nodeid or '', autousenames)) + + def getfixturedefs(self, argname, nodeid): + """ + Gets a list of fixtures which are applicable to the given node id. + + :param str argname: name of the fixture to search for + :param str nodeid: full node id of the requesting test. + :return: list[FixtureDef] + """ + try: + fixturedefs = self._arg2fixturedefs[argname] + except KeyError: + return None + else: + return tuple(self._matchfactories(fixturedefs, nodeid)) + + def _matchfactories(self, fixturedefs, nodeid): + for fixturedef in fixturedefs: + if nodes.ischildnode(fixturedef.baseid, nodeid): + yield fixturedef diff --git a/lib/spack/external/pytest-fallback/_pytest/freeze_support.py b/lib/spack/external/pytest-fallback/_pytest/freeze_support.py new file mode 100644 index 0000000000..97147a8825 --- /dev/null +++ b/lib/spack/external/pytest-fallback/_pytest/freeze_support.py @@ -0,0 +1,43 @@ +""" +Provides a function to report all internal modules for using freezing tools +pytest +""" +from __future__ import absolute_import, division, print_function + + +def freeze_includes(): + """ + Returns a list of module names used by py.test that should be + included by cx_freeze. + """ + import py + import _pytest + result = list(_iter_all_modules(py)) + result += list(_iter_all_modules(_pytest)) + return result + + +def _iter_all_modules(package, prefix=''): + """ + Iterates over the names of all modules that can be found in the given + package, recursively. + Example: + _iter_all_modules(_pytest) -> + ['_pytest.assertion.newinterpret', + '_pytest.capture', + '_pytest.core', + ... + ] + """ + import os + import pkgutil + if type(package) is not str: + path, prefix = package.__path__[0], package.__name__ + '.' + else: + path = package + for _, name, is_package in pkgutil.iter_modules([path]): + if is_package: + for m in _iter_all_modules(os.path.join(path, name), prefix=name + '.'): + yield prefix + m + else: + yield prefix + name diff --git a/lib/spack/external/pytest-fallback/_pytest/helpconfig.py b/lib/spack/external/pytest-fallback/_pytest/helpconfig.py new file mode 100644 index 0000000000..e744637f86 --- /dev/null +++ b/lib/spack/external/pytest-fallback/_pytest/helpconfig.py @@ -0,0 +1,184 @@ +""" version info, help messages, tracing configuration. """ +from __future__ import absolute_import, division, print_function + +import py +import pytest +from _pytest.config import PrintHelp +import os +import sys +from argparse import Action + + +class HelpAction(Action): + """This is an argparse Action that will raise an exception in + order to skip the rest of the argument parsing when --help is passed. + This prevents argparse from quitting due to missing required arguments + when any are defined, for example by ``pytest_addoption``. + This is similar to the way that the builtin argparse --help option is + implemented by raising SystemExit. + """ + + def __init__(self, + option_strings, + dest=None, + default=False, + help=None): + super(HelpAction, self).__init__( + option_strings=option_strings, + dest=dest, + const=True, + default=default, + nargs=0, + help=help) + + def __call__(self, parser, namespace, values, option_string=None): + setattr(namespace, self.dest, self.const) + + # We should only skip the rest of the parsing after preparse is done + if getattr(parser._parser, 'after_preparse', False): + raise PrintHelp + + +def pytest_addoption(parser): + group = parser.getgroup('debugconfig') + group.addoption('--version', action="store_true", + help="display pytest lib version and import information.") + group._addoption("-h", "--help", action=HelpAction, dest="help", + help="show help message and configuration info") + group._addoption('-p', action="append", dest="plugins", default=[], + metavar="name", + help="early-load given plugin (multi-allowed). " + "To avoid loading of plugins, use the `no:` prefix, e.g. " + "`no:doctest`.") + group.addoption('--traceconfig', '--trace-config', + action="store_true", default=False, + help="trace considerations of conftest.py files."), + group.addoption('--debug', + action="store_true", dest="debug", default=False, + help="store internal tracing debug information in 'pytestdebug.log'.") + group._addoption( + '-o', '--override-ini', nargs='*', dest="override_ini", + action="append", + help="override config option with option=value style, e.g. `-o xfail_strict=True`.") + + +@pytest.hookimpl(hookwrapper=True) +def pytest_cmdline_parse(): + outcome = yield + config = outcome.get_result() + if config.option.debug: + path = os.path.abspath("pytestdebug.log") + debugfile = open(path, 'w') + debugfile.write("versions pytest-%s, py-%s, " + "python-%s\ncwd=%s\nargs=%s\n\n" % ( + pytest.__version__, py.__version__, + ".".join(map(str, sys.version_info)), + os.getcwd(), config._origargs)) + config.trace.root.setwriter(debugfile.write) + undo_tracing = config.pluginmanager.enable_tracing() + sys.stderr.write("writing pytestdebug information to %s\n" % path) + + def unset_tracing(): + debugfile.close() + sys.stderr.write("wrote pytestdebug information to %s\n" % + debugfile.name) + config.trace.root.setwriter(None) + undo_tracing() + + config.add_cleanup(unset_tracing) + + +def pytest_cmdline_main(config): + if config.option.version: + p = py.path.local(pytest.__file__) + sys.stderr.write("This is pytest version %s, imported from %s\n" % + (pytest.__version__, p)) + plugininfo = getpluginversioninfo(config) + if plugininfo: + for line in plugininfo: + sys.stderr.write(line + "\n") + return 0 + elif config.option.help: + config._do_configure() + showhelp(config) + config._ensure_unconfigure() + return 0 + + +def showhelp(config): + reporter = config.pluginmanager.get_plugin('terminalreporter') + tw = reporter._tw + tw.write(config._parser.optparser.format_help()) + tw.line() + tw.line() + tw.line("[pytest] ini-options in the first " + "pytest.ini|tox.ini|setup.cfg file found:") + tw.line() + + for name in config._parser._ininames: + help, type, default = config._parser._inidict[name] + if type is None: + type = "string" + spec = "%s (%s)" % (name, type) + line = " %-24s %s" % (spec, help) + tw.line(line[:tw.fullwidth]) + + tw.line() + tw.line("environment variables:") + vars = [ + ("PYTEST_ADDOPTS", "extra command line options"), + ("PYTEST_PLUGINS", "comma-separated plugins to load during startup"), + ("PYTEST_DEBUG", "set to enable debug tracing of pytest's internals") + ] + for name, help in vars: + tw.line(" %-24s %s" % (name, help)) + tw.line() + tw.line() + + tw.line("to see available markers type: pytest --markers") + tw.line("to see available fixtures type: pytest --fixtures") + tw.line("(shown according to specified file_or_dir or current dir " + "if not specified)") + + for warningreport in reporter.stats.get('warnings', []): + tw.line("warning : " + warningreport.message, red=True) + return + + +conftest_options = [ + ('pytest_plugins', 'list of plugin names to load'), +] + + +def getpluginversioninfo(config): + lines = [] + plugininfo = config.pluginmanager.list_plugin_distinfo() + if plugininfo: + lines.append("setuptools registered plugins:") + for plugin, dist in plugininfo: + loc = getattr(plugin, '__file__', repr(plugin)) + content = "%s-%s at %s" % (dist.project_name, dist.version, loc) + lines.append(" " + content) + return lines + + +def pytest_report_header(config): + lines = [] + if config.option.debug or config.option.traceconfig: + lines.append("using: pytest-%s pylib-%s" % + (pytest.__version__, py.__version__)) + + verinfo = getpluginversioninfo(config) + if verinfo: + lines.extend(verinfo) + + if config.option.traceconfig: + lines.append("active plugins:") + items = config.pluginmanager.list_name_plugin() + for name, plugin in items: + if hasattr(plugin, '__file__'): + r = plugin.__file__ + else: + r = repr(plugin) + lines.append(" %-20s: %s" % (name, r)) + return lines diff --git a/lib/spack/external/pytest-fallback/_pytest/hookspec.py b/lib/spack/external/pytest-fallback/_pytest/hookspec.py new file mode 100644 index 0000000000..e5c966e58b --- /dev/null +++ b/lib/spack/external/pytest-fallback/_pytest/hookspec.py @@ -0,0 +1,423 @@ +""" hook specifications for pytest plugins, invoked from main.py and builtin plugins. """ + +from _pytest._pluggy import HookspecMarker + +hookspec = HookspecMarker("pytest") + +# ------------------------------------------------------------------------- +# Initialization hooks called for every plugin +# ------------------------------------------------------------------------- + + +@hookspec(historic=True) +def pytest_addhooks(pluginmanager): + """called at plugin registration time to allow adding new hooks via a call to + pluginmanager.add_hookspecs(module_or_class, prefix).""" + + +@hookspec(historic=True) +def pytest_namespace(): + """ + DEPRECATED: this hook causes direct monkeypatching on pytest, its use is strongly discouraged + return dict of name->object to be made globally available in + the pytest namespace. This hook is called at plugin registration + time. + """ + + +@hookspec(historic=True) +def pytest_plugin_registered(plugin, manager): + """ a new pytest plugin got registered. """ + + +@hookspec(historic=True) +def pytest_addoption(parser): + """register argparse-style options and ini-style config values, + called once at the beginning of a test run. + + .. note:: + + This function should be implemented only in plugins or ``conftest.py`` + files situated at the tests root directory due to how pytest + :ref:`discovers plugins during startup `. + + :arg parser: To add command line options, call + :py:func:`parser.addoption(...) <_pytest.config.Parser.addoption>`. + To add ini-file values call :py:func:`parser.addini(...) + <_pytest.config.Parser.addini>`. + + Options can later be accessed through the + :py:class:`config <_pytest.config.Config>` object, respectively: + + - :py:func:`config.getoption(name) <_pytest.config.Config.getoption>` to + retrieve the value of a command line option. + + - :py:func:`config.getini(name) <_pytest.config.Config.getini>` to retrieve + a value read from an ini-style file. + + The config object is passed around on many internal objects via the ``.config`` + attribute or can be retrieved as the ``pytestconfig`` fixture or accessed + via (deprecated) ``pytest.config``. + """ + + +@hookspec(historic=True) +def pytest_configure(config): + """ + Allows plugins and conftest files to perform initial configuration. + + This hook is called for every plugin and initial conftest file + after command line options have been parsed. + + After that, the hook is called for other conftest files as they are + imported. + + :arg config: pytest config object + :type config: _pytest.config.Config + """ + +# ------------------------------------------------------------------------- +# Bootstrapping hooks called for plugins registered early enough: +# internal and 3rd party plugins as well as directly +# discoverable conftest.py local plugins. +# ------------------------------------------------------------------------- + + +@hookspec(firstresult=True) +def pytest_cmdline_parse(pluginmanager, args): + """return initialized config object, parsing the specified args. + + Stops at first non-None result, see :ref:`firstresult` """ + + +def pytest_cmdline_preparse(config, args): + """(deprecated) modify command line arguments before option parsing. """ + + +@hookspec(firstresult=True) +def pytest_cmdline_main(config): + """ called for performing the main command line action. The default + implementation will invoke the configure hooks and runtest_mainloop. + + Stops at first non-None result, see :ref:`firstresult` """ + + +def pytest_load_initial_conftests(early_config, parser, args): + """ implements the loading of initial conftest files ahead + of command line option parsing. """ + + +# ------------------------------------------------------------------------- +# collection hooks +# ------------------------------------------------------------------------- + +@hookspec(firstresult=True) +def pytest_collection(session): + """ perform the collection protocol for the given session. + + Stops at first non-None result, see :ref:`firstresult` """ + + +def pytest_collection_modifyitems(session, config, items): + """ called after collection has been performed, may filter or re-order + the items in-place.""" + + +def pytest_collection_finish(session): + """ called after collection has been performed and modified. """ + + +@hookspec(firstresult=True) +def pytest_ignore_collect(path, config): + """ return True to prevent considering this path for collection. + This hook is consulted for all files and directories prior to calling + more specific hooks. + + Stops at first non-None result, see :ref:`firstresult` + """ + + +@hookspec(firstresult=True) +def pytest_collect_directory(path, parent): + """ called before traversing a directory for collection files. + + Stops at first non-None result, see :ref:`firstresult` """ + + +def pytest_collect_file(path, parent): + """ return collection Node or None for the given path. Any new node + needs to have the specified ``parent`` as a parent.""" + +# logging hooks for collection + + +def pytest_collectstart(collector): + """ collector starts collecting. """ + + +def pytest_itemcollected(item): + """ we just collected a test item. """ + + +def pytest_collectreport(report): + """ collector finished collecting. """ + + +def pytest_deselected(items): + """ called for test items deselected by keyword. """ + + +@hookspec(firstresult=True) +def pytest_make_collect_report(collector): + """ perform ``collector.collect()`` and return a CollectReport. + + Stops at first non-None result, see :ref:`firstresult` """ + +# ------------------------------------------------------------------------- +# Python test function related hooks +# ------------------------------------------------------------------------- + + +@hookspec(firstresult=True) +def pytest_pycollect_makemodule(path, parent): + """ return a Module collector or None for the given path. + This hook will be called for each matching test module path. + The pytest_collect_file hook needs to be used if you want to + create test modules for files that do not match as a test module. + + Stops at first non-None result, see :ref:`firstresult` """ + + +@hookspec(firstresult=True) +def pytest_pycollect_makeitem(collector, name, obj): + """ return custom item/collector for a python object in a module, or None. + + Stops at first non-None result, see :ref:`firstresult` """ + + +@hookspec(firstresult=True) +def pytest_pyfunc_call(pyfuncitem): + """ call underlying test function. + + Stops at first non-None result, see :ref:`firstresult` """ + + +def pytest_generate_tests(metafunc): + """ generate (multiple) parametrized calls to a test function.""" + + +@hookspec(firstresult=True) +def pytest_make_parametrize_id(config, val, argname): + """Return a user-friendly string representation of the given ``val`` that will be used + by @pytest.mark.parametrize calls. Return None if the hook doesn't know about ``val``. + The parameter name is available as ``argname``, if required. + + Stops at first non-None result, see :ref:`firstresult` """ + +# ------------------------------------------------------------------------- +# generic runtest related hooks +# ------------------------------------------------------------------------- + + +@hookspec(firstresult=True) +def pytest_runtestloop(session): + """ called for performing the main runtest loop + (after collection finished). + + Stops at first non-None result, see :ref:`firstresult` """ + + +def pytest_itemstart(item, node): + """ (deprecated, use pytest_runtest_logstart). """ + + +@hookspec(firstresult=True) +def pytest_runtest_protocol(item, nextitem): + """ implements the runtest_setup/call/teardown protocol for + the given test item, including capturing exceptions and calling + reporting hooks. + + :arg item: test item for which the runtest protocol is performed. + + :arg nextitem: the scheduled-to-be-next test item (or None if this + is the end my friend). This argument is passed on to + :py:func:`pytest_runtest_teardown`. + + :return boolean: True if no further hook implementations should be invoked. + + + Stops at first non-None result, see :ref:`firstresult` """ + + +def pytest_runtest_logstart(nodeid, location): + """ signal the start of running a single test item. """ + + +def pytest_runtest_setup(item): + """ called before ``pytest_runtest_call(item)``. """ + + +def pytest_runtest_call(item): + """ called to execute the test ``item``. """ + + +def pytest_runtest_teardown(item, nextitem): + """ called after ``pytest_runtest_call``. + + :arg nextitem: the scheduled-to-be-next test item (None if no further + test item is scheduled). This argument can be used to + perform exact teardowns, i.e. calling just enough finalizers + so that nextitem only needs to call setup-functions. + """ + + +@hookspec(firstresult=True) +def pytest_runtest_makereport(item, call): + """ return a :py:class:`_pytest.runner.TestReport` object + for the given :py:class:`pytest.Item <_pytest.main.Item>` and + :py:class:`_pytest.runner.CallInfo`. + + Stops at first non-None result, see :ref:`firstresult` """ + + +def pytest_runtest_logreport(report): + """ process a test setup/call/teardown report relating to + the respective phase of executing a test. """ + +# ------------------------------------------------------------------------- +# Fixture related hooks +# ------------------------------------------------------------------------- + + +@hookspec(firstresult=True) +def pytest_fixture_setup(fixturedef, request): + """ performs fixture setup execution. + + Stops at first non-None result, see :ref:`firstresult` """ + + +def pytest_fixture_post_finalizer(fixturedef): + """ called after fixture teardown, but before the cache is cleared so + the fixture result cache ``fixturedef.cached_result`` can + still be accessed.""" + +# ------------------------------------------------------------------------- +# test session related hooks +# ------------------------------------------------------------------------- + + +def pytest_sessionstart(session): + """ before session.main() is called. """ + + +def pytest_sessionfinish(session, exitstatus): + """ whole test run finishes. """ + + +def pytest_unconfigure(config): + """ called before test process is exited. """ + + +# ------------------------------------------------------------------------- +# hooks for customizing the assert methods +# ------------------------------------------------------------------------- + +def pytest_assertrepr_compare(config, op, left, right): + """return explanation for comparisons in failing assert expressions. + + Return None for no custom explanation, otherwise return a list + of strings. The strings will be joined by newlines but any newlines + *in* a string will be escaped. Note that all but the first line will + be indented slightly, the intention is for the first line to be a summary. + """ + +# ------------------------------------------------------------------------- +# hooks for influencing reporting (invoked from _pytest_terminal) +# ------------------------------------------------------------------------- + + +def pytest_report_header(config, startdir): + """ return a string or list of strings to be displayed as header info for terminal reporting. + + :param config: the pytest config object. + :param startdir: py.path object with the starting dir + + .. note:: + + This function should be implemented only in plugins or ``conftest.py`` + files situated at the tests root directory due to how pytest + :ref:`discovers plugins during startup `. + """ + + +def pytest_report_collectionfinish(config, startdir, items): + """ + .. versionadded:: 3.2 + + return a string or list of strings to be displayed after collection has finished successfully. + + This strings will be displayed after the standard "collected X items" message. + + :param config: the pytest config object. + :param startdir: py.path object with the starting dir + :param items: list of pytest items that are going to be executed; this list should not be modified. + """ + + +@hookspec(firstresult=True) +def pytest_report_teststatus(report): + """ return result-category, shortletter and verbose word for reporting. + + Stops at first non-None result, see :ref:`firstresult` """ + + +def pytest_terminal_summary(terminalreporter, exitstatus): + """ add additional section in terminal summary reporting. """ + + +@hookspec(historic=True) +def pytest_logwarning(message, code, nodeid, fslocation): + """ process a warning specified by a message, a code string, + a nodeid and fslocation (both of which may be None + if the warning is not tied to a partilar node/location).""" + +# ------------------------------------------------------------------------- +# doctest hooks +# ------------------------------------------------------------------------- + + +@hookspec(firstresult=True) +def pytest_doctest_prepare_content(content): + """ return processed content for a given doctest + + Stops at first non-None result, see :ref:`firstresult` """ + +# ------------------------------------------------------------------------- +# error handling and internal debugging hooks +# ------------------------------------------------------------------------- + + +def pytest_internalerror(excrepr, excinfo): + """ called for internal errors. """ + + +def pytest_keyboard_interrupt(excinfo): + """ called for keyboard interrupt. """ + + +def pytest_exception_interact(node, call, report): + """called when an exception was raised which can potentially be + interactively handled. + + This hook is only called if an exception was raised + that is not an internal exception like ``skip.Exception``. + """ + + +def pytest_enter_pdb(config): + """ called upon pdb.set_trace(), can be used by plugins to take special + action just before the python debugger enters in interactive mode. + + :arg config: pytest config object + :type config: _pytest.config.Config + """ diff --git a/lib/spack/external/pytest-fallback/_pytest/junitxml.py b/lib/spack/external/pytest-fallback/_pytest/junitxml.py new file mode 100644 index 0000000000..7fb40dc354 --- /dev/null +++ b/lib/spack/external/pytest-fallback/_pytest/junitxml.py @@ -0,0 +1,453 @@ +""" + report test results in JUnit-XML format, + for use with Jenkins and build integration servers. + + +Based on initial code from Ross Lawley. + +Output conforms to https://github.com/jenkinsci/xunit-plugin/blob/master/ +src/main/resources/org/jenkinsci/plugins/xunit/types/model/xsd/junit-10.xsd +""" +from __future__ import absolute_import, division, print_function + +import functools +import py +import os +import re +import sys +import time +import pytest +from _pytest import nodes +from _pytest.config import filename_arg + +# Python 2.X and 3.X compatibility +if sys.version_info[0] < 3: + from codecs import open +else: + unichr = chr + unicode = str + long = int + + +class Junit(py.xml.Namespace): + pass + + +# We need to get the subset of the invalid unicode ranges according to +# XML 1.0 which are valid in this python build. Hence we calculate +# this dynamically instead of hardcoding it. The spec range of valid +# chars is: Char ::= #x9 | #xA | #xD | [#x20-#xD7FF] | [#xE000-#xFFFD] +# | [#x10000-#x10FFFF] +_legal_chars = (0x09, 0x0A, 0x0d) +_legal_ranges = ( + (0x20, 0x7E), (0x80, 0xD7FF), (0xE000, 0xFFFD), (0x10000, 0x10FFFF), +) +_legal_xml_re = [ + unicode("%s-%s") % (unichr(low), unichr(high)) + for (low, high) in _legal_ranges if low < sys.maxunicode +] +_legal_xml_re = [unichr(x) for x in _legal_chars] + _legal_xml_re +illegal_xml_re = re.compile(unicode('[^%s]') % unicode('').join(_legal_xml_re)) +del _legal_chars +del _legal_ranges +del _legal_xml_re + +_py_ext_re = re.compile(r"\.py$") + + +def bin_xml_escape(arg): + def repl(matchobj): + i = ord(matchobj.group()) + if i <= 0xFF: + return unicode('#x%02X') % i + else: + return unicode('#x%04X') % i + + return py.xml.raw(illegal_xml_re.sub(repl, py.xml.escape(arg))) + + +class _NodeReporter(object): + def __init__(self, nodeid, xml): + + self.id = nodeid + self.xml = xml + self.add_stats = self.xml.add_stats + self.duration = 0 + self.properties = [] + self.nodes = [] + self.testcase = None + self.attrs = {} + + def append(self, node): + self.xml.add_stats(type(node).__name__) + self.nodes.append(node) + + def add_property(self, name, value): + self.properties.append((str(name), bin_xml_escape(value))) + + def make_properties_node(self): + """Return a Junit node containing custom properties, if any. + """ + if self.properties: + return Junit.properties([ + Junit.property(name=name, value=value) + for name, value in self.properties + ]) + return '' + + def record_testreport(self, testreport): + assert not self.testcase + names = mangle_test_address(testreport.nodeid) + classnames = names[:-1] + if self.xml.prefix: + classnames.insert(0, self.xml.prefix) + attrs = { + "classname": ".".join(classnames), + "name": bin_xml_escape(names[-1]), + "file": testreport.location[0], + } + if testreport.location[1] is not None: + attrs["line"] = testreport.location[1] + if hasattr(testreport, "url"): + attrs["url"] = testreport.url + self.attrs = attrs + + def to_xml(self): + testcase = Junit.testcase(time=self.duration, **self.attrs) + testcase.append(self.make_properties_node()) + for node in self.nodes: + testcase.append(node) + return testcase + + def _add_simple(self, kind, message, data=None): + data = bin_xml_escape(data) + node = kind(data, message=message) + self.append(node) + + def write_captured_output(self, report): + for capname in ('out', 'err'): + content = getattr(report, 'capstd' + capname) + if content: + tag = getattr(Junit, 'system-' + capname) + self.append(tag(bin_xml_escape(content))) + + def append_pass(self, report): + self.add_stats('passed') + + def append_failure(self, report): + # msg = str(report.longrepr.reprtraceback.extraline) + if hasattr(report, "wasxfail"): + self._add_simple( + Junit.skipped, + "xfail-marked test passes unexpectedly") + else: + if hasattr(report.longrepr, "reprcrash"): + message = report.longrepr.reprcrash.message + elif isinstance(report.longrepr, (unicode, str)): + message = report.longrepr + else: + message = str(report.longrepr) + message = bin_xml_escape(message) + fail = Junit.failure(message=message) + fail.append(bin_xml_escape(report.longrepr)) + self.append(fail) + + def append_collect_error(self, report): + # msg = str(report.longrepr.reprtraceback.extraline) + self.append(Junit.error(bin_xml_escape(report.longrepr), + message="collection failure")) + + def append_collect_skipped(self, report): + self._add_simple( + Junit.skipped, "collection skipped", report.longrepr) + + def append_error(self, report): + if getattr(report, 'when', None) == 'teardown': + msg = "test teardown failure" + else: + msg = "test setup failure" + self._add_simple( + Junit.error, msg, report.longrepr) + + def append_skipped(self, report): + if hasattr(report, "wasxfail"): + self._add_simple( + Junit.skipped, "expected test failure", report.wasxfail + ) + else: + filename, lineno, skipreason = report.longrepr + if skipreason.startswith("Skipped: "): + skipreason = bin_xml_escape(skipreason[9:]) + self.append( + Junit.skipped("%s:%s: %s" % (filename, lineno, skipreason), + type="pytest.skip", + message=skipreason)) + self.write_captured_output(report) + + def finalize(self): + data = self.to_xml().unicode(indent=0) + self.__dict__.clear() + self.to_xml = lambda: py.xml.raw(data) + + +@pytest.fixture +def record_xml_property(request): + """Add extra xml properties to the tag for the calling test. + The fixture is callable with ``(name, value)``, with value being automatically + xml-encoded. + """ + request.node.warn( + code='C3', + message='record_xml_property is an experimental feature', + ) + xml = getattr(request.config, "_xml", None) + if xml is not None: + node_reporter = xml.node_reporter(request.node.nodeid) + return node_reporter.add_property + else: + def add_property_noop(name, value): + pass + + return add_property_noop + + +def pytest_addoption(parser): + group = parser.getgroup("terminal reporting") + group.addoption( + '--junitxml', '--junit-xml', + action="store", + dest="xmlpath", + metavar="path", + type=functools.partial(filename_arg, optname="--junitxml"), + default=None, + help="create junit-xml style report file at given path.") + group.addoption( + '--junitprefix', '--junit-prefix', + action="store", + metavar="str", + default=None, + help="prepend prefix to classnames in junit-xml output") + parser.addini("junit_suite_name", "Test suite name for JUnit report", default="pytest") + + +def pytest_configure(config): + xmlpath = config.option.xmlpath + # prevent opening xmllog on slave nodes (xdist) + if xmlpath and not hasattr(config, 'slaveinput'): + config._xml = LogXML(xmlpath, config.option.junitprefix, config.getini("junit_suite_name")) + config.pluginmanager.register(config._xml) + + +def pytest_unconfigure(config): + xml = getattr(config, '_xml', None) + if xml: + del config._xml + config.pluginmanager.unregister(xml) + + +def mangle_test_address(address): + path, possible_open_bracket, params = address.partition('[') + names = path.split("::") + try: + names.remove('()') + except ValueError: + pass + # convert file path to dotted path + names[0] = names[0].replace(nodes.SEP, '.') + names[0] = _py_ext_re.sub("", names[0]) + # put any params back + names[-1] += possible_open_bracket + params + return names + + +class LogXML(object): + def __init__(self, logfile, prefix, suite_name="pytest"): + logfile = os.path.expanduser(os.path.expandvars(logfile)) + self.logfile = os.path.normpath(os.path.abspath(logfile)) + self.prefix = prefix + self.suite_name = suite_name + self.stats = dict.fromkeys([ + 'error', + 'passed', + 'failure', + 'skipped', + ], 0) + self.node_reporters = {} # nodeid -> _NodeReporter + self.node_reporters_ordered = [] + self.global_properties = [] + # List of reports that failed on call but teardown is pending. + self.open_reports = [] + self.cnt_double_fail_tests = 0 + + def finalize(self, report): + nodeid = getattr(report, 'nodeid', report) + # local hack to handle xdist report order + slavenode = getattr(report, 'node', None) + reporter = self.node_reporters.pop((nodeid, slavenode)) + if reporter is not None: + reporter.finalize() + + def node_reporter(self, report): + nodeid = getattr(report, 'nodeid', report) + # local hack to handle xdist report order + slavenode = getattr(report, 'node', None) + + key = nodeid, slavenode + + if key in self.node_reporters: + # TODO: breasks for --dist=each + return self.node_reporters[key] + + reporter = _NodeReporter(nodeid, self) + + self.node_reporters[key] = reporter + self.node_reporters_ordered.append(reporter) + + return reporter + + def add_stats(self, key): + if key in self.stats: + self.stats[key] += 1 + + def _opentestcase(self, report): + reporter = self.node_reporter(report) + reporter.record_testreport(report) + return reporter + + def pytest_runtest_logreport(self, report): + """handle a setup/call/teardown report, generating the appropriate + xml tags as necessary. + + note: due to plugins like xdist, this hook may be called in interlaced + order with reports from other nodes. for example: + + usual call order: + -> setup node1 + -> call node1 + -> teardown node1 + -> setup node2 + -> call node2 + -> teardown node2 + + possible call order in xdist: + -> setup node1 + -> call node1 + -> setup node2 + -> call node2 + -> teardown node2 + -> teardown node1 + """ + close_report = None + if report.passed: + if report.when == "call": # ignore setup/teardown + reporter = self._opentestcase(report) + reporter.append_pass(report) + elif report.failed: + if report.when == "teardown": + # The following vars are needed when xdist plugin is used + report_wid = getattr(report, "worker_id", None) + report_ii = getattr(report, "item_index", None) + close_report = next( + (rep for rep in self.open_reports + if (rep.nodeid == report.nodeid and + getattr(rep, "item_index", None) == report_ii and + getattr(rep, "worker_id", None) == report_wid + ) + ), None) + if close_report: + # We need to open new testcase in case we have failure in + # call and error in teardown in order to follow junit + # schema + self.finalize(close_report) + self.cnt_double_fail_tests += 1 + reporter = self._opentestcase(report) + if report.when == "call": + reporter.append_failure(report) + self.open_reports.append(report) + else: + reporter.append_error(report) + elif report.skipped: + reporter = self._opentestcase(report) + reporter.append_skipped(report) + self.update_testcase_duration(report) + if report.when == "teardown": + reporter = self._opentestcase(report) + reporter.write_captured_output(report) + self.finalize(report) + report_wid = getattr(report, "worker_id", None) + report_ii = getattr(report, "item_index", None) + close_report = next( + (rep for rep in self.open_reports + if (rep.nodeid == report.nodeid and + getattr(rep, "item_index", None) == report_ii and + getattr(rep, "worker_id", None) == report_wid + ) + ), None) + if close_report: + self.open_reports.remove(close_report) + + def update_testcase_duration(self, report): + """accumulates total duration for nodeid from given report and updates + the Junit.testcase with the new total if already created. + """ + reporter = self.node_reporter(report) + reporter.duration += getattr(report, 'duration', 0.0) + + def pytest_collectreport(self, report): + if not report.passed: + reporter = self._opentestcase(report) + if report.failed: + reporter.append_collect_error(report) + else: + reporter.append_collect_skipped(report) + + def pytest_internalerror(self, excrepr): + reporter = self.node_reporter('internal') + reporter.attrs.update(classname="pytest", name='internal') + reporter._add_simple(Junit.error, 'internal error', excrepr) + + def pytest_sessionstart(self): + self.suite_start_time = time.time() + + def pytest_sessionfinish(self): + dirname = os.path.dirname(os.path.abspath(self.logfile)) + if not os.path.isdir(dirname): + os.makedirs(dirname) + logfile = open(self.logfile, 'w', encoding='utf-8') + suite_stop_time = time.time() + suite_time_delta = suite_stop_time - self.suite_start_time + + numtests = (self.stats['passed'] + self.stats['failure'] + + self.stats['skipped'] + self.stats['error'] - + self.cnt_double_fail_tests) + logfile.write('') + + logfile.write(Junit.testsuite( + self._get_global_properties_node(), + [x.to_xml() for x in self.node_reporters_ordered], + name=self.suite_name, + errors=self.stats['error'], + failures=self.stats['failure'], + skips=self.stats['skipped'], + tests=numtests, + time="%.3f" % suite_time_delta, ).unicode(indent=0)) + logfile.close() + + def pytest_terminal_summary(self, terminalreporter): + terminalreporter.write_sep("-", + "generated xml file: %s" % (self.logfile)) + + def add_global_property(self, name, value): + self.global_properties.append((str(name), bin_xml_escape(value))) + + def _get_global_properties_node(self): + """Return a Junit node containing custom properties, if any. + """ + if self.global_properties: + return Junit.properties( + [ + Junit.property(name=name, value=value) + for name, value in self.global_properties + ] + ) + return '' diff --git a/lib/spack/external/pytest-fallback/_pytest/main.py b/lib/spack/external/pytest-fallback/_pytest/main.py new file mode 100644 index 0000000000..98aa28eb34 --- /dev/null +++ b/lib/spack/external/pytest-fallback/_pytest/main.py @@ -0,0 +1,838 @@ +""" core implementation of testing process: init, session, runtest loop. """ +from __future__ import absolute_import, division, print_function + +import functools +import os +import sys + +import _pytest +from _pytest import nodes +import _pytest._code +import py +try: + from collections.abc import MutableMapping as MappingMixin +except ImportError: + try: + from collections import MutableMapping as MappingMixin + except ImportError: + from UserDict import DictMixin as MappingMixin + +from _pytest.config import directory_arg, UsageError, hookimpl +from _pytest.outcomes import exit +from _pytest.runner import collect_one_node + +tracebackcutdir = py.path.local(_pytest.__file__).dirpath() + +# exitcodes for the command line +EXIT_OK = 0 +EXIT_TESTSFAILED = 1 +EXIT_INTERRUPTED = 2 +EXIT_INTERNALERROR = 3 +EXIT_USAGEERROR = 4 +EXIT_NOTESTSCOLLECTED = 5 + + +def pytest_addoption(parser): + parser.addini("norecursedirs", "directory patterns to avoid for recursion", + type="args", default=['.*', 'build', 'dist', 'CVS', '_darcs', '{arch}', '*.egg', 'venv']) + parser.addini("testpaths", "directories to search for tests when no files or directories are given in the " + "command line.", + type="args", default=[]) + # parser.addini("dirpatterns", + # "patterns specifying possible locations of test files", + # type="linelist", default=["**/test_*.txt", + # "**/test_*.py", "**/*_test.py"] + # ) + group = parser.getgroup("general", "running and selection options") + group._addoption('-x', '--exitfirst', action="store_const", + dest="maxfail", const=1, + help="exit instantly on first error or failed test."), + group._addoption('--maxfail', metavar="num", + action="store", type=int, dest="maxfail", default=0, + help="exit after first num failures or errors.") + group._addoption('--strict', action="store_true", + help="marks not registered in configuration file raise errors.") + group._addoption("-c", metavar="file", type=str, dest="inifilename", + help="load configuration from `file` instead of trying to locate one of the implicit " + "configuration files.") + group._addoption("--continue-on-collection-errors", action="store_true", + default=False, dest="continue_on_collection_errors", + help="Force test execution even if collection errors occur.") + + group = parser.getgroup("collect", "collection") + group.addoption('--collectonly', '--collect-only', action="store_true", + help="only collect tests, don't execute them."), + group.addoption('--pyargs', action="store_true", + help="try to interpret all arguments as python packages.") + group.addoption("--ignore", action="append", metavar="path", + help="ignore path during collection (multi-allowed).") + # when changing this to --conf-cut-dir, config.py Conftest.setinitial + # needs upgrading as well + group.addoption('--confcutdir', dest="confcutdir", default=None, + metavar="dir", type=functools.partial(directory_arg, optname="--confcutdir"), + help="only load conftest.py's relative to specified dir.") + group.addoption('--noconftest', action="store_true", + dest="noconftest", default=False, + help="Don't load any conftest.py files.") + group.addoption('--keepduplicates', '--keep-duplicates', action="store_true", + dest="keepduplicates", default=False, + help="Keep duplicate tests.") + group.addoption('--collect-in-virtualenv', action='store_true', + dest='collect_in_virtualenv', default=False, + help="Don't ignore tests in a local virtualenv directory") + + group = parser.getgroup("debugconfig", + "test session debugging and configuration") + group.addoption('--basetemp', dest="basetemp", default=None, metavar="dir", + help="base temporary directory for this test run.") + + +def pytest_namespace(): + """keeping this one works around a deeper startup issue in pytest + + i tried to find it for a while but the amount of time turned unsustainable, + so i put a hack in to revisit later + """ + return {} + + +def pytest_configure(config): + __import__('pytest').config = config # compatibiltiy + + +def wrap_session(config, doit): + """Skeleton command line program""" + session = Session(config) + session.exitstatus = EXIT_OK + initstate = 0 + try: + try: + config._do_configure() + initstate = 1 + config.hook.pytest_sessionstart(session=session) + initstate = 2 + session.exitstatus = doit(config, session) or 0 + except UsageError: + raise + except KeyboardInterrupt: + excinfo = _pytest._code.ExceptionInfo() + if initstate < 2 and isinstance(excinfo.value, exit.Exception): + sys.stderr.write('{0}: {1}\n'.format( + excinfo.typename, excinfo.value.msg)) + config.hook.pytest_keyboard_interrupt(excinfo=excinfo) + session.exitstatus = EXIT_INTERRUPTED + except: # noqa + excinfo = _pytest._code.ExceptionInfo() + config.notify_exception(excinfo, config.option) + session.exitstatus = EXIT_INTERNALERROR + if excinfo.errisinstance(SystemExit): + sys.stderr.write("mainloop: caught Spurious SystemExit!\n") + + finally: + excinfo = None # Explicitly break reference cycle. + session.startdir.chdir() + if initstate >= 2: + config.hook.pytest_sessionfinish( + session=session, + exitstatus=session.exitstatus) + config._ensure_unconfigure() + return session.exitstatus + + +def pytest_cmdline_main(config): + return wrap_session(config, _main) + + +def _main(config, session): + """ default command line protocol for initialization, session, + running tests and reporting. """ + config.hook.pytest_collection(session=session) + config.hook.pytest_runtestloop(session=session) + + if session.testsfailed: + return EXIT_TESTSFAILED + elif session.testscollected == 0: + return EXIT_NOTESTSCOLLECTED + + +def pytest_collection(session): + return session.perform_collect() + + +def pytest_runtestloop(session): + if (session.testsfailed and + not session.config.option.continue_on_collection_errors): + raise session.Interrupted( + "%d errors during collection" % session.testsfailed) + + if session.config.option.collectonly: + return True + + for i, item in enumerate(session.items): + nextitem = session.items[i + 1] if i + 1 < len(session.items) else None + item.config.hook.pytest_runtest_protocol(item=item, nextitem=nextitem) + if session.shouldstop: + raise session.Interrupted(session.shouldstop) + return True + + +def _in_venv(path): + """Attempts to detect if ``path`` is the root of a Virtual Environment by + checking for the existence of the appropriate activate script""" + bindir = path.join('Scripts' if sys.platform.startswith('win') else 'bin') + if not bindir.exists(): + return False + activates = ('activate', 'activate.csh', 'activate.fish', + 'Activate', 'Activate.bat', 'Activate.ps1') + return any([fname.basename in activates for fname in bindir.listdir()]) + + +def pytest_ignore_collect(path, config): + ignore_paths = config._getconftest_pathlist("collect_ignore", path=path.dirpath()) + ignore_paths = ignore_paths or [] + excludeopt = config.getoption("ignore") + if excludeopt: + ignore_paths.extend([py.path.local(x) for x in excludeopt]) + + if py.path.local(path) in ignore_paths: + return True + + allow_in_venv = config.getoption("collect_in_virtualenv") + if _in_venv(path) and not allow_in_venv: + return True + + # Skip duplicate paths. + keepduplicates = config.getoption("keepduplicates") + duplicate_paths = config.pluginmanager._duplicatepaths + if not keepduplicates: + if path in duplicate_paths: + return True + else: + duplicate_paths.add(path) + + return False + + +class FSHookProxy: + def __init__(self, fspath, pm, remove_mods): + self.fspath = fspath + self.pm = pm + self.remove_mods = remove_mods + + def __getattr__(self, name): + x = self.pm.subset_hook_caller(name, remove_plugins=self.remove_mods) + self.__dict__[name] = x + return x + + +class _CompatProperty(object): + def __init__(self, name): + self.name = name + + def __get__(self, obj, owner): + if obj is None: + return self + + # TODO: reenable in the features branch + # warnings.warn( + # "usage of {owner!r}.{name} is deprecated, please use pytest.{name} instead".format( + # name=self.name, owner=type(owner).__name__), + # PendingDeprecationWarning, stacklevel=2) + return getattr(__import__('pytest'), self.name) + + +class NodeKeywords(MappingMixin): + def __init__(self, node): + self.node = node + self.parent = node.parent + self._markers = {node.name: True} + + def __getitem__(self, key): + try: + return self._markers[key] + except KeyError: + if self.parent is None: + raise + return self.parent.keywords[key] + + def __setitem__(self, key, value): + self._markers[key] = value + + def __delitem__(self, key): + raise ValueError("cannot delete key in keywords dict") + + def __iter__(self): + seen = set(self._markers) + if self.parent is not None: + seen.update(self.parent.keywords) + return iter(seen) + + def __len__(self): + return len(self.__iter__()) + + def keys(self): + return list(self) + + def __repr__(self): + return "" % (self.node, ) + + +class Node(object): + """ base class for Collector and Item the test collection tree. + Collector subclasses have children, Items are terminal nodes.""" + + def __init__(self, name, parent=None, config=None, session=None): + #: a unique name within the scope of the parent node + self.name = name + + #: the parent collector node. + self.parent = parent + + #: the pytest config object + self.config = config or parent.config + + #: the session this node is part of + self.session = session or parent.session + + #: filesystem path where this node was collected from (can be None) + self.fspath = getattr(parent, 'fspath', None) + + #: keywords/markers collected from all scopes + self.keywords = NodeKeywords(self) + + #: allow adding of extra keywords to use for matching + self.extra_keyword_matches = set() + + # used for storing artificial fixturedefs for direct parametrization + self._name2pseudofixturedef = {} + + @property + def ihook(self): + """ fspath sensitive hook proxy used to call pytest hooks""" + return self.session.gethookproxy(self.fspath) + + Module = _CompatProperty("Module") + Class = _CompatProperty("Class") + Instance = _CompatProperty("Instance") + Function = _CompatProperty("Function") + File = _CompatProperty("File") + Item = _CompatProperty("Item") + + def _getcustomclass(self, name): + maybe_compatprop = getattr(type(self), name) + if isinstance(maybe_compatprop, _CompatProperty): + return getattr(__import__('pytest'), name) + else: + cls = getattr(self, name) + # TODO: reenable in the features branch + # warnings.warn("use of node.%s is deprecated, " + # "use pytest_pycollect_makeitem(...) to create custom " + # "collection nodes" % name, category=DeprecationWarning) + return cls + + def __repr__(self): + return "<%s %r>" % (self.__class__.__name__, + getattr(self, 'name', None)) + + def warn(self, code, message): + """ generate a warning with the given code and message for this + item. """ + assert isinstance(code, str) + fslocation = getattr(self, "location", None) + if fslocation is None: + fslocation = getattr(self, "fspath", None) + self.ihook.pytest_logwarning.call_historic(kwargs=dict( + code=code, message=message, + nodeid=self.nodeid, fslocation=fslocation)) + + # methods for ordering nodes + @property + def nodeid(self): + """ a ::-separated string denoting its collection tree address. """ + try: + return self._nodeid + except AttributeError: + self._nodeid = x = self._makeid() + return x + + def _makeid(self): + return self.parent.nodeid + "::" + self.name + + def __hash__(self): + return hash(self.nodeid) + + def setup(self): + pass + + def teardown(self): + pass + + def _memoizedcall(self, attrname, function): + exattrname = "_ex_" + attrname + failure = getattr(self, exattrname, None) + if failure is not None: + py.builtin._reraise(failure[0], failure[1], failure[2]) + if hasattr(self, attrname): + return getattr(self, attrname) + try: + res = function() + except py.builtin._sysex: + raise + except: # noqa + failure = sys.exc_info() + setattr(self, exattrname, failure) + raise + setattr(self, attrname, res) + return res + + def listchain(self): + """ return list of all parent collectors up to self, + starting from root of collection tree. """ + chain = [] + item = self + while item is not None: + chain.append(item) + item = item.parent + chain.reverse() + return chain + + def add_marker(self, marker): + """ dynamically add a marker object to the node. + + ``marker`` can be a string or pytest.mark.* instance. + """ + from _pytest.mark import MarkDecorator, MARK_GEN + if isinstance(marker, py.builtin._basestring): + marker = getattr(MARK_GEN, marker) + elif not isinstance(marker, MarkDecorator): + raise ValueError("is not a string or pytest.mark.* Marker") + self.keywords[marker.name] = marker + + def get_marker(self, name): + """ get a marker object from this node or None if + the node doesn't have a marker with that name. """ + val = self.keywords.get(name, None) + if val is not None: + from _pytest.mark import MarkInfo, MarkDecorator + if isinstance(val, (MarkDecorator, MarkInfo)): + return val + + def listextrakeywords(self): + """ Return a set of all extra keywords in self and any parents.""" + extra_keywords = set() + item = self + for item in self.listchain(): + extra_keywords.update(item.extra_keyword_matches) + return extra_keywords + + def listnames(self): + return [x.name for x in self.listchain()] + + def addfinalizer(self, fin): + """ register a function to be called when this node is finalized. + + This method can only be called when this node is active + in a setup chain, for example during self.setup(). + """ + self.session._setupstate.addfinalizer(fin, self) + + def getparent(self, cls): + """ get the next parent node (including ourself) + which is an instance of the given class""" + current = self + while current and not isinstance(current, cls): + current = current.parent + return current + + def _prunetraceback(self, excinfo): + pass + + def _repr_failure_py(self, excinfo, style=None): + fm = self.session._fixturemanager + if excinfo.errisinstance(fm.FixtureLookupError): + return excinfo.value.formatrepr() + tbfilter = True + if self.config.option.fulltrace: + style = "long" + else: + tb = _pytest._code.Traceback([excinfo.traceback[-1]]) + self._prunetraceback(excinfo) + if len(excinfo.traceback) == 0: + excinfo.traceback = tb + tbfilter = False # prunetraceback already does it + if style == "auto": + style = "long" + # XXX should excinfo.getrepr record all data and toterminal() process it? + if style is None: + if self.config.option.tbstyle == "short": + style = "short" + else: + style = "long" + + try: + os.getcwd() + abspath = False + except OSError: + abspath = True + + return excinfo.getrepr(funcargs=True, abspath=abspath, + showlocals=self.config.option.showlocals, + style=style, tbfilter=tbfilter) + + repr_failure = _repr_failure_py + + +class Collector(Node): + """ Collector instances create children through collect() + and thus iteratively build a tree. + """ + + class CollectError(Exception): + """ an error during collection, contains a custom message. """ + + def collect(self): + """ returns a list of children (items and collectors) + for this collection node. + """ + raise NotImplementedError("abstract") + + def repr_failure(self, excinfo): + """ represent a collection failure. """ + if excinfo.errisinstance(self.CollectError): + exc = excinfo.value + return str(exc.args[0]) + return self._repr_failure_py(excinfo, style="short") + + def _prunetraceback(self, excinfo): + if hasattr(self, 'fspath'): + traceback = excinfo.traceback + ntraceback = traceback.cut(path=self.fspath) + if ntraceback == traceback: + ntraceback = ntraceback.cut(excludepath=tracebackcutdir) + excinfo.traceback = ntraceback.filter() + + +class FSCollector(Collector): + def __init__(self, fspath, parent=None, config=None, session=None): + fspath = py.path.local(fspath) # xxx only for test_resultlog.py? + name = fspath.basename + if parent is not None: + rel = fspath.relto(parent.fspath) + if rel: + name = rel + name = name.replace(os.sep, nodes.SEP) + super(FSCollector, self).__init__(name, parent, config, session) + self.fspath = fspath + + def _check_initialpaths_for_relpath(self): + for initialpath in self.session._initialpaths: + if self.fspath.common(initialpath) == initialpath: + return self.fspath.relto(initialpath.dirname) + + def _makeid(self): + relpath = self.fspath.relto(self.config.rootdir) + + if not relpath: + relpath = self._check_initialpaths_for_relpath() + if os.sep != nodes.SEP: + relpath = relpath.replace(os.sep, nodes.SEP) + return relpath + + +class File(FSCollector): + """ base class for collecting tests from a file. """ + + +class Item(Node): + """ a basic test invocation item. Note that for a single function + there might be multiple test invocation items. + """ + nextitem = None + + def __init__(self, name, parent=None, config=None, session=None): + super(Item, self).__init__(name, parent, config, session) + self._report_sections = [] + + def add_report_section(self, when, key, content): + """ + Adds a new report section, similar to what's done internally to add stdout and + stderr captured output:: + + item.add_report_section("call", "stdout", "report section contents") + + :param str when: + One of the possible capture states, ``"setup"``, ``"call"``, ``"teardown"``. + :param str key: + Name of the section, can be customized at will. Pytest uses ``"stdout"`` and + ``"stderr"`` internally. + + :param str content: + The full contents as a string. + """ + if content: + self._report_sections.append((when, key, content)) + + def reportinfo(self): + return self.fspath, None, "" + + @property + def location(self): + try: + return self._location + except AttributeError: + location = self.reportinfo() + # bestrelpath is a quite slow function + cache = self.config.__dict__.setdefault("_bestrelpathcache", {}) + try: + fspath = cache[location[0]] + except KeyError: + fspath = self.session.fspath.bestrelpath(location[0]) + cache[location[0]] = fspath + location = (fspath, location[1], str(location[2])) + self._location = location + return location + + +class NoMatch(Exception): + """ raised if matching cannot locate a matching names. """ + + +class Interrupted(KeyboardInterrupt): + """ signals an interrupted test run. """ + __module__ = 'builtins' # for py3 + + +class Session(FSCollector): + Interrupted = Interrupted + + def __init__(self, config): + FSCollector.__init__(self, config.rootdir, parent=None, + config=config, session=self) + self.testsfailed = 0 + self.testscollected = 0 + self.shouldstop = False + self.trace = config.trace.root.get("collection") + self._norecursepatterns = config.getini("norecursedirs") + self.startdir = py.path.local() + self.config.pluginmanager.register(self, name="session") + + def _makeid(self): + return "" + + @hookimpl(tryfirst=True) + def pytest_collectstart(self): + if self.shouldstop: + raise self.Interrupted(self.shouldstop) + + @hookimpl(tryfirst=True) + def pytest_runtest_logreport(self, report): + if report.failed and not hasattr(report, 'wasxfail'): + self.testsfailed += 1 + maxfail = self.config.getvalue("maxfail") + if maxfail and self.testsfailed >= maxfail: + self.shouldstop = "stopping after %d failures" % ( + self.testsfailed) + pytest_collectreport = pytest_runtest_logreport + + def isinitpath(self, path): + return path in self._initialpaths + + def gethookproxy(self, fspath): + # check if we have the common case of running + # hooks with all conftest.py filesall conftest.py + pm = self.config.pluginmanager + my_conftestmodules = pm._getconftestmodules(fspath) + remove_mods = pm._conftest_plugins.difference(my_conftestmodules) + if remove_mods: + # one or more conftests are not in use at this fspath + proxy = FSHookProxy(fspath, pm, remove_mods) + else: + # all plugis are active for this fspath + proxy = self.config.hook + return proxy + + def perform_collect(self, args=None, genitems=True): + hook = self.config.hook + try: + items = self._perform_collect(args, genitems) + self.config.pluginmanager.check_pending() + hook.pytest_collection_modifyitems(session=self, + config=self.config, items=items) + finally: + hook.pytest_collection_finish(session=self) + self.testscollected = len(items) + return items + + def _perform_collect(self, args, genitems): + if args is None: + args = self.config.args + self.trace("perform_collect", self, args) + self.trace.root.indent += 1 + self._notfound = [] + self._initialpaths = set() + self._initialparts = [] + self.items = items = [] + for arg in args: + parts = self._parsearg(arg) + self._initialparts.append(parts) + self._initialpaths.add(parts[0]) + rep = collect_one_node(self) + self.ihook.pytest_collectreport(report=rep) + self.trace.root.indent -= 1 + if self._notfound: + errors = [] + for arg, exc in self._notfound: + line = "(no name %r in any of %r)" % (arg, exc.args[0]) + errors.append("not found: %s\n%s" % (arg, line)) + # XXX: test this + raise UsageError(*errors) + if not genitems: + return rep.result + else: + if rep.passed: + for node in rep.result: + self.items.extend(self.genitems(node)) + return items + + def collect(self): + for parts in self._initialparts: + arg = "::".join(map(str, parts)) + self.trace("processing argument", arg) + self.trace.root.indent += 1 + try: + for x in self._collect(arg): + yield x + except NoMatch: + # we are inside a make_report hook so + # we cannot directly pass through the exception + self._notfound.append((arg, sys.exc_info()[1])) + + self.trace.root.indent -= 1 + + def _collect(self, arg): + names = self._parsearg(arg) + path = names.pop(0) + if path.check(dir=1): + assert not names, "invalid arg %r" % (arg,) + for path in path.visit(fil=lambda x: x.check(file=1), + rec=self._recurse, bf=True, sort=True): + for x in self._collectfile(path): + yield x + else: + assert path.check(file=1) + for x in self.matchnodes(self._collectfile(path), names): + yield x + + def _collectfile(self, path): + ihook = self.gethookproxy(path) + if not self.isinitpath(path): + if ihook.pytest_ignore_collect(path=path, config=self.config): + return () + return ihook.pytest_collect_file(path=path, parent=self) + + def _recurse(self, path): + ihook = self.gethookproxy(path.dirpath()) + if ihook.pytest_ignore_collect(path=path, config=self.config): + return + for pat in self._norecursepatterns: + if path.check(fnmatch=pat): + return False + ihook = self.gethookproxy(path) + ihook.pytest_collect_directory(path=path, parent=self) + return True + + def _tryconvertpyarg(self, x): + """Convert a dotted module name to path. + + """ + import pkgutil + try: + loader = pkgutil.find_loader(x) + except ImportError: + return x + if loader is None: + return x + # This method is sometimes invoked when AssertionRewritingHook, which + # does not define a get_filename method, is already in place: + try: + path = loader.get_filename(x) + except AttributeError: + # Retrieve path from AssertionRewritingHook: + path = loader.modules[x][0].co_filename + if loader.is_package(x): + path = os.path.dirname(path) + return path + + def _parsearg(self, arg): + """ return (fspath, names) tuple after checking the file exists. """ + parts = str(arg).split("::") + if self.config.option.pyargs: + parts[0] = self._tryconvertpyarg(parts[0]) + relpath = parts[0].replace("/", os.sep) + path = self.config.invocation_dir.join(relpath, abs=True) + if not path.check(): + if self.config.option.pyargs: + raise UsageError( + "file or package not found: " + arg + + " (missing __init__.py?)") + else: + raise UsageError("file not found: " + arg) + parts[0] = path + return parts + + def matchnodes(self, matching, names): + self.trace("matchnodes", matching, names) + self.trace.root.indent += 1 + nodes = self._matchnodes(matching, names) + num = len(nodes) + self.trace("matchnodes finished -> ", num, "nodes") + self.trace.root.indent -= 1 + if num == 0: + raise NoMatch(matching, names[:1]) + return nodes + + def _matchnodes(self, matching, names): + if not matching or not names: + return matching + name = names[0] + assert name + nextnames = names[1:] + resultnodes = [] + for node in matching: + if isinstance(node, Item): + if not names: + resultnodes.append(node) + continue + assert isinstance(node, Collector) + rep = collect_one_node(node) + if rep.passed: + has_matched = False + for x in rep.result: + # TODO: remove parametrized workaround once collection structure contains parametrization + if x.name == name or x.name.split("[")[0] == name: + resultnodes.extend(self.matchnodes([x], nextnames)) + has_matched = True + # XXX accept IDs that don't have "()" for class instances + if not has_matched and len(rep.result) == 1 and x.name == "()": + nextnames.insert(0, name) + resultnodes.extend(self.matchnodes([x], nextnames)) + else: + # report collection failures here to avoid failing to run some test + # specified in the command line because the module could not be + # imported (#134) + node.ihook.pytest_collectreport(report=rep) + return resultnodes + + def genitems(self, node): + self.trace("genitems", node) + if isinstance(node, Item): + node.ihook.pytest_itemcollected(item=node) + yield node + else: + assert isinstance(node, Collector) + rep = collect_one_node(node) + if rep.passed: + for subnode in rep.result: + for x in self.genitems(subnode): + yield x + node.ihook.pytest_collectreport(report=rep) diff --git a/lib/spack/external/pytest-fallback/_pytest/mark.py b/lib/spack/external/pytest-fallback/_pytest/mark.py new file mode 100644 index 0000000000..454722ca2c --- /dev/null +++ b/lib/spack/external/pytest-fallback/_pytest/mark.py @@ -0,0 +1,465 @@ +""" generic mechanism for marking and selecting python functions. """ +from __future__ import absolute_import, division, print_function + +import inspect +import warnings +from collections import namedtuple +from operator import attrgetter +from .compat import imap +from .deprecated import MARK_PARAMETERSET_UNPACKING + + +def alias(name, warning=None): + getter = attrgetter(name) + + def warned(self): + warnings.warn(warning, stacklevel=2) + return getter(self) + + return property(getter if warning is None else warned, doc='alias for ' + name) + + +class ParameterSet(namedtuple('ParameterSet', 'values, marks, id')): + @classmethod + def param(cls, *values, **kw): + marks = kw.pop('marks', ()) + if isinstance(marks, MarkDecorator): + marks = marks, + else: + assert isinstance(marks, (tuple, list, set)) + + def param_extract_id(id=None): + return id + + id = param_extract_id(**kw) + return cls(values, marks, id) + + @classmethod + def extract_from(cls, parameterset, legacy_force_tuple=False): + """ + :param parameterset: + a legacy style parameterset that may or may not be a tuple, + and may or may not be wrapped into a mess of mark objects + + :param legacy_force_tuple: + enforce tuple wrapping so single argument tuple values + don't get decomposed and break tests + + """ + + if isinstance(parameterset, cls): + return parameterset + if not isinstance(parameterset, MarkDecorator) and legacy_force_tuple: + return cls.param(parameterset) + + newmarks = [] + argval = parameterset + while isinstance(argval, MarkDecorator): + newmarks.append(MarkDecorator(Mark( + argval.markname, argval.args[:-1], argval.kwargs))) + argval = argval.args[-1] + assert not isinstance(argval, ParameterSet) + if legacy_force_tuple: + argval = argval, + + if newmarks: + warnings.warn(MARK_PARAMETERSET_UNPACKING) + + return cls(argval, marks=newmarks, id=None) + + @property + def deprecated_arg_dict(self): + return dict((mark.name, mark) for mark in self.marks) + + +class MarkerError(Exception): + + """Error in use of a pytest marker/attribute.""" + + +def param(*values, **kw): + return ParameterSet.param(*values, **kw) + + +def pytest_addoption(parser): + group = parser.getgroup("general") + group._addoption( + '-k', + action="store", dest="keyword", default='', metavar="EXPRESSION", + help="only run tests which match the given substring expression. " + "An expression is a python evaluatable expression " + "where all names are substring-matched against test names " + "and their parent classes. Example: -k 'test_method or test_" + "other' matches all test functions and classes whose name " + "contains 'test_method' or 'test_other', while -k 'not test_method' " + "matches those that don't contain 'test_method' in their names. " + "Additionally keywords are matched to classes and functions " + "containing extra names in their 'extra_keyword_matches' set, " + "as well as functions which have names assigned directly to them." + ) + + group._addoption( + "-m", + action="store", dest="markexpr", default="", metavar="MARKEXPR", + help="only run tests matching given mark expression. " + "example: -m 'mark1 and not mark2'." + ) + + group.addoption( + "--markers", action="store_true", + help="show markers (builtin, plugin and per-project ones)." + ) + + parser.addini("markers", "markers for test functions", 'linelist') + + +def pytest_cmdline_main(config): + import _pytest.config + if config.option.markers: + config._do_configure() + tw = _pytest.config.create_terminal_writer(config) + for line in config.getini("markers"): + name, rest = line.split(":", 1) + tw.write("@pytest.mark.%s:" % name, bold=True) + tw.line(rest) + tw.line() + config._ensure_unconfigure() + return 0 + + +pytest_cmdline_main.tryfirst = True + + +def pytest_collection_modifyitems(items, config): + keywordexpr = config.option.keyword.lstrip() + matchexpr = config.option.markexpr + if not keywordexpr and not matchexpr: + return + # pytest used to allow "-" for negating + # but today we just allow "-" at the beginning, use "not" instead + # we probably remove "-" altogether soon + if keywordexpr.startswith("-"): + keywordexpr = "not " + keywordexpr[1:] + selectuntil = False + if keywordexpr[-1:] == ":": + selectuntil = True + keywordexpr = keywordexpr[:-1] + + remaining = [] + deselected = [] + for colitem in items: + if keywordexpr and not matchkeyword(colitem, keywordexpr): + deselected.append(colitem) + else: + if selectuntil: + keywordexpr = None + if matchexpr: + if not matchmark(colitem, matchexpr): + deselected.append(colitem) + continue + remaining.append(colitem) + + if deselected: + config.hook.pytest_deselected(items=deselected) + items[:] = remaining + + +class MarkMapping: + """Provides a local mapping for markers where item access + resolves to True if the marker is present. """ + + def __init__(self, keywords): + mymarks = set() + for key, value in keywords.items(): + if isinstance(value, MarkInfo) or isinstance(value, MarkDecorator): + mymarks.add(key) + self._mymarks = mymarks + + def __getitem__(self, name): + return name in self._mymarks + + +class KeywordMapping: + """Provides a local mapping for keywords. + Given a list of names, map any substring of one of these names to True. + """ + + def __init__(self, names): + self._names = names + + def __getitem__(self, subname): + for name in self._names: + if subname in name: + return True + return False + + +def matchmark(colitem, markexpr): + """Tries to match on any marker names, attached to the given colitem.""" + return eval(markexpr, {}, MarkMapping(colitem.keywords)) + + +def matchkeyword(colitem, keywordexpr): + """Tries to match given keyword expression to given collector item. + + Will match on the name of colitem, including the names of its parents. + Only matches names of items which are either a :class:`Class` or a + :class:`Function`. + Additionally, matches on names in the 'extra_keyword_matches' set of + any item, as well as names directly assigned to test functions. + """ + mapped_names = set() + + # Add the names of the current item and any parent items + import pytest + for item in colitem.listchain(): + if not isinstance(item, pytest.Instance): + mapped_names.add(item.name) + + # Add the names added as extra keywords to current or parent items + for name in colitem.listextrakeywords(): + mapped_names.add(name) + + # Add the names attached to the current function through direct assignment + if hasattr(colitem, 'function'): + for name in colitem.function.__dict__: + mapped_names.add(name) + + mapping = KeywordMapping(mapped_names) + if " " not in keywordexpr: + # special case to allow for simple "-k pass" and "-k 1.3" + return mapping[keywordexpr] + elif keywordexpr.startswith("not ") and " " not in keywordexpr[4:]: + return not mapping[keywordexpr[4:]] + return eval(keywordexpr, {}, mapping) + + +def pytest_configure(config): + config._old_mark_config = MARK_GEN._config + if config.option.strict: + MARK_GEN._config = config + + +def pytest_unconfigure(config): + MARK_GEN._config = getattr(config, '_old_mark_config', None) + + +class MarkGenerator: + """ Factory for :class:`MarkDecorator` objects - exposed as + a ``pytest.mark`` singleton instance. Example:: + + import pytest + @pytest.mark.slowtest + def test_function(): + pass + + will set a 'slowtest' :class:`MarkInfo` object + on the ``test_function`` object. """ + _config = None + + def __getattr__(self, name): + if name[0] == "_": + raise AttributeError("Marker name must NOT start with underscore") + if self._config is not None: + self._check(name) + return MarkDecorator(Mark(name, (), {})) + + def _check(self, name): + try: + if name in self._markers: + return + except AttributeError: + pass + self._markers = values = set() + for line in self._config.getini("markers"): + marker, _ = line.split(":", 1) + marker = marker.rstrip() + x = marker.split("(", 1)[0] + values.add(x) + if name not in self._markers: + raise AttributeError("%r not a registered marker" % (name,)) + + +def istestfunc(func): + return hasattr(func, "__call__") and \ + getattr(func, "__name__", "") != "" + + +class MarkDecorator: + """ A decorator for test functions and test classes. When applied + it will create :class:`MarkInfo` objects which may be + :ref:`retrieved by hooks as item keywords `. + MarkDecorator instances are often created like this:: + + mark1 = pytest.mark.NAME # simple MarkDecorator + mark2 = pytest.mark.NAME(name1=value) # parametrized MarkDecorator + + and can then be applied as decorators to test functions:: + + @mark2 + def test_function(): + pass + + When a MarkDecorator instance is called it does the following: + 1. If called with a single class as its only positional argument and no + additional keyword arguments, it attaches itself to the class so it + gets applied automatically to all test cases found in that class. + 2. If called with a single function as its only positional argument and + no additional keyword arguments, it attaches a MarkInfo object to the + function, containing all the arguments already stored internally in + the MarkDecorator. + 3. When called in any other case, it performs a 'fake construction' call, + i.e. it returns a new MarkDecorator instance with the original + MarkDecorator's content updated with the arguments passed to this + call. + + Note: The rules above prevent MarkDecorator objects from storing only a + single function or class reference as their positional argument with no + additional keyword or positional arguments. + + """ + + def __init__(self, mark): + assert isinstance(mark, Mark), repr(mark) + self.mark = mark + + name = alias('mark.name') + args = alias('mark.args') + kwargs = alias('mark.kwargs') + + @property + def markname(self): + return self.name # for backward-compat (2.4.1 had this attr) + + def __eq__(self, other): + return self.mark == other.mark if isinstance(other, MarkDecorator) else False + + def __repr__(self): + return "" % (self.mark,) + + def with_args(self, *args, **kwargs): + """ return a MarkDecorator with extra arguments added + + unlike call this can be used even if the sole argument is a callable/class + + :return: MarkDecorator + """ + + mark = Mark(self.name, args, kwargs) + return self.__class__(self.mark.combined_with(mark)) + + def __call__(self, *args, **kwargs): + """ if passed a single callable argument: decorate it with mark info. + otherwise add *args/**kwargs in-place to mark information. """ + if args and not kwargs: + func = args[0] + is_class = inspect.isclass(func) + if len(args) == 1 and (istestfunc(func) or is_class): + if is_class: + store_mark(func, self.mark) + else: + store_legacy_markinfo(func, self.mark) + store_mark(func, self.mark) + return func + return self.with_args(*args, **kwargs) + + +def get_unpacked_marks(obj): + """ + obtain the unpacked marks that are stored on a object + """ + mark_list = getattr(obj, 'pytestmark', []) + + if not isinstance(mark_list, list): + mark_list = [mark_list] + return [ + getattr(mark, 'mark', mark) # unpack MarkDecorator + for mark in mark_list + ] + + +def store_mark(obj, mark): + """store a Mark on a object + this is used to implement the Mark declarations/decorators correctly + """ + assert isinstance(mark, Mark), mark + # always reassign name to avoid updating pytestmark + # in a reference that was only borrowed + obj.pytestmark = get_unpacked_marks(obj) + [mark] + + +def store_legacy_markinfo(func, mark): + """create the legacy MarkInfo objects and put them onto the function + """ + if not isinstance(mark, Mark): + raise TypeError("got {mark!r} instead of a Mark".format(mark=mark)) + holder = getattr(func, mark.name, None) + if holder is None: + holder = MarkInfo(mark) + setattr(func, mark.name, holder) + else: + holder.add_mark(mark) + + +class Mark(namedtuple('Mark', 'name, args, kwargs')): + + def combined_with(self, other): + assert self.name == other.name + return Mark( + self.name, self.args + other.args, + dict(self.kwargs, **other.kwargs)) + + +class MarkInfo(object): + """ Marking object created by :class:`MarkDecorator` instances. """ + + def __init__(self, mark): + assert isinstance(mark, Mark), repr(mark) + self.combined = mark + self._marks = [mark] + + name = alias('combined.name') + args = alias('combined.args') + kwargs = alias('combined.kwargs') + + def __repr__(self): + return "".format(self.combined) + + def add_mark(self, mark): + """ add a MarkInfo with the given args and kwargs. """ + self._marks.append(mark) + self.combined = self.combined.combined_with(mark) + + def __iter__(self): + """ yield MarkInfo objects each relating to a marking-call. """ + return imap(MarkInfo, self._marks) + + +MARK_GEN = MarkGenerator() + + +def _marked(func, mark): + """ Returns True if :func: is already marked with :mark:, False otherwise. + This can happen if marker is applied to class and the test file is + invoked more than once. + """ + try: + func_mark = getattr(func, mark.name) + except AttributeError: + return False + return mark.args == func_mark.args and mark.kwargs == func_mark.kwargs + + +def transfer_markers(funcobj, cls, mod): + """ + this function transfers class level markers and module level markers + into function level markinfo objects + + this is the main reason why marks are so broken + the resolution will involve phasing out function level MarkInfo objects + + """ + for obj in (cls, mod): + for mark in get_unpacked_marks(obj): + if not _marked(funcobj, mark): + store_legacy_markinfo(funcobj, mark) diff --git a/lib/spack/external/pytest-fallback/_pytest/monkeypatch.py b/lib/spack/external/pytest-fallback/_pytest/monkeypatch.py new file mode 100644 index 0000000000..39ac770135 --- /dev/null +++ b/lib/spack/external/pytest-fallback/_pytest/monkeypatch.py @@ -0,0 +1,259 @@ +""" monkeypatching and mocking functionality. """ +from __future__ import absolute_import, division, print_function + +import os +import sys +import re + +from py.builtin import _basestring +from _pytest.fixtures import fixture + +RE_IMPORT_ERROR_NAME = re.compile("^No module named (.*)$") + + +@fixture +def monkeypatch(): + """The returned ``monkeypatch`` fixture provides these + helper methods to modify objects, dictionaries or os.environ:: + + monkeypatch.setattr(obj, name, value, raising=True) + monkeypatch.delattr(obj, name, raising=True) + monkeypatch.setitem(mapping, name, value) + monkeypatch.delitem(obj, name, raising=True) + monkeypatch.setenv(name, value, prepend=False) + monkeypatch.delenv(name, value, raising=True) + monkeypatch.syspath_prepend(path) + monkeypatch.chdir(path) + + All modifications will be undone after the requesting + test function or fixture has finished. The ``raising`` + parameter determines if a KeyError or AttributeError + will be raised if the set/deletion operation has no target. + """ + mpatch = MonkeyPatch() + yield mpatch + mpatch.undo() + + +def resolve(name): + # simplified from zope.dottedname + parts = name.split('.') + + used = parts.pop(0) + found = __import__(used) + for part in parts: + used += '.' + part + try: + found = getattr(found, part) + except AttributeError: + pass + else: + continue + # we use explicit un-nesting of the handling block in order + # to avoid nested exceptions on python 3 + try: + __import__(used) + except ImportError as ex: + # str is used for py2 vs py3 + expected = str(ex).split()[-1] + if expected == used: + raise + else: + raise ImportError( + 'import error in %s: %s' % (used, ex) + ) + found = annotated_getattr(found, part, used) + return found + + +def annotated_getattr(obj, name, ann): + try: + obj = getattr(obj, name) + except AttributeError: + raise AttributeError( + '%r object at %s has no attribute %r' % ( + type(obj).__name__, ann, name + ) + ) + return obj + + +def derive_importpath(import_path, raising): + if not isinstance(import_path, _basestring) or "." not in import_path: + raise TypeError("must be absolute import path string, not %r" % + (import_path,)) + module, attr = import_path.rsplit('.', 1) + target = resolve(module) + if raising: + annotated_getattr(target, attr, ann=module) + return attr, target + + +class Notset: + def __repr__(self): + return "" + + +notset = Notset() + + +class MonkeyPatch: + """ Object returned by the ``monkeypatch`` fixture keeping a record of setattr/item/env/syspath changes. + """ + + def __init__(self): + self._setattr = [] + self._setitem = [] + self._cwd = None + self._savesyspath = None + + def setattr(self, target, name, value=notset, raising=True): + """ Set attribute value on target, memorizing the old value. + By default raise AttributeError if the attribute did not exist. + + For convenience you can specify a string as ``target`` which + will be interpreted as a dotted import path, with the last part + being the attribute name. Example: + ``monkeypatch.setattr("os.getcwd", lambda x: "/")`` + would set the ``getcwd`` function of the ``os`` module. + + The ``raising`` value determines if the setattr should fail + if the attribute is not already present (defaults to True + which means it will raise). + """ + __tracebackhide__ = True + import inspect + + if value is notset: + if not isinstance(target, _basestring): + raise TypeError("use setattr(target, name, value) or " + "setattr(target, value) with target being a dotted " + "import string") + value = name + name, target = derive_importpath(target, raising) + + oldval = getattr(target, name, notset) + if raising and oldval is notset: + raise AttributeError("%r has no attribute %r" % (target, name)) + + # avoid class descriptors like staticmethod/classmethod + if inspect.isclass(target): + oldval = target.__dict__.get(name, notset) + self._setattr.append((target, name, oldval)) + setattr(target, name, value) + + def delattr(self, target, name=notset, raising=True): + """ Delete attribute ``name`` from ``target``, by default raise + AttributeError it the attribute did not previously exist. + + If no ``name`` is specified and ``target`` is a string + it will be interpreted as a dotted import path with the + last part being the attribute name. + + If ``raising`` is set to False, no exception will be raised if the + attribute is missing. + """ + __tracebackhide__ = True + if name is notset: + if not isinstance(target, _basestring): + raise TypeError("use delattr(target, name) or " + "delattr(target) with target being a dotted " + "import string") + name, target = derive_importpath(target, raising) + + if not hasattr(target, name): + if raising: + raise AttributeError(name) + else: + self._setattr.append((target, name, getattr(target, name, notset))) + delattr(target, name) + + def setitem(self, dic, name, value): + """ Set dictionary entry ``name`` to value. """ + self._setitem.append((dic, name, dic.get(name, notset))) + dic[name] = value + + def delitem(self, dic, name, raising=True): + """ Delete ``name`` from dict. Raise KeyError if it doesn't exist. + + If ``raising`` is set to False, no exception will be raised if the + key is missing. + """ + if name not in dic: + if raising: + raise KeyError(name) + else: + self._setitem.append((dic, name, dic.get(name, notset))) + del dic[name] + + def setenv(self, name, value, prepend=None): + """ Set environment variable ``name`` to ``value``. If ``prepend`` + is a character, read the current environment variable value + and prepend the ``value`` adjoined with the ``prepend`` character.""" + value = str(value) + if prepend and name in os.environ: + value = value + prepend + os.environ[name] + self.setitem(os.environ, name, value) + + def delenv(self, name, raising=True): + """ Delete ``name`` from the environment. Raise KeyError it does not + exist. + + If ``raising`` is set to False, no exception will be raised if the + environment variable is missing. + """ + self.delitem(os.environ, name, raising=raising) + + def syspath_prepend(self, path): + """ Prepend ``path`` to ``sys.path`` list of import locations. """ + if self._savesyspath is None: + self._savesyspath = sys.path[:] + sys.path.insert(0, str(path)) + + def chdir(self, path): + """ Change the current working directory to the specified path. + Path can be a string or a py.path.local object. + """ + if self._cwd is None: + self._cwd = os.getcwd() + if hasattr(path, "chdir"): + path.chdir() + else: + os.chdir(path) + + def undo(self): + """ Undo previous changes. This call consumes the + undo stack. Calling it a second time has no effect unless + you do more monkeypatching after the undo call. + + There is generally no need to call `undo()`, since it is + called automatically during tear-down. + + Note that the same `monkeypatch` fixture is used across a + single test function invocation. If `monkeypatch` is used both by + the test function itself and one of the test fixtures, + calling `undo()` will undo all of the changes made in + both functions. + """ + for obj, name, value in reversed(self._setattr): + if value is not notset: + setattr(obj, name, value) + else: + delattr(obj, name) + self._setattr[:] = [] + for dictionary, name, value in reversed(self._setitem): + if value is notset: + try: + del dictionary[name] + except KeyError: + pass # was already deleted, so we have the desired state + else: + dictionary[name] = value + self._setitem[:] = [] + if self._savesyspath is not None: + sys.path[:] = self._savesyspath + self._savesyspath = None + + if self._cwd is not None: + os.chdir(self._cwd) + self._cwd = None diff --git a/lib/spack/external/pytest-fallback/_pytest/nodes.py b/lib/spack/external/pytest-fallback/_pytest/nodes.py new file mode 100644 index 0000000000..ad3af2ce67 --- /dev/null +++ b/lib/spack/external/pytest-fallback/_pytest/nodes.py @@ -0,0 +1,37 @@ +SEP = "/" + + +def _splitnode(nodeid): + """Split a nodeid into constituent 'parts'. + + Node IDs are strings, and can be things like: + '' + 'testing/code' + 'testing/code/test_excinfo.py' + 'testing/code/test_excinfo.py::TestFormattedExcinfo::()' + + Return values are lists e.g. + [] + ['testing', 'code'] + ['testing', 'code', 'test_excinfo.py'] + ['testing', 'code', 'test_excinfo.py', 'TestFormattedExcinfo', '()'] + """ + if nodeid == '': + # If there is no root node at all, return an empty list so the caller's logic can remain sane + return [] + parts = nodeid.split(SEP) + # Replace single last element 'test_foo.py::Bar::()' with multiple elements 'test_foo.py', 'Bar', '()' + parts[-1:] = parts[-1].split("::") + return parts + + +def ischildnode(baseid, nodeid): + """Return True if the nodeid is a child node of the baseid. + + E.g. 'foo/bar::Baz::()' is a child of 'foo', 'foo/bar' and 'foo/bar::Baz', but not of 'foo/blorp' + """ + base_parts = _splitnode(baseid) + node_parts = _splitnode(nodeid) + if len(node_parts) < len(base_parts): + return False + return node_parts[:len(base_parts)] == base_parts diff --git a/lib/spack/external/pytest-fallback/_pytest/nose.py b/lib/spack/external/pytest-fallback/_pytest/nose.py new file mode 100644 index 0000000000..d246c5603d --- /dev/null +++ b/lib/spack/external/pytest-fallback/_pytest/nose.py @@ -0,0 +1,73 @@ +""" run test suites written for nose. """ +from __future__ import absolute_import, division, print_function + +import sys + +import py +from _pytest import unittest, runner, python +from _pytest.config import hookimpl + + +def get_skip_exceptions(): + skip_classes = set() + for module_name in ('unittest', 'unittest2', 'nose'): + mod = sys.modules.get(module_name) + if hasattr(mod, 'SkipTest'): + skip_classes.add(mod.SkipTest) + return tuple(skip_classes) + + +def pytest_runtest_makereport(item, call): + if call.excinfo and call.excinfo.errisinstance(get_skip_exceptions()): + # let's substitute the excinfo with a pytest.skip one + call2 = call.__class__( + lambda: runner.skip(str(call.excinfo.value)), call.when) + call.excinfo = call2.excinfo + + +@hookimpl(trylast=True) +def pytest_runtest_setup(item): + if is_potential_nosetest(item): + if isinstance(item.parent, python.Generator): + gen = item.parent + if not hasattr(gen, '_nosegensetup'): + call_optional(gen.obj, 'setup') + if isinstance(gen.parent, python.Instance): + call_optional(gen.parent.obj, 'setup') + gen._nosegensetup = True + if not call_optional(item.obj, 'setup'): + # call module level setup if there is no object level one + call_optional(item.parent.obj, 'setup') + # XXX this implies we only call teardown when setup worked + item.session._setupstate.addfinalizer((lambda: teardown_nose(item)), item) + + +def teardown_nose(item): + if is_potential_nosetest(item): + if not call_optional(item.obj, 'teardown'): + call_optional(item.parent.obj, 'teardown') + # if hasattr(item.parent, '_nosegensetup'): + # #call_optional(item._nosegensetup, 'teardown') + # del item.parent._nosegensetup + + +def pytest_make_collect_report(collector): + if isinstance(collector, python.Generator): + call_optional(collector.obj, 'setup') + + +def is_potential_nosetest(item): + # extra check needed since we do not do nose style setup/teardown + # on direct unittest style classes + return isinstance(item, python.Function) and \ + not isinstance(item, unittest.TestCaseFunction) + + +def call_optional(obj, name): + method = getattr(obj, name, None) + isfixture = hasattr(method, "_pytestfixturefunction") + if method is not None and not isfixture and py.builtin.callable(method): + # If there's any problems allow the exception to raise rather than + # silently ignoring them + method() + return True diff --git a/lib/spack/external/pytest-fallback/_pytest/outcomes.py b/lib/spack/external/pytest-fallback/_pytest/outcomes.py new file mode 100644 index 0000000000..ff5ef756d9 --- /dev/null +++ b/lib/spack/external/pytest-fallback/_pytest/outcomes.py @@ -0,0 +1,140 @@ +""" +exception classes and constants handling test outcomes +as well as functions creating them +""" +from __future__ import absolute_import, division, print_function +import py +import sys + + +class OutcomeException(BaseException): + """ OutcomeException and its subclass instances indicate and + contain info about test and collection outcomes. + """ + def __init__(self, msg=None, pytrace=True): + BaseException.__init__(self, msg) + self.msg = msg + self.pytrace = pytrace + + def __repr__(self): + if self.msg: + val = self.msg + if isinstance(val, bytes): + val = py._builtin._totext(val, errors='replace') + return val + return "<%s instance>" % (self.__class__.__name__,) + __str__ = __repr__ + + +TEST_OUTCOME = (OutcomeException, Exception) + + +class Skipped(OutcomeException): + # XXX hackish: on 3k we fake to live in the builtins + # in order to have Skipped exception printing shorter/nicer + __module__ = 'builtins' + + def __init__(self, msg=None, pytrace=True, allow_module_level=False): + OutcomeException.__init__(self, msg=msg, pytrace=pytrace) + self.allow_module_level = allow_module_level + + +class Failed(OutcomeException): + """ raised from an explicit call to pytest.fail() """ + __module__ = 'builtins' + + +class Exit(KeyboardInterrupt): + """ raised for immediate program exits (no tracebacks/summaries)""" + def __init__(self, msg="unknown reason"): + self.msg = msg + KeyboardInterrupt.__init__(self, msg) + +# exposed helper methods + + +def exit(msg): + """ exit testing process as if KeyboardInterrupt was triggered. """ + __tracebackhide__ = True + raise Exit(msg) + + +exit.Exception = Exit + + +def skip(msg=""): + """ skip an executing test with the given message. Note: it's usually + better to use the pytest.mark.skipif marker to declare a test to be + skipped under certain conditions like mismatching platforms or + dependencies. See the pytest_skipping plugin for details. + """ + __tracebackhide__ = True + raise Skipped(msg=msg) + + +skip.Exception = Skipped + + +def fail(msg="", pytrace=True): + """ explicitly fail an currently-executing test with the given Message. + + :arg pytrace: if false the msg represents the full failure information + and no python traceback will be reported. + """ + __tracebackhide__ = True + raise Failed(msg=msg, pytrace=pytrace) + + +fail.Exception = Failed + + +class XFailed(fail.Exception): + """ raised from an explicit call to pytest.xfail() """ + + +def xfail(reason=""): + """ xfail an executing test or setup functions with the given reason.""" + __tracebackhide__ = True + raise XFailed(reason) + + +xfail.Exception = XFailed + + +def importorskip(modname, minversion=None): + """ return imported module if it has at least "minversion" as its + __version__ attribute. If no minversion is specified the a skip + is only triggered if the module can not be imported. + """ + import warnings + __tracebackhide__ = True + compile(modname, '', 'eval') # to catch syntaxerrors + should_skip = False + + with warnings.catch_warnings(): + # make sure to ignore ImportWarnings that might happen because + # of existing directories with the same name we're trying to + # import but without a __init__.py file + warnings.simplefilter('ignore') + try: + __import__(modname) + except ImportError: + # Do not raise chained exception here(#1485) + should_skip = True + if should_skip: + raise Skipped("could not import %r" % (modname,), allow_module_level=True) + mod = sys.modules[modname] + if minversion is None: + return mod + verattr = getattr(mod, '__version__', None) + if minversion is not None: + try: + from pkg_resources import parse_version as pv + except ImportError: + raise Skipped("we have a required version for %r but can not import " + "pkg_resources to parse version strings." % (modname,), + allow_module_level=True) + if verattr is None or pv(verattr) < pv(minversion): + raise Skipped("module %r has __version__ %r, required is: %r" % ( + modname, verattr, minversion), allow_module_level=True) + return mod diff --git a/lib/spack/external/pytest-fallback/_pytest/pastebin.py b/lib/spack/external/pytest-fallback/_pytest/pastebin.py new file mode 100644 index 0000000000..9d689819f0 --- /dev/null +++ b/lib/spack/external/pytest-fallback/_pytest/pastebin.py @@ -0,0 +1,100 @@ +""" submit failure or test session information to a pastebin service. """ +from __future__ import absolute_import, division, print_function + +import pytest +import sys +import tempfile + + +def pytest_addoption(parser): + group = parser.getgroup("terminal reporting") + group._addoption('--pastebin', metavar="mode", + action='store', dest="pastebin", default=None, + choices=['failed', 'all'], + help="send failed|all info to bpaste.net pastebin service.") + + +@pytest.hookimpl(trylast=True) +def pytest_configure(config): + import py + if config.option.pastebin == "all": + tr = config.pluginmanager.getplugin('terminalreporter') + # if no terminal reporter plugin is present, nothing we can do here; + # this can happen when this function executes in a slave node + # when using pytest-xdist, for example + if tr is not None: + # pastebin file will be utf-8 encoded binary file + config._pastebinfile = tempfile.TemporaryFile('w+b') + oldwrite = tr._tw.write + + def tee_write(s, **kwargs): + oldwrite(s, **kwargs) + if py.builtin._istext(s): + s = s.encode('utf-8') + config._pastebinfile.write(s) + + tr._tw.write = tee_write + + +def pytest_unconfigure(config): + if hasattr(config, '_pastebinfile'): + # get terminal contents and delete file + config._pastebinfile.seek(0) + sessionlog = config._pastebinfile.read() + config._pastebinfile.close() + del config._pastebinfile + # undo our patching in the terminal reporter + tr = config.pluginmanager.getplugin('terminalreporter') + del tr._tw.__dict__['write'] + # write summary + tr.write_sep("=", "Sending information to Paste Service") + pastebinurl = create_new_paste(sessionlog) + tr.write_line("pastebin session-log: %s\n" % pastebinurl) + + +def create_new_paste(contents): + """ + Creates a new paste using bpaste.net service. + + :contents: paste contents as utf-8 encoded bytes + :returns: url to the pasted contents + """ + import re + if sys.version_info < (3, 0): + from urllib import urlopen, urlencode + else: + from urllib.request import urlopen + from urllib.parse import urlencode + + params = { + 'code': contents, + 'lexer': 'python3' if sys.version_info[0] == 3 else 'python', + 'expiry': '1week', + } + url = 'https://bpaste.net' + response = urlopen(url, data=urlencode(params).encode('ascii')).read() + m = re.search(r'href="/raw/(\w+)"', response.decode('utf-8')) + if m: + return '%s/show/%s' % (url, m.group(1)) + else: + return 'bad response: ' + response + + +def pytest_terminal_summary(terminalreporter): + import _pytest.config + if terminalreporter.config.option.pastebin != "failed": + return + tr = terminalreporter + if 'failed' in tr.stats: + terminalreporter.write_sep("=", "Sending information to Paste Service") + for rep in terminalreporter.stats.get('failed'): + try: + msg = rep.longrepr.reprtraceback.reprentries[-1].reprfileloc + except AttributeError: + msg = tr._getfailureheadline(rep) + tw = _pytest.config.create_terminal_writer(terminalreporter.config, stringio=True) + rep.toterminal(tw) + s = tw.stringio.getvalue() + assert len(s) + pastebinurl = create_new_paste(s) + tr.write_line("%s --> %s" % (msg, pastebinurl)) diff --git a/lib/spack/external/pytest-fallback/_pytest/pytester.py b/lib/spack/external/pytest-fallback/_pytest/pytester.py new file mode 100644 index 0000000000..82aa00e0d2 --- /dev/null +++ b/lib/spack/external/pytest-fallback/_pytest/pytester.py @@ -0,0 +1,1167 @@ +""" (disabled by default) support for testing pytest and pytest plugins. """ +from __future__ import absolute_import, division, print_function + +import codecs +import gc +import os +import platform +import re +import subprocess +import sys +import time +import traceback +from fnmatch import fnmatch + +from weakref import WeakKeyDictionary + +from _pytest.capture import MultiCapture, SysCapture +from _pytest._code import Source +import py +import pytest +from _pytest.main import Session, EXIT_OK +from _pytest.assertion.rewrite import AssertionRewritingHook + + +def pytest_addoption(parser): + # group = parser.getgroup("pytester", "pytester (self-tests) options") + parser.addoption('--lsof', + action="store_true", dest="lsof", default=False, + help=("run FD checks if lsof is available")) + + parser.addoption('--runpytest', default="inprocess", dest="runpytest", + choices=("inprocess", "subprocess", ), + help=("run pytest sub runs in tests using an 'inprocess' " + "or 'subprocess' (python -m main) method")) + + +def pytest_configure(config): + # This might be called multiple times. Only take the first. + global _pytest_fullpath + try: + _pytest_fullpath + except NameError: + _pytest_fullpath = os.path.abspath(pytest.__file__.rstrip("oc")) + _pytest_fullpath = _pytest_fullpath.replace("$py.class", ".py") + + if config.getvalue("lsof"): + checker = LsofFdLeakChecker() + if checker.matching_platform(): + config.pluginmanager.register(checker) + + +class LsofFdLeakChecker(object): + def get_open_files(self): + out = self._exec_lsof() + open_files = self._parse_lsof_output(out) + return open_files + + def _exec_lsof(self): + pid = os.getpid() + return py.process.cmdexec("lsof -Ffn0 -p %d" % pid) + + def _parse_lsof_output(self, out): + def isopen(line): + return line.startswith('f') and ("deleted" not in line and + 'mem' not in line and "txt" not in line and 'cwd' not in line) + + open_files = [] + + for line in out.split("\n"): + if isopen(line): + fields = line.split('\0') + fd = fields[0][1:] + filename = fields[1][1:] + if filename.startswith('/'): + open_files.append((fd, filename)) + + return open_files + + def matching_platform(self): + try: + py.process.cmdexec("lsof -v") + except (py.process.cmdexec.Error, UnicodeDecodeError): + # cmdexec may raise UnicodeDecodeError on Windows systems + # with locale other than english: + # https://bitbucket.org/pytest-dev/py/issues/66 + return False + else: + return True + + @pytest.hookimpl(hookwrapper=True, tryfirst=True) + def pytest_runtest_protocol(self, item): + lines1 = self.get_open_files() + yield + if hasattr(sys, "pypy_version_info"): + gc.collect() + lines2 = self.get_open_files() + + new_fds = set([t[0] for t in lines2]) - set([t[0] for t in lines1]) + leaked_files = [t for t in lines2 if t[0] in new_fds] + if leaked_files: + error = [] + error.append("***** %s FD leakage detected" % len(leaked_files)) + error.extend([str(f) for f in leaked_files]) + error.append("*** Before:") + error.extend([str(f) for f in lines1]) + error.append("*** After:") + error.extend([str(f) for f in lines2]) + error.append(error[0]) + error.append("*** function %s:%s: %s " % item.location) + error.append("See issue #2366") + item.warn('', "\n".join(error)) + + +# XXX copied from execnet's conftest.py - needs to be merged +winpymap = { + 'python2.7': r'C:\Python27\python.exe', + 'python2.6': r'C:\Python26\python.exe', + 'python3.1': r'C:\Python31\python.exe', + 'python3.2': r'C:\Python32\python.exe', + 'python3.3': r'C:\Python33\python.exe', + 'python3.4': r'C:\Python34\python.exe', + 'python3.5': r'C:\Python35\python.exe', +} + + +def getexecutable(name, cache={}): + try: + return cache[name] + except KeyError: + executable = py.path.local.sysfind(name) + if executable: + import subprocess + popen = subprocess.Popen([str(executable), "--version"], + universal_newlines=True, stderr=subprocess.PIPE) + out, err = popen.communicate() + if name == "jython": + if not err or "2.5" not in err: + executable = None + if "2.5.2" in err: + executable = None # http://bugs.jython.org/issue1790 + elif popen.returncode != 0: + # Handle pyenv's 127. + executable = None + cache[name] = executable + return executable + + +@pytest.fixture(params=['python2.6', 'python2.7', 'python3.3', "python3.4", + 'pypy', 'pypy3']) +def anypython(request): + name = request.param + executable = getexecutable(name) + if executable is None: + if sys.platform == "win32": + executable = winpymap.get(name, None) + if executable: + executable = py.path.local(executable) + if executable.check(): + return executable + pytest.skip("no suitable %s found" % (name,)) + return executable + +# used at least by pytest-xdist plugin + + +@pytest.fixture +def _pytest(request): + """ Return a helper which offers a gethookrecorder(hook) + method which returns a HookRecorder instance which helps + to make assertions about called hooks. + """ + return PytestArg(request) + + +class PytestArg: + def __init__(self, request): + self.request = request + + def gethookrecorder(self, hook): + hookrecorder = HookRecorder(hook._pm) + self.request.addfinalizer(hookrecorder.finish_recording) + return hookrecorder + + +def get_public_names(values): + """Only return names from iterator values without a leading underscore.""" + return [x for x in values if x[0] != "_"] + + +class ParsedCall: + def __init__(self, name, kwargs): + self.__dict__.update(kwargs) + self._name = name + + def __repr__(self): + d = self.__dict__.copy() + del d['_name'] + return "" % (self._name, d) + + +class HookRecorder: + """Record all hooks called in a plugin manager. + + This wraps all the hook calls in the plugin manager, recording + each call before propagating the normal calls. + + """ + + def __init__(self, pluginmanager): + self._pluginmanager = pluginmanager + self.calls = [] + + def before(hook_name, hook_impls, kwargs): + self.calls.append(ParsedCall(hook_name, kwargs)) + + def after(outcome, hook_name, hook_impls, kwargs): + pass + + self._undo_wrapping = pluginmanager.add_hookcall_monitoring(before, after) + + def finish_recording(self): + self._undo_wrapping() + + def getcalls(self, names): + if isinstance(names, str): + names = names.split() + return [call for call in self.calls if call._name in names] + + def assert_contains(self, entries): + __tracebackhide__ = True + i = 0 + entries = list(entries) + backlocals = sys._getframe(1).f_locals + while entries: + name, check = entries.pop(0) + for ind, call in enumerate(self.calls[i:]): + if call._name == name: + print("NAMEMATCH", name, call) + if eval(check, backlocals, call.__dict__): + print("CHECKERMATCH", repr(check), "->", call) + else: + print("NOCHECKERMATCH", repr(check), "-", call) + continue + i += ind + 1 + break + print("NONAMEMATCH", name, "with", call) + else: + pytest.fail("could not find %r check %r" % (name, check)) + + def popcall(self, name): + __tracebackhide__ = True + for i, call in enumerate(self.calls): + if call._name == name: + del self.calls[i] + return call + lines = ["could not find call %r, in:" % (name,)] + lines.extend([" %s" % str(x) for x in self.calls]) + pytest.fail("\n".join(lines)) + + def getcall(self, name): + values = self.getcalls(name) + assert len(values) == 1, (name, values) + return values[0] + + # functionality for test reports + + def getreports(self, + names="pytest_runtest_logreport pytest_collectreport"): + return [x.report for x in self.getcalls(names)] + + def matchreport(self, inamepart="", + names="pytest_runtest_logreport pytest_collectreport", when=None): + """ return a testreport whose dotted import path matches """ + values = [] + for rep in self.getreports(names=names): + try: + if not when and rep.when != "call" and rep.passed: + # setup/teardown passing reports - let's ignore those + continue + except AttributeError: + pass + if when and getattr(rep, 'when', None) != when: + continue + if not inamepart or inamepart in rep.nodeid.split("::"): + values.append(rep) + if not values: + raise ValueError("could not find test report matching %r: " + "no test reports at all!" % (inamepart,)) + if len(values) > 1: + raise ValueError( + "found 2 or more testreports matching %r: %s" % (inamepart, values)) + return values[0] + + def getfailures(self, + names='pytest_runtest_logreport pytest_collectreport'): + return [rep for rep in self.getreports(names) if rep.failed] + + def getfailedcollections(self): + return self.getfailures('pytest_collectreport') + + def listoutcomes(self): + passed = [] + skipped = [] + failed = [] + for rep in self.getreports( + "pytest_collectreport pytest_runtest_logreport"): + if rep.passed: + if getattr(rep, "when", None) == "call": + passed.append(rep) + elif rep.skipped: + skipped.append(rep) + elif rep.failed: + failed.append(rep) + return passed, skipped, failed + + def countoutcomes(self): + return [len(x) for x in self.listoutcomes()] + + def assertoutcome(self, passed=0, skipped=0, failed=0): + realpassed, realskipped, realfailed = self.listoutcomes() + assert passed == len(realpassed) + assert skipped == len(realskipped) + assert failed == len(realfailed) + + def clear(self): + self.calls[:] = [] + + +@pytest.fixture +def linecomp(request): + return LineComp() + + +@pytest.fixture(name='LineMatcher') +def LineMatcher_fixture(request): + return LineMatcher + + +@pytest.fixture +def testdir(request, tmpdir_factory): + return Testdir(request, tmpdir_factory) + + +rex_outcome = re.compile(r"(\d+) ([\w-]+)") + + +class RunResult: + """The result of running a command. + + Attributes: + + :ret: The return value. + :outlines: List of lines captured from stdout. + :errlines: List of lines captures from stderr. + :stdout: :py:class:`LineMatcher` of stdout, use ``stdout.str()`` to + reconstruct stdout or the commonly used + ``stdout.fnmatch_lines()`` method. + :stderrr: :py:class:`LineMatcher` of stderr. + :duration: Duration in seconds. + + """ + + def __init__(self, ret, outlines, errlines, duration): + self.ret = ret + self.outlines = outlines + self.errlines = errlines + self.stdout = LineMatcher(outlines) + self.stderr = LineMatcher(errlines) + self.duration = duration + + def parseoutcomes(self): + """ Return a dictionary of outcomestring->num from parsing + the terminal output that the test process produced.""" + for line in reversed(self.outlines): + if 'seconds' in line: + outcomes = rex_outcome.findall(line) + if outcomes: + d = {} + for num, cat in outcomes: + d[cat] = int(num) + return d + raise ValueError("Pytest terminal report not found") + + def assert_outcomes(self, passed=0, skipped=0, failed=0, error=0): + """ assert that the specified outcomes appear with the respective + numbers (0 means it didn't occur) in the text output from a test run.""" + d = self.parseoutcomes() + obtained = { + 'passed': d.get('passed', 0), + 'skipped': d.get('skipped', 0), + 'failed': d.get('failed', 0), + 'error': d.get('error', 0), + } + assert obtained == dict(passed=passed, skipped=skipped, failed=failed, error=error) + + +class Testdir: + """Temporary test directory with tools to test/run pytest itself. + + This is based on the ``tmpdir`` fixture but provides a number of + methods which aid with testing pytest itself. Unless + :py:meth:`chdir` is used all methods will use :py:attr:`tmpdir` as + current working directory. + + Attributes: + + :tmpdir: The :py:class:`py.path.local` instance of the temporary + directory. + + :plugins: A list of plugins to use with :py:meth:`parseconfig` and + :py:meth:`runpytest`. Initially this is an empty list but + plugins can be added to the list. The type of items to add to + the list depend on the method which uses them so refer to them + for details. + + """ + + def __init__(self, request, tmpdir_factory): + self.request = request + self._mod_collections = WeakKeyDictionary() + # XXX remove duplication with tmpdir plugin + basetmp = tmpdir_factory.ensuretemp("testdir") + name = request.function.__name__ + for i in range(100): + try: + tmpdir = basetmp.mkdir(name + str(i)) + except py.error.EEXIST: + continue + break + self.tmpdir = tmpdir + self.plugins = [] + self._savesyspath = (list(sys.path), list(sys.meta_path)) + self._savemodulekeys = set(sys.modules) + self.chdir() # always chdir + self.request.addfinalizer(self.finalize) + method = self.request.config.getoption("--runpytest") + if method == "inprocess": + self._runpytest_method = self.runpytest_inprocess + elif method == "subprocess": + self._runpytest_method = self.runpytest_subprocess + + def __repr__(self): + return "" % (self.tmpdir,) + + def finalize(self): + """Clean up global state artifacts. + + Some methods modify the global interpreter state and this + tries to clean this up. It does not remove the temporary + directory however so it can be looked at after the test run + has finished. + + """ + sys.path[:], sys.meta_path[:] = self._savesyspath + if hasattr(self, '_olddir'): + self._olddir.chdir() + self.delete_loaded_modules() + + def delete_loaded_modules(self): + """Delete modules that have been loaded during a test. + + This allows the interpreter to catch module changes in case + the module is re-imported. + """ + for name in set(sys.modules).difference(self._savemodulekeys): + # some zope modules used by twisted-related tests keeps internal + # state and can't be deleted; we had some trouble in the past + # with zope.interface for example + if not name.startswith("zope"): + del sys.modules[name] + + def make_hook_recorder(self, pluginmanager): + """Create a new :py:class:`HookRecorder` for a PluginManager.""" + assert not hasattr(pluginmanager, "reprec") + pluginmanager.reprec = reprec = HookRecorder(pluginmanager) + self.request.addfinalizer(reprec.finish_recording) + return reprec + + def chdir(self): + """Cd into the temporary directory. + + This is done automatically upon instantiation. + + """ + old = self.tmpdir.chdir() + if not hasattr(self, '_olddir'): + self._olddir = old + + def _makefile(self, ext, args, kwargs, encoding="utf-8"): + items = list(kwargs.items()) + if args: + source = py.builtin._totext("\n").join( + map(py.builtin._totext, args)) + py.builtin._totext("\n") + basename = self.request.function.__name__ + items.insert(0, (basename, source)) + ret = None + for name, value in items: + p = self.tmpdir.join(name).new(ext=ext) + p.dirpath().ensure_dir() + source = Source(value) + + def my_totext(s, encoding="utf-8"): + if py.builtin._isbytes(s): + s = py.builtin._totext(s, encoding=encoding) + return s + + source_unicode = "\n".join([my_totext(line) for line in source.lines]) + source = py.builtin._totext(source_unicode) + content = source.strip().encode(encoding) # + "\n" + # content = content.rstrip() + "\n" + p.write(content, "wb") + if ret is None: + ret = p + return ret + + def makefile(self, ext, *args, **kwargs): + """Create a new file in the testdir. + + ext: The extension the file should use, including the dot. + E.g. ".py". + + args: All args will be treated as strings and joined using + newlines. The result will be written as contents to the + file. The name of the file will be based on the test + function requesting this fixture. + E.g. "testdir.makefile('.txt', 'line1', 'line2')" + + kwargs: Each keyword is the name of a file, while the value of + it will be written as contents of the file. + E.g. "testdir.makefile('.ini', pytest='[pytest]\naddopts=-rs\n')" + + """ + return self._makefile(ext, args, kwargs) + + def makeconftest(self, source): + """Write a contest.py file with 'source' as contents.""" + return self.makepyfile(conftest=source) + + def makeini(self, source): + """Write a tox.ini file with 'source' as contents.""" + return self.makefile('.ini', tox=source) + + def getinicfg(self, source): + """Return the pytest section from the tox.ini config file.""" + p = self.makeini(source) + return py.iniconfig.IniConfig(p)['pytest'] + + def makepyfile(self, *args, **kwargs): + """Shortcut for .makefile() with a .py extension.""" + return self._makefile('.py', args, kwargs) + + def maketxtfile(self, *args, **kwargs): + """Shortcut for .makefile() with a .txt extension.""" + return self._makefile('.txt', args, kwargs) + + def syspathinsert(self, path=None): + """Prepend a directory to sys.path, defaults to :py:attr:`tmpdir`. + + This is undone automatically after the test. + """ + if path is None: + path = self.tmpdir + sys.path.insert(0, str(path)) + # a call to syspathinsert() usually means that the caller + # wants to import some dynamically created files. + # with python3 we thus invalidate import caches. + self._possibly_invalidate_import_caches() + + def _possibly_invalidate_import_caches(self): + # invalidate caches if we can (py33 and above) + try: + import importlib + except ImportError: + pass + else: + if hasattr(importlib, "invalidate_caches"): + importlib.invalidate_caches() + + def mkdir(self, name): + """Create a new (sub)directory.""" + return self.tmpdir.mkdir(name) + + def mkpydir(self, name): + """Create a new python package. + + This creates a (sub)directory with an empty ``__init__.py`` + file so that is recognised as a python package. + + """ + p = self.mkdir(name) + p.ensure("__init__.py") + return p + + Session = Session + + def getnode(self, config, arg): + """Return the collection node of a file. + + :param config: :py:class:`_pytest.config.Config` instance, see + :py:meth:`parseconfig` and :py:meth:`parseconfigure` to + create the configuration. + + :param arg: A :py:class:`py.path.local` instance of the file. + + """ + session = Session(config) + assert '::' not in str(arg) + p = py.path.local(arg) + config.hook.pytest_sessionstart(session=session) + res = session.perform_collect([str(p)], genitems=False)[0] + config.hook.pytest_sessionfinish(session=session, exitstatus=EXIT_OK) + return res + + def getpathnode(self, path): + """Return the collection node of a file. + + This is like :py:meth:`getnode` but uses + :py:meth:`parseconfigure` to create the (configured) pytest + Config instance. + + :param path: A :py:class:`py.path.local` instance of the file. + + """ + config = self.parseconfigure(path) + session = Session(config) + x = session.fspath.bestrelpath(path) + config.hook.pytest_sessionstart(session=session) + res = session.perform_collect([x], genitems=False)[0] + config.hook.pytest_sessionfinish(session=session, exitstatus=EXIT_OK) + return res + + def genitems(self, colitems): + """Generate all test items from a collection node. + + This recurses into the collection node and returns a list of + all the test items contained within. + + """ + session = colitems[0].session + result = [] + for colitem in colitems: + result.extend(session.genitems(colitem)) + return result + + def runitem(self, source): + """Run the "test_func" Item. + + The calling test instance (the class which contains the test + method) must provide a ``.getrunner()`` method which should + return a runner which can run the test protocol for a single + item, like e.g. :py:func:`_pytest.runner.runtestprotocol`. + + """ + # used from runner functional tests + item = self.getitem(source) + # the test class where we are called from wants to provide the runner + testclassinstance = self.request.instance + runner = testclassinstance.getrunner() + return runner(item) + + def inline_runsource(self, source, *cmdlineargs): + """Run a test module in process using ``pytest.main()``. + + This run writes "source" into a temporary file and runs + ``pytest.main()`` on it, returning a :py:class:`HookRecorder` + instance for the result. + + :param source: The source code of the test module. + + :param cmdlineargs: Any extra command line arguments to use. + + :return: :py:class:`HookRecorder` instance of the result. + + """ + p = self.makepyfile(source) + values = list(cmdlineargs) + [p] + return self.inline_run(*values) + + def inline_genitems(self, *args): + """Run ``pytest.main(['--collectonly'])`` in-process. + + Returns a tuple of the collected items and a + :py:class:`HookRecorder` instance. + + This runs the :py:func:`pytest.main` function to run all of + pytest inside the test process itself like + :py:meth:`inline_run`. However the return value is a tuple of + the collection items and a :py:class:`HookRecorder` instance. + + """ + rec = self.inline_run("--collect-only", *args) + items = [x.item for x in rec.getcalls("pytest_itemcollected")] + return items, rec + + def inline_run(self, *args, **kwargs): + """Run ``pytest.main()`` in-process, returning a HookRecorder. + + This runs the :py:func:`pytest.main` function to run all of + pytest inside the test process itself. This means it can + return a :py:class:`HookRecorder` instance which gives more + detailed results from then run then can be done by matching + stdout/stderr from :py:meth:`runpytest`. + + :param args: Any command line arguments to pass to + :py:func:`pytest.main`. + + :param plugin: (keyword-only) Extra plugin instances the + ``pytest.main()`` instance should use. + + :return: A :py:class:`HookRecorder` instance. + """ + # When running py.test inline any plugins active in the main + # test process are already imported. So this disables the + # warning which will trigger to say they can no longer be + # re-written, which is fine as they are already re-written. + orig_warn = AssertionRewritingHook._warn_already_imported + + def revert(): + AssertionRewritingHook._warn_already_imported = orig_warn + + self.request.addfinalizer(revert) + AssertionRewritingHook._warn_already_imported = lambda *a: None + + rec = [] + + class Collect: + def pytest_configure(x, config): + rec.append(self.make_hook_recorder(config.pluginmanager)) + + plugins = kwargs.get("plugins") or [] + plugins.append(Collect()) + ret = pytest.main(list(args), plugins=plugins) + self.delete_loaded_modules() + if len(rec) == 1: + reprec = rec.pop() + else: + class reprec: + pass + reprec.ret = ret + + # typically we reraise keyboard interrupts from the child run + # because it's our user requesting interruption of the testing + if ret == 2 and not kwargs.get("no_reraise_ctrlc"): + calls = reprec.getcalls("pytest_keyboard_interrupt") + if calls and calls[-1].excinfo.type == KeyboardInterrupt: + raise KeyboardInterrupt() + return reprec + + def runpytest_inprocess(self, *args, **kwargs): + """ Return result of running pytest in-process, providing a similar + interface to what self.runpytest() provides. """ + if kwargs.get("syspathinsert"): + self.syspathinsert() + now = time.time() + capture = MultiCapture(Capture=SysCapture) + capture.start_capturing() + try: + try: + reprec = self.inline_run(*args, **kwargs) + except SystemExit as e: + + class reprec: + ret = e.args[0] + + except Exception: + traceback.print_exc() + + class reprec: + ret = 3 + finally: + out, err = capture.readouterr() + capture.stop_capturing() + sys.stdout.write(out) + sys.stderr.write(err) + + res = RunResult(reprec.ret, + out.split("\n"), err.split("\n"), + time.time() - now) + res.reprec = reprec + return res + + def runpytest(self, *args, **kwargs): + """ Run pytest inline or in a subprocess, depending on the command line + option "--runpytest" and return a :py:class:`RunResult`. + + """ + args = self._ensure_basetemp(args) + return self._runpytest_method(*args, **kwargs) + + def _ensure_basetemp(self, args): + args = [str(x) for x in args] + for x in args: + if str(x).startswith('--basetemp'): + # print("basedtemp exists: %s" %(args,)) + break + else: + args.append("--basetemp=%s" % self.tmpdir.dirpath('basetemp')) + # print("added basetemp: %s" %(args,)) + return args + + def parseconfig(self, *args): + """Return a new pytest Config instance from given commandline args. + + This invokes the pytest bootstrapping code in _pytest.config + to create a new :py:class:`_pytest.core.PluginManager` and + call the pytest_cmdline_parse hook to create new + :py:class:`_pytest.config.Config` instance. + + If :py:attr:`plugins` has been populated they should be plugin + modules which will be registered with the PluginManager. + + """ + args = self._ensure_basetemp(args) + + import _pytest.config + config = _pytest.config._prepareconfig(args, self.plugins) + # we don't know what the test will do with this half-setup config + # object and thus we make sure it gets unconfigured properly in any + # case (otherwise capturing could still be active, for example) + self.request.addfinalizer(config._ensure_unconfigure) + return config + + def parseconfigure(self, *args): + """Return a new pytest configured Config instance. + + This returns a new :py:class:`_pytest.config.Config` instance + like :py:meth:`parseconfig`, but also calls the + pytest_configure hook. + + """ + config = self.parseconfig(*args) + config._do_configure() + self.request.addfinalizer(config._ensure_unconfigure) + return config + + def getitem(self, source, funcname="test_func"): + """Return the test item for a test function. + + This writes the source to a python file and runs pytest's + collection on the resulting module, returning the test item + for the requested function name. + + :param source: The module source. + + :param funcname: The name of the test function for which the + Item must be returned. + + """ + items = self.getitems(source) + for item in items: + if item.name == funcname: + return item + assert 0, "%r item not found in module:\n%s\nitems: %s" % ( + funcname, source, items) + + def getitems(self, source): + """Return all test items collected from the module. + + This writes the source to a python file and runs pytest's + collection on the resulting module, returning all test items + contained within. + + """ + modcol = self.getmodulecol(source) + return self.genitems([modcol]) + + def getmodulecol(self, source, configargs=(), withinit=False): + """Return the module collection node for ``source``. + + This writes ``source`` to a file using :py:meth:`makepyfile` + and then runs the pytest collection on it, returning the + collection node for the test module. + + :param source: The source code of the module to collect. + + :param configargs: Any extra arguments to pass to + :py:meth:`parseconfigure`. + + :param withinit: Whether to also write a ``__init__.py`` file + to the temporary directory to ensure it is a package. + + """ + kw = {self.request.function.__name__: Source(source).strip()} + path = self.makepyfile(**kw) + if withinit: + self.makepyfile(__init__="#") + self.config = config = self.parseconfigure(path, *configargs) + node = self.getnode(config, path) + + return node + + def collect_by_name(self, modcol, name): + """Return the collection node for name from the module collection. + + This will search a module collection node for a collection + node matching the given name. + + :param modcol: A module collection node, see + :py:meth:`getmodulecol`. + + :param name: The name of the node to return. + + """ + if modcol not in self._mod_collections: + self._mod_collections[modcol] = list(modcol.collect()) + for colitem in self._mod_collections[modcol]: + if colitem.name == name: + return colitem + + def popen(self, cmdargs, stdout, stderr, **kw): + """Invoke subprocess.Popen. + + This calls subprocess.Popen making sure the current working + directory is the PYTHONPATH. + + You probably want to use :py:meth:`run` instead. + + """ + env = os.environ.copy() + env['PYTHONPATH'] = os.pathsep.join(filter(None, [ + str(os.getcwd()), env.get('PYTHONPATH', '')])) + kw['env'] = env + + popen = subprocess.Popen(cmdargs, stdin=subprocess.PIPE, stdout=stdout, stderr=stderr, **kw) + popen.stdin.close() + + return popen + + def run(self, *cmdargs): + """Run a command with arguments. + + Run a process using subprocess.Popen saving the stdout and + stderr. + + Returns a :py:class:`RunResult`. + + """ + return self._run(*cmdargs) + + def _run(self, *cmdargs): + cmdargs = [str(x) for x in cmdargs] + p1 = self.tmpdir.join("stdout") + p2 = self.tmpdir.join("stderr") + print("running:", ' '.join(cmdargs)) + print(" in:", str(py.path.local())) + f1 = codecs.open(str(p1), "w", encoding="utf8") + f2 = codecs.open(str(p2), "w", encoding="utf8") + try: + now = time.time() + popen = self.popen(cmdargs, stdout=f1, stderr=f2, + close_fds=(sys.platform != "win32")) + ret = popen.wait() + finally: + f1.close() + f2.close() + f1 = codecs.open(str(p1), "r", encoding="utf8") + f2 = codecs.open(str(p2), "r", encoding="utf8") + try: + out = f1.read().splitlines() + err = f2.read().splitlines() + finally: + f1.close() + f2.close() + self._dump_lines(out, sys.stdout) + self._dump_lines(err, sys.stderr) + return RunResult(ret, out, err, time.time() - now) + + def _dump_lines(self, lines, fp): + try: + for line in lines: + print(line, file=fp) + except UnicodeEncodeError: + print("couldn't print to %s because of encoding" % (fp,)) + + def _getpytestargs(self): + # we cannot use "(sys.executable,script)" + # because on windows the script is e.g. a pytest.exe + return (sys.executable, _pytest_fullpath,) # noqa + + def runpython(self, script): + """Run a python script using sys.executable as interpreter. + + Returns a :py:class:`RunResult`. + """ + return self.run(sys.executable, script) + + def runpython_c(self, command): + """Run python -c "command", return a :py:class:`RunResult`.""" + return self.run(sys.executable, "-c", command) + + def runpytest_subprocess(self, *args, **kwargs): + """Run pytest as a subprocess with given arguments. + + Any plugins added to the :py:attr:`plugins` list will added + using the ``-p`` command line option. Addtionally + ``--basetemp`` is used put any temporary files and directories + in a numbered directory prefixed with "runpytest-" so they do + not conflict with the normal numberd pytest location for + temporary files and directories. + + Returns a :py:class:`RunResult`. + + """ + p = py.path.local.make_numbered_dir(prefix="runpytest-", + keep=None, rootdir=self.tmpdir) + args = ('--basetemp=%s' % p, ) + args + # for x in args: + # if '--confcutdir' in str(x): + # break + # else: + # pass + # args = ('--confcutdir=.',) + args + plugins = [x for x in self.plugins if isinstance(x, str)] + if plugins: + args = ('-p', plugins[0]) + args + args = self._getpytestargs() + args + return self.run(*args) + + def spawn_pytest(self, string, expect_timeout=10.0): + """Run pytest using pexpect. + + This makes sure to use the right pytest and sets up the + temporary directory locations. + + The pexpect child is returned. + + """ + basetemp = self.tmpdir.mkdir("temp-pexpect") + invoke = " ".join(map(str, self._getpytestargs())) + cmd = "%s --basetemp=%s %s" % (invoke, basetemp, string) + return self.spawn(cmd, expect_timeout=expect_timeout) + + def spawn(self, cmd, expect_timeout=10.0): + """Run a command using pexpect. + + The pexpect child is returned. + """ + pexpect = pytest.importorskip("pexpect", "3.0") + if hasattr(sys, 'pypy_version_info') and '64' in platform.machine(): + pytest.skip("pypy-64 bit not supported") + if sys.platform.startswith("freebsd"): + pytest.xfail("pexpect does not work reliably on freebsd") + logfile = self.tmpdir.join("spawn.out").open("wb") + child = pexpect.spawn(cmd, logfile=logfile) + self.request.addfinalizer(logfile.close) + child.timeout = expect_timeout + return child + + +def getdecoded(out): + try: + return out.decode("utf-8") + except UnicodeDecodeError: + return "INTERNAL not-utf8-decodeable, truncated string:\n%s" % ( + py.io.saferepr(out),) + + +class LineComp: + def __init__(self): + self.stringio = py.io.TextIO() + + def assert_contains_lines(self, lines2): + """ assert that lines2 are contained (linearly) in lines1. + return a list of extralines found. + """ + __tracebackhide__ = True + val = self.stringio.getvalue() + self.stringio.truncate(0) + self.stringio.seek(0) + lines1 = val.split("\n") + return LineMatcher(lines1).fnmatch_lines(lines2) + + +class LineMatcher: + """Flexible matching of text. + + This is a convenience class to test large texts like the output of + commands. + + The constructor takes a list of lines without their trailing + newlines, i.e. ``text.splitlines()``. + + """ + + def __init__(self, lines): + self.lines = lines + self._log_output = [] + + def str(self): + """Return the entire original text.""" + return "\n".join(self.lines) + + def _getlines(self, lines2): + if isinstance(lines2, str): + lines2 = Source(lines2) + if isinstance(lines2, Source): + lines2 = lines2.strip().lines + return lines2 + + def fnmatch_lines_random(self, lines2): + """Check lines exist in the output. + + The argument is a list of lines which have to occur in the + output, in any order. Each line can contain glob whildcards. + + """ + lines2 = self._getlines(lines2) + for line in lines2: + for x in self.lines: + if line == x or fnmatch(x, line): + self._log("matched: ", repr(line)) + break + else: + self._log("line %r not found in output" % line) + raise ValueError(self._log_text) + + def get_lines_after(self, fnline): + """Return all lines following the given line in the text. + + The given line can contain glob wildcards. + """ + for i, line in enumerate(self.lines): + if fnline == line or fnmatch(line, fnline): + return self.lines[i + 1:] + raise ValueError("line %r not found in output" % fnline) + + def _log(self, *args): + self._log_output.append(' '.join((str(x) for x in args))) + + @property + def _log_text(self): + return '\n'.join(self._log_output) + + def fnmatch_lines(self, lines2): + """Search the text for matching lines. + + The argument is a list of lines which have to match and can + use glob wildcards. If they do not match an pytest.fail() is + called. The matches and non-matches are also printed on + stdout. + + """ + lines2 = self._getlines(lines2) + lines1 = self.lines[:] + nextline = None + extralines = [] + __tracebackhide__ = True + for line in lines2: + nomatchprinted = False + while lines1: + nextline = lines1.pop(0) + if line == nextline: + self._log("exact match:", repr(line)) + break + elif fnmatch(nextline, line): + self._log("fnmatch:", repr(line)) + self._log(" with:", repr(nextline)) + break + else: + if not nomatchprinted: + self._log("nomatch:", repr(line)) + nomatchprinted = True + self._log(" and:", repr(nextline)) + extralines.append(nextline) + else: + self._log("remains unmatched: %r" % (line,)) + pytest.fail(self._log_text) diff --git a/lib/spack/external/pytest-fallback/_pytest/python.py b/lib/spack/external/pytest-fallback/_pytest/python.py new file mode 100644 index 0000000000..41fd2bdb7f --- /dev/null +++ b/lib/spack/external/pytest-fallback/_pytest/python.py @@ -0,0 +1,1173 @@ +""" Python test discovery, setup and run of test functions. """ +from __future__ import absolute_import, division, print_function + +import fnmatch +import inspect +import sys +import os +import collections +from textwrap import dedent +from itertools import count + +import py +from _pytest.mark import MarkerError +from _pytest.config import hookimpl + +import _pytest +import _pytest._pluggy as pluggy +from _pytest import fixtures +from _pytest import main +from _pytest.compat import ( + isclass, isfunction, is_generator, _ascii_escaped, + REGEX_TYPE, STRING_TYPES, NoneType, NOTSET, + get_real_func, getfslineno, safe_getattr, + safe_str, getlocation, enum, +) +from _pytest.outcomes import fail +from _pytest.mark import transfer_markers + +cutdir1 = py.path.local(pluggy.__file__.rstrip("oc")) +cutdir2 = py.path.local(_pytest.__file__).dirpath() +cutdir3 = py.path.local(py.__file__).dirpath() + + +def filter_traceback(entry): + """Return True if a TracebackEntry instance should be removed from tracebacks: + * dynamically generated code (no code to show up for it); + * internal traceback from pytest or its internal libraries, py and pluggy. + """ + # entry.path might sometimes return a str object when the entry + # points to dynamically generated code + # see https://bitbucket.org/pytest-dev/py/issues/71 + raw_filename = entry.frame.code.raw.co_filename + is_generated = '<' in raw_filename and '>' in raw_filename + if is_generated: + return False + # entry.path might point to an inexisting file, in which case it will + # alsso return a str object. see #1133 + p = py.path.local(entry.path) + return p != cutdir1 and not p.relto(cutdir2) and not p.relto(cutdir3) + + +def pyobj_property(name): + def get(self): + node = self.getparent(getattr(__import__('pytest'), name)) + if node is not None: + return node.obj + doc = "python %s object this node was collected from (can be None)." % ( + name.lower(),) + return property(get, None, None, doc) + + +def pytest_addoption(parser): + group = parser.getgroup("general") + group.addoption('--fixtures', '--funcargs', + action="store_true", dest="showfixtures", default=False, + help="show available fixtures, sorted by plugin appearance") + group.addoption( + '--fixtures-per-test', + action="store_true", + dest="show_fixtures_per_test", + default=False, + help="show fixtures per test", + ) + parser.addini("usefixtures", type="args", default=[], + help="list of default fixtures to be used with this project") + parser.addini("python_files", type="args", + default=['test_*.py', '*_test.py'], + help="glob-style file patterns for Python test module discovery") + parser.addini("python_classes", type="args", default=["Test", ], + help="prefixes or glob names for Python test class discovery") + parser.addini("python_functions", type="args", default=["test", ], + help="prefixes or glob names for Python test function and " + "method discovery") + + group.addoption("--import-mode", default="prepend", + choices=["prepend", "append"], dest="importmode", + help="prepend/append to sys.path when importing test modules, " + "default is to prepend.") + + +def pytest_cmdline_main(config): + if config.option.showfixtures: + showfixtures(config) + return 0 + if config.option.show_fixtures_per_test: + show_fixtures_per_test(config) + return 0 + + +def pytest_generate_tests(metafunc): + # those alternative spellings are common - raise a specific error to alert + # the user + alt_spellings = ['parameterize', 'parametrise', 'parameterise'] + for attr in alt_spellings: + if hasattr(metafunc.function, attr): + msg = "{0} has '{1}', spelling should be 'parametrize'" + raise MarkerError(msg.format(metafunc.function.__name__, attr)) + try: + markers = metafunc.function.parametrize + except AttributeError: + return + for marker in markers: + metafunc.parametrize(*marker.args, **marker.kwargs) + + +def pytest_configure(config): + config.addinivalue_line("markers", + "parametrize(argnames, argvalues): call a test function multiple " + "times passing in different arguments in turn. argvalues generally " + "needs to be a list of values if argnames specifies only one name " + "or a list of tuples of values if argnames specifies multiple names. " + "Example: @parametrize('arg1', [1,2]) would lead to two calls of the " + "decorated test function, one with arg1=1 and another with arg1=2." + "see http://pytest.org/latest/parametrize.html for more info and " + "examples." + ) + config.addinivalue_line("markers", + "usefixtures(fixturename1, fixturename2, ...): mark tests as needing " + "all of the specified fixtures. see http://pytest.org/latest/fixture.html#usefixtures " + ) + + +@hookimpl(trylast=True) +def pytest_pyfunc_call(pyfuncitem): + testfunction = pyfuncitem.obj + if pyfuncitem._isyieldedfunction(): + testfunction(*pyfuncitem._args) + else: + funcargs = pyfuncitem.funcargs + testargs = {} + for arg in pyfuncitem._fixtureinfo.argnames: + testargs[arg] = funcargs[arg] + testfunction(**testargs) + return True + + +def pytest_collect_file(path, parent): + ext = path.ext + if ext == ".py": + if not parent.session.isinitpath(path): + for pat in parent.config.getini('python_files'): + if path.fnmatch(pat): + break + else: + return + ihook = parent.session.gethookproxy(path) + return ihook.pytest_pycollect_makemodule(path=path, parent=parent) + + +def pytest_pycollect_makemodule(path, parent): + return Module(path, parent) + + +@hookimpl(hookwrapper=True) +def pytest_pycollect_makeitem(collector, name, obj): + outcome = yield + res = outcome.get_result() + if res is not None: + return + # nothing was collected elsewhere, let's do it here + if isclass(obj): + if collector.istestclass(obj, name): + Class = collector._getcustomclass("Class") + outcome.force_result(Class(name, parent=collector)) + elif collector.istestfunction(obj, name): + # mock seems to store unbound methods (issue473), normalize it + obj = getattr(obj, "__func__", obj) + # We need to try and unwrap the function if it's a functools.partial + # or a funtools.wrapped. + # We musn't if it's been wrapped with mock.patch (python 2 only) + if not (isfunction(obj) or isfunction(get_real_func(obj))): + collector.warn(code="C2", message="cannot collect %r because it is not a function." + % name, ) + elif getattr(obj, "__test__", True): + if is_generator(obj): + res = Generator(name, parent=collector) + else: + res = list(collector._genfunctions(name, obj)) + outcome.force_result(res) + + +def pytest_make_parametrize_id(config, val, argname=None): + return None + + +class PyobjContext(object): + module = pyobj_property("Module") + cls = pyobj_property("Class") + instance = pyobj_property("Instance") + + +class PyobjMixin(PyobjContext): + def obj(): + def fget(self): + obj = getattr(self, '_obj', None) + if obj is None: + self._obj = obj = self._getobj() + return obj + + def fset(self, value): + self._obj = value + + return property(fget, fset, None, "underlying python object") + + obj = obj() + + def _getobj(self): + return getattr(self.parent.obj, self.name) + + def getmodpath(self, stopatmodule=True, includemodule=False): + """ return python path relative to the containing module. """ + chain = self.listchain() + chain.reverse() + parts = [] + for node in chain: + if isinstance(node, Instance): + continue + name = node.name + if isinstance(node, Module): + name = os.path.splitext(name)[0] + if stopatmodule: + if includemodule: + parts.append(name) + break + parts.append(name) + parts.reverse() + s = ".".join(parts) + return s.replace(".[", "[") + + def _getfslineno(self): + return getfslineno(self.obj) + + def reportinfo(self): + # XXX caching? + obj = self.obj + compat_co_firstlineno = getattr(obj, 'compat_co_firstlineno', None) + if isinstance(compat_co_firstlineno, int): + # nose compatibility + fspath = sys.modules[obj.__module__].__file__ + if fspath.endswith(".pyc"): + fspath = fspath[:-1] + lineno = compat_co_firstlineno + else: + fspath, lineno = getfslineno(obj) + modpath = self.getmodpath() + assert isinstance(lineno, int) + return fspath, lineno, modpath + + +class PyCollector(PyobjMixin, main.Collector): + + def funcnamefilter(self, name): + return self._matches_prefix_or_glob_option('python_functions', name) + + def isnosetest(self, obj): + """ Look for the __test__ attribute, which is applied by the + @nose.tools.istest decorator + """ + # We explicitly check for "is True" here to not mistakenly treat + # classes with a custom __getattr__ returning something truthy (like a + # function) as test classes. + return safe_getattr(obj, '__test__', False) is True + + def classnamefilter(self, name): + return self._matches_prefix_or_glob_option('python_classes', name) + + def istestfunction(self, obj, name): + if self.funcnamefilter(name) or self.isnosetest(obj): + if isinstance(obj, staticmethod): + # static methods need to be unwrapped + obj = safe_getattr(obj, '__func__', False) + if obj is False: + # Python 2.6 wraps in a different way that we won't try to handle + msg = "cannot collect static method %r because " \ + "it is not a function (always the case in Python 2.6)" + self.warn( + code="C2", message=msg % name) + return False + return ( + safe_getattr(obj, "__call__", False) and fixtures.getfixturemarker(obj) is None + ) + else: + return False + + def istestclass(self, obj, name): + return self.classnamefilter(name) or self.isnosetest(obj) + + def _matches_prefix_or_glob_option(self, option_name, name): + """ + checks if the given name matches the prefix or glob-pattern defined + in ini configuration. + """ + for option in self.config.getini(option_name): + if name.startswith(option): + return True + # check that name looks like a glob-string before calling fnmatch + # because this is called for every name in each collected module, + # and fnmatch is somewhat expensive to call + elif ('*' in option or '?' in option or '[' in option) and \ + fnmatch.fnmatch(name, option): + return True + return False + + def collect(self): + if not getattr(self.obj, "__test__", True): + return [] + + # NB. we avoid random getattrs and peek in the __dict__ instead + # (XXX originally introduced from a PyPy need, still true?) + dicts = [getattr(self.obj, '__dict__', {})] + for basecls in inspect.getmro(self.obj.__class__): + dicts.append(basecls.__dict__) + seen = {} + values = [] + for dic in dicts: + for name, obj in list(dic.items()): + if name in seen: + continue + seen[name] = True + res = self.makeitem(name, obj) + if res is None: + continue + if not isinstance(res, list): + res = [res] + values.extend(res) + values.sort(key=lambda item: item.reportinfo()[:2]) + return values + + def makeitem(self, name, obj): + # assert self.ihook.fspath == self.fspath, self + return self.ihook.pytest_pycollect_makeitem( + collector=self, name=name, obj=obj) + + def _genfunctions(self, name, funcobj): + module = self.getparent(Module).obj + clscol = self.getparent(Class) + cls = clscol and clscol.obj or None + transfer_markers(funcobj, cls, module) + fm = self.session._fixturemanager + fixtureinfo = fm.getfixtureinfo(self, funcobj, cls) + metafunc = Metafunc(funcobj, fixtureinfo, self.config, + cls=cls, module=module) + methods = [] + if hasattr(module, "pytest_generate_tests"): + methods.append(module.pytest_generate_tests) + if hasattr(cls, "pytest_generate_tests"): + methods.append(cls().pytest_generate_tests) + if methods: + self.ihook.pytest_generate_tests.call_extra(methods, + dict(metafunc=metafunc)) + else: + self.ihook.pytest_generate_tests(metafunc=metafunc) + + Function = self._getcustomclass("Function") + if not metafunc._calls: + yield Function(name, parent=self, fixtureinfo=fixtureinfo) + else: + # add funcargs() as fixturedefs to fixtureinfo.arg2fixturedefs + fixtures.add_funcarg_pseudo_fixture_def(self, metafunc, fm) + + for callspec in metafunc._calls: + subname = "%s[%s]" % (name, callspec.id) + yield Function(name=subname, parent=self, + callspec=callspec, callobj=funcobj, + fixtureinfo=fixtureinfo, + keywords={callspec.id: True}, + originalname=name, + ) + + +class Module(main.File, PyCollector): + """ Collector for test classes and functions. """ + + def _getobj(self): + return self._importtestmodule() + + def collect(self): + self.session._fixturemanager.parsefactories(self) + return super(Module, self).collect() + + def _importtestmodule(self): + # we assume we are only called once per module + importmode = self.config.getoption("--import-mode") + try: + mod = self.fspath.pyimport(ensuresyspath=importmode) + except SyntaxError: + raise self.CollectError( + _pytest._code.ExceptionInfo().getrepr(style="short")) + except self.fspath.ImportMismatchError: + e = sys.exc_info()[1] + raise self.CollectError( + "import file mismatch:\n" + "imported module %r has this __file__ attribute:\n" + " %s\n" + "which is not the same as the test file we want to collect:\n" + " %s\n" + "HINT: remove __pycache__ / .pyc files and/or use a " + "unique basename for your test file modules" + % e.args + ) + except ImportError: + from _pytest._code.code import ExceptionInfo + exc_info = ExceptionInfo() + if self.config.getoption('verbose') < 2: + exc_info.traceback = exc_info.traceback.filter(filter_traceback) + exc_repr = exc_info.getrepr(style='short') if exc_info.traceback else exc_info.exconly() + formatted_tb = safe_str(exc_repr) + raise self.CollectError( + "ImportError while importing test module '{fspath}'.\n" + "Hint: make sure your test modules/packages have valid Python names.\n" + "Traceback:\n" + "{traceback}".format(fspath=self.fspath, traceback=formatted_tb) + ) + except _pytest.runner.Skipped as e: + if e.allow_module_level: + raise + raise self.CollectError( + "Using pytest.skip outside of a test is not allowed. " + "To decorate a test function, use the @pytest.mark.skip " + "or @pytest.mark.skipif decorators instead, and to skip a " + "module use `pytestmark = pytest.mark.{skip,skipif}." + ) + self.config.pluginmanager.consider_module(mod) + return mod + + def setup(self): + setup_module = _get_xunit_setup_teardown(self.obj, "setUpModule") + if setup_module is None: + setup_module = _get_xunit_setup_teardown(self.obj, "setup_module") + if setup_module is not None: + setup_module() + + teardown_module = _get_xunit_setup_teardown(self.obj, 'tearDownModule') + if teardown_module is None: + teardown_module = _get_xunit_setup_teardown(self.obj, 'teardown_module') + if teardown_module is not None: + self.addfinalizer(teardown_module) + + +def _get_xunit_setup_teardown(holder, attr_name, param_obj=None): + """ + Return a callable to perform xunit-style setup or teardown if + the function exists in the ``holder`` object. + The ``param_obj`` parameter is the parameter which will be passed to the function + when the callable is called without arguments, defaults to the ``holder`` object. + Return ``None`` if a suitable callable is not found. + """ + param_obj = param_obj if param_obj is not None else holder + result = _get_xunit_func(holder, attr_name) + if result is not None: + arg_count = result.__code__.co_argcount + if inspect.ismethod(result): + arg_count -= 1 + if arg_count: + return lambda: result(param_obj) + else: + return result + + +def _get_xunit_func(obj, name): + """Return the attribute from the given object to be used as a setup/teardown + xunit-style function, but only if not marked as a fixture to + avoid calling it twice. + """ + meth = getattr(obj, name, None) + if fixtures.getfixturemarker(meth) is None: + return meth + + +class Class(PyCollector): + """ Collector for test methods. """ + + def collect(self): + if not safe_getattr(self.obj, "__test__", True): + return [] + if hasinit(self.obj): + self.warn("C1", "cannot collect test class %r because it has a " + "__init__ constructor" % self.obj.__name__) + return [] + elif hasnew(self.obj): + self.warn("C1", "cannot collect test class %r because it has a " + "__new__ constructor" % self.obj.__name__) + return [] + return [self._getcustomclass("Instance")(name="()", parent=self)] + + def setup(self): + setup_class = _get_xunit_func(self.obj, 'setup_class') + if setup_class is not None: + setup_class = getattr(setup_class, 'im_func', setup_class) + setup_class = getattr(setup_class, '__func__', setup_class) + setup_class(self.obj) + + fin_class = getattr(self.obj, 'teardown_class', None) + if fin_class is not None: + fin_class = getattr(fin_class, 'im_func', fin_class) + fin_class = getattr(fin_class, '__func__', fin_class) + self.addfinalizer(lambda: fin_class(self.obj)) + + +class Instance(PyCollector): + def _getobj(self): + return self.parent.obj() + + def collect(self): + self.session._fixturemanager.parsefactories(self) + return super(Instance, self).collect() + + def newinstance(self): + self.obj = self._getobj() + return self.obj + + +class FunctionMixin(PyobjMixin): + """ mixin for the code common to Function and Generator. + """ + + def setup(self): + """ perform setup for this test function. """ + if hasattr(self, '_preservedparent'): + obj = self._preservedparent + elif isinstance(self.parent, Instance): + obj = self.parent.newinstance() + self.obj = self._getobj() + else: + obj = self.parent.obj + if inspect.ismethod(self.obj): + setup_name = 'setup_method' + teardown_name = 'teardown_method' + else: + setup_name = 'setup_function' + teardown_name = 'teardown_function' + setup_func_or_method = _get_xunit_setup_teardown(obj, setup_name, param_obj=self.obj) + if setup_func_or_method is not None: + setup_func_or_method() + teardown_func_or_method = _get_xunit_setup_teardown(obj, teardown_name, param_obj=self.obj) + if teardown_func_or_method is not None: + self.addfinalizer(teardown_func_or_method) + + def _prunetraceback(self, excinfo): + if hasattr(self, '_obj') and not self.config.option.fulltrace: + code = _pytest._code.Code(get_real_func(self.obj)) + path, firstlineno = code.path, code.firstlineno + traceback = excinfo.traceback + ntraceback = traceback.cut(path=path, firstlineno=firstlineno) + if ntraceback == traceback: + ntraceback = ntraceback.cut(path=path) + if ntraceback == traceback: + # ntraceback = ntraceback.cut(excludepath=cutdir2) + ntraceback = ntraceback.filter(filter_traceback) + if not ntraceback: + ntraceback = traceback + + excinfo.traceback = ntraceback.filter() + # issue364: mark all but first and last frames to + # only show a single-line message for each frame + if self.config.option.tbstyle == "auto": + if len(excinfo.traceback) > 2: + for entry in excinfo.traceback[1:-1]: + entry.set_repr_style('short') + + def _repr_failure_py(self, excinfo, style="long"): + if excinfo.errisinstance(fail.Exception): + if not excinfo.value.pytrace: + return py._builtin._totext(excinfo.value) + return super(FunctionMixin, self)._repr_failure_py(excinfo, + style=style) + + def repr_failure(self, excinfo, outerr=None): + assert outerr is None, "XXX outerr usage is deprecated" + style = self.config.option.tbstyle + if style == "auto": + style = "long" + return self._repr_failure_py(excinfo, style=style) + + +class Generator(FunctionMixin, PyCollector): + def collect(self): + # test generators are seen as collectors but they also + # invoke setup/teardown on popular request + # (induced by the common "test_*" naming shared with normal tests) + from _pytest import deprecated + self.session._setupstate.prepare(self) + # see FunctionMixin.setup and test_setupstate_is_preserved_134 + self._preservedparent = self.parent.obj + values = [] + seen = {} + for i, x in enumerate(self.obj()): + name, call, args = self.getcallargs(x) + if not callable(call): + raise TypeError("%r yielded non callable test %r" % (self.obj, call,)) + if name is None: + name = "[%d]" % i + else: + name = "['%s']" % name + if name in seen: + raise ValueError("%r generated tests with non-unique name %r" % (self, name)) + seen[name] = True + values.append(self.Function(name, self, args=args, callobj=call)) + self.warn('C1', deprecated.YIELD_TESTS) + return values + + def getcallargs(self, obj): + if not isinstance(obj, (tuple, list)): + obj = (obj,) + # explicit naming + if isinstance(obj[0], py.builtin._basestring): + name = obj[0] + obj = obj[1:] + else: + name = None + call, args = obj[0], obj[1:] + return name, call, args + + +def hasinit(obj): + init = getattr(obj, '__init__', None) + if init: + return init != object.__init__ + + +def hasnew(obj): + new = getattr(obj, '__new__', None) + if new: + return new != object.__new__ + + +class CallSpec2(object): + def __init__(self, metafunc): + self.metafunc = metafunc + self.funcargs = {} + self._idlist = [] + self.params = {} + self._globalid = NOTSET + self._globalid_args = set() + self._globalparam = NOTSET + self._arg2scopenum = {} # used for sorting parametrized resources + self.keywords = {} + self.indices = {} + + def copy(self, metafunc): + cs = CallSpec2(self.metafunc) + cs.funcargs.update(self.funcargs) + cs.params.update(self.params) + cs.keywords.update(self.keywords) + cs.indices.update(self.indices) + cs._arg2scopenum.update(self._arg2scopenum) + cs._idlist = list(self._idlist) + cs._globalid = self._globalid + cs._globalid_args = self._globalid_args + cs._globalparam = self._globalparam + return cs + + def _checkargnotcontained(self, arg): + if arg in self.params or arg in self.funcargs: + raise ValueError("duplicate %r" % (arg,)) + + def getparam(self, name): + try: + return self.params[name] + except KeyError: + if self._globalparam is NOTSET: + raise ValueError(name) + return self._globalparam + + @property + def id(self): + return "-".join(map(str, filter(None, self._idlist))) + + def setmulti(self, valtypes, argnames, valset, id, keywords, scopenum, + param_index): + for arg, val in zip(argnames, valset): + self._checkargnotcontained(arg) + valtype_for_arg = valtypes[arg] + getattr(self, valtype_for_arg)[arg] = val + self.indices[arg] = param_index + self._arg2scopenum[arg] = scopenum + self._idlist.append(id) + self.keywords.update(keywords) + + def setall(self, funcargs, id, param): + for x in funcargs: + self._checkargnotcontained(x) + self.funcargs.update(funcargs) + if id is not NOTSET: + self._idlist.append(id) + if param is not NOTSET: + assert self._globalparam is NOTSET + self._globalparam = param + for arg in funcargs: + self._arg2scopenum[arg] = fixtures.scopenum_function + + +class Metafunc(fixtures.FuncargnamesCompatAttr): + """ + Metafunc objects are passed to the ``pytest_generate_tests`` hook. + They help to inspect a test function and to generate tests according to + test configuration or values specified in the class or module where a + test function is defined. + """ + + def __init__(self, function, fixtureinfo, config, cls=None, module=None): + #: access to the :class:`_pytest.config.Config` object for the test session + self.config = config + + #: the module object where the test function is defined in. + self.module = module + + #: underlying python test function + self.function = function + + #: set of fixture names required by the test function + self.fixturenames = fixtureinfo.names_closure + + #: class object where the test function is defined in or ``None``. + self.cls = cls + + self._calls = [] + self._ids = py.builtin.set() + self._arg2fixturedefs = fixtureinfo.name2fixturedefs + + def parametrize(self, argnames, argvalues, indirect=False, ids=None, + scope=None): + """ Add new invocations to the underlying test function using the list + of argvalues for the given argnames. Parametrization is performed + during the collection phase. If you need to setup expensive resources + see about setting indirect to do it rather at test setup time. + + :arg argnames: a comma-separated string denoting one or more argument + names, or a list/tuple of argument strings. + + :arg argvalues: The list of argvalues determines how often a + test is invoked with different argument values. If only one + argname was specified argvalues is a list of values. If N + argnames were specified, argvalues must be a list of N-tuples, + where each tuple-element specifies a value for its respective + argname. + + :arg indirect: The list of argnames or boolean. A list of arguments' + names (subset of argnames). If True the list contains all names from + the argnames. Each argvalue corresponding to an argname in this list will + be passed as request.param to its respective argname fixture + function so that it can perform more expensive setups during the + setup phase of a test rather than at collection time. + + :arg ids: list of string ids, or a callable. + If strings, each is corresponding to the argvalues so that they are + part of the test id. If None is given as id of specific test, the + automatically generated id for that argument will be used. + If callable, it should take one argument (a single argvalue) and return + a string or return None. If None, the automatically generated id for that + argument will be used. + If no ids are provided they will be generated automatically from + the argvalues. + + :arg scope: if specified it denotes the scope of the parameters. + The scope is used for grouping tests by parameter instances. + It will also override any fixture-function defined scope, allowing + to set a dynamic scope using test context or configuration. + """ + from _pytest.fixtures import scope2index + from _pytest.mark import MARK_GEN, ParameterSet + from py.io import saferepr + + if not isinstance(argnames, (tuple, list)): + argnames = [x.strip() for x in argnames.split(",") if x.strip()] + force_tuple = len(argnames) == 1 + else: + force_tuple = False + parameters = [ + ParameterSet.extract_from(x, legacy_force_tuple=force_tuple) + for x in argvalues] + del argvalues + + if not parameters: + fs, lineno = getfslineno(self.function) + reason = "got empty parameter set %r, function %s at %s:%d" % ( + argnames, self.function.__name__, fs, lineno) + mark = MARK_GEN.skip(reason=reason) + parameters.append(ParameterSet( + values=(NOTSET,) * len(argnames), + marks=[mark], + id=None, + )) + + if scope is None: + scope = _find_parametrized_scope(argnames, self._arg2fixturedefs, indirect) + + scopenum = scope2index(scope, descr='call to {0}'.format(self.parametrize)) + valtypes = {} + for arg in argnames: + if arg not in self.fixturenames: + if isinstance(indirect, (tuple, list)): + name = 'fixture' if arg in indirect else 'argument' + else: + name = 'fixture' if indirect else 'argument' + raise ValueError( + "%r uses no %s %r" % ( + self.function, name, arg)) + + if indirect is True: + valtypes = dict.fromkeys(argnames, "params") + elif indirect is False: + valtypes = dict.fromkeys(argnames, "funcargs") + elif isinstance(indirect, (tuple, list)): + valtypes = dict.fromkeys(argnames, "funcargs") + for arg in indirect: + if arg not in argnames: + raise ValueError("indirect given to %r: fixture %r doesn't exist" % ( + self.function, arg)) + valtypes[arg] = "params" + idfn = None + if callable(ids): + idfn = ids + ids = None + if ids: + if len(ids) != len(parameters): + raise ValueError('%d tests specified with %d ids' % ( + len(parameters), len(ids))) + for id_value in ids: + if id_value is not None and not isinstance(id_value, py.builtin._basestring): + msg = 'ids must be list of strings, found: %s (type: %s)' + raise ValueError(msg % (saferepr(id_value), type(id_value).__name__)) + ids = idmaker(argnames, parameters, idfn, ids, self.config) + newcalls = [] + for callspec in self._calls or [CallSpec2(self)]: + elements = zip(ids, parameters, count()) + for a_id, param, param_index in elements: + if len(param.values) != len(argnames): + raise ValueError( + 'In "parametrize" the number of values ({0}) must be ' + 'equal to the number of names ({1})'.format( + param.values, argnames)) + newcallspec = callspec.copy(self) + newcallspec.setmulti(valtypes, argnames, param.values, a_id, + param.deprecated_arg_dict, scopenum, param_index) + newcalls.append(newcallspec) + self._calls = newcalls + + def addcall(self, funcargs=None, id=NOTSET, param=NOTSET): + """ (deprecated, use parametrize) Add a new call to the underlying + test function during the collection phase of a test run. Note that + request.addcall() is called during the test collection phase prior and + independently to actual test execution. You should only use addcall() + if you need to specify multiple arguments of a test function. + + :arg funcargs: argument keyword dictionary used when invoking + the test function. + + :arg id: used for reporting and identification purposes. If you + don't supply an `id` an automatic unique id will be generated. + + :arg param: a parameter which will be exposed to a later fixture function + invocation through the ``request.param`` attribute. + """ + assert funcargs is None or isinstance(funcargs, dict) + if funcargs is not None: + for name in funcargs: + if name not in self.fixturenames: + fail("funcarg %r not used in this function." % name) + else: + funcargs = {} + if id is None: + raise ValueError("id=None not allowed") + if id is NOTSET: + id = len(self._calls) + id = str(id) + if id in self._ids: + raise ValueError("duplicate id %r" % id) + self._ids.add(id) + + cs = CallSpec2(self) + cs.setall(funcargs, id, param) + self._calls.append(cs) + + +def _find_parametrized_scope(argnames, arg2fixturedefs, indirect): + """Find the most appropriate scope for a parametrized call based on its arguments. + + When there's at least one direct argument, always use "function" scope. + + When a test function is parametrized and all its arguments are indirect + (e.g. fixtures), return the most narrow scope based on the fixtures used. + + Related to issue #1832, based on code posted by @Kingdread. + """ + from _pytest.fixtures import scopes + indirect_as_list = isinstance(indirect, (list, tuple)) + all_arguments_are_fixtures = indirect is True or \ + indirect_as_list and len(indirect) == argnames + if all_arguments_are_fixtures: + fixturedefs = arg2fixturedefs or {} + used_scopes = [fixturedef[0].scope for name, fixturedef in fixturedefs.items()] + if used_scopes: + # Takes the most narrow scope from used fixtures + for scope in reversed(scopes): + if scope in used_scopes: + return scope + + return 'function' + + +def _idval(val, argname, idx, idfn, config=None): + if idfn: + s = None + try: + s = idfn(val) + except Exception: + # See issue https://github.com/pytest-dev/pytest/issues/2169 + import warnings + msg = "Raised while trying to determine id of parameter %s at position %d." % (argname, idx) + msg += '\nUpdate your code as this will raise an error in pytest-4.0.' + warnings.warn(msg, DeprecationWarning) + if s: + return _ascii_escaped(s) + + if config: + hook_id = config.hook.pytest_make_parametrize_id( + config=config, val=val, argname=argname) + if hook_id: + return hook_id + + if isinstance(val, STRING_TYPES): + return _ascii_escaped(val) + elif isinstance(val, (float, int, bool, NoneType)): + return str(val) + elif isinstance(val, REGEX_TYPE): + return _ascii_escaped(val.pattern) + elif enum is not None and isinstance(val, enum.Enum): + return str(val) + elif isclass(val) and hasattr(val, '__name__'): + return val.__name__ + return str(argname) + str(idx) + + +def _idvalset(idx, parameterset, argnames, idfn, ids, config=None): + if parameterset.id is not None: + return parameterset.id + if ids is None or (idx >= len(ids) or ids[idx] is None): + this_id = [_idval(val, argname, idx, idfn, config) + for val, argname in zip(parameterset.values, argnames)] + return "-".join(this_id) + else: + return _ascii_escaped(ids[idx]) + + +def idmaker(argnames, parametersets, idfn=None, ids=None, config=None): + ids = [_idvalset(valindex, parameterset, argnames, idfn, ids, config) + for valindex, parameterset in enumerate(parametersets)] + if len(set(ids)) != len(ids): + # The ids are not unique + duplicates = [testid for testid in ids if ids.count(testid) > 1] + counters = collections.defaultdict(lambda: 0) + for index, testid in enumerate(ids): + if testid in duplicates: + ids[index] = testid + str(counters[testid]) + counters[testid] += 1 + return ids + + +def show_fixtures_per_test(config): + from _pytest.main import wrap_session + return wrap_session(config, _show_fixtures_per_test) + + +def _show_fixtures_per_test(config, session): + import _pytest.config + session.perform_collect() + curdir = py.path.local() + tw = _pytest.config.create_terminal_writer(config) + verbose = config.getvalue("verbose") + + def get_best_relpath(func): + loc = getlocation(func, curdir) + return curdir.bestrelpath(loc) + + def write_fixture(fixture_def): + argname = fixture_def.argname + if verbose <= 0 and argname.startswith("_"): + return + if verbose > 0: + bestrel = get_best_relpath(fixture_def.func) + funcargspec = "{0} -- {1}".format(argname, bestrel) + else: + funcargspec = argname + tw.line(funcargspec, green=True) + fixture_doc = fixture_def.func.__doc__ + if fixture_doc: + write_docstring(tw, fixture_doc) + else: + tw.line(' no docstring available', red=True) + + def write_item(item): + try: + info = item._fixtureinfo + except AttributeError: + # doctests items have no _fixtureinfo attribute + return + if not info.name2fixturedefs: + # this test item does not use any fixtures + return + tw.line() + tw.sep('-', 'fixtures used by {0}'.format(item.name)) + tw.sep('-', '({0})'.format(get_best_relpath(item.function))) + # dict key not used in loop but needed for sorting + for _, fixturedefs in sorted(info.name2fixturedefs.items()): + assert fixturedefs is not None + if not fixturedefs: + continue + # last item is expected to be the one used by the test item + write_fixture(fixturedefs[-1]) + + for session_item in session.items: + write_item(session_item) + + +def showfixtures(config): + from _pytest.main import wrap_session + return wrap_session(config, _showfixtures_main) + + +def _showfixtures_main(config, session): + import _pytest.config + session.perform_collect() + curdir = py.path.local() + tw = _pytest.config.create_terminal_writer(config) + verbose = config.getvalue("verbose") + + fm = session._fixturemanager + + available = [] + seen = set() + + for argname, fixturedefs in fm._arg2fixturedefs.items(): + assert fixturedefs is not None + if not fixturedefs: + continue + for fixturedef in fixturedefs: + loc = getlocation(fixturedef.func, curdir) + if (fixturedef.argname, loc) in seen: + continue + seen.add((fixturedef.argname, loc)) + available.append((len(fixturedef.baseid), + fixturedef.func.__module__, + curdir.bestrelpath(loc), + fixturedef.argname, fixturedef)) + + available.sort() + currentmodule = None + for baseid, module, bestrel, argname, fixturedef in available: + if currentmodule != module: + if not module.startswith("_pytest."): + tw.line() + tw.sep("-", "fixtures defined from %s" % (module,)) + currentmodule = module + if verbose <= 0 and argname[0] == "_": + continue + if verbose > 0: + funcargspec = "%s -- %s" % (argname, bestrel,) + else: + funcargspec = argname + tw.line(funcargspec, green=True) + loc = getlocation(fixturedef.func, curdir) + doc = fixturedef.func.__doc__ or "" + if doc: + write_docstring(tw, doc) + else: + tw.line(" %s: no docstring available" % (loc,), + red=True) + + +def write_docstring(tw, doc): + INDENT = " " + doc = doc.rstrip() + if "\n" in doc: + firstline, rest = doc.split("\n", 1) + else: + firstline, rest = doc, "" + + if firstline.strip(): + tw.line(INDENT + firstline.strip()) + + if rest: + for line in dedent(rest).split("\n"): + tw.write(INDENT + line + "\n") + + +class Function(FunctionMixin, main.Item, fixtures.FuncargnamesCompatAttr): + """ a Function Item is responsible for setting up and executing a + Python test function. + """ + _genid = None + + def __init__(self, name, parent, args=None, config=None, + callspec=None, callobj=NOTSET, keywords=None, session=None, + fixtureinfo=None, originalname=None): + super(Function, self).__init__(name, parent, config=config, + session=session) + self._args = args + if callobj is not NOTSET: + self.obj = callobj + + self.keywords.update(self.obj.__dict__) + if callspec: + self.callspec = callspec + self.keywords.update(callspec.keywords) + if keywords: + self.keywords.update(keywords) + + if fixtureinfo is None: + fixtureinfo = self.session._fixturemanager.getfixtureinfo( + self.parent, self.obj, self.cls, + funcargs=not self._isyieldedfunction()) + self._fixtureinfo = fixtureinfo + self.fixturenames = fixtureinfo.names_closure + self._initrequest() + + #: original function name, without any decorations (for example + #: parametrization adds a ``"[...]"`` suffix to function names). + #: + #: .. versionadded:: 3.0 + self.originalname = originalname + + def _initrequest(self): + self.funcargs = {} + if self._isyieldedfunction(): + assert not hasattr(self, "callspec"), ( + "yielded functions (deprecated) cannot have funcargs") + else: + if hasattr(self, "callspec"): + callspec = self.callspec + assert not callspec.funcargs + self._genid = callspec.id + if hasattr(callspec, "param"): + self.param = callspec.param + self._request = fixtures.FixtureRequest(self) + + @property + def function(self): + "underlying python 'function' object" + return getattr(self.obj, 'im_func', self.obj) + + def _getobj(self): + name = self.name + i = name.find("[") # parametrization + if i != -1: + name = name[:i] + return getattr(self.parent.obj, name) + + @property + def _pyfuncitem(self): + "(compatonly) for code expecting pytest-2.2 style request objects" + return self + + def _isyieldedfunction(self): + return getattr(self, "_args", None) is not None + + def runtest(self): + """ execute the underlying test function. """ + self.ihook.pytest_pyfunc_call(pyfuncitem=self) + + def setup(self): + super(Function, self).setup() + fixtures.fillfixtures(self) diff --git a/lib/spack/external/pytest-fallback/_pytest/python_api.py b/lib/spack/external/pytest-fallback/_pytest/python_api.py new file mode 100644 index 0000000000..a931b4d2c7 --- /dev/null +++ b/lib/spack/external/pytest-fallback/_pytest/python_api.py @@ -0,0 +1,629 @@ +import math +import sys + +import py + +from _pytest.compat import isclass, izip +from _pytest.outcomes import fail +import _pytest._code + + +def _cmp_raises_type_error(self, other): + """__cmp__ implementation which raises TypeError. Used + by Approx base classes to implement only == and != and raise a + TypeError for other comparisons. + + Needed in Python 2 only, Python 3 all it takes is not implementing the + other operators at all. + """ + __tracebackhide__ = True + raise TypeError('Comparison operators other than == and != not supported by approx objects') + + +# builtin pytest.approx helper + + +class ApproxBase(object): + """ + Provide shared utilities for making approximate comparisons between numbers + or sequences of numbers. + """ + + def __init__(self, expected, rel=None, abs=None, nan_ok=False): + self.expected = expected + self.abs = abs + self.rel = rel + self.nan_ok = nan_ok + + def __repr__(self): + raise NotImplementedError + + def __eq__(self, actual): + return all( + a == self._approx_scalar(x) + for a, x in self._yield_comparisons(actual)) + + __hash__ = None + + def __ne__(self, actual): + return not (actual == self) + + if sys.version_info[0] == 2: + __cmp__ = _cmp_raises_type_error + + def _approx_scalar(self, x): + return ApproxScalar(x, rel=self.rel, abs=self.abs, nan_ok=self.nan_ok) + + def _yield_comparisons(self, actual): + """ + Yield all the pairs of numbers to be compared. This is used to + implement the `__eq__` method. + """ + raise NotImplementedError + + +class ApproxNumpy(ApproxBase): + """ + Perform approximate comparisons for numpy arrays. + """ + + # Tell numpy to use our `__eq__` operator instead of its. + __array_priority__ = 100 + + def __repr__(self): + # It might be nice to rewrite this function to account for the + # shape of the array... + return "approx({0!r})".format(list( + self._approx_scalar(x) for x in self.expected)) + + if sys.version_info[0] == 2: + __cmp__ = _cmp_raises_type_error + + def __eq__(self, actual): + import numpy as np + + try: + actual = np.asarray(actual) + except: # noqa + raise TypeError("cannot compare '{0}' to numpy.ndarray".format(actual)) + + if actual.shape != self.expected.shape: + return False + + return ApproxBase.__eq__(self, actual) + + def _yield_comparisons(self, actual): + import numpy as np + + # We can be sure that `actual` is a numpy array, because it's + # casted in `__eq__` before being passed to `ApproxBase.__eq__`, + # which is the only method that calls this one. + for i in np.ndindex(self.expected.shape): + yield actual[i], self.expected[i] + + +class ApproxMapping(ApproxBase): + """ + Perform approximate comparisons for mappings where the values are numbers + (the keys can be anything). + """ + + def __repr__(self): + return "approx({0!r})".format(dict( + (k, self._approx_scalar(v)) + for k, v in self.expected.items())) + + def __eq__(self, actual): + if set(actual.keys()) != set(self.expected.keys()): + return False + + return ApproxBase.__eq__(self, actual) + + def _yield_comparisons(self, actual): + for k in self.expected.keys(): + yield actual[k], self.expected[k] + + +class ApproxSequence(ApproxBase): + """ + Perform approximate comparisons for sequences of numbers. + """ + + # Tell numpy to use our `__eq__` operator instead of its. + __array_priority__ = 100 + + def __repr__(self): + seq_type = type(self.expected) + if seq_type not in (tuple, list, set): + seq_type = list + return "approx({0!r})".format(seq_type( + self._approx_scalar(x) for x in self.expected)) + + def __eq__(self, actual): + if len(actual) != len(self.expected): + return False + return ApproxBase.__eq__(self, actual) + + def _yield_comparisons(self, actual): + return izip(actual, self.expected) + + +class ApproxScalar(ApproxBase): + """ + Perform approximate comparisons for single numbers only. + """ + + def __repr__(self): + """ + Return a string communicating both the expected value and the tolerance + for the comparison being made, e.g. '1.0 +- 1e-6'. Use the unicode + plus/minus symbol if this is python3 (it's too hard to get right for + python2). + """ + if isinstance(self.expected, complex): + return str(self.expected) + + # Infinities aren't compared using tolerances, so don't show a + # tolerance. + if math.isinf(self.expected): + return str(self.expected) + + # If a sensible tolerance can't be calculated, self.tolerance will + # raise a ValueError. In this case, display '???'. + try: + vetted_tolerance = '{:.1e}'.format(self.tolerance) + except ValueError: + vetted_tolerance = '???' + + if sys.version_info[0] == 2: + return '{0} +- {1}'.format(self.expected, vetted_tolerance) + else: + return u'{0} \u00b1 {1}'.format(self.expected, vetted_tolerance) + + def __eq__(self, actual): + """ + Return true if the given value is equal to the expected value within + the pre-specified tolerance. + """ + + # Short-circuit exact equality. + if actual == self.expected: + return True + + # Allow the user to control whether NaNs are considered equal to each + # other or not. The abs() calls are for compatibility with complex + # numbers. + if math.isnan(abs(self.expected)): + return self.nan_ok and math.isnan(abs(actual)) + + # Infinity shouldn't be approximately equal to anything but itself, but + # if there's a relative tolerance, it will be infinite and infinity + # will seem approximately equal to everything. The equal-to-itself + # case would have been short circuited above, so here we can just + # return false if the expected value is infinite. The abs() call is + # for compatibility with complex numbers. + if math.isinf(abs(self.expected)): + return False + + # Return true if the two numbers are within the tolerance. + return abs(self.expected - actual) <= self.tolerance + + __hash__ = None + + @property + def tolerance(self): + """ + Return the tolerance for the comparison. This could be either an + absolute tolerance or a relative tolerance, depending on what the user + specified or which would be larger. + """ + def set_default(x, default): + return x if x is not None else default + + # Figure out what the absolute tolerance should be. ``self.abs`` is + # either None or a value specified by the user. + absolute_tolerance = set_default(self.abs, 1e-12) + + if absolute_tolerance < 0: + raise ValueError("absolute tolerance can't be negative: {0}".format(absolute_tolerance)) + if math.isnan(absolute_tolerance): + raise ValueError("absolute tolerance can't be NaN.") + + # If the user specified an absolute tolerance but not a relative one, + # just return the absolute tolerance. + if self.rel is None: + if self.abs is not None: + return absolute_tolerance + + # Figure out what the relative tolerance should be. ``self.rel`` is + # either None or a value specified by the user. This is done after + # we've made sure the user didn't ask for an absolute tolerance only, + # because we don't want to raise errors about the relative tolerance if + # we aren't even going to use it. + relative_tolerance = set_default(self.rel, 1e-6) * abs(self.expected) + + if relative_tolerance < 0: + raise ValueError("relative tolerance can't be negative: {0}".format(absolute_tolerance)) + if math.isnan(relative_tolerance): + raise ValueError("relative tolerance can't be NaN.") + + # Return the larger of the relative and absolute tolerances. + return max(relative_tolerance, absolute_tolerance) + + +def approx(expected, rel=None, abs=None, nan_ok=False): + """ + Assert that two numbers (or two sets of numbers) are equal to each other + within some tolerance. + + Due to the `intricacies of floating-point arithmetic`__, numbers that we + would intuitively expect to be equal are not always so:: + + >>> 0.1 + 0.2 == 0.3 + False + + __ https://docs.python.org/3/tutorial/floatingpoint.html + + This problem is commonly encountered when writing tests, e.g. when making + sure that floating-point values are what you expect them to be. One way to + deal with this problem is to assert that two floating-point numbers are + equal to within some appropriate tolerance:: + + >>> abs((0.1 + 0.2) - 0.3) < 1e-6 + True + + However, comparisons like this are tedious to write and difficult to + understand. Furthermore, absolute comparisons like the one above are + usually discouraged because there's no tolerance that works well for all + situations. ``1e-6`` is good for numbers around ``1``, but too small for + very big numbers and too big for very small ones. It's better to express + the tolerance as a fraction of the expected value, but relative comparisons + like that are even more difficult to write correctly and concisely. + + The ``approx`` class performs floating-point comparisons using a syntax + that's as intuitive as possible:: + + >>> from pytest import approx + >>> 0.1 + 0.2 == approx(0.3) + True + + The same syntax also works for sequences of numbers:: + + >>> (0.1 + 0.2, 0.2 + 0.4) == approx((0.3, 0.6)) + True + + Dictionary *values*:: + + >>> {'a': 0.1 + 0.2, 'b': 0.2 + 0.4} == approx({'a': 0.3, 'b': 0.6}) + True + + And ``numpy`` arrays:: + + >>> import numpy as np # doctest: +SKIP + >>> np.array([0.1, 0.2]) + np.array([0.2, 0.4]) == approx(np.array([0.3, 0.6])) # doctest: +SKIP + True + + By default, ``approx`` considers numbers within a relative tolerance of + ``1e-6`` (i.e. one part in a million) of its expected value to be equal. + This treatment would lead to surprising results if the expected value was + ``0.0``, because nothing but ``0.0`` itself is relatively close to ``0.0``. + To handle this case less surprisingly, ``approx`` also considers numbers + within an absolute tolerance of ``1e-12`` of its expected value to be + equal. Infinity and NaN are special cases. Infinity is only considered + equal to itself, regardless of the relative tolerance. NaN is not + considered equal to anything by default, but you can make it be equal to + itself by setting the ``nan_ok`` argument to True. (This is meant to + facilitate comparing arrays that use NaN to mean "no data".) + + Both the relative and absolute tolerances can be changed by passing + arguments to the ``approx`` constructor:: + + >>> 1.0001 == approx(1) + False + >>> 1.0001 == approx(1, rel=1e-3) + True + >>> 1.0001 == approx(1, abs=1e-3) + True + + If you specify ``abs`` but not ``rel``, the comparison will not consider + the relative tolerance at all. In other words, two numbers that are within + the default relative tolerance of ``1e-6`` will still be considered unequal + if they exceed the specified absolute tolerance. If you specify both + ``abs`` and ``rel``, the numbers will be considered equal if either + tolerance is met:: + + >>> 1 + 1e-8 == approx(1) + True + >>> 1 + 1e-8 == approx(1, abs=1e-12) + False + >>> 1 + 1e-8 == approx(1, rel=1e-6, abs=1e-12) + True + + If you're thinking about using ``approx``, then you might want to know how + it compares to other good ways of comparing floating-point numbers. All of + these algorithms are based on relative and absolute tolerances and should + agree for the most part, but they do have meaningful differences: + + - ``math.isclose(a, b, rel_tol=1e-9, abs_tol=0.0)``: True if the relative + tolerance is met w.r.t. either ``a`` or ``b`` or if the absolute + tolerance is met. Because the relative tolerance is calculated w.r.t. + both ``a`` and ``b``, this test is symmetric (i.e. neither ``a`` nor + ``b`` is a "reference value"). You have to specify an absolute tolerance + if you want to compare to ``0.0`` because there is no tolerance by + default. Only available in python>=3.5. `More information...`__ + + __ https://docs.python.org/3/library/math.html#math.isclose + + - ``numpy.isclose(a, b, rtol=1e-5, atol=1e-8)``: True if the difference + between ``a`` and ``b`` is less that the sum of the relative tolerance + w.r.t. ``b`` and the absolute tolerance. Because the relative tolerance + is only calculated w.r.t. ``b``, this test is asymmetric and you can + think of ``b`` as the reference value. Support for comparing sequences + is provided by ``numpy.allclose``. `More information...`__ + + __ http://docs.scipy.org/doc/numpy-1.10.0/reference/generated/numpy.isclose.html + + - ``unittest.TestCase.assertAlmostEqual(a, b)``: True if ``a`` and ``b`` + are within an absolute tolerance of ``1e-7``. No relative tolerance is + considered and the absolute tolerance cannot be changed, so this function + is not appropriate for very large or very small numbers. Also, it's only + available in subclasses of ``unittest.TestCase`` and it's ugly because it + doesn't follow PEP8. `More information...`__ + + __ https://docs.python.org/3/library/unittest.html#unittest.TestCase.assertAlmostEqual + + - ``a == pytest.approx(b, rel=1e-6, abs=1e-12)``: True if the relative + tolerance is met w.r.t. ``b`` or if the absolute tolerance is met. + Because the relative tolerance is only calculated w.r.t. ``b``, this test + is asymmetric and you can think of ``b`` as the reference value. In the + special case that you explicitly specify an absolute tolerance but not a + relative tolerance, only the absolute tolerance is considered. + + .. warning:: + + .. versionchanged:: 3.2 + + In order to avoid inconsistent behavior, ``TypeError`` is + raised for ``>``, ``>=``, ``<`` and ``<=`` comparisons. + The example below illustrates the problem:: + + assert approx(0.1) > 0.1 + 1e-10 # calls approx(0.1).__gt__(0.1 + 1e-10) + assert 0.1 + 1e-10 > approx(0.1) # calls approx(0.1).__lt__(0.1 + 1e-10) + + In the second example one expects ``approx(0.1).__le__(0.1 + 1e-10)`` + to be called. But instead, ``approx(0.1).__lt__(0.1 + 1e-10)`` is used to + comparison. This is because the call hierarchy of rich comparisons + follows a fixed behavior. `More information...`__ + + __ https://docs.python.org/3/reference/datamodel.html#object.__ge__ + """ + + if sys.version_info >= (3, 3): + from collections.abc import Mapping, Sequence + else: + from collections import Mapping, Sequence + from _pytest.compat import STRING_TYPES as String + + # Delegate the comparison to a class that knows how to deal with the type + # of the expected value (e.g. int, float, list, dict, numpy.array, etc). + # + # This architecture is really driven by the need to support numpy arrays. + # The only way to override `==` for arrays without requiring that approx be + # the left operand is to inherit the approx object from `numpy.ndarray`. + # But that can't be a general solution, because it requires (1) numpy to be + # installed and (2) the expected value to be a numpy array. So the general + # solution is to delegate each type of expected value to a different class. + # + # This has the advantage that it made it easy to support mapping types + # (i.e. dict). The old code accepted mapping types, but would only compare + # their keys, which is probably not what most people would expect. + + if _is_numpy_array(expected): + cls = ApproxNumpy + elif isinstance(expected, Mapping): + cls = ApproxMapping + elif isinstance(expected, Sequence) and not isinstance(expected, String): + cls = ApproxSequence + else: + cls = ApproxScalar + + return cls(expected, rel, abs, nan_ok) + + +def _is_numpy_array(obj): + """ + Return true if the given object is a numpy array. Make a special effort to + avoid importing numpy unless it's really necessary. + """ + import inspect + + for cls in inspect.getmro(type(obj)): + if cls.__module__ == 'numpy': + try: + import numpy as np + return isinstance(obj, np.ndarray) + except ImportError: + pass + + return False + + +# builtin pytest.raises helper + +def raises(expected_exception, *args, **kwargs): + """ + Assert that a code block/function call raises ``expected_exception`` + and raise a failure exception otherwise. + + This helper produces a ``ExceptionInfo()`` object (see below). + + If using Python 2.5 or above, you may use this function as a + context manager:: + + >>> with raises(ZeroDivisionError): + ... 1/0 + + .. versionchanged:: 2.10 + + In the context manager form you may use the keyword argument + ``message`` to specify a custom failure message:: + + >>> with raises(ZeroDivisionError, message="Expecting ZeroDivisionError"): + ... pass + Traceback (most recent call last): + ... + Failed: Expecting ZeroDivisionError + + .. note:: + + When using ``pytest.raises`` as a context manager, it's worthwhile to + note that normal context manager rules apply and that the exception + raised *must* be the final line in the scope of the context manager. + Lines of code after that, within the scope of the context manager will + not be executed. For example:: + + >>> value = 15 + >>> with raises(ValueError) as exc_info: + ... if value > 10: + ... raise ValueError("value must be <= 10") + ... assert exc_info.type == ValueError # this will not execute + + Instead, the following approach must be taken (note the difference in + scope):: + + >>> with raises(ValueError) as exc_info: + ... if value > 10: + ... raise ValueError("value must be <= 10") + ... + >>> assert exc_info.type == ValueError + + + Since version ``3.1`` you can use the keyword argument ``match`` to assert that the + exception matches a text or regex:: + + >>> with raises(ValueError, match='must be 0 or None'): + ... raise ValueError("value must be 0 or None") + + >>> with raises(ValueError, match=r'must be \d+$'): + ... raise ValueError("value must be 42") + + **Legacy forms** + + The forms below are fully supported but are discouraged for new code because the + context manager form is regarded as more readable and less error-prone. + + It is possible to specify a callable by passing a to-be-called lambda:: + + >>> raises(ZeroDivisionError, lambda: 1/0) + + + or you can specify an arbitrary callable with arguments:: + + >>> def f(x): return 1/x + ... + >>> raises(ZeroDivisionError, f, 0) + + >>> raises(ZeroDivisionError, f, x=0) + + + It is also possible to pass a string to be evaluated at runtime:: + + >>> raises(ZeroDivisionError, "f(0)") + + + The string will be evaluated using the same ``locals()`` and ``globals()`` + at the moment of the ``raises`` call. + + .. autoclass:: _pytest._code.ExceptionInfo + :members: + + .. note:: + Similar to caught exception objects in Python, explicitly clearing + local references to returned ``ExceptionInfo`` objects can + help the Python interpreter speed up its garbage collection. + + Clearing those references breaks a reference cycle + (``ExceptionInfo`` --> caught exception --> frame stack raising + the exception --> current frame stack --> local variables --> + ``ExceptionInfo``) which makes Python keep all objects referenced + from that cycle (including all local variables in the current + frame) alive until the next cyclic garbage collection run. See the + official Python ``try`` statement documentation for more detailed + information. + + """ + __tracebackhide__ = True + msg = ("exceptions must be old-style classes or" + " derived from BaseException, not %s") + if isinstance(expected_exception, tuple): + for exc in expected_exception: + if not isclass(exc): + raise TypeError(msg % type(exc)) + elif not isclass(expected_exception): + raise TypeError(msg % type(expected_exception)) + + message = "DID NOT RAISE {0}".format(expected_exception) + match_expr = None + + if not args: + if "message" in kwargs: + message = kwargs.pop("message") + if "match" in kwargs: + match_expr = kwargs.pop("match") + message += " matching '{0}'".format(match_expr) + return RaisesContext(expected_exception, message, match_expr) + elif isinstance(args[0], str): + code, = args + assert isinstance(code, str) + frame = sys._getframe(1) + loc = frame.f_locals.copy() + loc.update(kwargs) + # print "raises frame scope: %r" % frame.f_locals + try: + code = _pytest._code.Source(code).compile() + py.builtin.exec_(code, frame.f_globals, loc) + # XXX didn'T mean f_globals == f_locals something special? + # this is destroyed here ... + except expected_exception: + return _pytest._code.ExceptionInfo() + else: + func = args[0] + try: + func(*args[1:], **kwargs) + except expected_exception: + return _pytest._code.ExceptionInfo() + fail(message) + + +raises.Exception = fail.Exception + + +class RaisesContext(object): + def __init__(self, expected_exception, message, match_expr): + self.expected_exception = expected_exception + self.message = message + self.match_expr = match_expr + self.excinfo = None + + def __enter__(self): + self.excinfo = object.__new__(_pytest._code.ExceptionInfo) + return self.excinfo + + def __exit__(self, *tp): + __tracebackhide__ = True + if tp[0] is None: + fail(self.message) + if sys.version_info < (2, 7): + # py26: on __exit__() exc_value often does not contain the + # exception value. + # http://bugs.python.org/issue7853 + if not isinstance(tp[1], BaseException): + exc_type, value, traceback = tp + tp = exc_type, exc_type(value), traceback + self.excinfo.__init__(tp) + suppress_exception = issubclass(self.excinfo.type, self.expected_exception) + if sys.version_info[0] == 2 and suppress_exception: + sys.exc_clear() + if self.match_expr: + self.excinfo.match(self.match_expr) + return suppress_exception diff --git a/lib/spack/external/pytest-fallback/_pytest/recwarn.py b/lib/spack/external/pytest-fallback/_pytest/recwarn.py new file mode 100644 index 0000000000..c9fa872c07 --- /dev/null +++ b/lib/spack/external/pytest-fallback/_pytest/recwarn.py @@ -0,0 +1,205 @@ +""" recording warnings during test function execution. """ +from __future__ import absolute_import, division, print_function + +import inspect + +import _pytest._code +import py +import sys +import warnings + +from _pytest.fixtures import yield_fixture +from _pytest.outcomes import fail + + +@yield_fixture +def recwarn(): + """Return a WarningsRecorder instance that provides these methods: + + * ``pop(category=None)``: return last warning matching the category. + * ``clear()``: clear list of warnings + + See http://docs.python.org/library/warnings.html for information + on warning categories. + """ + wrec = WarningsRecorder() + with wrec: + warnings.simplefilter('default') + yield wrec + + +def deprecated_call(func=None, *args, **kwargs): + """context manager that can be used to ensure a block of code triggers a + ``DeprecationWarning`` or ``PendingDeprecationWarning``:: + + >>> import warnings + >>> def api_call_v2(): + ... warnings.warn('use v3 of this api', DeprecationWarning) + ... return 200 + + >>> with deprecated_call(): + ... assert api_call_v2() == 200 + + ``deprecated_call`` can also be used by passing a function and ``*args`` and ``*kwargs``, + in which case it will ensure calling ``func(*args, **kwargs)`` produces one of the warnings + types above. + """ + if not func: + return _DeprecatedCallContext() + else: + __tracebackhide__ = True + with _DeprecatedCallContext(): + return func(*args, **kwargs) + + +class _DeprecatedCallContext(object): + """Implements the logic to capture deprecation warnings as a context manager.""" + + def __enter__(self): + self._captured_categories = [] + self._old_warn = warnings.warn + self._old_warn_explicit = warnings.warn_explicit + warnings.warn_explicit = self._warn_explicit + warnings.warn = self._warn + + def _warn_explicit(self, message, category, *args, **kwargs): + self._captured_categories.append(category) + + def _warn(self, message, category=None, *args, **kwargs): + if isinstance(message, Warning): + self._captured_categories.append(message.__class__) + else: + self._captured_categories.append(category) + + def __exit__(self, exc_type, exc_val, exc_tb): + warnings.warn_explicit = self._old_warn_explicit + warnings.warn = self._old_warn + + if exc_type is None: + deprecation_categories = (DeprecationWarning, PendingDeprecationWarning) + if not any(issubclass(c, deprecation_categories) for c in self._captured_categories): + __tracebackhide__ = True + msg = "Did not produce DeprecationWarning or PendingDeprecationWarning" + raise AssertionError(msg) + + +def warns(expected_warning, *args, **kwargs): + """Assert that code raises a particular class of warning. + + Specifically, the input @expected_warning can be a warning class or + tuple of warning classes, and the code must return that warning + (if a single class) or one of those warnings (if a tuple). + + This helper produces a list of ``warnings.WarningMessage`` objects, + one for each warning raised. + + This function can be used as a context manager, or any of the other ways + ``pytest.raises`` can be used:: + + >>> with warns(RuntimeWarning): + ... warnings.warn("my warning", RuntimeWarning) + """ + wcheck = WarningsChecker(expected_warning) + if not args: + return wcheck + elif isinstance(args[0], str): + code, = args + assert isinstance(code, str) + frame = sys._getframe(1) + loc = frame.f_locals.copy() + loc.update(kwargs) + + with wcheck: + code = _pytest._code.Source(code).compile() + py.builtin.exec_(code, frame.f_globals, loc) + else: + func = args[0] + with wcheck: + return func(*args[1:], **kwargs) + + +class WarningsRecorder(warnings.catch_warnings): + """A context manager to record raised warnings. + + Adapted from `warnings.catch_warnings`. + """ + + def __init__(self): + super(WarningsRecorder, self).__init__(record=True) + self._entered = False + self._list = [] + + @property + def list(self): + """The list of recorded warnings.""" + return self._list + + def __getitem__(self, i): + """Get a recorded warning by index.""" + return self._list[i] + + def __iter__(self): + """Iterate through the recorded warnings.""" + return iter(self._list) + + def __len__(self): + """The number of recorded warnings.""" + return len(self._list) + + def pop(self, cls=Warning): + """Pop the first recorded warning, raise exception if not exists.""" + for i, w in enumerate(self._list): + if issubclass(w.category, cls): + return self._list.pop(i) + __tracebackhide__ = True + raise AssertionError("%r not found in warning list" % cls) + + def clear(self): + """Clear the list of recorded warnings.""" + self._list[:] = [] + + def __enter__(self): + if self._entered: + __tracebackhide__ = True + raise RuntimeError("Cannot enter %r twice" % self) + self._list = super(WarningsRecorder, self).__enter__() + warnings.simplefilter('always') + return self + + def __exit__(self, *exc_info): + if not self._entered: + __tracebackhide__ = True + raise RuntimeError("Cannot exit %r without entering first" % self) + super(WarningsRecorder, self).__exit__(*exc_info) + + +class WarningsChecker(WarningsRecorder): + def __init__(self, expected_warning=None): + super(WarningsChecker, self).__init__() + + msg = ("exceptions must be old-style classes or " + "derived from Warning, not %s") + if isinstance(expected_warning, tuple): + for exc in expected_warning: + if not inspect.isclass(exc): + raise TypeError(msg % type(exc)) + elif inspect.isclass(expected_warning): + expected_warning = (expected_warning,) + elif expected_warning is not None: + raise TypeError(msg % type(expected_warning)) + + self.expected_warning = expected_warning + + def __exit__(self, *exc_info): + super(WarningsChecker, self).__exit__(*exc_info) + + # only check if we're not currently handling an exception + if all(a is None for a in exc_info): + if self.expected_warning is not None: + if not any(issubclass(r.category, self.expected_warning) + for r in self): + __tracebackhide__ = True + fail("DID NOT WARN. No warnings of type {0} was emitted. " + "The list of emitted warnings is: {1}.".format( + self.expected_warning, + [each.message for each in self])) diff --git a/lib/spack/external/pytest-fallback/_pytest/resultlog.py b/lib/spack/external/pytest-fallback/_pytest/resultlog.py new file mode 100644 index 0000000000..9f9c2d1f65 --- /dev/null +++ b/lib/spack/external/pytest-fallback/_pytest/resultlog.py @@ -0,0 +1,113 @@ +""" log machine-parseable test session result information in a plain +text file. +""" +from __future__ import absolute_import, division, print_function + +import py +import os + + +def pytest_addoption(parser): + group = parser.getgroup("terminal reporting", "resultlog plugin options") + group.addoption('--resultlog', '--result-log', action="store", + metavar="path", default=None, + help="DEPRECATED path for machine-readable result log.") + + +def pytest_configure(config): + resultlog = config.option.resultlog + # prevent opening resultlog on slave nodes (xdist) + if resultlog and not hasattr(config, 'slaveinput'): + dirname = os.path.dirname(os.path.abspath(resultlog)) + if not os.path.isdir(dirname): + os.makedirs(dirname) + logfile = open(resultlog, 'w', 1) # line buffered + config._resultlog = ResultLog(config, logfile) + config.pluginmanager.register(config._resultlog) + + from _pytest.deprecated import RESULT_LOG + config.warn('C1', RESULT_LOG) + + +def pytest_unconfigure(config): + resultlog = getattr(config, '_resultlog', None) + if resultlog: + resultlog.logfile.close() + del config._resultlog + config.pluginmanager.unregister(resultlog) + + +def generic_path(item): + chain = item.listchain() + gpath = [chain[0].name] + fspath = chain[0].fspath + fspart = False + for node in chain[1:]: + newfspath = node.fspath + if newfspath == fspath: + if fspart: + gpath.append(':') + fspart = False + else: + gpath.append('.') + else: + gpath.append('/') + fspart = True + name = node.name + if name[0] in '([': + gpath.pop() + gpath.append(name) + fspath = newfspath + return ''.join(gpath) + + +class ResultLog(object): + def __init__(self, config, logfile): + self.config = config + self.logfile = logfile # preferably line buffered + + def write_log_entry(self, testpath, lettercode, longrepr): + print("%s %s" % (lettercode, testpath), file=self.logfile) + for line in longrepr.splitlines(): + print(" %s" % line, file=self.logfile) + + def log_outcome(self, report, lettercode, longrepr): + testpath = getattr(report, 'nodeid', None) + if testpath is None: + testpath = report.fspath + self.write_log_entry(testpath, lettercode, longrepr) + + def pytest_runtest_logreport(self, report): + if report.when != "call" and report.passed: + return + res = self.config.hook.pytest_report_teststatus(report=report) + code = res[1] + if code == 'x': + longrepr = str(report.longrepr) + elif code == 'X': + longrepr = '' + elif report.passed: + longrepr = "" + elif report.failed: + longrepr = str(report.longrepr) + elif report.skipped: + longrepr = str(report.longrepr[2]) + self.log_outcome(report, code, longrepr) + + def pytest_collectreport(self, report): + if not report.passed: + if report.failed: + code = "F" + longrepr = str(report.longrepr) + else: + assert report.skipped + code = "S" + longrepr = "%s:%d: %s" % report.longrepr + self.log_outcome(report, code, longrepr) + + def pytest_internalerror(self, excrepr): + reprcrash = getattr(excrepr, 'reprcrash', None) + path = getattr(reprcrash, "path", None) + if path is None: + path = "cwd:%s" % py.path.local() + self.write_log_entry(path, '!', str(excrepr)) diff --git a/lib/spack/external/pytest-fallback/_pytest/runner.py b/lib/spack/external/pytest-fallback/_pytest/runner.py new file mode 100644 index 0000000000..b643fa3c91 --- /dev/null +++ b/lib/spack/external/pytest-fallback/_pytest/runner.py @@ -0,0 +1,508 @@ +""" basic collect and runtest protocol implementations """ +from __future__ import absolute_import, division, print_function + +import bdb +import os +import sys +from time import time + +import py +from _pytest.compat import _PY2 +from _pytest._code.code import TerminalRepr, ExceptionInfo +from _pytest.outcomes import skip, Skipped, TEST_OUTCOME + +# +# pytest plugin hooks + + +def pytest_addoption(parser): + group = parser.getgroup("terminal reporting", "reporting", after="general") + group.addoption('--durations', + action="store", type=int, default=None, metavar="N", + help="show N slowest setup/test durations (N=0 for all)."), + + +def pytest_terminal_summary(terminalreporter): + durations = terminalreporter.config.option.durations + if durations is None: + return + tr = terminalreporter + dlist = [] + for replist in tr.stats.values(): + for rep in replist: + if hasattr(rep, 'duration'): + dlist.append(rep) + if not dlist: + return + dlist.sort(key=lambda x: x.duration) + dlist.reverse() + if not durations: + tr.write_sep("=", "slowest test durations") + else: + tr.write_sep("=", "slowest %s test durations" % durations) + dlist = dlist[:durations] + + for rep in dlist: + nodeid = rep.nodeid.replace("::()::", "::") + tr.write_line("%02.2fs %-8s %s" % + (rep.duration, rep.when, nodeid)) + + +def pytest_sessionstart(session): + session._setupstate = SetupState() + + +def pytest_sessionfinish(session): + session._setupstate.teardown_all() + + +def pytest_runtest_protocol(item, nextitem): + item.ihook.pytest_runtest_logstart( + nodeid=item.nodeid, location=item.location, + ) + runtestprotocol(item, nextitem=nextitem) + return True + + +def runtestprotocol(item, log=True, nextitem=None): + hasrequest = hasattr(item, "_request") + if hasrequest and not item._request: + item._initrequest() + rep = call_and_report(item, "setup", log) + reports = [rep] + if rep.passed: + if item.config.option.setupshow: + show_test_item(item) + if not item.config.option.setuponly: + reports.append(call_and_report(item, "call", log)) + reports.append(call_and_report(item, "teardown", log, + nextitem=nextitem)) + # after all teardown hooks have been called + # want funcargs and request info to go away + if hasrequest: + item._request = False + item.funcargs = None + return reports + + +def show_test_item(item): + """Show test function, parameters and the fixtures of the test item.""" + tw = item.config.get_terminal_writer() + tw.line() + tw.write(' ' * 8) + tw.write(item._nodeid) + used_fixtures = sorted(item._fixtureinfo.name2fixturedefs.keys()) + if used_fixtures: + tw.write(' (fixtures used: {0})'.format(', '.join(used_fixtures))) + + +def pytest_runtest_setup(item): + _update_current_test_var(item, 'setup') + item.session._setupstate.prepare(item) + + +def pytest_runtest_call(item): + _update_current_test_var(item, 'call') + try: + item.runtest() + except Exception: + # Store trace info to allow postmortem debugging + type, value, tb = sys.exc_info() + tb = tb.tb_next # Skip *this* frame + sys.last_type = type + sys.last_value = value + sys.last_traceback = tb + del tb # Get rid of it in this namespace + raise + + +def pytest_runtest_teardown(item, nextitem): + _update_current_test_var(item, 'teardown') + item.session._setupstate.teardown_exact(item, nextitem) + _update_current_test_var(item, None) + + +def _update_current_test_var(item, when): + """ + Update PYTEST_CURRENT_TEST to reflect the current item and stage. + + If ``when`` is None, delete PYTEST_CURRENT_TEST from the environment. + """ + var_name = 'PYTEST_CURRENT_TEST' + if when: + value = '{0} ({1})'.format(item.nodeid, when) + if _PY2: + # python 2 doesn't like null bytes on environment variables (see #2644) + value = value.replace('\x00', '(null)') + os.environ[var_name] = value + else: + os.environ.pop(var_name) + + +def pytest_report_teststatus(report): + if report.when in ("setup", "teardown"): + if report.failed: + # category, shortletter, verbose-word + return "error", "E", "ERROR" + elif report.skipped: + return "skipped", "s", "SKIPPED" + else: + return "", "", "" + + +# +# Implementation + +def call_and_report(item, when, log=True, **kwds): + call = call_runtest_hook(item, when, **kwds) + hook = item.ihook + report = hook.pytest_runtest_makereport(item=item, call=call) + if log: + hook.pytest_runtest_logreport(report=report) + if check_interactive_exception(call, report): + hook.pytest_exception_interact(node=item, call=call, report=report) + return report + + +def check_interactive_exception(call, report): + return call.excinfo and not ( + hasattr(report, "wasxfail") or + call.excinfo.errisinstance(skip.Exception) or + call.excinfo.errisinstance(bdb.BdbQuit)) + + +def call_runtest_hook(item, when, **kwds): + hookname = "pytest_runtest_" + when + ihook = getattr(item.ihook, hookname) + return CallInfo(lambda: ihook(item=item, **kwds), when=when) + + +class CallInfo: + """ Result/Exception info a function invocation. """ + #: None or ExceptionInfo object. + excinfo = None + + def __init__(self, func, when): + #: context of invocation: one of "setup", "call", + #: "teardown", "memocollect" + self.when = when + self.start = time() + try: + self.result = func() + except KeyboardInterrupt: + self.stop = time() + raise + except: # noqa + self.excinfo = ExceptionInfo() + self.stop = time() + + def __repr__(self): + if self.excinfo: + status = "exception: %s" % str(self.excinfo.value) + else: + status = "result: %r" % (self.result,) + return "" % (self.when, status) + + +def getslaveinfoline(node): + try: + return node._slaveinfocache + except AttributeError: + d = node.slaveinfo + ver = "%s.%s.%s" % d['version_info'][:3] + node._slaveinfocache = s = "[%s] %s -- Python %s %s" % ( + d['id'], d['sysplatform'], ver, d['executable']) + return s + + +class BaseReport(object): + + def __init__(self, **kw): + self.__dict__.update(kw) + + def toterminal(self, out): + if hasattr(self, 'node'): + out.line(getslaveinfoline(self.node)) + + longrepr = self.longrepr + if longrepr is None: + return + + if hasattr(longrepr, 'toterminal'): + longrepr.toterminal(out) + else: + try: + out.line(longrepr) + except UnicodeEncodeError: + out.line("") + + def get_sections(self, prefix): + for name, content in self.sections: + if name.startswith(prefix): + yield prefix, content + + @property + def longreprtext(self): + """ + Read-only property that returns the full string representation + of ``longrepr``. + + .. versionadded:: 3.0 + """ + tw = py.io.TerminalWriter(stringio=True) + tw.hasmarkup = False + self.toterminal(tw) + exc = tw.stringio.getvalue() + return exc.strip() + + @property + def capstdout(self): + """Return captured text from stdout, if capturing is enabled + + .. versionadded:: 3.0 + """ + return ''.join(content for (prefix, content) in self.get_sections('Captured stdout')) + + @property + def capstderr(self): + """Return captured text from stderr, if capturing is enabled + + .. versionadded:: 3.0 + """ + return ''.join(content for (prefix, content) in self.get_sections('Captured stderr')) + + passed = property(lambda x: x.outcome == "passed") + failed = property(lambda x: x.outcome == "failed") + skipped = property(lambda x: x.outcome == "skipped") + + @property + def fspath(self): + return self.nodeid.split("::")[0] + + +def pytest_runtest_makereport(item, call): + when = call.when + duration = call.stop - call.start + keywords = dict([(x, 1) for x in item.keywords]) + excinfo = call.excinfo + sections = [] + if not call.excinfo: + outcome = "passed" + longrepr = None + else: + if not isinstance(excinfo, ExceptionInfo): + outcome = "failed" + longrepr = excinfo + elif excinfo.errisinstance(skip.Exception): + outcome = "skipped" + r = excinfo._getreprcrash() + longrepr = (str(r.path), r.lineno, r.message) + else: + outcome = "failed" + if call.when == "call": + longrepr = item.repr_failure(excinfo) + else: # exception in setup or teardown + longrepr = item._repr_failure_py(excinfo, + style=item.config.option.tbstyle) + for rwhen, key, content in item._report_sections: + sections.append(("Captured %s %s" % (key, rwhen), content)) + return TestReport(item.nodeid, item.location, + keywords, outcome, longrepr, when, + sections, duration) + + +class TestReport(BaseReport): + """ Basic test report object (also used for setup and teardown calls if + they fail). + """ + + def __init__(self, nodeid, location, keywords, outcome, + longrepr, when, sections=(), duration=0, **extra): + #: normalized collection node id + self.nodeid = nodeid + + #: a (filesystempath, lineno, domaininfo) tuple indicating the + #: actual location of a test item - it might be different from the + #: collected one e.g. if a method is inherited from a different module. + self.location = location + + #: a name -> value dictionary containing all keywords and + #: markers associated with a test invocation. + self.keywords = keywords + + #: test outcome, always one of "passed", "failed", "skipped". + self.outcome = outcome + + #: None or a failure representation. + self.longrepr = longrepr + + #: one of 'setup', 'call', 'teardown' to indicate runtest phase. + self.when = when + + #: list of pairs ``(str, str)`` of extra information which needs to + #: marshallable. Used by pytest to add captured text + #: from ``stdout`` and ``stderr``, but may be used by other plugins + #: to add arbitrary information to reports. + self.sections = list(sections) + + #: time it took to run just the test + self.duration = duration + + self.__dict__.update(extra) + + def __repr__(self): + return "" % ( + self.nodeid, self.when, self.outcome) + + +class TeardownErrorReport(BaseReport): + outcome = "failed" + when = "teardown" + + def __init__(self, longrepr, **extra): + self.longrepr = longrepr + self.sections = [] + self.__dict__.update(extra) + + +def pytest_make_collect_report(collector): + call = CallInfo( + lambda: list(collector.collect()), + 'collect') + longrepr = None + if not call.excinfo: + outcome = "passed" + else: + from _pytest import nose + skip_exceptions = (Skipped,) + nose.get_skip_exceptions() + if call.excinfo.errisinstance(skip_exceptions): + outcome = "skipped" + r = collector._repr_failure_py(call.excinfo, "line").reprcrash + longrepr = (str(r.path), r.lineno, r.message) + else: + outcome = "failed" + errorinfo = collector.repr_failure(call.excinfo) + if not hasattr(errorinfo, "toterminal"): + errorinfo = CollectErrorRepr(errorinfo) + longrepr = errorinfo + rep = CollectReport(collector.nodeid, outcome, longrepr, + getattr(call, 'result', None)) + rep.call = call # see collect_one_node + return rep + + +class CollectReport(BaseReport): + def __init__(self, nodeid, outcome, longrepr, result, + sections=(), **extra): + self.nodeid = nodeid + self.outcome = outcome + self.longrepr = longrepr + self.result = result or [] + self.sections = list(sections) + self.__dict__.update(extra) + + @property + def location(self): + return (self.fspath, None, self.fspath) + + def __repr__(self): + return "" % ( + self.nodeid, len(self.result), self.outcome) + + +class CollectErrorRepr(TerminalRepr): + def __init__(self, msg): + self.longrepr = msg + + def toterminal(self, out): + out.line(self.longrepr, red=True) + + +class SetupState(object): + """ shared state for setting up/tearing down test items or collectors. """ + + def __init__(self): + self.stack = [] + self._finalizers = {} + + def addfinalizer(self, finalizer, colitem): + """ attach a finalizer to the given colitem. + if colitem is None, this will add a finalizer that + is called at the end of teardown_all(). + """ + assert colitem and not isinstance(colitem, tuple) + assert py.builtin.callable(finalizer) + # assert colitem in self.stack # some unit tests don't setup stack :/ + self._finalizers.setdefault(colitem, []).append(finalizer) + + def _pop_and_teardown(self): + colitem = self.stack.pop() + self._teardown_with_finalization(colitem) + + def _callfinalizers(self, colitem): + finalizers = self._finalizers.pop(colitem, None) + exc = None + while finalizers: + fin = finalizers.pop() + try: + fin() + except TEST_OUTCOME: + # XXX Only first exception will be seen by user, + # ideally all should be reported. + if exc is None: + exc = sys.exc_info() + if exc: + py.builtin._reraise(*exc) + + def _teardown_with_finalization(self, colitem): + self._callfinalizers(colitem) + if hasattr(colitem, "teardown"): + colitem.teardown() + for colitem in self._finalizers: + assert colitem is None or colitem in self.stack \ + or isinstance(colitem, tuple) + + def teardown_all(self): + while self.stack: + self._pop_and_teardown() + for key in list(self._finalizers): + self._teardown_with_finalization(key) + assert not self._finalizers + + def teardown_exact(self, item, nextitem): + needed_collectors = nextitem and nextitem.listchain() or [] + self._teardown_towards(needed_collectors) + + def _teardown_towards(self, needed_collectors): + while self.stack: + if self.stack == needed_collectors[:len(self.stack)]: + break + self._pop_and_teardown() + + def prepare(self, colitem): + """ setup objects along the collector chain to the test-method + and teardown previously setup objects.""" + needed_collectors = colitem.listchain() + self._teardown_towards(needed_collectors) + + # check if the last collection node has raised an error + for col in self.stack: + if hasattr(col, '_prepare_exc'): + py.builtin._reraise(*col._prepare_exc) + for col in needed_collectors[len(self.stack):]: + self.stack.append(col) + try: + col.setup() + except TEST_OUTCOME: + col._prepare_exc = sys.exc_info() + raise + + +def collect_one_node(collector): + ihook = collector.ihook + ihook.pytest_collectstart(collector=collector) + rep = ihook.pytest_make_collect_report(collector=collector) + call = rep.__dict__.pop("call", None) + if call and check_interactive_exception(call, rep): + ihook.pytest_exception_interact(node=collector, call=call, report=rep) + return rep diff --git a/lib/spack/external/pytest-fallback/_pytest/setuponly.py b/lib/spack/external/pytest-fallback/_pytest/setuponly.py new file mode 100644 index 0000000000..15e195ad5a --- /dev/null +++ b/lib/spack/external/pytest-fallback/_pytest/setuponly.py @@ -0,0 +1,74 @@ +from __future__ import absolute_import, division, print_function + +import pytest +import sys + + +def pytest_addoption(parser): + group = parser.getgroup("debugconfig") + group.addoption('--setuponly', '--setup-only', action="store_true", + help="only setup fixtures, do not execute tests.") + group.addoption('--setupshow', '--setup-show', action="store_true", + help="show setup of fixtures while executing tests.") + + +@pytest.hookimpl(hookwrapper=True) +def pytest_fixture_setup(fixturedef, request): + yield + config = request.config + if config.option.setupshow: + if hasattr(request, 'param'): + # Save the fixture parameter so ._show_fixture_action() can + # display it now and during the teardown (in .finish()). + if fixturedef.ids: + if callable(fixturedef.ids): + fixturedef.cached_param = fixturedef.ids(request.param) + else: + fixturedef.cached_param = fixturedef.ids[ + request.param_index] + else: + fixturedef.cached_param = request.param + _show_fixture_action(fixturedef, 'SETUP') + + +def pytest_fixture_post_finalizer(fixturedef): + if hasattr(fixturedef, "cached_result"): + config = fixturedef._fixturemanager.config + if config.option.setupshow: + _show_fixture_action(fixturedef, 'TEARDOWN') + if hasattr(fixturedef, "cached_param"): + del fixturedef.cached_param + + +def _show_fixture_action(fixturedef, msg): + config = fixturedef._fixturemanager.config + capman = config.pluginmanager.getplugin('capturemanager') + if capman: + out, err = capman.suspendcapture() + + tw = config.get_terminal_writer() + tw.line() + tw.write(' ' * 2 * fixturedef.scopenum) + tw.write('{step} {scope} {fixture}'.format( + step=msg.ljust(8), # align the output to TEARDOWN + scope=fixturedef.scope[0].upper(), + fixture=fixturedef.argname)) + + if msg == 'SETUP': + deps = sorted(arg for arg in fixturedef.argnames if arg != 'request') + if deps: + tw.write(' (fixtures used: {0})'.format(', '.join(deps))) + + if hasattr(fixturedef, 'cached_param'): + tw.write('[{0}]'.format(fixturedef.cached_param)) + + if capman: + capman.resumecapture() + sys.stdout.write(out) + sys.stderr.write(err) + + +@pytest.hookimpl(tryfirst=True) +def pytest_cmdline_main(config): + if config.option.setuponly: + config.option.setupshow = True diff --git a/lib/spack/external/pytest-fallback/_pytest/setupplan.py b/lib/spack/external/pytest-fallback/_pytest/setupplan.py new file mode 100644 index 0000000000..e11bd40698 --- /dev/null +++ b/lib/spack/external/pytest-fallback/_pytest/setupplan.py @@ -0,0 +1,25 @@ +from __future__ import absolute_import, division, print_function + +import pytest + + +def pytest_addoption(parser): + group = parser.getgroup("debugconfig") + group.addoption('--setupplan', '--setup-plan', action="store_true", + help="show what fixtures and tests would be executed but " + "don't execute anything.") + + +@pytest.hookimpl(tryfirst=True) +def pytest_fixture_setup(fixturedef, request): + # Will return a dummy fixture if the setuponly option is provided. + if request.config.option.setupplan: + fixturedef.cached_result = (None, None, None) + return fixturedef.cached_result + + +@pytest.hookimpl(tryfirst=True) +def pytest_cmdline_main(config): + if config.option.setupplan: + config.option.setuponly = True + config.option.setupshow = True diff --git a/lib/spack/external/pytest-fallback/_pytest/skipping.py b/lib/spack/external/pytest-fallback/_pytest/skipping.py new file mode 100644 index 0000000000..b92800d10b --- /dev/null +++ b/lib/spack/external/pytest-fallback/_pytest/skipping.py @@ -0,0 +1,372 @@ +""" support for skip/xfail functions and markers. """ +from __future__ import absolute_import, division, print_function + +import os +import sys +import traceback + +import py +from _pytest.config import hookimpl +from _pytest.mark import MarkInfo, MarkDecorator +from _pytest.outcomes import fail, skip, xfail, TEST_OUTCOME + + +def pytest_addoption(parser): + group = parser.getgroup("general") + group.addoption('--runxfail', + action="store_true", dest="runxfail", default=False, + help="run tests even if they are marked xfail") + + parser.addini("xfail_strict", "default for the strict parameter of xfail " + "markers when not given explicitly (default: " + "False)", + default=False, + type="bool") + + +def pytest_configure(config): + if config.option.runxfail: + # yay a hack + import pytest + old = pytest.xfail + config._cleanup.append(lambda: setattr(pytest, "xfail", old)) + + def nop(*args, **kwargs): + pass + + nop.Exception = xfail.Exception + setattr(pytest, "xfail", nop) + + config.addinivalue_line("markers", + "skip(reason=None): skip the given test function with an optional reason. " + "Example: skip(reason=\"no way of currently testing this\") skips the " + "test." + ) + config.addinivalue_line("markers", + "skipif(condition): skip the given test function if eval(condition) " + "results in a True value. Evaluation happens within the " + "module global context. Example: skipif('sys.platform == \"win32\"') " + "skips the test if we are on the win32 platform. see " + "http://pytest.org/latest/skipping.html" + ) + config.addinivalue_line("markers", + "xfail(condition, reason=None, run=True, raises=None, strict=False): " + "mark the test function as an expected failure if eval(condition) " + "has a True value. Optionally specify a reason for better reporting " + "and run=False if you don't even want to execute the test function. " + "If only specific exception(s) are expected, you can list them in " + "raises, and if the test fails in other ways, it will be reported as " + "a true failure. See http://pytest.org/latest/skipping.html" + ) + + +class MarkEvaluator: + def __init__(self, item, name): + self.item = item + self.name = name + + @property + def holder(self): + return self.item.keywords.get(self.name) + + def __bool__(self): + return bool(self.holder) + __nonzero__ = __bool__ + + def wasvalid(self): + return not hasattr(self, 'exc') + + def invalidraise(self, exc): + raises = self.get('raises') + if not raises: + return + return not isinstance(exc, raises) + + def istrue(self): + try: + return self._istrue() + except TEST_OUTCOME: + self.exc = sys.exc_info() + if isinstance(self.exc[1], SyntaxError): + msg = [" " * (self.exc[1].offset + 4) + "^", ] + msg.append("SyntaxError: invalid syntax") + else: + msg = traceback.format_exception_only(*self.exc[:2]) + fail("Error evaluating %r expression\n" + " %s\n" + "%s" + % (self.name, self.expr, "\n".join(msg)), + pytrace=False) + + def _getglobals(self): + d = {'os': os, 'sys': sys, 'config': self.item.config} + if hasattr(self.item, 'obj'): + d.update(self.item.obj.__globals__) + return d + + def _istrue(self): + if hasattr(self, 'result'): + return self.result + if self.holder: + if self.holder.args or 'condition' in self.holder.kwargs: + self.result = False + # "holder" might be a MarkInfo or a MarkDecorator; only + # MarkInfo keeps track of all parameters it received in an + # _arglist attribute + marks = getattr(self.holder, '_marks', None) \ + or [self.holder.mark] + for _, args, kwargs in marks: + if 'condition' in kwargs: + args = (kwargs['condition'],) + for expr in args: + self.expr = expr + if isinstance(expr, py.builtin._basestring): + d = self._getglobals() + result = cached_eval(self.item.config, expr, d) + else: + if "reason" not in kwargs: + # XXX better be checked at collection time + msg = "you need to specify reason=STRING " \ + "when using booleans as conditions." + fail(msg) + result = bool(expr) + if result: + self.result = True + self.reason = kwargs.get('reason', None) + self.expr = expr + return self.result + else: + self.result = True + return getattr(self, 'result', False) + + def get(self, attr, default=None): + return self.holder.kwargs.get(attr, default) + + def getexplanation(self): + expl = getattr(self, 'reason', None) or self.get('reason', None) + if not expl: + if not hasattr(self, 'expr'): + return "" + else: + return "condition: " + str(self.expr) + return expl + + +@hookimpl(tryfirst=True) +def pytest_runtest_setup(item): + # Check if skip or skipif are specified as pytest marks + + skipif_info = item.keywords.get('skipif') + if isinstance(skipif_info, (MarkInfo, MarkDecorator)): + eval_skipif = MarkEvaluator(item, 'skipif') + if eval_skipif.istrue(): + item._evalskip = eval_skipif + skip(eval_skipif.getexplanation()) + + skip_info = item.keywords.get('skip') + if isinstance(skip_info, (MarkInfo, MarkDecorator)): + item._evalskip = True + if 'reason' in skip_info.kwargs: + skip(skip_info.kwargs['reason']) + elif skip_info.args: + skip(skip_info.args[0]) + else: + skip("unconditional skip") + + item._evalxfail = MarkEvaluator(item, 'xfail') + check_xfail_no_run(item) + + +@hookimpl(hookwrapper=True) +def pytest_pyfunc_call(pyfuncitem): + check_xfail_no_run(pyfuncitem) + outcome = yield + passed = outcome.excinfo is None + if passed: + check_strict_xfail(pyfuncitem) + + +def check_xfail_no_run(item): + """check xfail(run=False)""" + if not item.config.option.runxfail: + evalxfail = item._evalxfail + if evalxfail.istrue(): + if not evalxfail.get('run', True): + xfail("[NOTRUN] " + evalxfail.getexplanation()) + + +def check_strict_xfail(pyfuncitem): + """check xfail(strict=True) for the given PASSING test""" + evalxfail = pyfuncitem._evalxfail + if evalxfail.istrue(): + strict_default = pyfuncitem.config.getini('xfail_strict') + is_strict_xfail = evalxfail.get('strict', strict_default) + if is_strict_xfail: + del pyfuncitem._evalxfail + explanation = evalxfail.getexplanation() + fail('[XPASS(strict)] ' + explanation, pytrace=False) + + +@hookimpl(hookwrapper=True) +def pytest_runtest_makereport(item, call): + outcome = yield + rep = outcome.get_result() + evalxfail = getattr(item, '_evalxfail', None) + evalskip = getattr(item, '_evalskip', None) + # unitttest special case, see setting of _unexpectedsuccess + if hasattr(item, '_unexpectedsuccess') and rep.when == "call": + from _pytest.compat import _is_unittest_unexpected_success_a_failure + if item._unexpectedsuccess: + rep.longrepr = "Unexpected success: {0}".format(item._unexpectedsuccess) + else: + rep.longrepr = "Unexpected success" + if _is_unittest_unexpected_success_a_failure(): + rep.outcome = "failed" + else: + rep.outcome = "passed" + rep.wasxfail = rep.longrepr + elif item.config.option.runxfail: + pass # don't interefere + elif call.excinfo and call.excinfo.errisinstance(xfail.Exception): + rep.wasxfail = "reason: " + call.excinfo.value.msg + rep.outcome = "skipped" + elif evalxfail and not rep.skipped and evalxfail.wasvalid() and \ + evalxfail.istrue(): + if call.excinfo: + if evalxfail.invalidraise(call.excinfo.value): + rep.outcome = "failed" + else: + rep.outcome = "skipped" + rep.wasxfail = evalxfail.getexplanation() + elif call.when == "call": + strict_default = item.config.getini('xfail_strict') + is_strict_xfail = evalxfail.get('strict', strict_default) + explanation = evalxfail.getexplanation() + if is_strict_xfail: + rep.outcome = "failed" + rep.longrepr = "[XPASS(strict)] {0}".format(explanation) + else: + rep.outcome = "passed" + rep.wasxfail = explanation + elif evalskip is not None and rep.skipped and type(rep.longrepr) is tuple: + # skipped by mark.skipif; change the location of the failure + # to point to the item definition, otherwise it will display + # the location of where the skip exception was raised within pytest + filename, line, reason = rep.longrepr + filename, line = item.location[:2] + rep.longrepr = filename, line, reason + +# called by terminalreporter progress reporting + + +def pytest_report_teststatus(report): + if hasattr(report, "wasxfail"): + if report.skipped: + return "xfailed", "x", "xfail" + elif report.passed: + return "xpassed", "X", ("XPASS", {'yellow': True}) + +# called by the terminalreporter instance/plugin + + +def pytest_terminal_summary(terminalreporter): + tr = terminalreporter + if not tr.reportchars: + # for name in "xfailed skipped failed xpassed": + # if not tr.stats.get(name, 0): + # tr.write_line("HINT: use '-r' option to see extra " + # "summary info about tests") + # break + return + + lines = [] + for char in tr.reportchars: + if char == "x": + show_xfailed(terminalreporter, lines) + elif char == "X": + show_xpassed(terminalreporter, lines) + elif char in "fF": + show_simple(terminalreporter, lines, 'failed', "FAIL %s") + elif char in "sS": + show_skipped(terminalreporter, lines) + elif char == "E": + show_simple(terminalreporter, lines, 'error', "ERROR %s") + elif char == 'p': + show_simple(terminalreporter, lines, 'passed', "PASSED %s") + + if lines: + tr._tw.sep("=", "short test summary info") + for line in lines: + tr._tw.line(line) + + +def show_simple(terminalreporter, lines, stat, format): + failed = terminalreporter.stats.get(stat) + if failed: + for rep in failed: + pos = terminalreporter.config.cwd_relative_nodeid(rep.nodeid) + lines.append(format % (pos,)) + + +def show_xfailed(terminalreporter, lines): + xfailed = terminalreporter.stats.get("xfailed") + if xfailed: + for rep in xfailed: + pos = terminalreporter.config.cwd_relative_nodeid(rep.nodeid) + reason = rep.wasxfail + lines.append("XFAIL %s" % (pos,)) + if reason: + lines.append(" " + str(reason)) + + +def show_xpassed(terminalreporter, lines): + xpassed = terminalreporter.stats.get("xpassed") + if xpassed: + for rep in xpassed: + pos = terminalreporter.config.cwd_relative_nodeid(rep.nodeid) + reason = rep.wasxfail + lines.append("XPASS %s %s" % (pos, reason)) + + +def cached_eval(config, expr, d): + if not hasattr(config, '_evalcache'): + config._evalcache = {} + try: + return config._evalcache[expr] + except KeyError: + import _pytest._code + exprcode = _pytest._code.compile(expr, mode="eval") + config._evalcache[expr] = x = eval(exprcode, d) + return x + + +def folded_skips(skipped): + d = {} + for event in skipped: + key = event.longrepr + assert len(key) == 3, (event, key) + d.setdefault(key, []).append(event) + values = [] + for key, events in d.items(): + values.append((len(events),) + key) + return values + + +def show_skipped(terminalreporter, lines): + tr = terminalreporter + skipped = tr.stats.get('skipped', []) + if skipped: + # if not tr.hasopt('skipped'): + # tr.write_line( + # "%d skipped tests, specify -rs for more info" % + # len(skipped)) + # return + fskips = folded_skips(skipped) + if fskips: + # tr.write_sep("_", "skipped test summary") + for num, fspath, lineno, reason in fskips: + if reason.startswith("Skipped: "): + reason = reason[9:] + lines.append( + "SKIP [%d] %s:%d: %s" % + (num, fspath, lineno + 1, reason)) diff --git a/lib/spack/external/pytest-fallback/_pytest/terminal.py b/lib/spack/external/pytest-fallback/_pytest/terminal.py new file mode 100644 index 0000000000..9da94d0c91 --- /dev/null +++ b/lib/spack/external/pytest-fallback/_pytest/terminal.py @@ -0,0 +1,650 @@ +""" terminal reporting of the full testing process. + +This is a good source for looking at the various reporting hooks. +""" +from __future__ import absolute_import, division, print_function + +import itertools +from _pytest.main import EXIT_OK, EXIT_TESTSFAILED, EXIT_INTERRUPTED, \ + EXIT_USAGEERROR, EXIT_NOTESTSCOLLECTED +import pytest +import py +import sys +import time +import platform + +from _pytest import nodes +import _pytest._pluggy as pluggy + + +def pytest_addoption(parser): + group = parser.getgroup("terminal reporting", "reporting", after="general") + group._addoption('-v', '--verbose', action="count", + dest="verbose", default=0, help="increase verbosity."), + group._addoption('-q', '--quiet', action="count", + dest="quiet", default=0, help="decrease verbosity."), + group._addoption('-r', + action="store", dest="reportchars", default='', metavar="chars", + help="show extra test summary info as specified by chars (f)ailed, " + "(E)error, (s)skipped, (x)failed, (X)passed, " + "(p)passed, (P)passed with output, (a)all except pP. " + "Warnings are displayed at all times except when " + "--disable-warnings is set") + group._addoption('--disable-warnings', '--disable-pytest-warnings', default=False, + dest='disable_warnings', action='store_true', + help='disable warnings summary') + group._addoption('-l', '--showlocals', + action="store_true", dest="showlocals", default=False, + help="show locals in tracebacks (disabled by default).") + group._addoption('--tb', metavar="style", + action="store", dest="tbstyle", default='auto', + choices=['auto', 'long', 'short', 'no', 'line', 'native'], + help="traceback print mode (auto/long/short/line/native/no).") + group._addoption('--fulltrace', '--full-trace', + action="store_true", default=False, + help="don't cut any tracebacks (default is to cut).") + group._addoption('--color', metavar="color", + action="store", dest="color", default='auto', + choices=['yes', 'no', 'auto'], + help="color terminal output (yes/no/auto).") + + +def pytest_configure(config): + config.option.verbose -= config.option.quiet + reporter = TerminalReporter(config, sys.stdout) + config.pluginmanager.register(reporter, 'terminalreporter') + if config.option.debug or config.option.traceconfig: + def mywriter(tags, args): + msg = " ".join(map(str, args)) + reporter.write_line("[traceconfig] " + msg) + config.trace.root.setprocessor("pytest:config", mywriter) + + +def getreportopt(config): + reportopts = "" + reportchars = config.option.reportchars + if not config.option.disable_warnings and 'w' not in reportchars: + reportchars += 'w' + elif config.option.disable_warnings and 'w' in reportchars: + reportchars = reportchars.replace('w', '') + if reportchars: + for char in reportchars: + if char not in reportopts and char != 'a': + reportopts += char + elif char == 'a': + reportopts = 'fEsxXw' + return reportopts + + +def pytest_report_teststatus(report): + if report.passed: + letter = "." + elif report.skipped: + letter = "s" + elif report.failed: + letter = "F" + if report.when != "call": + letter = "f" + return report.outcome, letter, report.outcome.upper() + + +class WarningReport: + """ + Simple structure to hold warnings information captured by ``pytest_logwarning``. + """ + + def __init__(self, code, message, nodeid=None, fslocation=None): + """ + :param code: unused + :param str message: user friendly message about the warning + :param str|None nodeid: node id that generated the warning (see ``get_location``). + :param tuple|py.path.local fslocation: + file system location of the source of the warning (see ``get_location``). + """ + self.code = code + self.message = message + self.nodeid = nodeid + self.fslocation = fslocation + + def get_location(self, config): + """ + Returns the more user-friendly information about the location + of a warning, or None. + """ + if self.nodeid: + return self.nodeid + if self.fslocation: + if isinstance(self.fslocation, tuple) and len(self.fslocation) >= 2: + filename, linenum = self.fslocation[:2] + relpath = py.path.local(filename).relto(config.invocation_dir) + return '%s:%s' % (relpath, linenum) + else: + return str(self.fslocation) + return None + + +class TerminalReporter: + def __init__(self, config, file=None): + import _pytest.config + self.config = config + self.verbosity = self.config.option.verbose + self.showheader = self.verbosity >= 0 + self.showfspath = self.verbosity >= 0 + self.showlongtestinfo = self.verbosity > 0 + self._numcollected = 0 + + self.stats = {} + self.startdir = py.path.local() + if file is None: + file = sys.stdout + self._tw = self.writer = _pytest.config.create_terminal_writer(config, + file) + self.currentfspath = None + self.reportchars = getreportopt(config) + self.hasmarkup = self._tw.hasmarkup + self.isatty = file.isatty() + + def hasopt(self, char): + char = {'xfailed': 'x', 'skipped': 's'}.get(char, char) + return char in self.reportchars + + def write_fspath_result(self, nodeid, res): + fspath = self.config.rootdir.join(nodeid.split("::")[0]) + if fspath != self.currentfspath: + self.currentfspath = fspath + fspath = self.startdir.bestrelpath(fspath) + self._tw.line() + self._tw.write(fspath + " ") + self._tw.write(res) + + def write_ensure_prefix(self, prefix, extra="", **kwargs): + if self.currentfspath != prefix: + self._tw.line() + self.currentfspath = prefix + self._tw.write(prefix) + if extra: + self._tw.write(extra, **kwargs) + self.currentfspath = -2 + + def ensure_newline(self): + if self.currentfspath: + self._tw.line() + self.currentfspath = None + + def write(self, content, **markup): + self._tw.write(content, **markup) + + def write_line(self, line, **markup): + if not py.builtin._istext(line): + line = py.builtin.text(line, errors="replace") + self.ensure_newline() + self._tw.line(line, **markup) + + def rewrite(self, line, **markup): + """ + Rewinds the terminal cursor to the beginning and writes the given line. + + :kwarg erase: if True, will also add spaces until the full terminal width to ensure + previous lines are properly erased. + + The rest of the keyword arguments are markup instructions. + """ + erase = markup.pop('erase', False) + if erase: + fill_count = self._tw.fullwidth - len(line) + fill = ' ' * fill_count + else: + fill = '' + line = str(line) + self._tw.write("\r" + line + fill, **markup) + + def write_sep(self, sep, title=None, **markup): + self.ensure_newline() + self._tw.sep(sep, title, **markup) + + def section(self, title, sep="=", **kw): + self._tw.sep(sep, title, **kw) + + def line(self, msg, **kw): + self._tw.line(msg, **kw) + + def pytest_internalerror(self, excrepr): + for line in py.builtin.text(excrepr).split("\n"): + self.write_line("INTERNALERROR> " + line) + return 1 + + def pytest_logwarning(self, code, fslocation, message, nodeid): + warnings = self.stats.setdefault("warnings", []) + warning = WarningReport(code=code, fslocation=fslocation, + message=message, nodeid=nodeid) + warnings.append(warning) + + def pytest_plugin_registered(self, plugin): + if self.config.option.traceconfig: + msg = "PLUGIN registered: %s" % (plugin,) + # XXX this event may happen during setup/teardown time + # which unfortunately captures our output here + # which garbles our output if we use self.write_line + self.write_line(msg) + + def pytest_deselected(self, items): + self.stats.setdefault('deselected', []).extend(items) + + def pytest_runtest_logstart(self, nodeid, location): + # ensure that the path is printed before the + # 1st test of a module starts running + if self.showlongtestinfo: + line = self._locationline(nodeid, *location) + self.write_ensure_prefix(line, "") + elif self.showfspath: + fsid = nodeid.split("::")[0] + self.write_fspath_result(fsid, "") + + def pytest_runtest_logreport(self, report): + rep = report + res = self.config.hook.pytest_report_teststatus(report=rep) + cat, letter, word = res + self.stats.setdefault(cat, []).append(rep) + self._tests_ran = True + if not letter and not word: + # probably passed setup/teardown + return + if self.verbosity <= 0: + if not hasattr(rep, 'node') and self.showfspath: + self.write_fspath_result(rep.nodeid, letter) + else: + self._tw.write(letter) + else: + if isinstance(word, tuple): + word, markup = word + else: + if rep.passed: + markup = {'green': True} + elif rep.failed: + markup = {'red': True} + elif rep.skipped: + markup = {'yellow': True} + line = self._locationline(rep.nodeid, *rep.location) + if not hasattr(rep, 'node'): + self.write_ensure_prefix(line, word, **markup) + # self._tw.write(word, **markup) + else: + self.ensure_newline() + if hasattr(rep, 'node'): + self._tw.write("[%s] " % rep.node.gateway.id) + self._tw.write(word, **markup) + self._tw.write(" " + line) + self.currentfspath = -2 + + def pytest_collection(self): + if not self.isatty and self.config.option.verbose >= 1: + self.write("collecting ... ", bold=True) + + def pytest_collectreport(self, report): + if report.failed: + self.stats.setdefault("error", []).append(report) + elif report.skipped: + self.stats.setdefault("skipped", []).append(report) + items = [x for x in report.result if isinstance(x, pytest.Item)] + self._numcollected += len(items) + if self.isatty: + # self.write_fspath_result(report.nodeid, 'E') + self.report_collect() + + def report_collect(self, final=False): + if self.config.option.verbose < 0: + return + + errors = len(self.stats.get('error', [])) + skipped = len(self.stats.get('skipped', [])) + if final: + line = "collected " + else: + line = "collecting " + line += str(self._numcollected) + " item" + ('' if self._numcollected == 1 else 's') + if errors: + line += " / %d errors" % errors + if skipped: + line += " / %d skipped" % skipped + if self.isatty: + self.rewrite(line, bold=True, erase=True) + if final: + self.write('\n') + else: + self.write_line(line) + + def pytest_collection_modifyitems(self): + self.report_collect(True) + + @pytest.hookimpl(trylast=True) + def pytest_sessionstart(self, session): + self._sessionstarttime = time.time() + if not self.showheader: + return + self.write_sep("=", "test session starts", bold=True) + verinfo = platform.python_version() + msg = "platform %s -- Python %s" % (sys.platform, verinfo) + if hasattr(sys, 'pypy_version_info'): + verinfo = ".".join(map(str, sys.pypy_version_info[:3])) + msg += "[pypy-%s-%s]" % (verinfo, sys.pypy_version_info[3]) + msg += ", pytest-%s, py-%s, pluggy-%s" % ( + pytest.__version__, py.__version__, pluggy.__version__) + if self.verbosity > 0 or self.config.option.debug or \ + getattr(self.config.option, 'pastebin', None): + msg += " -- " + str(sys.executable) + self.write_line(msg) + lines = self.config.hook.pytest_report_header( + config=self.config, startdir=self.startdir) + self._write_report_lines_from_hooks(lines) + + def _write_report_lines_from_hooks(self, lines): + lines.reverse() + for line in flatten(lines): + self.write_line(line) + + def pytest_report_header(self, config): + inifile = "" + if config.inifile: + inifile = " " + config.rootdir.bestrelpath(config.inifile) + lines = ["rootdir: %s, inifile:%s" % (config.rootdir, inifile)] + + plugininfo = config.pluginmanager.list_plugin_distinfo() + if plugininfo: + + lines.append( + "plugins: %s" % ", ".join(_plugin_nameversions(plugininfo))) + return lines + + def pytest_collection_finish(self, session): + if self.config.option.collectonly: + self._printcollecteditems(session.items) + if self.stats.get('failed'): + self._tw.sep("!", "collection failures") + for rep in self.stats.get('failed'): + rep.toterminal(self._tw) + return 1 + return 0 + lines = self.config.hook.pytest_report_collectionfinish( + config=self.config, startdir=self.startdir, items=session.items) + self._write_report_lines_from_hooks(lines) + + def _printcollecteditems(self, items): + # to print out items and their parent collectors + # we take care to leave out Instances aka () + # because later versions are going to get rid of them anyway + if self.config.option.verbose < 0: + if self.config.option.verbose < -1: + counts = {} + for item in items: + name = item.nodeid.split('::', 1)[0] + counts[name] = counts.get(name, 0) + 1 + for name, count in sorted(counts.items()): + self._tw.line("%s: %d" % (name, count)) + else: + for item in items: + nodeid = item.nodeid + nodeid = nodeid.replace("::()::", "::") + self._tw.line(nodeid) + return + stack = [] + indent = "" + for item in items: + needed_collectors = item.listchain()[1:] # strip root node + while stack: + if stack == needed_collectors[:len(stack)]: + break + stack.pop() + for col in needed_collectors[len(stack):]: + stack.append(col) + # if col.name == "()": + # continue + indent = (len(stack) - 1) * " " + self._tw.line("%s%s" % (indent, col)) + + @pytest.hookimpl(hookwrapper=True) + def pytest_sessionfinish(self, exitstatus): + outcome = yield + outcome.get_result() + self._tw.line("") + summary_exit_codes = ( + EXIT_OK, EXIT_TESTSFAILED, EXIT_INTERRUPTED, EXIT_USAGEERROR, + EXIT_NOTESTSCOLLECTED) + if exitstatus in summary_exit_codes: + self.config.hook.pytest_terminal_summary(terminalreporter=self, + exitstatus=exitstatus) + self.summary_errors() + self.summary_failures() + self.summary_warnings() + self.summary_passes() + if exitstatus == EXIT_INTERRUPTED: + self._report_keyboardinterrupt() + del self._keyboardinterrupt_memo + self.summary_deselected() + self.summary_stats() + + def pytest_keyboard_interrupt(self, excinfo): + self._keyboardinterrupt_memo = excinfo.getrepr(funcargs=True) + + def pytest_unconfigure(self): + if hasattr(self, '_keyboardinterrupt_memo'): + self._report_keyboardinterrupt() + + def _report_keyboardinterrupt(self): + excrepr = self._keyboardinterrupt_memo + msg = excrepr.reprcrash.message + self.write_sep("!", msg) + if "KeyboardInterrupt" in msg: + if self.config.option.fulltrace: + excrepr.toterminal(self._tw) + else: + self._tw.line("to show a full traceback on KeyboardInterrupt use --fulltrace", yellow=True) + excrepr.reprcrash.toterminal(self._tw) + + def _locationline(self, nodeid, fspath, lineno, domain): + def mkrel(nodeid): + line = self.config.cwd_relative_nodeid(nodeid) + if domain and line.endswith(domain): + line = line[:-len(domain)] + values = domain.split("[") + values[0] = values[0].replace('.', '::') # don't replace '.' in params + line += "[".join(values) + return line + # collect_fspath comes from testid which has a "/"-normalized path + + if fspath: + res = mkrel(nodeid).replace("::()", "") # parens-normalization + if nodeid.split("::")[0] != fspath.replace("\\", nodes.SEP): + res += " <- " + self.startdir.bestrelpath(fspath) + else: + res = "[location]" + return res + " " + + def _getfailureheadline(self, rep): + if hasattr(rep, 'location'): + fspath, lineno, domain = rep.location + return domain + else: + return "test session" # XXX? + + def _getcrashline(self, rep): + try: + return str(rep.longrepr.reprcrash) + except AttributeError: + try: + return str(rep.longrepr)[:50] + except AttributeError: + return "" + + # + # summaries for sessionfinish + # + def getreports(self, name): + values = [] + for x in self.stats.get(name, []): + if not hasattr(x, '_pdbshown'): + values.append(x) + return values + + def summary_warnings(self): + if self.hasopt("w"): + all_warnings = self.stats.get("warnings") + if not all_warnings: + return + + grouped = itertools.groupby(all_warnings, key=lambda wr: wr.get_location(self.config)) + + self.write_sep("=", "warnings summary", yellow=True, bold=False) + for location, warnings in grouped: + self._tw.line(str(location) or '') + for w in warnings: + lines = w.message.splitlines() + indented = '\n'.join(' ' + x for x in lines) + self._tw.line(indented) + self._tw.line() + self._tw.line('-- Docs: http://doc.pytest.org/en/latest/warnings.html') + + def summary_passes(self): + if self.config.option.tbstyle != "no": + if self.hasopt("P"): + reports = self.getreports('passed') + if not reports: + return + self.write_sep("=", "PASSES") + for rep in reports: + msg = self._getfailureheadline(rep) + self.write_sep("_", msg) + self._outrep_summary(rep) + + def print_teardown_sections(self, rep): + for secname, content in rep.sections: + if 'teardown' in secname: + self._tw.sep('-', secname) + if content[-1:] == "\n": + content = content[:-1] + self._tw.line(content) + + def summary_failures(self): + if self.config.option.tbstyle != "no": + reports = self.getreports('failed') + if not reports: + return + self.write_sep("=", "FAILURES") + for rep in reports: + if self.config.option.tbstyle == "line": + line = self._getcrashline(rep) + self.write_line(line) + else: + msg = self._getfailureheadline(rep) + markup = {'red': True, 'bold': True} + self.write_sep("_", msg, **markup) + self._outrep_summary(rep) + for report in self.getreports(''): + if report.nodeid == rep.nodeid and report.when == 'teardown': + self.print_teardown_sections(report) + + def summary_errors(self): + if self.config.option.tbstyle != "no": + reports = self.getreports('error') + if not reports: + return + self.write_sep("=", "ERRORS") + for rep in self.stats['error']: + msg = self._getfailureheadline(rep) + if not hasattr(rep, 'when'): + # collect + msg = "ERROR collecting " + msg + elif rep.when == "setup": + msg = "ERROR at setup of " + msg + elif rep.when == "teardown": + msg = "ERROR at teardown of " + msg + self.write_sep("_", msg) + self._outrep_summary(rep) + + def _outrep_summary(self, rep): + rep.toterminal(self._tw) + for secname, content in rep.sections: + self._tw.sep("-", secname) + if content[-1:] == "\n": + content = content[:-1] + self._tw.line(content) + + def summary_stats(self): + session_duration = time.time() - self._sessionstarttime + (line, color) = build_summary_stats_line(self.stats) + msg = "%s in %.2f seconds" % (line, session_duration) + markup = {color: True, 'bold': True} + + if self.verbosity >= 0: + self.write_sep("=", msg, **markup) + if self.verbosity == -1: + self.write_line(msg, **markup) + + def summary_deselected(self): + if 'deselected' in self.stats: + self.write_sep("=", "%d tests deselected" % ( + len(self.stats['deselected'])), bold=True) + + +def repr_pythonversion(v=None): + if v is None: + v = sys.version_info + try: + return "%s.%s.%s-%s-%s" % v + except (TypeError, ValueError): + return str(v) + + +def flatten(values): + for x in values: + if isinstance(x, (list, tuple)): + for y in flatten(x): + yield y + else: + yield x + + +def build_summary_stats_line(stats): + keys = ("failed passed skipped deselected " + "xfailed xpassed warnings error").split() + unknown_key_seen = False + for key in stats.keys(): + if key not in keys: + if key: # setup/teardown reports have an empty key, ignore them + keys.append(key) + unknown_key_seen = True + parts = [] + for key in keys: + val = stats.get(key, None) + if val: + parts.append("%d %s" % (len(val), key)) + + if parts: + line = ", ".join(parts) + else: + line = "no tests ran" + + if 'failed' in stats or 'error' in stats: + color = 'red' + elif 'warnings' in stats or unknown_key_seen: + color = 'yellow' + elif 'passed' in stats: + color = 'green' + else: + color = 'yellow' + + return (line, color) + + +def _plugin_nameversions(plugininfo): + values = [] + for plugin, dist in plugininfo: + # gets us name and version! + name = '{dist.project_name}-{dist.version}'.format(dist=dist) + # questionable convenience, but it keeps things short + if name.startswith("pytest-"): + name = name[7:] + # we decided to print python package names + # they can have more than one plugin + if name not in values: + values.append(name) + return values diff --git a/lib/spack/external/pytest-fallback/_pytest/tmpdir.py b/lib/spack/external/pytest-fallback/_pytest/tmpdir.py new file mode 100644 index 0000000000..da1b032237 --- /dev/null +++ b/lib/spack/external/pytest-fallback/_pytest/tmpdir.py @@ -0,0 +1,126 @@ +""" support for providing temporary directories to test functions. """ +from __future__ import absolute_import, division, print_function + +import re + +import pytest +import py +from _pytest.monkeypatch import MonkeyPatch + + +class TempdirFactory: + """Factory for temporary directories under the common base temp directory. + + The base directory can be configured using the ``--basetemp`` option. + """ + + def __init__(self, config): + self.config = config + self.trace = config.trace.get("tmpdir") + + def ensuretemp(self, string, dir=1): + """ (deprecated) return temporary directory path with + the given string as the trailing part. It is usually + better to use the 'tmpdir' function argument which + provides an empty unique-per-test-invocation directory + and is guaranteed to be empty. + """ + # py.log._apiwarn(">1.1", "use tmpdir function argument") + return self.getbasetemp().ensure(string, dir=dir) + + def mktemp(self, basename, numbered=True): + """Create a subdirectory of the base temporary directory and return it. + If ``numbered``, ensure the directory is unique by adding a number + prefix greater than any existing one. + """ + basetemp = self.getbasetemp() + if not numbered: + p = basetemp.mkdir(basename) + else: + p = py.path.local.make_numbered_dir(prefix=basename, + keep=0, rootdir=basetemp, lock_timeout=None) + self.trace("mktemp", p) + return p + + def getbasetemp(self): + """ return base temporary directory. """ + try: + return self._basetemp + except AttributeError: + basetemp = self.config.option.basetemp + if basetemp: + basetemp = py.path.local(basetemp) + if basetemp.check(): + basetemp.remove() + basetemp.mkdir() + else: + temproot = py.path.local.get_temproot() + user = get_user() + if user: + # use a sub-directory in the temproot to speed-up + # make_numbered_dir() call + rootdir = temproot.join('pytest-of-%s' % user) + else: + rootdir = temproot + rootdir.ensure(dir=1) + basetemp = py.path.local.make_numbered_dir(prefix='pytest-', + rootdir=rootdir) + self._basetemp = t = basetemp.realpath() + self.trace("new basetemp", t) + return t + + def finish(self): + self.trace("finish") + + +def get_user(): + """Return the current user name, or None if getuser() does not work + in the current environment (see #1010). + """ + import getpass + try: + return getpass.getuser() + except (ImportError, KeyError): + return None + + +# backward compatibility +TempdirHandler = TempdirFactory + + +def pytest_configure(config): + """Create a TempdirFactory and attach it to the config object. + + This is to comply with existing plugins which expect the handler to be + available at pytest_configure time, but ideally should be moved entirely + to the tmpdir_factory session fixture. + """ + mp = MonkeyPatch() + t = TempdirFactory(config) + config._cleanup.extend([mp.undo, t.finish]) + mp.setattr(config, '_tmpdirhandler', t, raising=False) + mp.setattr(pytest, 'ensuretemp', t.ensuretemp, raising=False) + + +@pytest.fixture(scope='session') +def tmpdir_factory(request): + """Return a TempdirFactory instance for the test session. + """ + return request.config._tmpdirhandler + + +@pytest.fixture +def tmpdir(request, tmpdir_factory): + """Return a temporary directory path object + which is unique to each test function invocation, + created as a sub directory of the base temporary + directory. The returned object is a `py.path.local`_ + path object. + """ + name = request.node.name + name = re.sub(r"[\W]", "_", name) + MAXVAL = 30 + if len(name) > MAXVAL: + name = name[:MAXVAL] + x = tmpdir_factory.mktemp(name, numbered=True) + return x diff --git a/lib/spack/external/pytest-fallback/_pytest/unittest.py b/lib/spack/external/pytest-fallback/_pytest/unittest.py new file mode 100644 index 0000000000..52c9813e8b --- /dev/null +++ b/lib/spack/external/pytest-fallback/_pytest/unittest.py @@ -0,0 +1,239 @@ +""" discovery and running of std-library "unittest" style tests. """ +from __future__ import absolute_import, division, print_function + +import sys +import traceback + +# for transferring markers +import _pytest._code +from _pytest.config import hookimpl +from _pytest.outcomes import fail, skip, xfail +from _pytest.python import transfer_markers, Class, Module, Function +from _pytest.skipping import MarkEvaluator + + +def pytest_pycollect_makeitem(collector, name, obj): + # has unittest been imported and is obj a subclass of its TestCase? + try: + if not issubclass(obj, sys.modules["unittest"].TestCase): + return + except Exception: + return + # yes, so let's collect it + return UnitTestCase(name, parent=collector) + + +class UnitTestCase(Class): + # marker for fixturemanger.getfixtureinfo() + # to declare that our children do not support funcargs + nofuncargs = True + + def setup(self): + cls = self.obj + if getattr(cls, '__unittest_skip__', False): + return # skipped + setup = getattr(cls, 'setUpClass', None) + if setup is not None: + setup() + teardown = getattr(cls, 'tearDownClass', None) + if teardown is not None: + self.addfinalizer(teardown) + super(UnitTestCase, self).setup() + + def collect(self): + from unittest import TestLoader + cls = self.obj + if not getattr(cls, "__test__", True): + return + self.session._fixturemanager.parsefactories(self, unittest=True) + loader = TestLoader() + module = self.getparent(Module).obj + foundsomething = False + for name in loader.getTestCaseNames(self.obj): + x = getattr(self.obj, name) + if not getattr(x, '__test__', True): + continue + funcobj = getattr(x, 'im_func', x) + transfer_markers(funcobj, cls, module) + yield TestCaseFunction(name, parent=self) + foundsomething = True + + if not foundsomething: + runtest = getattr(self.obj, 'runTest', None) + if runtest is not None: + ut = sys.modules.get("twisted.trial.unittest", None) + if ut is None or runtest != ut.TestCase.runTest: + yield TestCaseFunction('runTest', parent=self) + + +class TestCaseFunction(Function): + _excinfo = None + + def setup(self): + self._testcase = self.parent.obj(self.name) + self._fix_unittest_skip_decorator() + self._obj = getattr(self._testcase, self.name) + if hasattr(self._testcase, 'setup_method'): + self._testcase.setup_method(self._obj) + if hasattr(self, "_request"): + self._request._fillfixtures() + + def _fix_unittest_skip_decorator(self): + """ + The @unittest.skip decorator calls functools.wraps(self._testcase) + The call to functools.wraps() fails unless self._testcase + has a __name__ attribute. This is usually automatically supplied + if the test is a function or method, but we need to add manually + here. + + See issue #1169 + """ + if sys.version_info[0] == 2: + setattr(self._testcase, "__name__", self.name) + + def teardown(self): + if hasattr(self._testcase, 'teardown_method'): + self._testcase.teardown_method(self._obj) + # Allow garbage collection on TestCase instance attributes. + self._testcase = None + self._obj = None + + def startTest(self, testcase): + pass + + def _addexcinfo(self, rawexcinfo): + # unwrap potential exception info (see twisted trial support below) + rawexcinfo = getattr(rawexcinfo, '_rawexcinfo', rawexcinfo) + try: + excinfo = _pytest._code.ExceptionInfo(rawexcinfo) + except TypeError: + try: + try: + values = traceback.format_exception(*rawexcinfo) + values.insert(0, "NOTE: Incompatible Exception Representation, " + "displaying natively:\n\n") + fail("".join(values), pytrace=False) + except (fail.Exception, KeyboardInterrupt): + raise + except: # noqa + fail("ERROR: Unknown Incompatible Exception " + "representation:\n%r" % (rawexcinfo,), pytrace=False) + except KeyboardInterrupt: + raise + except fail.Exception: + excinfo = _pytest._code.ExceptionInfo() + self.__dict__.setdefault('_excinfo', []).append(excinfo) + + def addError(self, testcase, rawexcinfo): + self._addexcinfo(rawexcinfo) + + def addFailure(self, testcase, rawexcinfo): + self._addexcinfo(rawexcinfo) + + def addSkip(self, testcase, reason): + try: + skip(reason) + except skip.Exception: + self._evalskip = MarkEvaluator(self, 'SkipTest') + self._evalskip.result = True + self._addexcinfo(sys.exc_info()) + + def addExpectedFailure(self, testcase, rawexcinfo, reason=""): + try: + xfail(str(reason)) + except xfail.Exception: + self._addexcinfo(sys.exc_info()) + + def addUnexpectedSuccess(self, testcase, reason=""): + self._unexpectedsuccess = reason + + def addSuccess(self, testcase): + pass + + def stopTest(self, testcase): + pass + + def _handle_skip(self): + # implements the skipping machinery (see #2137) + # analog to pythons Lib/unittest/case.py:run + testMethod = getattr(self._testcase, self._testcase._testMethodName) + if (getattr(self._testcase.__class__, "__unittest_skip__", False) or + getattr(testMethod, "__unittest_skip__", False)): + # If the class or method was skipped. + skip_why = (getattr(self._testcase.__class__, '__unittest_skip_why__', '') or + getattr(testMethod, '__unittest_skip_why__', '')) + try: # PY3, unittest2 on PY2 + self._testcase._addSkip(self, self._testcase, skip_why) + except TypeError: # PY2 + if sys.version_info[0] != 2: + raise + self._testcase._addSkip(self, skip_why) + return True + return False + + def runtest(self): + if self.config.pluginmanager.get_plugin("pdbinvoke") is None: + self._testcase(result=self) + else: + # disables tearDown and cleanups for post mortem debugging (see #1890) + if self._handle_skip(): + return + self._testcase.debug() + + def _prunetraceback(self, excinfo): + Function._prunetraceback(self, excinfo) + traceback = excinfo.traceback.filter( + lambda x: not x.frame.f_globals.get('__unittest')) + if traceback: + excinfo.traceback = traceback + + +@hookimpl(tryfirst=True) +def pytest_runtest_makereport(item, call): + if isinstance(item, TestCaseFunction): + if item._excinfo: + call.excinfo = item._excinfo.pop(0) + try: + del call.result + except AttributeError: + pass + +# twisted trial support + + +@hookimpl(hookwrapper=True) +def pytest_runtest_protocol(item): + if isinstance(item, TestCaseFunction) and \ + 'twisted.trial.unittest' in sys.modules: + ut = sys.modules['twisted.python.failure'] + Failure__init__ = ut.Failure.__init__ + check_testcase_implements_trial_reporter() + + def excstore(self, exc_value=None, exc_type=None, exc_tb=None, + captureVars=None): + if exc_value is None: + self._rawexcinfo = sys.exc_info() + else: + if exc_type is None: + exc_type = type(exc_value) + self._rawexcinfo = (exc_type, exc_value, exc_tb) + try: + Failure__init__(self, exc_value, exc_type, exc_tb, + captureVars=captureVars) + except TypeError: + Failure__init__(self, exc_value, exc_type, exc_tb) + + ut.Failure.__init__ = excstore + yield + ut.Failure.__init__ = Failure__init__ + else: + yield + + +def check_testcase_implements_trial_reporter(done=[]): + if done: + return + from zope.interface import classImplements + from twisted.trial.itrial import IReporter + classImplements(TestCaseFunction, IReporter) + done.append(1) diff --git a/lib/spack/external/pytest-fallback/_pytest/vendored_packages/README.md b/lib/spack/external/pytest-fallback/_pytest/vendored_packages/README.md new file mode 100644 index 0000000000..b5fe6febb0 --- /dev/null +++ b/lib/spack/external/pytest-fallback/_pytest/vendored_packages/README.md @@ -0,0 +1,13 @@ +This directory vendors the `pluggy` module. + +For a more detailed discussion for the reasons to vendoring this +package, please see [this issue](https://github.com/pytest-dev/pytest/issues/944). + +To update the current version, execute: + +``` +$ pip install -U pluggy== --no-compile --target=_pytest/vendored_packages +``` + +And commit the modified files. The `pluggy-.dist-info` directory +created by `pip` should be added as well. diff --git a/lib/spack/external/pytest-fallback/_pytest/vendored_packages/__init__.py b/lib/spack/external/pytest-fallback/_pytest/vendored_packages/__init__.py new file mode 100644 index 0000000000..e69de29bb2 diff --git a/lib/spack/external/pytest-fallback/_pytest/vendored_packages/pluggy-0.4.0.dist-info/DESCRIPTION.rst b/lib/spack/external/pytest-fallback/_pytest/vendored_packages/pluggy-0.4.0.dist-info/DESCRIPTION.rst new file mode 100644 index 0000000000..da0e7a6ed7 --- /dev/null +++ b/lib/spack/external/pytest-fallback/_pytest/vendored_packages/pluggy-0.4.0.dist-info/DESCRIPTION.rst @@ -0,0 +1,11 @@ + +Plugin registration and hook calling for Python +=============================================== + +This is the plugin manager as used by pytest but stripped +of pytest specific details. + +During the 0.x series this plugin does not have much documentation +except extensive docstrings in the pluggy.py module. + + diff --git a/lib/spack/external/pytest-fallback/_pytest/vendored_packages/pluggy-0.4.0.dist-info/INSTALLER b/lib/spack/external/pytest-fallback/_pytest/vendored_packages/pluggy-0.4.0.dist-info/INSTALLER new file mode 100644 index 0000000000..a1b589e38a --- /dev/null +++ b/lib/spack/external/pytest-fallback/_pytest/vendored_packages/pluggy-0.4.0.dist-info/INSTALLER @@ -0,0 +1 @@ +pip diff --git a/lib/spack/external/pytest-fallback/_pytest/vendored_packages/pluggy-0.4.0.dist-info/LICENSE.txt b/lib/spack/external/pytest-fallback/_pytest/vendored_packages/pluggy-0.4.0.dist-info/LICENSE.txt new file mode 100644 index 0000000000..121017d086 --- /dev/null +++ b/lib/spack/external/pytest-fallback/_pytest/vendored_packages/pluggy-0.4.0.dist-info/LICENSE.txt @@ -0,0 +1,22 @@ +The MIT License (MIT) + +Copyright (c) 2015 holger krekel (rather uses bitbucket/hpk42) + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all +copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE +SOFTWARE. + diff --git a/lib/spack/external/pytest-fallback/_pytest/vendored_packages/pluggy-0.4.0.dist-info/METADATA b/lib/spack/external/pytest-fallback/_pytest/vendored_packages/pluggy-0.4.0.dist-info/METADATA new file mode 100644 index 0000000000..bd88517c94 --- /dev/null +++ b/lib/spack/external/pytest-fallback/_pytest/vendored_packages/pluggy-0.4.0.dist-info/METADATA @@ -0,0 +1,40 @@ +Metadata-Version: 2.0 +Name: pluggy +Version: 0.4.0 +Summary: plugin and hook calling mechanisms for python +Home-page: https://github.com/pytest-dev/pluggy +Author: Holger Krekel +Author-email: holger at merlinux.eu +License: MIT license +Platform: unix +Platform: linux +Platform: osx +Platform: win32 +Classifier: Development Status :: 4 - Beta +Classifier: Intended Audience :: Developers +Classifier: License :: OSI Approved :: MIT License +Classifier: Operating System :: POSIX +Classifier: Operating System :: Microsoft :: Windows +Classifier: Operating System :: MacOS :: MacOS X +Classifier: Topic :: Software Development :: Testing +Classifier: Topic :: Software Development :: Libraries +Classifier: Topic :: Utilities +Classifier: Programming Language :: Python :: 2 +Classifier: Programming Language :: Python :: 2.6 +Classifier: Programming Language :: Python :: 2.7 +Classifier: Programming Language :: Python :: 3 +Classifier: Programming Language :: Python :: 3.3 +Classifier: Programming Language :: Python :: 3.4 +Classifier: Programming Language :: Python :: 3.5 + + +Plugin registration and hook calling for Python +=============================================== + +This is the plugin manager as used by pytest but stripped +of pytest specific details. + +During the 0.x series this plugin does not have much documentation +except extensive docstrings in the pluggy.py module. + + diff --git a/lib/spack/external/pytest-fallback/_pytest/vendored_packages/pluggy-0.4.0.dist-info/RECORD b/lib/spack/external/pytest-fallback/_pytest/vendored_packages/pluggy-0.4.0.dist-info/RECORD new file mode 100644 index 0000000000..3003a3bf2b --- /dev/null +++ b/lib/spack/external/pytest-fallback/_pytest/vendored_packages/pluggy-0.4.0.dist-info/RECORD @@ -0,0 +1,9 @@ +pluggy.py,sha256=u0oG9cv-oLOkNvEBlwnnu8pp1AyxpoERgUO00S3rvpQ,31543 +pluggy-0.4.0.dist-info/DESCRIPTION.rst,sha256=ltvjkFd40LW_xShthp6RRVM6OB_uACYDFR3kTpKw7o4,307 +pluggy-0.4.0.dist-info/LICENSE.txt,sha256=ruwhUOyV1HgE9F35JVL9BCZ9vMSALx369I4xq9rhpkM,1134 +pluggy-0.4.0.dist-info/METADATA,sha256=pe2hbsqKFaLHC6wAQPpFPn0KlpcPfLBe_BnS4O70bfk,1364 +pluggy-0.4.0.dist-info/RECORD,, +pluggy-0.4.0.dist-info/WHEEL,sha256=9Z5Xm-eel1bTS7e6ogYiKz0zmPEqDwIypurdHN1hR40,116 +pluggy-0.4.0.dist-info/metadata.json,sha256=T3go5L2qOa_-H-HpCZi3EoVKb8sZ3R-fOssbkWo2nvM,1119 +pluggy-0.4.0.dist-info/top_level.txt,sha256=xKSCRhai-v9MckvMuWqNz16c1tbsmOggoMSwTgcpYHE,7 +pluggy-0.4.0.dist-info/INSTALLER,sha256=zuuue4knoyJ-UwPPXg8fezS7VCrXJQrAP7zeNuwvFQg,4 diff --git a/lib/spack/external/pytest-fallback/_pytest/vendored_packages/pluggy-0.4.0.dist-info/WHEEL b/lib/spack/external/pytest-fallback/_pytest/vendored_packages/pluggy-0.4.0.dist-info/WHEEL new file mode 100644 index 0000000000..8b6dd1b5a8 --- /dev/null +++ b/lib/spack/external/pytest-fallback/_pytest/vendored_packages/pluggy-0.4.0.dist-info/WHEEL @@ -0,0 +1,6 @@ +Wheel-Version: 1.0 +Generator: bdist_wheel (0.29.0) +Root-Is-Purelib: true +Tag: py2-none-any +Tag: py3-none-any + diff --git a/lib/spack/external/pytest-fallback/_pytest/vendored_packages/pluggy-0.4.0.dist-info/metadata.json b/lib/spack/external/pytest-fallback/_pytest/vendored_packages/pluggy-0.4.0.dist-info/metadata.json new file mode 100644 index 0000000000..cde22aff02 --- /dev/null +++ b/lib/spack/external/pytest-fallback/_pytest/vendored_packages/pluggy-0.4.0.dist-info/metadata.json @@ -0,0 +1 @@ +{"classifiers": ["Development Status :: 4 - Beta", "Intended Audience :: Developers", "License :: OSI Approved :: MIT License", "Operating System :: POSIX", "Operating System :: Microsoft :: Windows", "Operating System :: MacOS :: MacOS X", "Topic :: Software Development :: Testing", "Topic :: Software Development :: Libraries", "Topic :: Utilities", "Programming Language :: Python :: 2", "Programming Language :: Python :: 2.6", "Programming Language :: Python :: 2.7", "Programming Language :: Python :: 3", "Programming Language :: Python :: 3.3", "Programming Language :: Python :: 3.4", "Programming Language :: Python :: 3.5"], "extensions": {"python.details": {"contacts": [{"email": "holger at merlinux.eu", "name": "Holger Krekel", "role": "author"}], "document_names": {"description": "DESCRIPTION.rst", "license": "LICENSE.txt"}, "project_urls": {"Home": "https://github.com/pytest-dev/pluggy"}}}, "generator": "bdist_wheel (0.29.0)", "license": "MIT license", "metadata_version": "2.0", "name": "pluggy", "platform": "unix", "summary": "plugin and hook calling mechanisms for python", "version": "0.4.0"} \ No newline at end of file diff --git a/lib/spack/external/pytest-fallback/_pytest/vendored_packages/pluggy-0.4.0.dist-info/top_level.txt b/lib/spack/external/pytest-fallback/_pytest/vendored_packages/pluggy-0.4.0.dist-info/top_level.txt new file mode 100644 index 0000000000..11bdb5c1f5 --- /dev/null +++ b/lib/spack/external/pytest-fallback/_pytest/vendored_packages/pluggy-0.4.0.dist-info/top_level.txt @@ -0,0 +1 @@ +pluggy diff --git a/lib/spack/external/pytest-fallback/_pytest/vendored_packages/pluggy.py b/lib/spack/external/pytest-fallback/_pytest/vendored_packages/pluggy.py new file mode 100644 index 0000000000..6f26552d73 --- /dev/null +++ b/lib/spack/external/pytest-fallback/_pytest/vendored_packages/pluggy.py @@ -0,0 +1,782 @@ +""" +PluginManager, basic initialization and tracing. + +pluggy is the cristallized core of plugin management as used +by some 150 plugins for pytest. + +Pluggy uses semantic versioning. Breaking changes are only foreseen for +Major releases (incremented X in "X.Y.Z"). If you want to use pluggy in +your project you should thus use a dependency restriction like +"pluggy>=0.1.0,<1.0" to avoid surprises. + +pluggy is concerned with hook specification, hook implementations and hook +calling. For any given hook specification a hook call invokes up to N implementations. +A hook implementation can influence its position and type of execution: +if attributed "tryfirst" or "trylast" it will be tried to execute +first or last. However, if attributed "hookwrapper" an implementation +can wrap all calls to non-hookwrapper implementations. A hookwrapper +can thus execute some code ahead and after the execution of other hooks. + +Hook specification is done by way of a regular python function where +both the function name and the names of all its arguments are significant. +Each hook implementation function is verified against the original specification +function, including the names of all its arguments. To allow for hook specifications +to evolve over the livetime of a project, hook implementations can +accept less arguments. One can thus add new arguments and semantics to +a hook specification by adding another argument typically without breaking +existing hook implementations. + +The chosen approach is meant to let a hook designer think carefuly about +which objects are needed by an extension writer. By contrast, subclass-based +extension mechanisms often expose a lot more state and behaviour than needed, +thus restricting future developments. + +Pluggy currently consists of functionality for: + +- a way to register new hook specifications. Without a hook + specification no hook calling can be performed. + +- a registry of plugins which contain hook implementation functions. It + is possible to register plugins for which a hook specification is not yet + known and validate all hooks when the system is in a more referentially + consistent state. Setting an "optionalhook" attribution to a hook + implementation will avoid PluginValidationError's if a specification + is missing. This allows to have optional integration between plugins. + +- a "hook" relay object from which you can launch 1:N calls to + registered hook implementation functions + +- a mechanism for ordering hook implementation functions + +- mechanisms for two different type of 1:N calls: "firstresult" for when + the call should stop when the first implementation returns a non-None result. + And the other (default) way of guaranteeing that all hook implementations + will be called and their non-None result collected. + +- mechanisms for "historic" extension points such that all newly + registered functions will receive all hook calls that happened + before their registration. + +- a mechanism for discovering plugin objects which are based on + setuptools based entry points. + +- a simple tracing mechanism, including tracing of plugin calls and + their arguments. + +""" +import sys +import inspect + +__version__ = '0.4.0' + +__all__ = ["PluginManager", "PluginValidationError", "HookCallError", + "HookspecMarker", "HookimplMarker"] + +_py3 = sys.version_info > (3, 0) + + +class HookspecMarker: + """ Decorator helper class for marking functions as hook specifications. + + You can instantiate it with a project_name to get a decorator. + Calling PluginManager.add_hookspecs later will discover all marked functions + if the PluginManager uses the same project_name. + """ + + def __init__(self, project_name): + self.project_name = project_name + + def __call__(self, function=None, firstresult=False, historic=False): + """ if passed a function, directly sets attributes on the function + which will make it discoverable to add_hookspecs(). If passed no + function, returns a decorator which can be applied to a function + later using the attributes supplied. + + If firstresult is True the 1:N hook call (N being the number of registered + hook implementation functions) will stop at I<=N when the I'th function + returns a non-None result. + + If historic is True calls to a hook will be memorized and replayed + on later registered plugins. + + """ + def setattr_hookspec_opts(func): + if historic and firstresult: + raise ValueError("cannot have a historic firstresult hook") + setattr(func, self.project_name + "_spec", + dict(firstresult=firstresult, historic=historic)) + return func + + if function is not None: + return setattr_hookspec_opts(function) + else: + return setattr_hookspec_opts + + +class HookimplMarker: + """ Decorator helper class for marking functions as hook implementations. + + You can instantiate with a project_name to get a decorator. + Calling PluginManager.register later will discover all marked functions + if the PluginManager uses the same project_name. + """ + def __init__(self, project_name): + self.project_name = project_name + + def __call__(self, function=None, hookwrapper=False, optionalhook=False, + tryfirst=False, trylast=False): + + """ if passed a function, directly sets attributes on the function + which will make it discoverable to register(). If passed no function, + returns a decorator which can be applied to a function later using + the attributes supplied. + + If optionalhook is True a missing matching hook specification will not result + in an error (by default it is an error if no matching spec is found). + + If tryfirst is True this hook implementation will run as early as possible + in the chain of N hook implementations for a specfication. + + If trylast is True this hook implementation will run as late as possible + in the chain of N hook implementations. + + If hookwrapper is True the hook implementations needs to execute exactly + one "yield". The code before the yield is run early before any non-hookwrapper + function is run. The code after the yield is run after all non-hookwrapper + function have run. The yield receives an ``_CallOutcome`` object representing + the exception or result outcome of the inner calls (including other hookwrapper + calls). + + """ + def setattr_hookimpl_opts(func): + setattr(func, self.project_name + "_impl", + dict(hookwrapper=hookwrapper, optionalhook=optionalhook, + tryfirst=tryfirst, trylast=trylast)) + return func + + if function is None: + return setattr_hookimpl_opts + else: + return setattr_hookimpl_opts(function) + + +def normalize_hookimpl_opts(opts): + opts.setdefault("tryfirst", False) + opts.setdefault("trylast", False) + opts.setdefault("hookwrapper", False) + opts.setdefault("optionalhook", False) + + +class _TagTracer: + def __init__(self): + self._tag2proc = {} + self.writer = None + self.indent = 0 + + def get(self, name): + return _TagTracerSub(self, (name,)) + + def format_message(self, tags, args): + if isinstance(args[-1], dict): + extra = args[-1] + args = args[:-1] + else: + extra = {} + + content = " ".join(map(str, args)) + indent = " " * self.indent + + lines = [ + "%s%s [%s]\n" % (indent, content, ":".join(tags)) + ] + + for name, value in extra.items(): + lines.append("%s %s: %s\n" % (indent, name, value)) + return lines + + def processmessage(self, tags, args): + if self.writer is not None and args: + lines = self.format_message(tags, args) + self.writer(''.join(lines)) + try: + self._tag2proc[tags](tags, args) + except KeyError: + pass + + def setwriter(self, writer): + self.writer = writer + + def setprocessor(self, tags, processor): + if isinstance(tags, str): + tags = tuple(tags.split(":")) + else: + assert isinstance(tags, tuple) + self._tag2proc[tags] = processor + + +class _TagTracerSub: + def __init__(self, root, tags): + self.root = root + self.tags = tags + + def __call__(self, *args): + self.root.processmessage(self.tags, args) + + def setmyprocessor(self, processor): + self.root.setprocessor(self.tags, processor) + + def get(self, name): + return self.__class__(self.root, self.tags + (name,)) + + +def _raise_wrapfail(wrap_controller, msg): + co = wrap_controller.gi_code + raise RuntimeError("wrap_controller at %r %s:%d %s" % + (co.co_name, co.co_filename, co.co_firstlineno, msg)) + + +def _wrapped_call(wrap_controller, func): + """ Wrap calling to a function with a generator which needs to yield + exactly once. The yield point will trigger calling the wrapped function + and return its _CallOutcome to the yield point. The generator then needs + to finish (raise StopIteration) in order for the wrapped call to complete. + """ + try: + next(wrap_controller) # first yield + except StopIteration: + _raise_wrapfail(wrap_controller, "did not yield") + call_outcome = _CallOutcome(func) + try: + wrap_controller.send(call_outcome) + _raise_wrapfail(wrap_controller, "has second yield") + except StopIteration: + pass + return call_outcome.get_result() + + +class _CallOutcome: + """ Outcome of a function call, either an exception or a proper result. + Calling the ``get_result`` method will return the result or reraise + the exception raised when the function was called. """ + excinfo = None + + def __init__(self, func): + try: + self.result = func() + except BaseException: + self.excinfo = sys.exc_info() + + def force_result(self, result): + self.result = result + self.excinfo = None + + def get_result(self): + if self.excinfo is None: + return self.result + else: + ex = self.excinfo + if _py3: + raise ex[1].with_traceback(ex[2]) + _reraise(*ex) # noqa + +if not _py3: + exec(""" +def _reraise(cls, val, tb): + raise cls, val, tb +""") + + +class _TracedHookExecution: + def __init__(self, pluginmanager, before, after): + self.pluginmanager = pluginmanager + self.before = before + self.after = after + self.oldcall = pluginmanager._inner_hookexec + assert not isinstance(self.oldcall, _TracedHookExecution) + self.pluginmanager._inner_hookexec = self + + def __call__(self, hook, hook_impls, kwargs): + self.before(hook.name, hook_impls, kwargs) + outcome = _CallOutcome(lambda: self.oldcall(hook, hook_impls, kwargs)) + self.after(outcome, hook.name, hook_impls, kwargs) + return outcome.get_result() + + def undo(self): + self.pluginmanager._inner_hookexec = self.oldcall + + +class PluginManager(object): + """ Core Pluginmanager class which manages registration + of plugin objects and 1:N hook calling. + + You can register new hooks by calling ``add_hookspec(module_or_class)``. + You can register plugin objects (which contain hooks) by calling + ``register(plugin)``. The Pluginmanager is initialized with a + prefix that is searched for in the names of the dict of registered + plugin objects. An optional excludefunc allows to blacklist names which + are not considered as hooks despite a matching prefix. + + For debugging purposes you can call ``enable_tracing()`` + which will subsequently send debug information to the trace helper. + """ + + def __init__(self, project_name, implprefix=None): + """ if implprefix is given implementation functions + will be recognized if their name matches the implprefix. """ + self.project_name = project_name + self._name2plugin = {} + self._plugin2hookcallers = {} + self._plugin_distinfo = [] + self.trace = _TagTracer().get("pluginmanage") + self.hook = _HookRelay(self.trace.root.get("hook")) + self._implprefix = implprefix + self._inner_hookexec = lambda hook, methods, kwargs: \ + _MultiCall(methods, kwargs, hook.spec_opts).execute() + + def _hookexec(self, hook, methods, kwargs): + # called from all hookcaller instances. + # enable_tracing will set its own wrapping function at self._inner_hookexec + return self._inner_hookexec(hook, methods, kwargs) + + def register(self, plugin, name=None): + """ Register a plugin and return its canonical name or None if the name + is blocked from registering. Raise a ValueError if the plugin is already + registered. """ + plugin_name = name or self.get_canonical_name(plugin) + + if plugin_name in self._name2plugin or plugin in self._plugin2hookcallers: + if self._name2plugin.get(plugin_name, -1) is None: + return # blocked plugin, return None to indicate no registration + raise ValueError("Plugin already registered: %s=%s\n%s" % + (plugin_name, plugin, self._name2plugin)) + + # XXX if an error happens we should make sure no state has been + # changed at point of return + self._name2plugin[plugin_name] = plugin + + # register matching hook implementations of the plugin + self._plugin2hookcallers[plugin] = hookcallers = [] + for name in dir(plugin): + hookimpl_opts = self.parse_hookimpl_opts(plugin, name) + if hookimpl_opts is not None: + normalize_hookimpl_opts(hookimpl_opts) + method = getattr(plugin, name) + hookimpl = HookImpl(plugin, plugin_name, method, hookimpl_opts) + hook = getattr(self.hook, name, None) + if hook is None: + hook = _HookCaller(name, self._hookexec) + setattr(self.hook, name, hook) + elif hook.has_spec(): + self._verify_hook(hook, hookimpl) + hook._maybe_apply_history(hookimpl) + hook._add_hookimpl(hookimpl) + hookcallers.append(hook) + return plugin_name + + def parse_hookimpl_opts(self, plugin, name): + method = getattr(plugin, name) + try: + res = getattr(method, self.project_name + "_impl", None) + except Exception: + res = {} + if res is not None and not isinstance(res, dict): + # false positive + res = None + elif res is None and self._implprefix and name.startswith(self._implprefix): + res = {} + return res + + def unregister(self, plugin=None, name=None): + """ unregister a plugin object and all its contained hook implementations + from internal data structures. """ + if name is None: + assert plugin is not None, "one of name or plugin needs to be specified" + name = self.get_name(plugin) + + if plugin is None: + plugin = self.get_plugin(name) + + # if self._name2plugin[name] == None registration was blocked: ignore + if self._name2plugin.get(name): + del self._name2plugin[name] + + for hookcaller in self._plugin2hookcallers.pop(plugin, []): + hookcaller._remove_plugin(plugin) + + return plugin + + def set_blocked(self, name): + """ block registrations of the given name, unregister if already registered. """ + self.unregister(name=name) + self._name2plugin[name] = None + + def is_blocked(self, name): + """ return True if the name blogs registering plugins of that name. """ + return name in self._name2plugin and self._name2plugin[name] is None + + def add_hookspecs(self, module_or_class): + """ add new hook specifications defined in the given module_or_class. + Functions are recognized if they have been decorated accordingly. """ + names = [] + for name in dir(module_or_class): + spec_opts = self.parse_hookspec_opts(module_or_class, name) + if spec_opts is not None: + hc = getattr(self.hook, name, None) + if hc is None: + hc = _HookCaller(name, self._hookexec, module_or_class, spec_opts) + setattr(self.hook, name, hc) + else: + # plugins registered this hook without knowing the spec + hc.set_specification(module_or_class, spec_opts) + for hookfunction in (hc._wrappers + hc._nonwrappers): + self._verify_hook(hc, hookfunction) + names.append(name) + + if not names: + raise ValueError("did not find any %r hooks in %r" % + (self.project_name, module_or_class)) + + def parse_hookspec_opts(self, module_or_class, name): + method = getattr(module_or_class, name) + return getattr(method, self.project_name + "_spec", None) + + def get_plugins(self): + """ return the set of registered plugins. """ + return set(self._plugin2hookcallers) + + def is_registered(self, plugin): + """ Return True if the plugin is already registered. """ + return plugin in self._plugin2hookcallers + + def get_canonical_name(self, plugin): + """ Return canonical name for a plugin object. Note that a plugin + may be registered under a different name which was specified + by the caller of register(plugin, name). To obtain the name + of an registered plugin use ``get_name(plugin)`` instead.""" + return getattr(plugin, "__name__", None) or str(id(plugin)) + + def get_plugin(self, name): + """ Return a plugin or None for the given name. """ + return self._name2plugin.get(name) + + def has_plugin(self, name): + """ Return True if a plugin with the given name is registered. """ + return self.get_plugin(name) is not None + + def get_name(self, plugin): + """ Return name for registered plugin or None if not registered. """ + for name, val in self._name2plugin.items(): + if plugin == val: + return name + + def _verify_hook(self, hook, hookimpl): + if hook.is_historic() and hookimpl.hookwrapper: + raise PluginValidationError( + "Plugin %r\nhook %r\nhistoric incompatible to hookwrapper" % + (hookimpl.plugin_name, hook.name)) + + for arg in hookimpl.argnames: + if arg not in hook.argnames: + raise PluginValidationError( + "Plugin %r\nhook %r\nargument %r not available\n" + "plugin definition: %s\n" + "available hookargs: %s" % + (hookimpl.plugin_name, hook.name, arg, + _formatdef(hookimpl.function), ", ".join(hook.argnames))) + + def check_pending(self): + """ Verify that all hooks which have not been verified against + a hook specification are optional, otherwise raise PluginValidationError""" + for name in self.hook.__dict__: + if name[0] != "_": + hook = getattr(self.hook, name) + if not hook.has_spec(): + for hookimpl in (hook._wrappers + hook._nonwrappers): + if not hookimpl.optionalhook: + raise PluginValidationError( + "unknown hook %r in plugin %r" % + (name, hookimpl.plugin)) + + def list_plugin_distinfo(self): + """ return list of distinfo/plugin tuples for all setuptools registered + plugins. """ + return list(self._plugin_distinfo) + + def list_name_plugin(self): + """ return list of name/plugin pairs. """ + return list(self._name2plugin.items()) + + def get_hookcallers(self, plugin): + """ get all hook callers for the specified plugin. """ + return self._plugin2hookcallers.get(plugin) + + def add_hookcall_monitoring(self, before, after): + """ add before/after tracing functions for all hooks + and return an undo function which, when called, + will remove the added tracers. + + ``before(hook_name, hook_impls, kwargs)`` will be called ahead + of all hook calls and receive a hookcaller instance, a list + of HookImpl instances and the keyword arguments for the hook call. + + ``after(outcome, hook_name, hook_impls, kwargs)`` receives the + same arguments as ``before`` but also a :py:class:`_CallOutcome <_pytest.vendored_packages.pluggy._CallOutcome>` object + which represents the result of the overall hook call. + """ + return _TracedHookExecution(self, before, after).undo + + def enable_tracing(self): + """ enable tracing of hook calls and return an undo function. """ + hooktrace = self.hook._trace + + def before(hook_name, methods, kwargs): + hooktrace.root.indent += 1 + hooktrace(hook_name, kwargs) + + def after(outcome, hook_name, methods, kwargs): + if outcome.excinfo is None: + hooktrace("finish", hook_name, "-->", outcome.result) + hooktrace.root.indent -= 1 + + return self.add_hookcall_monitoring(before, after) + + def subset_hook_caller(self, name, remove_plugins): + """ Return a new _HookCaller instance for the named method + which manages calls to all registered plugins except the + ones from remove_plugins. """ + orig = getattr(self.hook, name) + plugins_to_remove = [plug for plug in remove_plugins if hasattr(plug, name)] + if plugins_to_remove: + hc = _HookCaller(orig.name, orig._hookexec, orig._specmodule_or_class, + orig.spec_opts) + for hookimpl in (orig._wrappers + orig._nonwrappers): + plugin = hookimpl.plugin + if plugin not in plugins_to_remove: + hc._add_hookimpl(hookimpl) + # we also keep track of this hook caller so it + # gets properly removed on plugin unregistration + self._plugin2hookcallers.setdefault(plugin, []).append(hc) + return hc + return orig + + +class _MultiCall: + """ execute a call into multiple python functions/methods. """ + + # XXX note that the __multicall__ argument is supported only + # for pytest compatibility reasons. It was never officially + # supported there and is explicitely deprecated since 2.8 + # so we can remove it soon, allowing to avoid the below recursion + # in execute() and simplify/speed up the execute loop. + + def __init__(self, hook_impls, kwargs, specopts={}): + self.hook_impls = hook_impls + self.kwargs = kwargs + self.kwargs["__multicall__"] = self + self.specopts = specopts + + def execute(self): + all_kwargs = self.kwargs + self.results = results = [] + firstresult = self.specopts.get("firstresult") + + while self.hook_impls: + hook_impl = self.hook_impls.pop() + try: + args = [all_kwargs[argname] for argname in hook_impl.argnames] + except KeyError: + for argname in hook_impl.argnames: + if argname not in all_kwargs: + raise HookCallError( + "hook call must provide argument %r" % (argname,)) + if hook_impl.hookwrapper: + return _wrapped_call(hook_impl.function(*args), self.execute) + res = hook_impl.function(*args) + if res is not None: + if firstresult: + return res + results.append(res) + + if not firstresult: + return results + + def __repr__(self): + status = "%d meths" % (len(self.hook_impls),) + if hasattr(self, "results"): + status = ("%d results, " % len(self.results)) + status + return "<_MultiCall %s, kwargs=%r>" % (status, self.kwargs) + + +def varnames(func, startindex=None): + """ return argument name tuple for a function, method, class or callable. + + In case of a class, its "__init__" method is considered. + For methods the "self" parameter is not included unless you are passing + an unbound method with Python3 (which has no supports for unbound methods) + """ + cache = getattr(func, "__dict__", {}) + try: + return cache["_varnames"] + except KeyError: + pass + if inspect.isclass(func): + try: + func = func.__init__ + except AttributeError: + return () + startindex = 1 + else: + if not inspect.isfunction(func) and not inspect.ismethod(func): + try: + func = getattr(func, '__call__', func) + except Exception: + return () + if startindex is None: + startindex = int(inspect.ismethod(func)) + + try: + rawcode = func.__code__ + except AttributeError: + return () + try: + x = rawcode.co_varnames[startindex:rawcode.co_argcount] + except AttributeError: + x = () + else: + defaults = func.__defaults__ + if defaults: + x = x[:-len(defaults)] + try: + cache["_varnames"] = x + except TypeError: + pass + return x + + +class _HookRelay: + """ hook holder object for performing 1:N hook calls where N is the number + of registered plugins. + + """ + + def __init__(self, trace): + self._trace = trace + + +class _HookCaller(object): + def __init__(self, name, hook_execute, specmodule_or_class=None, spec_opts=None): + self.name = name + self._wrappers = [] + self._nonwrappers = [] + self._hookexec = hook_execute + if specmodule_or_class is not None: + assert spec_opts is not None + self.set_specification(specmodule_or_class, spec_opts) + + def has_spec(self): + return hasattr(self, "_specmodule_or_class") + + def set_specification(self, specmodule_or_class, spec_opts): + assert not self.has_spec() + self._specmodule_or_class = specmodule_or_class + specfunc = getattr(specmodule_or_class, self.name) + argnames = varnames(specfunc, startindex=inspect.isclass(specmodule_or_class)) + assert "self" not in argnames # sanity check + self.argnames = ["__multicall__"] + list(argnames) + self.spec_opts = spec_opts + if spec_opts.get("historic"): + self._call_history = [] + + def is_historic(self): + return hasattr(self, "_call_history") + + def _remove_plugin(self, plugin): + def remove(wrappers): + for i, method in enumerate(wrappers): + if method.plugin == plugin: + del wrappers[i] + return True + if remove(self._wrappers) is None: + if remove(self._nonwrappers) is None: + raise ValueError("plugin %r not found" % (plugin,)) + + def _add_hookimpl(self, hookimpl): + if hookimpl.hookwrapper: + methods = self._wrappers + else: + methods = self._nonwrappers + + if hookimpl.trylast: + methods.insert(0, hookimpl) + elif hookimpl.tryfirst: + methods.append(hookimpl) + else: + # find last non-tryfirst method + i = len(methods) - 1 + while i >= 0 and methods[i].tryfirst: + i -= 1 + methods.insert(i + 1, hookimpl) + + def __repr__(self): + return "<_HookCaller %r>" % (self.name,) + + def __call__(self, **kwargs): + assert not self.is_historic() + return self._hookexec(self, self._nonwrappers + self._wrappers, kwargs) + + def call_historic(self, proc=None, kwargs=None): + self._call_history.append((kwargs or {}, proc)) + # historizing hooks don't return results + self._hookexec(self, self._nonwrappers + self._wrappers, kwargs) + + def call_extra(self, methods, kwargs): + """ Call the hook with some additional temporarily participating + methods using the specified kwargs as call parameters. """ + old = list(self._nonwrappers), list(self._wrappers) + for method in methods: + opts = dict(hookwrapper=False, trylast=False, tryfirst=False) + hookimpl = HookImpl(None, "", method, opts) + self._add_hookimpl(hookimpl) + try: + return self(**kwargs) + finally: + self._nonwrappers, self._wrappers = old + + def _maybe_apply_history(self, method): + if self.is_historic(): + for kwargs, proc in self._call_history: + res = self._hookexec(self, [method], kwargs) + if res and proc is not None: + proc(res[0]) + + +class HookImpl: + def __init__(self, plugin, plugin_name, function, hook_impl_opts): + self.function = function + self.argnames = varnames(self.function) + self.plugin = plugin + self.opts = hook_impl_opts + self.plugin_name = plugin_name + self.__dict__.update(hook_impl_opts) + + +class PluginValidationError(Exception): + """ plugin failed validation. """ + + +class HookCallError(Exception): + """ Hook was called wrongly. """ + + +if hasattr(inspect, 'signature'): + def _formatdef(func): + return "%s%s" % ( + func.__name__, + str(inspect.signature(func)) + ) +else: + def _formatdef(func): + return "%s%s" % ( + func.__name__, + inspect.formatargspec(*inspect.getargspec(func)) + ) diff --git a/lib/spack/external/pytest-fallback/_pytest/warnings.py b/lib/spack/external/pytest-fallback/_pytest/warnings.py new file mode 100644 index 0000000000..926b1f5811 --- /dev/null +++ b/lib/spack/external/pytest-fallback/_pytest/warnings.py @@ -0,0 +1,94 @@ +from __future__ import absolute_import, division, print_function + +import warnings +from contextlib import contextmanager + +import pytest + +from _pytest import compat + + +def _setoption(wmod, arg): + """ + Copy of the warning._setoption function but does not escape arguments. + """ + parts = arg.split(':') + if len(parts) > 5: + raise wmod._OptionError("too many fields (max 5): %r" % (arg,)) + while len(parts) < 5: + parts.append('') + action, message, category, module, lineno = [s.strip() + for s in parts] + action = wmod._getaction(action) + category = wmod._getcategory(category) + if lineno: + try: + lineno = int(lineno) + if lineno < 0: + raise ValueError + except (ValueError, OverflowError): + raise wmod._OptionError("invalid lineno %r" % (lineno,)) + else: + lineno = 0 + wmod.filterwarnings(action, message, category, module, lineno) + + +def pytest_addoption(parser): + group = parser.getgroup("pytest-warnings") + group.addoption( + '-W', '--pythonwarnings', action='append', + help="set which warnings to report, see -W option of python itself.") + parser.addini("filterwarnings", type="linelist", + help="Each line specifies a pattern for " + "warnings.filterwarnings. " + "Processed after -W and --pythonwarnings.") + + +@contextmanager +def catch_warnings_for_item(item): + """ + catches the warnings generated during setup/call/teardown execution + of the given item and after it is done posts them as warnings to this + item. + """ + args = item.config.getoption('pythonwarnings') or [] + inifilters = item.config.getini("filterwarnings") + with warnings.catch_warnings(record=True) as log: + for arg in args: + warnings._setoption(arg) + + for arg in inifilters: + _setoption(warnings, arg) + + mark = item.get_marker('filterwarnings') + if mark: + for arg in mark.args: + warnings._setoption(arg) + + yield + + for warning in log: + warn_msg = warning.message + unicode_warning = False + + if compat._PY2 and any(isinstance(m, compat.UNICODE_TYPES) for m in warn_msg.args): + new_args = [compat.safe_str(m) for m in warn_msg.args] + unicode_warning = warn_msg.args != new_args + warn_msg.args = new_args + + msg = warnings.formatwarning( + warn_msg, warning.category, + warning.filename, warning.lineno, warning.line) + item.warn("unused", msg) + + if unicode_warning: + warnings.warn( + "Warning is using unicode non convertible to ascii, " + "converting to a safe representation:\n %s" % msg, + UnicodeWarning) + + +@pytest.hookimpl(hookwrapper=True) +def pytest_runtest_protocol(item): + with catch_warnings_for_item(item): + yield diff --git a/lib/spack/external/pytest-fallback/py/__init__.py b/lib/spack/external/pytest-fallback/py/__init__.py new file mode 100644 index 0000000000..85af650f5c --- /dev/null +++ b/lib/spack/external/pytest-fallback/py/__init__.py @@ -0,0 +1,152 @@ +""" +pylib: rapid testing and development utils + +this module uses apipkg.py for lazy-loading sub modules +and classes. The initpkg-dictionary below specifies +name->value mappings where value can be another namespace +dictionary or an import path. + +(c) Holger Krekel and others, 2004-2014 +""" +__version__ = '1.4.34' + +from py import _apipkg + +# so that py.error.* instances are picklable +import sys +sys.modules['py.error'] = _apipkg.AliasModule("py.error", "py._error", 'error') +import py.error # "Dereference" it now just to be safe (issue110) + + +_apipkg.initpkg(__name__, attr={'_apipkg': _apipkg}, exportdefs={ + # access to all standard lib modules + 'std': '._std:std', + # access to all posix errno's as classes + 'error': '._error:error', + + '_pydir' : '.__metainfo:pydir', + 'version': 'py:__version__', # backward compatibility + + # pytest-2.0 has a flat namespace, we use alias modules + # to keep old references compatible + 'test' : 'pytest', + 'test.collect' : 'pytest', + 'test.cmdline' : 'pytest', + + # hook into the top-level standard library + 'process' : { + '__doc__' : '._process:__doc__', + 'cmdexec' : '._process.cmdexec:cmdexec', + 'kill' : '._process.killproc:kill', + 'ForkedFunc' : '._process.forkedfunc:ForkedFunc', + }, + + 'apipkg' : { + 'initpkg' : '._apipkg:initpkg', + 'ApiModule' : '._apipkg:ApiModule', + }, + + 'iniconfig' : { + 'IniConfig' : '._iniconfig:IniConfig', + 'ParseError' : '._iniconfig:ParseError', + }, + + 'path' : { + '__doc__' : '._path:__doc__', + 'svnwc' : '._path.svnwc:SvnWCCommandPath', + 'svnurl' : '._path.svnurl:SvnCommandPath', + 'local' : '._path.local:LocalPath', + 'SvnAuth' : '._path.svnwc:SvnAuth', + }, + + # python inspection/code-generation API + 'code' : { + '__doc__' : '._code:__doc__', + 'compile' : '._code.source:compile_', + 'Source' : '._code.source:Source', + 'Code' : '._code.code:Code', + 'Frame' : '._code.code:Frame', + 'ExceptionInfo' : '._code.code:ExceptionInfo', + 'Traceback' : '._code.code:Traceback', + 'getfslineno' : '._code.source:getfslineno', + 'getrawcode' : '._code.code:getrawcode', + 'patch_builtins' : '._code.code:patch_builtins', + 'unpatch_builtins' : '._code.code:unpatch_builtins', + '_AssertionError' : '._code.assertion:AssertionError', + '_reinterpret_old' : '._code.assertion:reinterpret_old', + '_reinterpret' : '._code.assertion:reinterpret', + '_reprcompare' : '._code.assertion:_reprcompare', + '_format_explanation' : '._code.assertion:_format_explanation', + }, + + # backports and additions of builtins + 'builtin' : { + '__doc__' : '._builtin:__doc__', + 'enumerate' : '._builtin:enumerate', + 'reversed' : '._builtin:reversed', + 'sorted' : '._builtin:sorted', + 'any' : '._builtin:any', + 'all' : '._builtin:all', + 'set' : '._builtin:set', + 'frozenset' : '._builtin:frozenset', + 'BaseException' : '._builtin:BaseException', + 'GeneratorExit' : '._builtin:GeneratorExit', + '_sysex' : '._builtin:_sysex', + 'print_' : '._builtin:print_', + '_reraise' : '._builtin:_reraise', + '_tryimport' : '._builtin:_tryimport', + 'exec_' : '._builtin:exec_', + '_basestring' : '._builtin:_basestring', + '_totext' : '._builtin:_totext', + '_isbytes' : '._builtin:_isbytes', + '_istext' : '._builtin:_istext', + '_getimself' : '._builtin:_getimself', + '_getfuncdict' : '._builtin:_getfuncdict', + '_getcode' : '._builtin:_getcode', + 'builtins' : '._builtin:builtins', + 'execfile' : '._builtin:execfile', + 'callable' : '._builtin:callable', + 'bytes' : '._builtin:bytes', + 'text' : '._builtin:text', + }, + + # input-output helping + 'io' : { + '__doc__' : '._io:__doc__', + 'dupfile' : '._io.capture:dupfile', + 'TextIO' : '._io.capture:TextIO', + 'BytesIO' : '._io.capture:BytesIO', + 'FDCapture' : '._io.capture:FDCapture', + 'StdCapture' : '._io.capture:StdCapture', + 'StdCaptureFD' : '._io.capture:StdCaptureFD', + 'TerminalWriter' : '._io.terminalwriter:TerminalWriter', + 'ansi_print' : '._io.terminalwriter:ansi_print', + 'get_terminal_width' : '._io.terminalwriter:get_terminal_width', + 'saferepr' : '._io.saferepr:saferepr', + }, + + # small and mean xml/html generation + 'xml' : { + '__doc__' : '._xmlgen:__doc__', + 'html' : '._xmlgen:html', + 'Tag' : '._xmlgen:Tag', + 'raw' : '._xmlgen:raw', + 'Namespace' : '._xmlgen:Namespace', + 'escape' : '._xmlgen:escape', + }, + + 'log' : { + # logging API ('producers' and 'consumers' connected via keywords) + '__doc__' : '._log:__doc__', + '_apiwarn' : '._log.warning:_apiwarn', + 'Producer' : '._log.log:Producer', + 'setconsumer' : '._log.log:setconsumer', + '_setstate' : '._log.log:setstate', + '_getstate' : '._log.log:getstate', + 'Path' : '._log.log:Path', + 'STDOUT' : '._log.log:STDOUT', + 'STDERR' : '._log.log:STDERR', + 'Syslog' : '._log.log:Syslog', + }, + +}) diff --git a/lib/spack/external/pytest-fallback/py/__metainfo.py b/lib/spack/external/pytest-fallback/py/__metainfo.py new file mode 100644 index 0000000000..12581eb7af --- /dev/null +++ b/lib/spack/external/pytest-fallback/py/__metainfo.py @@ -0,0 +1,2 @@ +import py +pydir = py.path.local(py.__file__).dirpath() diff --git a/lib/spack/external/pytest-fallback/py/_apipkg.py b/lib/spack/external/pytest-fallback/py/_apipkg.py new file mode 100644 index 0000000000..a73b8f6d0b --- /dev/null +++ b/lib/spack/external/pytest-fallback/py/_apipkg.py @@ -0,0 +1,181 @@ +""" +apipkg: control the exported namespace of a python package. + +see http://pypi.python.org/pypi/apipkg + +(c) holger krekel, 2009 - MIT license +""" +import os +import sys +from types import ModuleType + +__version__ = '1.3.dev' + +def _py_abspath(path): + """ + special version of abspath + that will leave paths from jython jars alone + """ + if path.startswith('__pyclasspath__'): + + return path + else: + return os.path.abspath(path) + +def initpkg(pkgname, exportdefs, attr=dict()): + """ initialize given package from the export definitions. """ + oldmod = sys.modules.get(pkgname) + d = {} + f = getattr(oldmod, '__file__', None) + if f: + f = _py_abspath(f) + d['__file__'] = f + if hasattr(oldmod, '__version__'): + d['__version__'] = oldmod.__version__ + if hasattr(oldmod, '__loader__'): + d['__loader__'] = oldmod.__loader__ + if hasattr(oldmod, '__path__'): + d['__path__'] = [_py_abspath(p) for p in oldmod.__path__] + if '__doc__' not in exportdefs and getattr(oldmod, '__doc__', None): + d['__doc__'] = oldmod.__doc__ + d.update(attr) + if hasattr(oldmod, "__dict__"): + oldmod.__dict__.update(d) + mod = ApiModule(pkgname, exportdefs, implprefix=pkgname, attr=d) + sys.modules[pkgname] = mod + +def importobj(modpath, attrname): + module = __import__(modpath, None, None, ['__doc__']) + if not attrname: + return module + + retval = module + names = attrname.split(".") + for x in names: + retval = getattr(retval, x) + return retval + +class ApiModule(ModuleType): + def __docget(self): + try: + return self.__doc + except AttributeError: + if '__doc__' in self.__map__: + return self.__makeattr('__doc__') + def __docset(self, value): + self.__doc = value + __doc__ = property(__docget, __docset) + + def __init__(self, name, importspec, implprefix=None, attr=None): + self.__name__ = name + self.__all__ = [x for x in importspec if x != '__onfirstaccess__'] + self.__map__ = {} + self.__implprefix__ = implprefix or name + if attr: + for name, val in attr.items(): + # print "setting", self.__name__, name, val + setattr(self, name, val) + for name, importspec in importspec.items(): + if isinstance(importspec, dict): + subname = '%s.%s' % (self.__name__, name) + apimod = ApiModule(subname, importspec, implprefix) + sys.modules[subname] = apimod + setattr(self, name, apimod) + else: + parts = importspec.split(':') + modpath = parts.pop(0) + attrname = parts and parts[0] or "" + if modpath[0] == '.': + modpath = implprefix + modpath + + if not attrname: + subname = '%s.%s' % (self.__name__, name) + apimod = AliasModule(subname, modpath) + sys.modules[subname] = apimod + if '.' not in name: + setattr(self, name, apimod) + else: + self.__map__[name] = (modpath, attrname) + + def __repr__(self): + l = [] + if hasattr(self, '__version__'): + l.append("version=" + repr(self.__version__)) + if hasattr(self, '__file__'): + l.append('from ' + repr(self.__file__)) + if l: + return '' % (self.__name__, " ".join(l)) + return '' % (self.__name__,) + + def __makeattr(self, name): + """lazily compute value for name or raise AttributeError if unknown.""" + # print "makeattr", self.__name__, name + target = None + if '__onfirstaccess__' in self.__map__: + target = self.__map__.pop('__onfirstaccess__') + importobj(*target)() + try: + modpath, attrname = self.__map__[name] + except KeyError: + if target is not None and name != '__onfirstaccess__': + # retry, onfirstaccess might have set attrs + return getattr(self, name) + raise AttributeError(name) + else: + result = importobj(modpath, attrname) + setattr(self, name, result) + try: + del self.__map__[name] + except KeyError: + pass # in a recursive-import situation a double-del can happen + return result + + __getattr__ = __makeattr + + def __dict__(self): + # force all the content of the module to be loaded when __dict__ is read + dictdescr = ModuleType.__dict__['__dict__'] + dict = dictdescr.__get__(self) + if dict is not None: + hasattr(self, 'some') + for name in self.__all__: + try: + self.__makeattr(name) + except AttributeError: + pass + return dict + __dict__ = property(__dict__) + + +def AliasModule(modname, modpath, attrname=None): + mod = [] + + def getmod(): + if not mod: + x = importobj(modpath, None) + if attrname is not None: + x = getattr(x, attrname) + mod.append(x) + return mod[0] + + class AliasModule(ModuleType): + + def __repr__(self): + x = modpath + if attrname: + x += "." + attrname + return '' % (modname, x) + + def __getattribute__(self, name): + try: + return getattr(getmod(), name) + except ImportError: + return None + + def __setattr__(self, name, value): + setattr(getmod(), name, value) + + def __delattr__(self, name): + delattr(getmod(), name) + + return AliasModule(str(modname)) diff --git a/lib/spack/external/pytest-fallback/py/_builtin.py b/lib/spack/external/pytest-fallback/py/_builtin.py new file mode 100644 index 0000000000..52ee9d79ca --- /dev/null +++ b/lib/spack/external/pytest-fallback/py/_builtin.py @@ -0,0 +1,248 @@ +import sys + +try: + reversed = reversed +except NameError: + def reversed(sequence): + """reversed(sequence) -> reverse iterator over values of the sequence + + Return a reverse iterator + """ + if hasattr(sequence, '__reversed__'): + return sequence.__reversed__() + if not hasattr(sequence, '__getitem__'): + raise TypeError("argument to reversed() must be a sequence") + return reversed_iterator(sequence) + + class reversed_iterator(object): + + def __init__(self, seq): + self.seq = seq + self.remaining = len(seq) + + def __iter__(self): + return self + + def next(self): + i = self.remaining + if i > 0: + i -= 1 + item = self.seq[i] + self.remaining = i + return item + raise StopIteration + + def __length_hint__(self): + return self.remaining + +try: + any = any +except NameError: + def any(iterable): + for x in iterable: + if x: + return True + return False + +try: + all = all +except NameError: + def all(iterable): + for x in iterable: + if not x: + return False + return True + +try: + sorted = sorted +except NameError: + builtin_cmp = cmp # need to use cmp as keyword arg + + def sorted(iterable, cmp=None, key=None, reverse=0): + use_cmp = None + if key is not None: + if cmp is None: + def use_cmp(x, y): + return builtin_cmp(x[0], y[0]) + else: + def use_cmp(x, y): + return cmp(x[0], y[0]) + l = [(key(element), element) for element in iterable] + else: + if cmp is not None: + use_cmp = cmp + l = list(iterable) + if use_cmp is not None: + l.sort(use_cmp) + else: + l.sort() + if reverse: + l.reverse() + if key is not None: + return [element for (_, element) in l] + return l + +try: + set, frozenset = set, frozenset +except NameError: + from sets import set, frozenset + +# pass through +enumerate = enumerate + +try: + BaseException = BaseException +except NameError: + BaseException = Exception + +try: + GeneratorExit = GeneratorExit +except NameError: + class GeneratorExit(Exception): + """ This exception is never raised, it is there to make it possible to + write code compatible with CPython 2.5 even in lower CPython + versions.""" + pass + GeneratorExit.__module__ = 'exceptions' + +_sysex = (KeyboardInterrupt, SystemExit, MemoryError, GeneratorExit) + +try: + callable = callable +except NameError: + def callable(obj): + return hasattr(obj, "__call__") + +if sys.version_info >= (3, 0): + exec ("print_ = print ; exec_=exec") + import builtins + + # some backward compatibility helpers + _basestring = str + def _totext(obj, encoding=None, errors=None): + if isinstance(obj, bytes): + if errors is None: + obj = obj.decode(encoding) + else: + obj = obj.decode(encoding, errors) + elif not isinstance(obj, str): + obj = str(obj) + return obj + + def _isbytes(x): + return isinstance(x, bytes) + def _istext(x): + return isinstance(x, str) + + text = str + bytes = bytes + + + def _getimself(function): + return getattr(function, '__self__', None) + + def _getfuncdict(function): + return getattr(function, "__dict__", None) + + def _getcode(function): + return getattr(function, "__code__", None) + + def execfile(fn, globs=None, locs=None): + if globs is None: + back = sys._getframe(1) + globs = back.f_globals + locs = back.f_locals + del back + elif locs is None: + locs = globs + fp = open(fn, "r") + try: + source = fp.read() + finally: + fp.close() + co = compile(source, fn, "exec", dont_inherit=True) + exec_(co, globs, locs) + +else: + import __builtin__ as builtins + _totext = unicode + _basestring = basestring + text = unicode + bytes = str + execfile = execfile + callable = callable + def _isbytes(x): + return isinstance(x, str) + def _istext(x): + return isinstance(x, unicode) + + def _getimself(function): + return getattr(function, 'im_self', None) + + def _getfuncdict(function): + return getattr(function, "__dict__", None) + + def _getcode(function): + try: + return getattr(function, "__code__") + except AttributeError: + return getattr(function, "func_code", None) + + def print_(*args, **kwargs): + """ minimal backport of py3k print statement. """ + sep = ' ' + if 'sep' in kwargs: + sep = kwargs.pop('sep') + end = '\n' + if 'end' in kwargs: + end = kwargs.pop('end') + file = 'file' in kwargs and kwargs.pop('file') or sys.stdout + if kwargs: + args = ", ".join([str(x) for x in kwargs]) + raise TypeError("invalid keyword arguments: %s" % args) + at_start = True + for x in args: + if not at_start: + file.write(sep) + file.write(str(x)) + at_start = False + file.write(end) + + def exec_(obj, globals=None, locals=None): + """ minimal backport of py3k exec statement. """ + __tracebackhide__ = True + if globals is None: + frame = sys._getframe(1) + globals = frame.f_globals + if locals is None: + locals = frame.f_locals + elif locals is None: + locals = globals + exec2(obj, globals, locals) + +if sys.version_info >= (3, 0): + def _reraise(cls, val, tb): + __tracebackhide__ = True + assert hasattr(val, '__traceback__') + raise cls.with_traceback(val, tb) +else: + exec (""" +def _reraise(cls, val, tb): + __tracebackhide__ = True + raise cls, val, tb +def exec2(obj, globals, locals): + __tracebackhide__ = True + exec obj in globals, locals +""") + +def _tryimport(*names): + """ return the first successfully imported module. """ + assert names + for name in names: + try: + __import__(name) + except ImportError: + excinfo = sys.exc_info() + else: + return sys.modules[name] + _reraise(*excinfo) diff --git a/lib/spack/external/pytest-fallback/py/_code/__init__.py b/lib/spack/external/pytest-fallback/py/_code/__init__.py new file mode 100644 index 0000000000..f15acf8513 --- /dev/null +++ b/lib/spack/external/pytest-fallback/py/_code/__init__.py @@ -0,0 +1 @@ +""" python inspection/code generation API """ diff --git a/lib/spack/external/pytest-fallback/py/_code/_assertionnew.py b/lib/spack/external/pytest-fallback/py/_code/_assertionnew.py new file mode 100644 index 0000000000..afb1b31ff0 --- /dev/null +++ b/lib/spack/external/pytest-fallback/py/_code/_assertionnew.py @@ -0,0 +1,339 @@ +""" +Find intermediate evalutation results in assert statements through builtin AST. +This should replace _assertionold.py eventually. +""" + +import sys +import ast + +import py +from py._code.assertion import _format_explanation, BuiltinAssertionError + + +if sys.platform.startswith("java") and sys.version_info < (2, 5, 2): + # See http://bugs.jython.org/issue1497 + _exprs = ("BoolOp", "BinOp", "UnaryOp", "Lambda", "IfExp", "Dict", + "ListComp", "GeneratorExp", "Yield", "Compare", "Call", + "Repr", "Num", "Str", "Attribute", "Subscript", "Name", + "List", "Tuple") + _stmts = ("FunctionDef", "ClassDef", "Return", "Delete", "Assign", + "AugAssign", "Print", "For", "While", "If", "With", "Raise", + "TryExcept", "TryFinally", "Assert", "Import", "ImportFrom", + "Exec", "Global", "Expr", "Pass", "Break", "Continue") + _expr_nodes = set(getattr(ast, name) for name in _exprs) + _stmt_nodes = set(getattr(ast, name) for name in _stmts) + def _is_ast_expr(node): + return node.__class__ in _expr_nodes + def _is_ast_stmt(node): + return node.__class__ in _stmt_nodes +else: + def _is_ast_expr(node): + return isinstance(node, ast.expr) + def _is_ast_stmt(node): + return isinstance(node, ast.stmt) + + +class Failure(Exception): + """Error found while interpreting AST.""" + + def __init__(self, explanation=""): + self.cause = sys.exc_info() + self.explanation = explanation + + +def interpret(source, frame, should_fail=False): + mod = ast.parse(source) + visitor = DebugInterpreter(frame) + try: + visitor.visit(mod) + except Failure: + failure = sys.exc_info()[1] + return getfailure(failure) + if should_fail: + return ("(assertion failed, but when it was re-run for " + "printing intermediate values, it did not fail. Suggestions: " + "compute assert expression before the assert or use --no-assert)") + +def run(offending_line, frame=None): + if frame is None: + frame = py.code.Frame(sys._getframe(1)) + return interpret(offending_line, frame) + +def getfailure(failure): + explanation = _format_explanation(failure.explanation) + value = failure.cause[1] + if str(value): + lines = explanation.splitlines() + if not lines: + lines.append("") + lines[0] += " << %s" % (value,) + explanation = "\n".join(lines) + text = "%s: %s" % (failure.cause[0].__name__, explanation) + if text.startswith("AssertionError: assert "): + text = text[16:] + return text + + +operator_map = { + ast.BitOr : "|", + ast.BitXor : "^", + ast.BitAnd : "&", + ast.LShift : "<<", + ast.RShift : ">>", + ast.Add : "+", + ast.Sub : "-", + ast.Mult : "*", + ast.Div : "/", + ast.FloorDiv : "//", + ast.Mod : "%", + ast.Eq : "==", + ast.NotEq : "!=", + ast.Lt : "<", + ast.LtE : "<=", + ast.Gt : ">", + ast.GtE : ">=", + ast.Pow : "**", + ast.Is : "is", + ast.IsNot : "is not", + ast.In : "in", + ast.NotIn : "not in" +} + +unary_map = { + ast.Not : "not %s", + ast.Invert : "~%s", + ast.USub : "-%s", + ast.UAdd : "+%s" +} + + +class DebugInterpreter(ast.NodeVisitor): + """Interpret AST nodes to gleam useful debugging information. """ + + def __init__(self, frame): + self.frame = frame + + def generic_visit(self, node): + # Fallback when we don't have a special implementation. + if _is_ast_expr(node): + mod = ast.Expression(node) + co = self._compile(mod) + try: + result = self.frame.eval(co) + except Exception: + raise Failure() + explanation = self.frame.repr(result) + return explanation, result + elif _is_ast_stmt(node): + mod = ast.Module([node]) + co = self._compile(mod, "exec") + try: + self.frame.exec_(co) + except Exception: + raise Failure() + return None, None + else: + raise AssertionError("can't handle %s" %(node,)) + + def _compile(self, source, mode="eval"): + return compile(source, "", mode) + + def visit_Expr(self, expr): + return self.visit(expr.value) + + def visit_Module(self, mod): + for stmt in mod.body: + self.visit(stmt) + + def visit_Name(self, name): + explanation, result = self.generic_visit(name) + # See if the name is local. + source = "%r in locals() is not globals()" % (name.id,) + co = self._compile(source) + try: + local = self.frame.eval(co) + except Exception: + # have to assume it isn't + local = False + if not local: + return name.id, result + return explanation, result + + def visit_Compare(self, comp): + left = comp.left + left_explanation, left_result = self.visit(left) + for op, next_op in zip(comp.ops, comp.comparators): + next_explanation, next_result = self.visit(next_op) + op_symbol = operator_map[op.__class__] + explanation = "%s %s %s" % (left_explanation, op_symbol, + next_explanation) + source = "__exprinfo_left %s __exprinfo_right" % (op_symbol,) + co = self._compile(source) + try: + result = self.frame.eval(co, __exprinfo_left=left_result, + __exprinfo_right=next_result) + except Exception: + raise Failure(explanation) + try: + if not result: + break + except KeyboardInterrupt: + raise + except: + break + left_explanation, left_result = next_explanation, next_result + + rcomp = py.code._reprcompare + if rcomp: + res = rcomp(op_symbol, left_result, next_result) + if res: + explanation = res + return explanation, result + + def visit_BoolOp(self, boolop): + is_or = isinstance(boolop.op, ast.Or) + explanations = [] + for operand in boolop.values: + explanation, result = self.visit(operand) + explanations.append(explanation) + if result == is_or: + break + name = is_or and " or " or " and " + explanation = "(" + name.join(explanations) + ")" + return explanation, result + + def visit_UnaryOp(self, unary): + pattern = unary_map[unary.op.__class__] + operand_explanation, operand_result = self.visit(unary.operand) + explanation = pattern % (operand_explanation,) + co = self._compile(pattern % ("__exprinfo_expr",)) + try: + result = self.frame.eval(co, __exprinfo_expr=operand_result) + except Exception: + raise Failure(explanation) + return explanation, result + + def visit_BinOp(self, binop): + left_explanation, left_result = self.visit(binop.left) + right_explanation, right_result = self.visit(binop.right) + symbol = operator_map[binop.op.__class__] + explanation = "(%s %s %s)" % (left_explanation, symbol, + right_explanation) + source = "__exprinfo_left %s __exprinfo_right" % (symbol,) + co = self._compile(source) + try: + result = self.frame.eval(co, __exprinfo_left=left_result, + __exprinfo_right=right_result) + except Exception: + raise Failure(explanation) + return explanation, result + + def visit_Call(self, call): + func_explanation, func = self.visit(call.func) + arg_explanations = [] + ns = {"__exprinfo_func" : func} + arguments = [] + for arg in call.args: + arg_explanation, arg_result = self.visit(arg) + arg_name = "__exprinfo_%s" % (len(ns),) + ns[arg_name] = arg_result + arguments.append(arg_name) + arg_explanations.append(arg_explanation) + for keyword in call.keywords: + arg_explanation, arg_result = self.visit(keyword.value) + arg_name = "__exprinfo_%s" % (len(ns),) + ns[arg_name] = arg_result + keyword_source = "%s=%%s" % (keyword.arg) + arguments.append(keyword_source % (arg_name,)) + arg_explanations.append(keyword_source % (arg_explanation,)) + if call.starargs: + arg_explanation, arg_result = self.visit(call.starargs) + arg_name = "__exprinfo_star" + ns[arg_name] = arg_result + arguments.append("*%s" % (arg_name,)) + arg_explanations.append("*%s" % (arg_explanation,)) + if call.kwargs: + arg_explanation, arg_result = self.visit(call.kwargs) + arg_name = "__exprinfo_kwds" + ns[arg_name] = arg_result + arguments.append("**%s" % (arg_name,)) + arg_explanations.append("**%s" % (arg_explanation,)) + args_explained = ", ".join(arg_explanations) + explanation = "%s(%s)" % (func_explanation, args_explained) + args = ", ".join(arguments) + source = "__exprinfo_func(%s)" % (args,) + co = self._compile(source) + try: + result = self.frame.eval(co, **ns) + except Exception: + raise Failure(explanation) + pattern = "%s\n{%s = %s\n}" + rep = self.frame.repr(result) + explanation = pattern % (rep, rep, explanation) + return explanation, result + + def _is_builtin_name(self, name): + pattern = "%r not in globals() and %r not in locals()" + source = pattern % (name.id, name.id) + co = self._compile(source) + try: + return self.frame.eval(co) + except Exception: + return False + + def visit_Attribute(self, attr): + if not isinstance(attr.ctx, ast.Load): + return self.generic_visit(attr) + source_explanation, source_result = self.visit(attr.value) + explanation = "%s.%s" % (source_explanation, attr.attr) + source = "__exprinfo_expr.%s" % (attr.attr,) + co = self._compile(source) + try: + result = self.frame.eval(co, __exprinfo_expr=source_result) + except Exception: + raise Failure(explanation) + explanation = "%s\n{%s = %s.%s\n}" % (self.frame.repr(result), + self.frame.repr(result), + source_explanation, attr.attr) + # Check if the attr is from an instance. + source = "%r in getattr(__exprinfo_expr, '__dict__', {})" + source = source % (attr.attr,) + co = self._compile(source) + try: + from_instance = self.frame.eval(co, __exprinfo_expr=source_result) + except Exception: + from_instance = True + if from_instance: + rep = self.frame.repr(result) + pattern = "%s\n{%s = %s\n}" + explanation = pattern % (rep, rep, explanation) + return explanation, result + + def visit_Assert(self, assrt): + test_explanation, test_result = self.visit(assrt.test) + if test_explanation.startswith("False\n{False =") and \ + test_explanation.endswith("\n"): + test_explanation = test_explanation[15:-2] + explanation = "assert %s" % (test_explanation,) + if not test_result: + try: + raise BuiltinAssertionError + except Exception: + raise Failure(explanation) + return explanation, test_result + + def visit_Assign(self, assign): + value_explanation, value_result = self.visit(assign.value) + explanation = "... = %s" % (value_explanation,) + name = ast.Name("__exprinfo_expr", ast.Load(), + lineno=assign.value.lineno, + col_offset=assign.value.col_offset) + new_assign = ast.Assign(assign.targets, name, lineno=assign.lineno, + col_offset=assign.col_offset) + mod = ast.Module([new_assign]) + co = self._compile(mod, "exec") + try: + self.frame.exec_(co, __exprinfo_expr=value_result) + except Exception: + raise Failure(explanation) + return explanation, value_result diff --git a/lib/spack/external/pytest-fallback/py/_code/_assertionold.py b/lib/spack/external/pytest-fallback/py/_code/_assertionold.py new file mode 100644 index 0000000000..4e81fb3ef6 --- /dev/null +++ b/lib/spack/external/pytest-fallback/py/_code/_assertionold.py @@ -0,0 +1,555 @@ +import py +import sys, inspect +from compiler import parse, ast, pycodegen +from py._code.assertion import BuiltinAssertionError, _format_explanation + +passthroughex = py.builtin._sysex + +class Failure: + def __init__(self, node): + self.exc, self.value, self.tb = sys.exc_info() + self.node = node + +class View(object): + """View base class. + + If C is a subclass of View, then C(x) creates a proxy object around + the object x. The actual class of the proxy is not C in general, + but a *subclass* of C determined by the rules below. To avoid confusion + we call view class the class of the proxy (a subclass of C, so of View) + and object class the class of x. + + Attributes and methods not found in the proxy are automatically read on x. + Other operations like setting attributes are performed on the proxy, as + determined by its view class. The object x is available from the proxy + as its __obj__ attribute. + + The view class selection is determined by the __view__ tuples and the + optional __viewkey__ method. By default, the selected view class is the + most specific subclass of C whose __view__ mentions the class of x. + If no such subclass is found, the search proceeds with the parent + object classes. For example, C(True) will first look for a subclass + of C with __view__ = (..., bool, ...) and only if it doesn't find any + look for one with __view__ = (..., int, ...), and then ..., object,... + If everything fails the class C itself is considered to be the default. + + Alternatively, the view class selection can be driven by another aspect + of the object x, instead of the class of x, by overriding __viewkey__. + See last example at the end of this module. + """ + + _viewcache = {} + __view__ = () + + def __new__(rootclass, obj, *args, **kwds): + self = object.__new__(rootclass) + self.__obj__ = obj + self.__rootclass__ = rootclass + key = self.__viewkey__() + try: + self.__class__ = self._viewcache[key] + except KeyError: + self.__class__ = self._selectsubclass(key) + return self + + def __getattr__(self, attr): + # attributes not found in the normal hierarchy rooted on View + # are looked up in the object's real class + return getattr(self.__obj__, attr) + + def __viewkey__(self): + return self.__obj__.__class__ + + def __matchkey__(self, key, subclasses): + if inspect.isclass(key): + keys = inspect.getmro(key) + else: + keys = [key] + for key in keys: + result = [C for C in subclasses if key in C.__view__] + if result: + return result + return [] + + def _selectsubclass(self, key): + subclasses = list(enumsubclasses(self.__rootclass__)) + for C in subclasses: + if not isinstance(C.__view__, tuple): + C.__view__ = (C.__view__,) + choices = self.__matchkey__(key, subclasses) + if not choices: + return self.__rootclass__ + elif len(choices) == 1: + return choices[0] + else: + # combine the multiple choices + return type('?', tuple(choices), {}) + + def __repr__(self): + return '%s(%r)' % (self.__rootclass__.__name__, self.__obj__) + + +def enumsubclasses(cls): + for subcls in cls.__subclasses__(): + for subsubclass in enumsubclasses(subcls): + yield subsubclass + yield cls + + +class Interpretable(View): + """A parse tree node with a few extra methods.""" + explanation = None + + def is_builtin(self, frame): + return False + + def eval(self, frame): + # fall-back for unknown expression nodes + try: + expr = ast.Expression(self.__obj__) + expr.filename = '' + self.__obj__.filename = '' + co = pycodegen.ExpressionCodeGenerator(expr).getCode() + result = frame.eval(co) + except passthroughex: + raise + except: + raise Failure(self) + self.result = result + self.explanation = self.explanation or frame.repr(self.result) + + def run(self, frame): + # fall-back for unknown statement nodes + try: + expr = ast.Module(None, ast.Stmt([self.__obj__])) + expr.filename = '' + co = pycodegen.ModuleCodeGenerator(expr).getCode() + frame.exec_(co) + except passthroughex: + raise + except: + raise Failure(self) + + def nice_explanation(self): + return _format_explanation(self.explanation) + + +class Name(Interpretable): + __view__ = ast.Name + + def is_local(self, frame): + source = '%r in locals() is not globals()' % self.name + try: + return frame.is_true(frame.eval(source)) + except passthroughex: + raise + except: + return False + + def is_global(self, frame): + source = '%r in globals()' % self.name + try: + return frame.is_true(frame.eval(source)) + except passthroughex: + raise + except: + return False + + def is_builtin(self, frame): + source = '%r not in locals() and %r not in globals()' % ( + self.name, self.name) + try: + return frame.is_true(frame.eval(source)) + except passthroughex: + raise + except: + return False + + def eval(self, frame): + super(Name, self).eval(frame) + if not self.is_local(frame): + self.explanation = self.name + +class Compare(Interpretable): + __view__ = ast.Compare + + def eval(self, frame): + expr = Interpretable(self.expr) + expr.eval(frame) + for operation, expr2 in self.ops: + if hasattr(self, 'result'): + # shortcutting in chained expressions + if not frame.is_true(self.result): + break + expr2 = Interpretable(expr2) + expr2.eval(frame) + self.explanation = "%s %s %s" % ( + expr.explanation, operation, expr2.explanation) + source = "__exprinfo_left %s __exprinfo_right" % operation + try: + self.result = frame.eval(source, + __exprinfo_left=expr.result, + __exprinfo_right=expr2.result) + except passthroughex: + raise + except: + raise Failure(self) + expr = expr2 + +class And(Interpretable): + __view__ = ast.And + + def eval(self, frame): + explanations = [] + for expr in self.nodes: + expr = Interpretable(expr) + expr.eval(frame) + explanations.append(expr.explanation) + self.result = expr.result + if not frame.is_true(expr.result): + break + self.explanation = '(' + ' and '.join(explanations) + ')' + +class Or(Interpretable): + __view__ = ast.Or + + def eval(self, frame): + explanations = [] + for expr in self.nodes: + expr = Interpretable(expr) + expr.eval(frame) + explanations.append(expr.explanation) + self.result = expr.result + if frame.is_true(expr.result): + break + self.explanation = '(' + ' or '.join(explanations) + ')' + + +# == Unary operations == +keepalive = [] +for astclass, astpattern in { + ast.Not : 'not __exprinfo_expr', + ast.Invert : '(~__exprinfo_expr)', + }.items(): + + class UnaryArith(Interpretable): + __view__ = astclass + + def eval(self, frame, astpattern=astpattern): + expr = Interpretable(self.expr) + expr.eval(frame) + self.explanation = astpattern.replace('__exprinfo_expr', + expr.explanation) + try: + self.result = frame.eval(astpattern, + __exprinfo_expr=expr.result) + except passthroughex: + raise + except: + raise Failure(self) + + keepalive.append(UnaryArith) + +# == Binary operations == +for astclass, astpattern in { + ast.Add : '(__exprinfo_left + __exprinfo_right)', + ast.Sub : '(__exprinfo_left - __exprinfo_right)', + ast.Mul : '(__exprinfo_left * __exprinfo_right)', + ast.Div : '(__exprinfo_left / __exprinfo_right)', + ast.Mod : '(__exprinfo_left % __exprinfo_right)', + ast.Power : '(__exprinfo_left ** __exprinfo_right)', + }.items(): + + class BinaryArith(Interpretable): + __view__ = astclass + + def eval(self, frame, astpattern=astpattern): + left = Interpretable(self.left) + left.eval(frame) + right = Interpretable(self.right) + right.eval(frame) + self.explanation = (astpattern + .replace('__exprinfo_left', left .explanation) + .replace('__exprinfo_right', right.explanation)) + try: + self.result = frame.eval(astpattern, + __exprinfo_left=left.result, + __exprinfo_right=right.result) + except passthroughex: + raise + except: + raise Failure(self) + + keepalive.append(BinaryArith) + + +class CallFunc(Interpretable): + __view__ = ast.CallFunc + + def is_bool(self, frame): + source = 'isinstance(__exprinfo_value, bool)' + try: + return frame.is_true(frame.eval(source, + __exprinfo_value=self.result)) + except passthroughex: + raise + except: + return False + + def eval(self, frame): + node = Interpretable(self.node) + node.eval(frame) + explanations = [] + vars = {'__exprinfo_fn': node.result} + source = '__exprinfo_fn(' + for a in self.args: + if isinstance(a, ast.Keyword): + keyword = a.name + a = a.expr + else: + keyword = None + a = Interpretable(a) + a.eval(frame) + argname = '__exprinfo_%d' % len(vars) + vars[argname] = a.result + if keyword is None: + source += argname + ',' + explanations.append(a.explanation) + else: + source += '%s=%s,' % (keyword, argname) + explanations.append('%s=%s' % (keyword, a.explanation)) + if self.star_args: + star_args = Interpretable(self.star_args) + star_args.eval(frame) + argname = '__exprinfo_star' + vars[argname] = star_args.result + source += '*' + argname + ',' + explanations.append('*' + star_args.explanation) + if self.dstar_args: + dstar_args = Interpretable(self.dstar_args) + dstar_args.eval(frame) + argname = '__exprinfo_kwds' + vars[argname] = dstar_args.result + source += '**' + argname + ',' + explanations.append('**' + dstar_args.explanation) + self.explanation = "%s(%s)" % ( + node.explanation, ', '.join(explanations)) + if source.endswith(','): + source = source[:-1] + source += ')' + try: + self.result = frame.eval(source, **vars) + except passthroughex: + raise + except: + raise Failure(self) + if not node.is_builtin(frame) or not self.is_bool(frame): + r = frame.repr(self.result) + self.explanation = '%s\n{%s = %s\n}' % (r, r, self.explanation) + +class Getattr(Interpretable): + __view__ = ast.Getattr + + def eval(self, frame): + expr = Interpretable(self.expr) + expr.eval(frame) + source = '__exprinfo_expr.%s' % self.attrname + try: + self.result = frame.eval(source, __exprinfo_expr=expr.result) + except passthroughex: + raise + except: + raise Failure(self) + self.explanation = '%s.%s' % (expr.explanation, self.attrname) + # if the attribute comes from the instance, its value is interesting + source = ('hasattr(__exprinfo_expr, "__dict__") and ' + '%r in __exprinfo_expr.__dict__' % self.attrname) + try: + from_instance = frame.is_true( + frame.eval(source, __exprinfo_expr=expr.result)) + except passthroughex: + raise + except: + from_instance = True + if from_instance: + r = frame.repr(self.result) + self.explanation = '%s\n{%s = %s\n}' % (r, r, self.explanation) + +# == Re-interpretation of full statements == + +class Assert(Interpretable): + __view__ = ast.Assert + + def run(self, frame): + test = Interpretable(self.test) + test.eval(frame) + # simplify 'assert False where False = ...' + if (test.explanation.startswith('False\n{False = ') and + test.explanation.endswith('\n}')): + test.explanation = test.explanation[15:-2] + # print the result as 'assert ' + self.result = test.result + self.explanation = 'assert ' + test.explanation + if not frame.is_true(test.result): + try: + raise BuiltinAssertionError + except passthroughex: + raise + except: + raise Failure(self) + +class Assign(Interpretable): + __view__ = ast.Assign + + def run(self, frame): + expr = Interpretable(self.expr) + expr.eval(frame) + self.result = expr.result + self.explanation = '... = ' + expr.explanation + # fall-back-run the rest of the assignment + ass = ast.Assign(self.nodes, ast.Name('__exprinfo_expr')) + mod = ast.Module(None, ast.Stmt([ass])) + mod.filename = '' + co = pycodegen.ModuleCodeGenerator(mod).getCode() + try: + frame.exec_(co, __exprinfo_expr=expr.result) + except passthroughex: + raise + except: + raise Failure(self) + +class Discard(Interpretable): + __view__ = ast.Discard + + def run(self, frame): + expr = Interpretable(self.expr) + expr.eval(frame) + self.result = expr.result + self.explanation = expr.explanation + +class Stmt(Interpretable): + __view__ = ast.Stmt + + def run(self, frame): + for stmt in self.nodes: + stmt = Interpretable(stmt) + stmt.run(frame) + + +def report_failure(e): + explanation = e.node.nice_explanation() + if explanation: + explanation = ", in: " + explanation + else: + explanation = "" + sys.stdout.write("%s: %s%s\n" % (e.exc.__name__, e.value, explanation)) + +def check(s, frame=None): + if frame is None: + frame = sys._getframe(1) + frame = py.code.Frame(frame) + expr = parse(s, 'eval') + assert isinstance(expr, ast.Expression) + node = Interpretable(expr.node) + try: + node.eval(frame) + except passthroughex: + raise + except Failure: + e = sys.exc_info()[1] + report_failure(e) + else: + if not frame.is_true(node.result): + sys.stderr.write("assertion failed: %s\n" % node.nice_explanation()) + + +########################################################### +# API / Entry points +# ######################################################### + +def interpret(source, frame, should_fail=False): + module = Interpretable(parse(source, 'exec').node) + #print "got module", module + if isinstance(frame, py.std.types.FrameType): + frame = py.code.Frame(frame) + try: + module.run(frame) + except Failure: + e = sys.exc_info()[1] + return getfailure(e) + except passthroughex: + raise + except: + import traceback + traceback.print_exc() + if should_fail: + return ("(assertion failed, but when it was re-run for " + "printing intermediate values, it did not fail. Suggestions: " + "compute assert expression before the assert or use --nomagic)") + else: + return None + +def getmsg(excinfo): + if isinstance(excinfo, tuple): + excinfo = py.code.ExceptionInfo(excinfo) + #frame, line = gettbline(tb) + #frame = py.code.Frame(frame) + #return interpret(line, frame) + + tb = excinfo.traceback[-1] + source = str(tb.statement).strip() + x = interpret(source, tb.frame, should_fail=True) + if not isinstance(x, str): + raise TypeError("interpret returned non-string %r" % (x,)) + return x + +def getfailure(e): + explanation = e.node.nice_explanation() + if str(e.value): + lines = explanation.split('\n') + lines[0] += " << %s" % (e.value,) + explanation = '\n'.join(lines) + text = "%s: %s" % (e.exc.__name__, explanation) + if text.startswith('AssertionError: assert '): + text = text[16:] + return text + +def run(s, frame=None): + if frame is None: + frame = sys._getframe(1) + frame = py.code.Frame(frame) + module = Interpretable(parse(s, 'exec').node) + try: + module.run(frame) + except Failure: + e = sys.exc_info()[1] + report_failure(e) + + +if __name__ == '__main__': + # example: + def f(): + return 5 + def g(): + return 3 + def h(x): + return 'never' + check("f() * g() == 5") + check("not f()") + check("not (f() and g() or 0)") + check("f() == g()") + i = 4 + check("i == f()") + check("len(f()) == 0") + check("isinstance(2+3+4, float)") + + run("x = i") + check("x == 5") + + run("assert not f(), 'oops'") + run("a, b, c = 1, 2") + run("a, b, c = f()") + + check("max([f(),g()]) == 4") + check("'hello'[g()] == 'h'") + run("'guk%d' % h(f())") diff --git a/lib/spack/external/pytest-fallback/py/_code/_py2traceback.py b/lib/spack/external/pytest-fallback/py/_code/_py2traceback.py new file mode 100644 index 0000000000..d65e27cb73 --- /dev/null +++ b/lib/spack/external/pytest-fallback/py/_code/_py2traceback.py @@ -0,0 +1,79 @@ +# copied from python-2.7.3's traceback.py +# CHANGES: +# - some_str is replaced, trying to create unicode strings +# +import types + +def format_exception_only(etype, value): + """Format the exception part of a traceback. + + The arguments are the exception type and value such as given by + sys.last_type and sys.last_value. The return value is a list of + strings, each ending in a newline. + + Normally, the list contains a single string; however, for + SyntaxError exceptions, it contains several lines that (when + printed) display detailed information about where the syntax + error occurred. + + The message indicating which exception occurred is always the last + string in the list. + + """ + + # An instance should not have a meaningful value parameter, but + # sometimes does, particularly for string exceptions, such as + # >>> raise string1, string2 # deprecated + # + # Clear these out first because issubtype(string1, SyntaxError) + # would throw another exception and mask the original problem. + if (isinstance(etype, BaseException) or + isinstance(etype, types.InstanceType) or + etype is None or type(etype) is str): + return [_format_final_exc_line(etype, value)] + + stype = etype.__name__ + + if not issubclass(etype, SyntaxError): + return [_format_final_exc_line(stype, value)] + + # It was a syntax error; show exactly where the problem was found. + lines = [] + try: + msg, (filename, lineno, offset, badline) = value.args + except Exception: + pass + else: + filename = filename or "" + lines.append(' File "%s", line %d\n' % (filename, lineno)) + if badline is not None: + lines.append(' %s\n' % badline.strip()) + if offset is not None: + caretspace = badline.rstrip('\n')[:offset].lstrip() + # non-space whitespace (likes tabs) must be kept for alignment + caretspace = ((c.isspace() and c or ' ') for c in caretspace) + # only three spaces to account for offset1 == pos 0 + lines.append(' %s^\n' % ''.join(caretspace)) + value = msg + + lines.append(_format_final_exc_line(stype, value)) + return lines + +def _format_final_exc_line(etype, value): + """Return a list of a single line -- normal case for format_exception_only""" + valuestr = _some_str(value) + if value is None or not valuestr: + line = "%s\n" % etype + else: + line = "%s: %s\n" % (etype, valuestr) + return line + +def _some_str(value): + try: + return unicode(value) + except Exception: + try: + return str(value) + except Exception: + pass + return '' % type(value).__name__ diff --git a/lib/spack/external/pytest-fallback/py/_code/assertion.py b/lib/spack/external/pytest-fallback/py/_code/assertion.py new file mode 100644 index 0000000000..4ce80c75b1 --- /dev/null +++ b/lib/spack/external/pytest-fallback/py/_code/assertion.py @@ -0,0 +1,94 @@ +import sys +import py + +BuiltinAssertionError = py.builtin.builtins.AssertionError + +_reprcompare = None # if set, will be called by assert reinterp for comparison ops + +def _format_explanation(explanation): + """This formats an explanation + + Normally all embedded newlines are escaped, however there are + three exceptions: \n{, \n} and \n~. The first two are intended + cover nested explanations, see function and attribute explanations + for examples (.visit_Call(), visit_Attribute()). The last one is + for when one explanation needs to span multiple lines, e.g. when + displaying diffs. + """ + raw_lines = (explanation or '').split('\n') + # escape newlines not followed by {, } and ~ + lines = [raw_lines[0]] + for l in raw_lines[1:]: + if l.startswith('{') or l.startswith('}') or l.startswith('~'): + lines.append(l) + else: + lines[-1] += '\\n' + l + + result = lines[:1] + stack = [0] + stackcnt = [0] + for line in lines[1:]: + if line.startswith('{'): + if stackcnt[-1]: + s = 'and ' + else: + s = 'where ' + stack.append(len(result)) + stackcnt[-1] += 1 + stackcnt.append(0) + result.append(' +' + ' '*(len(stack)-1) + s + line[1:]) + elif line.startswith('}'): + assert line.startswith('}') + stack.pop() + stackcnt.pop() + result[stack[-1]] += line[1:] + else: + assert line.startswith('~') + result.append(' '*len(stack) + line[1:]) + assert len(stack) == 1 + return '\n'.join(result) + + +class AssertionError(BuiltinAssertionError): + def __init__(self, *args): + BuiltinAssertionError.__init__(self, *args) + if args: + try: + self.msg = str(args[0]) + except py.builtin._sysex: + raise + except: + self.msg = "<[broken __repr__] %s at %0xd>" %( + args[0].__class__, id(args[0])) + else: + f = py.code.Frame(sys._getframe(1)) + try: + source = f.code.fullsource + if source is not None: + try: + source = source.getstatement(f.lineno, assertion=True) + except IndexError: + source = None + else: + source = str(source.deindent()).strip() + except py.error.ENOENT: + source = None + # this can also occur during reinterpretation, when the + # co_filename is set to "". + if source: + self.msg = reinterpret(source, f, should_fail=True) + else: + self.msg = "" + if not self.args: + self.args = (self.msg,) + +if sys.version_info > (3, 0): + AssertionError.__module__ = "builtins" + reinterpret_old = "old reinterpretation not available for py3" +else: + from py._code._assertionold import interpret as reinterpret_old +if sys.version_info >= (2, 6) or (sys.platform.startswith("java")): + from py._code._assertionnew import interpret as reinterpret +else: + reinterpret = reinterpret_old + diff --git a/lib/spack/external/pytest-fallback/py/_code/code.py b/lib/spack/external/pytest-fallback/py/_code/code.py new file mode 100644 index 0000000000..20fd965c97 --- /dev/null +++ b/lib/spack/external/pytest-fallback/py/_code/code.py @@ -0,0 +1,787 @@ +import py +import sys +from inspect import CO_VARARGS, CO_VARKEYWORDS + +builtin_repr = repr + +reprlib = py.builtin._tryimport('repr', 'reprlib') + +if sys.version_info[0] >= 3: + from traceback import format_exception_only +else: + from py._code._py2traceback import format_exception_only + +class Code(object): + """ wrapper around Python code objects """ + def __init__(self, rawcode): + if not hasattr(rawcode, "co_filename"): + rawcode = py.code.getrawcode(rawcode) + try: + self.filename = rawcode.co_filename + self.firstlineno = rawcode.co_firstlineno - 1 + self.name = rawcode.co_name + except AttributeError: + raise TypeError("not a code object: %r" %(rawcode,)) + self.raw = rawcode + + def __eq__(self, other): + return self.raw == other.raw + + def __ne__(self, other): + return not self == other + + @property + def path(self): + """ return a path object pointing to source code (note that it + might not point to an actually existing file). """ + p = py.path.local(self.raw.co_filename) + # maybe don't try this checking + if not p.check(): + # XXX maybe try harder like the weird logic + # in the standard lib [linecache.updatecache] does? + p = self.raw.co_filename + return p + + @property + def fullsource(self): + """ return a py.code.Source object for the full source file of the code + """ + from py._code import source + full, _ = source.findsource(self.raw) + return full + + def source(self): + """ return a py.code.Source object for the code object's source only + """ + # return source only for that part of code + return py.code.Source(self.raw) + + def getargs(self, var=False): + """ return a tuple with the argument names for the code object + + if 'var' is set True also return the names of the variable and + keyword arguments when present + """ + # handfull shortcut for getting args + raw = self.raw + argcount = raw.co_argcount + if var: + argcount += raw.co_flags & CO_VARARGS + argcount += raw.co_flags & CO_VARKEYWORDS + return raw.co_varnames[:argcount] + +class Frame(object): + """Wrapper around a Python frame holding f_locals and f_globals + in which expressions can be evaluated.""" + + def __init__(self, frame): + self.lineno = frame.f_lineno - 1 + self.f_globals = frame.f_globals + self.f_locals = frame.f_locals + self.raw = frame + self.code = py.code.Code(frame.f_code) + + @property + def statement(self): + """ statement this frame is at """ + if self.code.fullsource is None: + return py.code.Source("") + return self.code.fullsource.getstatement(self.lineno) + + def eval(self, code, **vars): + """ evaluate 'code' in the frame + + 'vars' are optional additional local variables + + returns the result of the evaluation + """ + f_locals = self.f_locals.copy() + f_locals.update(vars) + return eval(code, self.f_globals, f_locals) + + def exec_(self, code, **vars): + """ exec 'code' in the frame + + 'vars' are optiona; additional local variables + """ + f_locals = self.f_locals.copy() + f_locals.update(vars) + py.builtin.exec_(code, self.f_globals, f_locals ) + + def repr(self, object): + """ return a 'safe' (non-recursive, one-line) string repr for 'object' + """ + return py.io.saferepr(object) + + def is_true(self, object): + return object + + def getargs(self, var=False): + """ return a list of tuples (name, value) for all arguments + + if 'var' is set True also include the variable and keyword + arguments when present + """ + retval = [] + for arg in self.code.getargs(var): + try: + retval.append((arg, self.f_locals[arg])) + except KeyError: + pass # this can occur when using Psyco + return retval + +class TracebackEntry(object): + """ a single entry in a traceback """ + + _repr_style = None + exprinfo = None + + def __init__(self, rawentry): + self._rawentry = rawentry + self.lineno = rawentry.tb_lineno - 1 + + def set_repr_style(self, mode): + assert mode in ("short", "long") + self._repr_style = mode + + @property + def frame(self): + return py.code.Frame(self._rawentry.tb_frame) + + @property + def relline(self): + return self.lineno - self.frame.code.firstlineno + + def __repr__(self): + return "" %(self.frame.code.path, self.lineno+1) + + @property + def statement(self): + """ py.code.Source object for the current statement """ + source = self.frame.code.fullsource + return source.getstatement(self.lineno) + + @property + def path(self): + """ path to the source code """ + return self.frame.code.path + + def getlocals(self): + return self.frame.f_locals + locals = property(getlocals, None, None, "locals of underlaying frame") + + def reinterpret(self): + """Reinterpret the failing statement and returns a detailed information + about what operations are performed.""" + if self.exprinfo is None: + source = str(self.statement).strip() + x = py.code._reinterpret(source, self.frame, should_fail=True) + if not isinstance(x, str): + raise TypeError("interpret returned non-string %r" % (x,)) + self.exprinfo = x + return self.exprinfo + + def getfirstlinesource(self): + # on Jython this firstlineno can be -1 apparently + return max(self.frame.code.firstlineno, 0) + + def getsource(self, astcache=None): + """ return failing source code. """ + # we use the passed in astcache to not reparse asttrees + # within exception info printing + from py._code.source import getstatementrange_ast + source = self.frame.code.fullsource + if source is None: + return None + key = astnode = None + if astcache is not None: + key = self.frame.code.path + if key is not None: + astnode = astcache.get(key, None) + start = self.getfirstlinesource() + try: + astnode, _, end = getstatementrange_ast(self.lineno, source, + astnode=astnode) + except SyntaxError: + end = self.lineno + 1 + else: + if key is not None: + astcache[key] = astnode + return source[start:end] + + source = property(getsource) + + def ishidden(self): + """ return True if the current frame has a var __tracebackhide__ + resolving to True + + mostly for internal use + """ + try: + return self.frame.f_locals['__tracebackhide__'] + except KeyError: + try: + return self.frame.f_globals['__tracebackhide__'] + except KeyError: + return False + + def __str__(self): + try: + fn = str(self.path) + except py.error.Error: + fn = '???' + name = self.frame.code.name + try: + line = str(self.statement).lstrip() + except KeyboardInterrupt: + raise + except: + line = "???" + return " File %r:%d in %s\n %s\n" %(fn, self.lineno+1, name, line) + + def name(self): + return self.frame.code.raw.co_name + name = property(name, None, None, "co_name of underlaying code") + +class Traceback(list): + """ Traceback objects encapsulate and offer higher level + access to Traceback entries. + """ + Entry = TracebackEntry + def __init__(self, tb): + """ initialize from given python traceback object. """ + if hasattr(tb, 'tb_next'): + def f(cur): + while cur is not None: + yield self.Entry(cur) + cur = cur.tb_next + list.__init__(self, f(tb)) + else: + list.__init__(self, tb) + + def cut(self, path=None, lineno=None, firstlineno=None, excludepath=None): + """ return a Traceback instance wrapping part of this Traceback + + by provding any combination of path, lineno and firstlineno, the + first frame to start the to-be-returned traceback is determined + + this allows cutting the first part of a Traceback instance e.g. + for formatting reasons (removing some uninteresting bits that deal + with handling of the exception/traceback) + """ + for x in self: + code = x.frame.code + codepath = code.path + if ((path is None or codepath == path) and + (excludepath is None or not hasattr(codepath, 'relto') or + not codepath.relto(excludepath)) and + (lineno is None or x.lineno == lineno) and + (firstlineno is None or x.frame.code.firstlineno == firstlineno)): + return Traceback(x._rawentry) + return self + + def __getitem__(self, key): + val = super(Traceback, self).__getitem__(key) + if isinstance(key, type(slice(0))): + val = self.__class__(val) + return val + + def filter(self, fn=lambda x: not x.ishidden()): + """ return a Traceback instance with certain items removed + + fn is a function that gets a single argument, a TracebackItem + instance, and should return True when the item should be added + to the Traceback, False when not + + by default this removes all the TracebackItems which are hidden + (see ishidden() above) + """ + return Traceback(filter(fn, self)) + + def getcrashentry(self): + """ return last non-hidden traceback entry that lead + to the exception of a traceback. + """ + for i in range(-1, -len(self)-1, -1): + entry = self[i] + if not entry.ishidden(): + return entry + return self[-1] + + def recursionindex(self): + """ return the index of the frame/TracebackItem where recursion + originates if appropriate, None if no recursion occurred + """ + cache = {} + for i, entry in enumerate(self): + # id for the code.raw is needed to work around + # the strange metaprogramming in the decorator lib from pypi + # which generates code objects that have hash/value equality + #XXX needs a test + key = entry.frame.code.path, id(entry.frame.code.raw), entry.lineno + #print "checking for recursion at", key + l = cache.setdefault(key, []) + if l: + f = entry.frame + loc = f.f_locals + for otherloc in l: + if f.is_true(f.eval(co_equal, + __recursioncache_locals_1=loc, + __recursioncache_locals_2=otherloc)): + return i + l.append(entry.frame.f_locals) + return None + +co_equal = compile('__recursioncache_locals_1 == __recursioncache_locals_2', + '?', 'eval') + +class ExceptionInfo(object): + """ wraps sys.exc_info() objects and offers + help for navigating the traceback. + """ + _striptext = '' + def __init__(self, tup=None, exprinfo=None): + if tup is None: + tup = sys.exc_info() + if exprinfo is None and isinstance(tup[1], AssertionError): + exprinfo = getattr(tup[1], 'msg', None) + if exprinfo is None: + exprinfo = str(tup[1]) + if exprinfo and exprinfo.startswith('assert '): + self._striptext = 'AssertionError: ' + self._excinfo = tup + #: the exception class + self.type = tup[0] + #: the exception instance + self.value = tup[1] + #: the exception raw traceback + self.tb = tup[2] + #: the exception type name + self.typename = self.type.__name__ + #: the exception traceback (py.code.Traceback instance) + self.traceback = py.code.Traceback(self.tb) + + def __repr__(self): + return "" % (self.typename, len(self.traceback)) + + def exconly(self, tryshort=False): + """ return the exception as a string + + when 'tryshort' resolves to True, and the exception is a + py.code._AssertionError, only the actual exception part of + the exception representation is returned (so 'AssertionError: ' is + removed from the beginning) + """ + lines = format_exception_only(self.type, self.value) + text = ''.join(lines) + text = text.rstrip() + if tryshort: + if text.startswith(self._striptext): + text = text[len(self._striptext):] + return text + + def errisinstance(self, exc): + """ return True if the exception is an instance of exc """ + return isinstance(self.value, exc) + + def _getreprcrash(self): + exconly = self.exconly(tryshort=True) + entry = self.traceback.getcrashentry() + path, lineno = entry.frame.code.raw.co_filename, entry.lineno + return ReprFileLocation(path, lineno+1, exconly) + + def getrepr(self, showlocals=False, style="long", + abspath=False, tbfilter=True, funcargs=False): + """ return str()able representation of this exception info. + showlocals: show locals per traceback entry + style: long|short|no|native traceback style + tbfilter: hide entries (where __tracebackhide__ is true) + + in case of style==native, tbfilter and showlocals is ignored. + """ + if style == 'native': + return ReprExceptionInfo(ReprTracebackNative( + py.std.traceback.format_exception( + self.type, + self.value, + self.traceback[0]._rawentry, + )), self._getreprcrash()) + + fmt = FormattedExcinfo(showlocals=showlocals, style=style, + abspath=abspath, tbfilter=tbfilter, funcargs=funcargs) + return fmt.repr_excinfo(self) + + def __str__(self): + entry = self.traceback[-1] + loc = ReprFileLocation(entry.path, entry.lineno + 1, self.exconly()) + return str(loc) + + def __unicode__(self): + entry = self.traceback[-1] + loc = ReprFileLocation(entry.path, entry.lineno + 1, self.exconly()) + return loc.__unicode__() + + +class FormattedExcinfo(object): + """ presenting information about failing Functions and Generators. """ + # for traceback entries + flow_marker = ">" + fail_marker = "E" + + def __init__(self, showlocals=False, style="long", abspath=True, tbfilter=True, funcargs=False): + self.showlocals = showlocals + self.style = style + self.tbfilter = tbfilter + self.funcargs = funcargs + self.abspath = abspath + self.astcache = {} + + def _getindent(self, source): + # figure out indent for given source + try: + s = str(source.getstatement(len(source)-1)) + except KeyboardInterrupt: + raise + except: + try: + s = str(source[-1]) + except KeyboardInterrupt: + raise + except: + return 0 + return 4 + (len(s) - len(s.lstrip())) + + def _getentrysource(self, entry): + source = entry.getsource(self.astcache) + if source is not None: + source = source.deindent() + return source + + def _saferepr(self, obj): + return py.io.saferepr(obj) + + def repr_args(self, entry): + if self.funcargs: + args = [] + for argname, argvalue in entry.frame.getargs(var=True): + args.append((argname, self._saferepr(argvalue))) + return ReprFuncArgs(args) + + def get_source(self, source, line_index=-1, excinfo=None, short=False): + """ return formatted and marked up source lines. """ + lines = [] + if source is None or line_index >= len(source.lines): + source = py.code.Source("???") + line_index = 0 + if line_index < 0: + line_index += len(source) + space_prefix = " " + if short: + lines.append(space_prefix + source.lines[line_index].strip()) + else: + for line in source.lines[:line_index]: + lines.append(space_prefix + line) + lines.append(self.flow_marker + " " + source.lines[line_index]) + for line in source.lines[line_index+1:]: + lines.append(space_prefix + line) + if excinfo is not None: + indent = 4 if short else self._getindent(source) + lines.extend(self.get_exconly(excinfo, indent=indent, markall=True)) + return lines + + def get_exconly(self, excinfo, indent=4, markall=False): + lines = [] + indent = " " * indent + # get the real exception information out + exlines = excinfo.exconly(tryshort=True).split('\n') + failindent = self.fail_marker + indent[1:] + for line in exlines: + lines.append(failindent + line) + if not markall: + failindent = indent + return lines + + def repr_locals(self, locals): + if self.showlocals: + lines = [] + keys = [loc for loc in locals if loc[0] != "@"] + keys.sort() + for name in keys: + value = locals[name] + if name == '__builtins__': + lines.append("__builtins__ = ") + else: + # This formatting could all be handled by the + # _repr() function, which is only reprlib.Repr in + # disguise, so is very configurable. + str_repr = self._saferepr(value) + #if len(str_repr) < 70 or not isinstance(value, + # (list, tuple, dict)): + lines.append("%-10s = %s" %(name, str_repr)) + #else: + # self._line("%-10s =\\" % (name,)) + # # XXX + # py.std.pprint.pprint(value, stream=self.excinfowriter) + return ReprLocals(lines) + + def repr_traceback_entry(self, entry, excinfo=None): + source = self._getentrysource(entry) + if source is None: + source = py.code.Source("???") + line_index = 0 + else: + # entry.getfirstlinesource() can be -1, should be 0 on jython + line_index = entry.lineno - max(entry.getfirstlinesource(), 0) + + lines = [] + style = entry._repr_style + if style is None: + style = self.style + if style in ("short", "long"): + short = style == "short" + reprargs = self.repr_args(entry) if not short else None + s = self.get_source(source, line_index, excinfo, short=short) + lines.extend(s) + if short: + message = "in %s" %(entry.name) + else: + message = excinfo and excinfo.typename or "" + path = self._makepath(entry.path) + filelocrepr = ReprFileLocation(path, entry.lineno+1, message) + localsrepr = None + if not short: + localsrepr = self.repr_locals(entry.locals) + return ReprEntry(lines, reprargs, localsrepr, filelocrepr, style) + if excinfo: + lines.extend(self.get_exconly(excinfo, indent=4)) + return ReprEntry(lines, None, None, None, style) + + def _makepath(self, path): + if not self.abspath: + try: + np = py.path.local().bestrelpath(path) + except OSError: + return path + if len(np) < len(str(path)): + path = np + return path + + def repr_traceback(self, excinfo): + traceback = excinfo.traceback + if self.tbfilter: + traceback = traceback.filter() + recursionindex = None + if excinfo.errisinstance(RuntimeError): + if "maximum recursion depth exceeded" in str(excinfo.value): + recursionindex = traceback.recursionindex() + last = traceback[-1] + entries = [] + extraline = None + for index, entry in enumerate(traceback): + einfo = (last == entry) and excinfo or None + reprentry = self.repr_traceback_entry(entry, einfo) + entries.append(reprentry) + if index == recursionindex: + extraline = "!!! Recursion detected (same locals & position)" + break + return ReprTraceback(entries, extraline, style=self.style) + + def repr_excinfo(self, excinfo): + reprtraceback = self.repr_traceback(excinfo) + reprcrash = excinfo._getreprcrash() + return ReprExceptionInfo(reprtraceback, reprcrash) + +class TerminalRepr: + def __str__(self): + s = self.__unicode__() + if sys.version_info[0] < 3: + s = s.encode('utf-8') + return s + + def __unicode__(self): + # FYI this is called from pytest-xdist's serialization of exception + # information. + io = py.io.TextIO() + tw = py.io.TerminalWriter(file=io) + self.toterminal(tw) + return io.getvalue().strip() + + def __repr__(self): + return "<%s instance at %0x>" %(self.__class__, id(self)) + + +class ReprExceptionInfo(TerminalRepr): + def __init__(self, reprtraceback, reprcrash): + self.reprtraceback = reprtraceback + self.reprcrash = reprcrash + self.sections = [] + + def addsection(self, name, content, sep="-"): + self.sections.append((name, content, sep)) + + def toterminal(self, tw): + self.reprtraceback.toterminal(tw) + for name, content, sep in self.sections: + tw.sep(sep, name) + tw.line(content) + +class ReprTraceback(TerminalRepr): + entrysep = "_ " + + def __init__(self, reprentries, extraline, style): + self.reprentries = reprentries + self.extraline = extraline + self.style = style + + def toterminal(self, tw): + # the entries might have different styles + last_style = None + for i, entry in enumerate(self.reprentries): + if entry.style == "long": + tw.line("") + entry.toterminal(tw) + if i < len(self.reprentries) - 1: + next_entry = self.reprentries[i+1] + if entry.style == "long" or \ + entry.style == "short" and next_entry.style == "long": + tw.sep(self.entrysep) + + if self.extraline: + tw.line(self.extraline) + +class ReprTracebackNative(ReprTraceback): + def __init__(self, tblines): + self.style = "native" + self.reprentries = [ReprEntryNative(tblines)] + self.extraline = None + +class ReprEntryNative(TerminalRepr): + style = "native" + + def __init__(self, tblines): + self.lines = tblines + + def toterminal(self, tw): + tw.write("".join(self.lines)) + +class ReprEntry(TerminalRepr): + localssep = "_ " + + def __init__(self, lines, reprfuncargs, reprlocals, filelocrepr, style): + self.lines = lines + self.reprfuncargs = reprfuncargs + self.reprlocals = reprlocals + self.reprfileloc = filelocrepr + self.style = style + + def toterminal(self, tw): + if self.style == "short": + self.reprfileloc.toterminal(tw) + for line in self.lines: + red = line.startswith("E ") + tw.line(line, bold=True, red=red) + #tw.line("") + return + if self.reprfuncargs: + self.reprfuncargs.toterminal(tw) + for line in self.lines: + red = line.startswith("E ") + tw.line(line, bold=True, red=red) + if self.reprlocals: + #tw.sep(self.localssep, "Locals") + tw.line("") + self.reprlocals.toterminal(tw) + if self.reprfileloc: + if self.lines: + tw.line("") + self.reprfileloc.toterminal(tw) + + def __str__(self): + return "%s\n%s\n%s" % ("\n".join(self.lines), + self.reprlocals, + self.reprfileloc) + +class ReprFileLocation(TerminalRepr): + def __init__(self, path, lineno, message): + self.path = str(path) + self.lineno = lineno + self.message = message + + def toterminal(self, tw): + # filename and lineno output for each entry, + # using an output format that most editors unterstand + msg = self.message + i = msg.find("\n") + if i != -1: + msg = msg[:i] + tw.line("%s:%s: %s" %(self.path, self.lineno, msg)) + +class ReprLocals(TerminalRepr): + def __init__(self, lines): + self.lines = lines + + def toterminal(self, tw): + for line in self.lines: + tw.line(line) + +class ReprFuncArgs(TerminalRepr): + def __init__(self, args): + self.args = args + + def toterminal(self, tw): + if self.args: + linesofar = "" + for name, value in self.args: + ns = "%s = %s" %(name, value) + if len(ns) + len(linesofar) + 2 > tw.fullwidth: + if linesofar: + tw.line(linesofar) + linesofar = ns + else: + if linesofar: + linesofar += ", " + ns + else: + linesofar = ns + if linesofar: + tw.line(linesofar) + tw.line("") + + + +oldbuiltins = {} + +def patch_builtins(assertion=True, compile=True): + """ put compile and AssertionError builtins to Python's builtins. """ + if assertion: + from py._code import assertion + l = oldbuiltins.setdefault('AssertionError', []) + l.append(py.builtin.builtins.AssertionError) + py.builtin.builtins.AssertionError = assertion.AssertionError + if compile: + l = oldbuiltins.setdefault('compile', []) + l.append(py.builtin.builtins.compile) + py.builtin.builtins.compile = py.code.compile + +def unpatch_builtins(assertion=True, compile=True): + """ remove compile and AssertionError builtins from Python builtins. """ + if assertion: + py.builtin.builtins.AssertionError = oldbuiltins['AssertionError'].pop() + if compile: + py.builtin.builtins.compile = oldbuiltins['compile'].pop() + +def getrawcode(obj, trycall=True): + """ return code object for given function. """ + try: + return obj.__code__ + except AttributeError: + obj = getattr(obj, 'im_func', obj) + obj = getattr(obj, 'func_code', obj) + obj = getattr(obj, 'f_code', obj) + obj = getattr(obj, '__code__', obj) + if trycall and not hasattr(obj, 'co_firstlineno'): + if hasattr(obj, '__call__') and not py.std.inspect.isclass(obj): + x = getrawcode(obj.__call__, trycall=False) + if hasattr(x, 'co_firstlineno'): + return x + return obj + diff --git a/lib/spack/external/pytest-fallback/py/_code/source.py b/lib/spack/external/pytest-fallback/py/_code/source.py new file mode 100644 index 0000000000..c8b668b2fb --- /dev/null +++ b/lib/spack/external/pytest-fallback/py/_code/source.py @@ -0,0 +1,411 @@ +from __future__ import generators + +from bisect import bisect_right +import sys +import inspect, tokenize +import py +from types import ModuleType +cpy_compile = compile + +try: + import _ast + from _ast import PyCF_ONLY_AST as _AST_FLAG +except ImportError: + _AST_FLAG = 0 + _ast = None + + +class Source(object): + """ a immutable object holding a source code fragment, + possibly deindenting it. + """ + _compilecounter = 0 + def __init__(self, *parts, **kwargs): + self.lines = lines = [] + de = kwargs.get('deindent', True) + rstrip = kwargs.get('rstrip', True) + for part in parts: + if not part: + partlines = [] + if isinstance(part, Source): + partlines = part.lines + elif isinstance(part, (tuple, list)): + partlines = [x.rstrip("\n") for x in part] + elif isinstance(part, py.builtin._basestring): + partlines = part.split('\n') + if rstrip: + while partlines: + if partlines[-1].strip(): + break + partlines.pop() + else: + partlines = getsource(part, deindent=de).lines + if de: + partlines = deindent(partlines) + lines.extend(partlines) + + def __eq__(self, other): + try: + return self.lines == other.lines + except AttributeError: + if isinstance(other, str): + return str(self) == other + return False + + def __getitem__(self, key): + if isinstance(key, int): + return self.lines[key] + else: + if key.step not in (None, 1): + raise IndexError("cannot slice a Source with a step") + return self.__getslice__(key.start, key.stop) + + def __len__(self): + return len(self.lines) + + def __getslice__(self, start, end): + newsource = Source() + newsource.lines = self.lines[start:end] + return newsource + + def strip(self): + """ return new source object with trailing + and leading blank lines removed. + """ + start, end = 0, len(self) + while start < end and not self.lines[start].strip(): + start += 1 + while end > start and not self.lines[end-1].strip(): + end -= 1 + source = Source() + source.lines[:] = self.lines[start:end] + return source + + def putaround(self, before='', after='', indent=' ' * 4): + """ return a copy of the source object with + 'before' and 'after' wrapped around it. + """ + before = Source(before) + after = Source(after) + newsource = Source() + lines = [ (indent + line) for line in self.lines] + newsource.lines = before.lines + lines + after.lines + return newsource + + def indent(self, indent=' ' * 4): + """ return a copy of the source object with + all lines indented by the given indent-string. + """ + newsource = Source() + newsource.lines = [(indent+line) for line in self.lines] + return newsource + + def getstatement(self, lineno, assertion=False): + """ return Source statement which contains the + given linenumber (counted from 0). + """ + start, end = self.getstatementrange(lineno, assertion) + return self[start:end] + + def getstatementrange(self, lineno, assertion=False): + """ return (start, end) tuple which spans the minimal + statement region which containing the given lineno. + """ + if not (0 <= lineno < len(self)): + raise IndexError("lineno out of range") + ast, start, end = getstatementrange_ast(lineno, self) + return start, end + + def deindent(self, offset=None): + """ return a new source object deindented by offset. + If offset is None then guess an indentation offset from + the first non-blank line. Subsequent lines which have a + lower indentation offset will be copied verbatim as + they are assumed to be part of multilines. + """ + # XXX maybe use the tokenizer to properly handle multiline + # strings etc.pp? + newsource = Source() + newsource.lines[:] = deindent(self.lines, offset) + return newsource + + def isparseable(self, deindent=True): + """ return True if source is parseable, heuristically + deindenting it by default. + """ + try: + import parser + except ImportError: + syntax_checker = lambda x: compile(x, 'asd', 'exec') + else: + syntax_checker = parser.suite + + if deindent: + source = str(self.deindent()) + else: + source = str(self) + try: + #compile(source+'\n', "x", "exec") + syntax_checker(source+'\n') + except KeyboardInterrupt: + raise + except Exception: + return False + else: + return True + + def __str__(self): + return "\n".join(self.lines) + + def compile(self, filename=None, mode='exec', + flag=generators.compiler_flag, + dont_inherit=0, _genframe=None): + """ return compiled code object. if filename is None + invent an artificial filename which displays + the source/line position of the caller frame. + """ + if not filename or py.path.local(filename).check(file=0): + if _genframe is None: + _genframe = sys._getframe(1) # the caller + fn,lineno = _genframe.f_code.co_filename, _genframe.f_lineno + base = "<%d-codegen " % self._compilecounter + self.__class__._compilecounter += 1 + if not filename: + filename = base + '%s:%d>' % (fn, lineno) + else: + filename = base + '%r %s:%d>' % (filename, fn, lineno) + source = "\n".join(self.lines) + '\n' + try: + co = cpy_compile(source, filename, mode, flag) + except SyntaxError: + ex = sys.exc_info()[1] + # re-represent syntax errors from parsing python strings + msglines = self.lines[:ex.lineno] + if ex.offset: + msglines.append(" "*ex.offset + '^') + msglines.append("(code was compiled probably from here: %s)" % filename) + newex = SyntaxError('\n'.join(msglines)) + newex.offset = ex.offset + newex.lineno = ex.lineno + newex.text = ex.text + raise newex + else: + if flag & _AST_FLAG: + return co + lines = [(x + "\n") for x in self.lines] + py.std.linecache.cache[filename] = (1, None, lines, filename) + return co + +# +# public API shortcut functions +# + +def compile_(source, filename=None, mode='exec', flags= + generators.compiler_flag, dont_inherit=0): + """ compile the given source to a raw code object, + and maintain an internal cache which allows later + retrieval of the source code for the code object + and any recursively created code objects. + """ + if _ast is not None and isinstance(source, _ast.AST): + # XXX should Source support having AST? + return cpy_compile(source, filename, mode, flags, dont_inherit) + _genframe = sys._getframe(1) # the caller + s = Source(source) + co = s.compile(filename, mode, flags, _genframe=_genframe) + return co + + +def getfslineno(obj): + """ Return source location (path, lineno) for the given object. + If the source cannot be determined return ("", -1) + """ + try: + code = py.code.Code(obj) + except TypeError: + try: + fn = (py.std.inspect.getsourcefile(obj) or + py.std.inspect.getfile(obj)) + except TypeError: + return "", -1 + + fspath = fn and py.path.local(fn) or None + lineno = -1 + if fspath: + try: + _, lineno = findsource(obj) + except IOError: + pass + else: + fspath = code.path + lineno = code.firstlineno + assert isinstance(lineno, int) + return fspath, lineno + +# +# helper functions +# + +def findsource(obj): + try: + sourcelines, lineno = py.std.inspect.findsource(obj) + except py.builtin._sysex: + raise + except: + return None, -1 + source = Source() + source.lines = [line.rstrip() for line in sourcelines] + return source, lineno + +def getsource(obj, **kwargs): + obj = py.code.getrawcode(obj) + try: + strsrc = inspect.getsource(obj) + except IndentationError: + strsrc = "\"Buggy python version consider upgrading, cannot get source\"" + assert isinstance(strsrc, str) + return Source(strsrc, **kwargs) + +def deindent(lines, offset=None): + if offset is None: + for line in lines: + line = line.expandtabs() + s = line.lstrip() + if s: + offset = len(line)-len(s) + break + else: + offset = 0 + if offset == 0: + return list(lines) + newlines = [] + def readline_generator(lines): + for line in lines: + yield line + '\n' + while True: + yield '' + + it = readline_generator(lines) + + try: + for _, _, (sline, _), (eline, _), _ in tokenize.generate_tokens(lambda: next(it)): + if sline > len(lines): + break # End of input reached + if sline > len(newlines): + line = lines[sline - 1].expandtabs() + if line.lstrip() and line[:offset].isspace(): + line = line[offset:] # Deindent + newlines.append(line) + + for i in range(sline, eline): + # Don't deindent continuing lines of + # multiline tokens (i.e. multiline strings) + newlines.append(lines[i]) + except (IndentationError, tokenize.TokenError): + pass + # Add any lines we didn't see. E.g. if an exception was raised. + newlines.extend(lines[len(newlines):]) + return newlines + + +def get_statement_startend2(lineno, node): + import ast + # flatten all statements and except handlers into one lineno-list + # AST's line numbers start indexing at 1 + l = [] + for x in ast.walk(node): + if isinstance(x, _ast.stmt) or isinstance(x, _ast.ExceptHandler): + l.append(x.lineno - 1) + for name in "finalbody", "orelse": + val = getattr(x, name, None) + if val: + # treat the finally/orelse part as its own statement + l.append(val[0].lineno - 1 - 1) + l.sort() + insert_index = bisect_right(l, lineno) + start = l[insert_index - 1] + if insert_index >= len(l): + end = None + else: + end = l[insert_index] + return start, end + + +def getstatementrange_ast(lineno, source, assertion=False, astnode=None): + if astnode is None: + content = str(source) + if sys.version_info < (2,7): + content += "\n" + try: + astnode = compile(content, "source", "exec", 1024) # 1024 for AST + except ValueError: + start, end = getstatementrange_old(lineno, source, assertion) + return None, start, end + start, end = get_statement_startend2(lineno, astnode) + # we need to correct the end: + # - ast-parsing strips comments + # - there might be empty lines + # - we might have lesser indented code blocks at the end + if end is None: + end = len(source.lines) + + if end > start + 1: + # make sure we don't span differently indented code blocks + # by using the BlockFinder helper used which inspect.getsource() uses itself + block_finder = inspect.BlockFinder() + # if we start with an indented line, put blockfinder to "started" mode + block_finder.started = source.lines[start][0].isspace() + it = ((x + "\n") for x in source.lines[start:end]) + try: + for tok in tokenize.generate_tokens(lambda: next(it)): + block_finder.tokeneater(*tok) + except (inspect.EndOfBlock, IndentationError): + end = block_finder.last + start + except Exception: + pass + + # the end might still point to a comment or empty line, correct it + while end: + line = source.lines[end - 1].lstrip() + if line.startswith("#") or not line: + end -= 1 + else: + break + return astnode, start, end + + +def getstatementrange_old(lineno, source, assertion=False): + """ return (start, end) tuple which spans the minimal + statement region which containing the given lineno. + raise an IndexError if no such statementrange can be found. + """ + # XXX this logic is only used on python2.4 and below + # 1. find the start of the statement + from codeop import compile_command + for start in range(lineno, -1, -1): + if assertion: + line = source.lines[start] + # the following lines are not fully tested, change with care + if 'super' in line and 'self' in line and '__init__' in line: + raise IndexError("likely a subclass") + if "assert" not in line and "raise" not in line: + continue + trylines = source.lines[start:lineno+1] + # quick hack to prepare parsing an indented line with + # compile_command() (which errors on "return" outside defs) + trylines.insert(0, 'def xxx():') + trysource = '\n '.join(trylines) + # ^ space here + try: + compile_command(trysource) + except (SyntaxError, OverflowError, ValueError): + continue + + # 2. find the end of the statement + for end in range(lineno+1, len(source)+1): + trysource = source[start:end] + if trysource.isparseable(): + return start, end + raise SyntaxError("no valid source range around line %d " % (lineno,)) + + diff --git a/lib/spack/external/pytest-fallback/py/_error.py b/lib/spack/external/pytest-fallback/py/_error.py new file mode 100644 index 0000000000..8ca339beba --- /dev/null +++ b/lib/spack/external/pytest-fallback/py/_error.py @@ -0,0 +1,89 @@ +""" +create errno-specific classes for IO or os calls. + +""" +import sys, os, errno + +class Error(EnvironmentError): + def __repr__(self): + return "%s.%s %r: %s " %(self.__class__.__module__, + self.__class__.__name__, + self.__class__.__doc__, + " ".join(map(str, self.args)), + #repr(self.args) + ) + + def __str__(self): + s = "[%s]: %s" %(self.__class__.__doc__, + " ".join(map(str, self.args)), + ) + return s + +_winerrnomap = { + 2: errno.ENOENT, + 3: errno.ENOENT, + 17: errno.EEXIST, + 18: errno.EXDEV, + 13: errno.EBUSY, # empty cd drive, but ENOMEDIUM seems unavailiable + 22: errno.ENOTDIR, + 20: errno.ENOTDIR, + 267: errno.ENOTDIR, + 5: errno.EACCES, # anything better? +} + +class ErrorMaker(object): + """ lazily provides Exception classes for each possible POSIX errno + (as defined per the 'errno' module). All such instances + subclass EnvironmentError. + """ + Error = Error + _errno2class = {} + + def __getattr__(self, name): + if name[0] == "_": + raise AttributeError(name) + eno = getattr(errno, name) + cls = self._geterrnoclass(eno) + setattr(self, name, cls) + return cls + + def _geterrnoclass(self, eno): + try: + return self._errno2class[eno] + except KeyError: + clsname = errno.errorcode.get(eno, "UnknownErrno%d" %(eno,)) + errorcls = type(Error)(clsname, (Error,), + {'__module__':'py.error', + '__doc__': os.strerror(eno)}) + self._errno2class[eno] = errorcls + return errorcls + + def checked_call(self, func, *args, **kwargs): + """ call a function and raise an errno-exception if applicable. """ + __tracebackhide__ = True + try: + return func(*args, **kwargs) + except self.Error: + raise + except (OSError, EnvironmentError): + cls, value, tb = sys.exc_info() + if not hasattr(value, 'errno'): + raise + __tracebackhide__ = False + errno = value.errno + try: + if not isinstance(value, WindowsError): + raise NameError + except NameError: + # we are not on Windows, or we got a proper OSError + cls = self._geterrnoclass(errno) + else: + try: + cls = self._geterrnoclass(_winerrnomap[errno]) + except KeyError: + raise value + raise cls("%s%r" % (func.__name__, args)) + __tracebackhide__ = True + + +error = ErrorMaker() diff --git a/lib/spack/external/pytest-fallback/py/_iniconfig.py b/lib/spack/external/pytest-fallback/py/_iniconfig.py new file mode 100644 index 0000000000..92b50bd853 --- /dev/null +++ b/lib/spack/external/pytest-fallback/py/_iniconfig.py @@ -0,0 +1,162 @@ +""" brain-dead simple parser for ini-style files. +(C) Ronny Pfannschmidt, Holger Krekel -- MIT licensed +""" +__version__ = "0.2.dev2" + +__all__ = ['IniConfig', 'ParseError'] + +COMMENTCHARS = "#;" + +class ParseError(Exception): + def __init__(self, path, lineno, msg): + Exception.__init__(self, path, lineno, msg) + self.path = path + self.lineno = lineno + self.msg = msg + + def __str__(self): + return "%s:%s: %s" %(self.path, self.lineno+1, self.msg) + +class SectionWrapper(object): + def __init__(self, config, name): + self.config = config + self.name = name + + def lineof(self, name): + return self.config.lineof(self.name, name) + + def get(self, key, default=None, convert=str): + return self.config.get(self.name, key, convert=convert, default=default) + + def __getitem__(self, key): + return self.config.sections[self.name][key] + + def __iter__(self): + section = self.config.sections.get(self.name, []) + def lineof(key): + return self.config.lineof(self.name, key) + for name in sorted(section, key=lineof): + yield name + + def items(self): + for name in self: + yield name, self[name] + + +class IniConfig(object): + def __init__(self, path, data=None): + self.path = str(path) # convenience + if data is None: + f = open(self.path) + try: + tokens = self._parse(iter(f)) + finally: + f.close() + else: + tokens = self._parse(data.splitlines(True)) + + self._sources = {} + self.sections = {} + + for lineno, section, name, value in tokens: + if section is None: + self._raise(lineno, 'no section header defined') + self._sources[section, name] = lineno + if name is None: + if section in self.sections: + self._raise(lineno, 'duplicate section %r'%(section, )) + self.sections[section] = {} + else: + if name in self.sections[section]: + self._raise(lineno, 'duplicate name %r'%(name, )) + self.sections[section][name] = value + + def _raise(self, lineno, msg): + raise ParseError(self.path, lineno, msg) + + def _parse(self, line_iter): + result = [] + section = None + for lineno, line in enumerate(line_iter): + name, data = self._parseline(line, lineno) + # new value + if name is not None and data is not None: + result.append((lineno, section, name, data)) + # new section + elif name is not None and data is None: + if not name: + self._raise(lineno, 'empty section name') + section = name + result.append((lineno, section, None, None)) + # continuation + elif name is None and data is not None: + if not result: + self._raise(lineno, 'unexpected value continuation') + last = result.pop() + last_name, last_data = last[-2:] + if last_name is None: + self._raise(lineno, 'unexpected value continuation') + + if last_data: + data = '%s\n%s' % (last_data, data) + result.append(last[:-1] + (data,)) + return result + + def _parseline(self, line, lineno): + # blank lines + if iscommentline(line): + line = "" + else: + line = line.rstrip() + if not line: + return None, None + # section + if line[0] == '[': + realline = line + for c in COMMENTCHARS: + line = line.split(c)[0].rstrip() + if line[-1] == "]": + return line[1:-1], None + return None, realline.strip() + # value + elif not line[0].isspace(): + try: + name, value = line.split('=', 1) + if ":" in name: + raise ValueError() + except ValueError: + try: + name, value = line.split(":", 1) + except ValueError: + self._raise(lineno, 'unexpected line: %r' % line) + return name.strip(), value.strip() + # continuation + else: + return None, line.strip() + + def lineof(self, section, name=None): + lineno = self._sources.get((section, name)) + if lineno is not None: + return lineno + 1 + + def get(self, section, name, default=None, convert=str): + try: + return convert(self.sections[section][name]) + except KeyError: + return default + + def __getitem__(self, name): + if name not in self.sections: + raise KeyError(name) + return SectionWrapper(self, name) + + def __iter__(self): + for name in sorted(self.sections, key=self.lineof): + yield SectionWrapper(self, name) + + def __contains__(self, arg): + return arg in self.sections + +def iscommentline(line): + c = line.lstrip()[:1] + return c in COMMENTCHARS diff --git a/lib/spack/external/pytest-fallback/py/_io/__init__.py b/lib/spack/external/pytest-fallback/py/_io/__init__.py new file mode 100644 index 0000000000..835f01f3ab --- /dev/null +++ b/lib/spack/external/pytest-fallback/py/_io/__init__.py @@ -0,0 +1 @@ +""" input/output helping """ diff --git a/lib/spack/external/pytest-fallback/py/_io/capture.py b/lib/spack/external/pytest-fallback/py/_io/capture.py new file mode 100644 index 0000000000..bc157ed978 --- /dev/null +++ b/lib/spack/external/pytest-fallback/py/_io/capture.py @@ -0,0 +1,371 @@ +import os +import sys +import py +import tempfile + +try: + from io import StringIO +except ImportError: + from StringIO import StringIO + +if sys.version_info < (3,0): + class TextIO(StringIO): + def write(self, data): + if not isinstance(data, unicode): + data = unicode(data, getattr(self, '_encoding', 'UTF-8'), 'replace') + StringIO.write(self, data) +else: + TextIO = StringIO + +try: + from io import BytesIO +except ImportError: + class BytesIO(StringIO): + def write(self, data): + if isinstance(data, unicode): + raise TypeError("not a byte value: %r" %(data,)) + StringIO.write(self, data) + +patchsysdict = {0: 'stdin', 1: 'stdout', 2: 'stderr'} + +class FDCapture: + """ Capture IO to/from a given os-level filedescriptor. """ + + def __init__(self, targetfd, tmpfile=None, now=True, patchsys=False): + """ save targetfd descriptor, and open a new + temporary file there. If no tmpfile is + specified a tempfile.Tempfile() will be opened + in text mode. + """ + self.targetfd = targetfd + if tmpfile is None and targetfd != 0: + f = tempfile.TemporaryFile('wb+') + tmpfile = dupfile(f, encoding="UTF-8") + f.close() + self.tmpfile = tmpfile + self._savefd = os.dup(self.targetfd) + if patchsys: + self._oldsys = getattr(sys, patchsysdict[targetfd]) + if now: + self.start() + + def start(self): + try: + os.fstat(self._savefd) + except OSError: + raise ValueError("saved filedescriptor not valid, " + "did you call start() twice?") + if self.targetfd == 0 and not self.tmpfile: + fd = os.open(devnullpath, os.O_RDONLY) + os.dup2(fd, 0) + os.close(fd) + if hasattr(self, '_oldsys'): + setattr(sys, patchsysdict[self.targetfd], DontReadFromInput()) + else: + os.dup2(self.tmpfile.fileno(), self.targetfd) + if hasattr(self, '_oldsys'): + setattr(sys, patchsysdict[self.targetfd], self.tmpfile) + + def done(self): + """ unpatch and clean up, returns the self.tmpfile (file object) + """ + os.dup2(self._savefd, self.targetfd) + os.close(self._savefd) + if self.targetfd != 0: + self.tmpfile.seek(0) + if hasattr(self, '_oldsys'): + setattr(sys, patchsysdict[self.targetfd], self._oldsys) + return self.tmpfile + + def writeorg(self, data): + """ write a string to the original file descriptor + """ + tempfp = tempfile.TemporaryFile() + try: + os.dup2(self._savefd, tempfp.fileno()) + tempfp.write(data) + finally: + tempfp.close() + + +def dupfile(f, mode=None, buffering=0, raising=False, encoding=None): + """ return a new open file object that's a duplicate of f + + mode is duplicated if not given, 'buffering' controls + buffer size (defaulting to no buffering) and 'raising' + defines whether an exception is raised when an incompatible + file object is passed in (if raising is False, the file + object itself will be returned) + """ + try: + fd = f.fileno() + mode = mode or f.mode + except AttributeError: + if raising: + raise + return f + newfd = os.dup(fd) + if sys.version_info >= (3,0): + if encoding is not None: + mode = mode.replace("b", "") + buffering = True + return os.fdopen(newfd, mode, buffering, encoding, closefd=True) + else: + f = os.fdopen(newfd, mode, buffering) + if encoding is not None: + return EncodedFile(f, encoding) + return f + +class EncodedFile(object): + def __init__(self, _stream, encoding): + self._stream = _stream + self.encoding = encoding + + def write(self, obj): + if isinstance(obj, unicode): + obj = obj.encode(self.encoding) + elif isinstance(obj, str): + pass + else: + obj = str(obj) + self._stream.write(obj) + + def writelines(self, linelist): + data = ''.join(linelist) + self.write(data) + + def __getattr__(self, name): + return getattr(self._stream, name) + +class Capture(object): + def call(cls, func, *args, **kwargs): + """ return a (res, out, err) tuple where + out and err represent the output/error output + during function execution. + call the given function with args/kwargs + and capture output/error during its execution. + """ + so = cls() + try: + res = func(*args, **kwargs) + finally: + out, err = so.reset() + return res, out, err + call = classmethod(call) + + def reset(self): + """ reset sys.stdout/stderr and return captured output as strings. """ + if hasattr(self, '_reset'): + raise ValueError("was already reset") + self._reset = True + outfile, errfile = self.done(save=False) + out, err = "", "" + if outfile and not outfile.closed: + out = outfile.read() + outfile.close() + if errfile and errfile != outfile and not errfile.closed: + err = errfile.read() + errfile.close() + return out, err + + def suspend(self): + """ return current snapshot captures, memorize tempfiles. """ + outerr = self.readouterr() + outfile, errfile = self.done() + return outerr + + +class StdCaptureFD(Capture): + """ This class allows to capture writes to FD1 and FD2 + and may connect a NULL file to FD0 (and prevent + reads from sys.stdin). If any of the 0,1,2 file descriptors + is invalid it will not be captured. + """ + def __init__(self, out=True, err=True, mixed=False, + in_=True, patchsys=True, now=True): + self._options = { + "out": out, + "err": err, + "mixed": mixed, + "in_": in_, + "patchsys": patchsys, + "now": now, + } + self._save() + if now: + self.startall() + + def _save(self): + in_ = self._options['in_'] + out = self._options['out'] + err = self._options['err'] + mixed = self._options['mixed'] + patchsys = self._options['patchsys'] + if in_: + try: + self.in_ = FDCapture(0, tmpfile=None, now=False, + patchsys=patchsys) + except OSError: + pass + if out: + tmpfile = None + if hasattr(out, 'write'): + tmpfile = out + try: + self.out = FDCapture(1, tmpfile=tmpfile, + now=False, patchsys=patchsys) + self._options['out'] = self.out.tmpfile + except OSError: + pass + if err: + if out and mixed: + tmpfile = self.out.tmpfile + elif hasattr(err, 'write'): + tmpfile = err + else: + tmpfile = None + try: + self.err = FDCapture(2, tmpfile=tmpfile, + now=False, patchsys=patchsys) + self._options['err'] = self.err.tmpfile + except OSError: + pass + + def startall(self): + if hasattr(self, 'in_'): + self.in_.start() + if hasattr(self, 'out'): + self.out.start() + if hasattr(self, 'err'): + self.err.start() + + def resume(self): + """ resume capturing with original temp files. """ + self.startall() + + def done(self, save=True): + """ return (outfile, errfile) and stop capturing. """ + outfile = errfile = None + if hasattr(self, 'out') and not self.out.tmpfile.closed: + outfile = self.out.done() + if hasattr(self, 'err') and not self.err.tmpfile.closed: + errfile = self.err.done() + if hasattr(self, 'in_'): + tmpfile = self.in_.done() + if save: + self._save() + return outfile, errfile + + def readouterr(self): + """ return snapshot value of stdout/stderr capturings. """ + if hasattr(self, "out"): + out = self._readsnapshot(self.out.tmpfile) + else: + out = "" + if hasattr(self, "err"): + err = self._readsnapshot(self.err.tmpfile) + else: + err = "" + return [out, err] + + def _readsnapshot(self, f): + f.seek(0) + res = f.read() + enc = getattr(f, "encoding", None) + if enc: + res = py.builtin._totext(res, enc, "replace") + f.truncate(0) + f.seek(0) + return res + + +class StdCapture(Capture): + """ This class allows to capture writes to sys.stdout|stderr "in-memory" + and will raise errors on tries to read from sys.stdin. It only + modifies sys.stdout|stderr|stdin attributes and does not + touch underlying File Descriptors (use StdCaptureFD for that). + """ + def __init__(self, out=True, err=True, in_=True, mixed=False, now=True): + self._oldout = sys.stdout + self._olderr = sys.stderr + self._oldin = sys.stdin + if out and not hasattr(out, 'file'): + out = TextIO() + self.out = out + if err: + if mixed: + err = out + elif not hasattr(err, 'write'): + err = TextIO() + self.err = err + self.in_ = in_ + if now: + self.startall() + + def startall(self): + if self.out: + sys.stdout = self.out + if self.err: + sys.stderr = self.err + if self.in_: + sys.stdin = self.in_ = DontReadFromInput() + + def done(self, save=True): + """ return (outfile, errfile) and stop capturing. """ + outfile = errfile = None + if self.out and not self.out.closed: + sys.stdout = self._oldout + outfile = self.out + outfile.seek(0) + if self.err and not self.err.closed: + sys.stderr = self._olderr + errfile = self.err + errfile.seek(0) + if self.in_: + sys.stdin = self._oldin + return outfile, errfile + + def resume(self): + """ resume capturing with original temp files. """ + self.startall() + + def readouterr(self): + """ return snapshot value of stdout/stderr capturings. """ + out = err = "" + if self.out: + out = self.out.getvalue() + self.out.truncate(0) + self.out.seek(0) + if self.err: + err = self.err.getvalue() + self.err.truncate(0) + self.err.seek(0) + return out, err + +class DontReadFromInput: + """Temporary stub class. Ideally when stdin is accessed, the + capturing should be turned off, with possibly all data captured + so far sent to the screen. This should be configurable, though, + because in automated test runs it is better to crash than + hang indefinitely. + """ + def read(self, *args): + raise IOError("reading from stdin while output is captured") + readline = read + readlines = read + __iter__ = read + + def fileno(self): + raise ValueError("redirected Stdin is pseudofile, has no fileno()") + def isatty(self): + return False + def close(self): + pass + +try: + devnullpath = os.devnull +except AttributeError: + if os.name == 'nt': + devnullpath = 'NUL' + else: + devnullpath = '/dev/null' diff --git a/lib/spack/external/pytest-fallback/py/_io/saferepr.py b/lib/spack/external/pytest-fallback/py/_io/saferepr.py new file mode 100644 index 0000000000..8518290efd --- /dev/null +++ b/lib/spack/external/pytest-fallback/py/_io/saferepr.py @@ -0,0 +1,71 @@ +import py +import sys + +builtin_repr = repr + +reprlib = py.builtin._tryimport('repr', 'reprlib') + +class SafeRepr(reprlib.Repr): + """ subclass of repr.Repr that limits the resulting size of repr() + and includes information on exceptions raised during the call. + """ + def repr(self, x): + return self._callhelper(reprlib.Repr.repr, self, x) + + def repr_unicode(self, x, level): + # Strictly speaking wrong on narrow builds + def repr(u): + if "'" not in u: + return py.builtin._totext("'%s'") % u + elif '"' not in u: + return py.builtin._totext('"%s"') % u + else: + return py.builtin._totext("'%s'") % u.replace("'", r"\'") + s = repr(x[:self.maxstring]) + if len(s) > self.maxstring: + i = max(0, (self.maxstring-3)//2) + j = max(0, self.maxstring-3-i) + s = repr(x[:i] + x[len(x)-j:]) + s = s[:i] + '...' + s[len(s)-j:] + return s + + def repr_instance(self, x, level): + return self._callhelper(builtin_repr, x) + + def _callhelper(self, call, x, *args): + try: + # Try the vanilla repr and make sure that the result is a string + s = call(x, *args) + except py.builtin._sysex: + raise + except: + cls, e, tb = sys.exc_info() + exc_name = getattr(cls, '__name__', 'unknown') + try: + exc_info = str(e) + except py.builtin._sysex: + raise + except: + exc_info = 'unknown' + return '<[%s("%s") raised in repr()] %s object at 0x%x>' % ( + exc_name, exc_info, x.__class__.__name__, id(x)) + else: + if len(s) > self.maxsize: + i = max(0, (self.maxsize-3)//2) + j = max(0, self.maxsize-3-i) + s = s[:i] + '...' + s[len(s)-j:] + return s + +def saferepr(obj, maxsize=240): + """ return a size-limited safe repr-string for the given object. + Failing __repr__ functions of user instances will be represented + with a short exception info and 'saferepr' generally takes + care to never raise exceptions itself. This function is a wrapper + around the Repr/reprlib functionality of the standard 2.6 lib. + """ + # review exception handling + srepr = SafeRepr() + srepr.maxstring = maxsize + srepr.maxsize = maxsize + srepr.maxother = 160 + return srepr.repr(obj) diff --git a/lib/spack/external/pytest-fallback/py/_io/terminalwriter.py b/lib/spack/external/pytest-fallback/py/_io/terminalwriter.py new file mode 100644 index 0000000000..390e8ca7b9 --- /dev/null +++ b/lib/spack/external/pytest-fallback/py/_io/terminalwriter.py @@ -0,0 +1,357 @@ +""" + +Helper functions for writing to terminals and files. + +""" + + +import sys, os +import py +py3k = sys.version_info[0] >= 3 +from py.builtin import text, bytes + +win32_and_ctypes = False +colorama = None +if sys.platform == "win32": + try: + import colorama + except ImportError: + try: + import ctypes + win32_and_ctypes = True + except ImportError: + pass + + +def _getdimensions(): + import termios,fcntl,struct + call = fcntl.ioctl(1,termios.TIOCGWINSZ,"\000"*8) + height,width = struct.unpack( "hhhh", call ) [:2] + return height, width + + +def get_terminal_width(): + height = width = 0 + try: + height, width = _getdimensions() + except py.builtin._sysex: + raise + except: + # pass to fallback below + pass + + if width == 0: + # FALLBACK: + # * some exception happened + # * or this is emacs terminal which reports (0,0) + width = int(os.environ.get('COLUMNS', 80)) + + # XXX the windows getdimensions may be bogus, let's sanify a bit + if width < 40: + width = 80 + return width + +terminal_width = get_terminal_width() + +# XXX unify with _escaped func below +def ansi_print(text, esc, file=None, newline=True, flush=False): + if file is None: + file = sys.stderr + text = text.rstrip() + if esc and not isinstance(esc, tuple): + esc = (esc,) + if esc and sys.platform != "win32" and file.isatty(): + text = (''.join(['\x1b[%sm' % cod for cod in esc]) + + text + + '\x1b[0m') # ANSI color code "reset" + if newline: + text += '\n' + + if esc and win32_and_ctypes and file.isatty(): + if 1 in esc: + bold = True + esc = tuple([x for x in esc if x != 1]) + else: + bold = False + esctable = {() : FOREGROUND_WHITE, # normal + (31,): FOREGROUND_RED, # red + (32,): FOREGROUND_GREEN, # green + (33,): FOREGROUND_GREEN|FOREGROUND_RED, # yellow + (34,): FOREGROUND_BLUE, # blue + (35,): FOREGROUND_BLUE|FOREGROUND_RED, # purple + (36,): FOREGROUND_BLUE|FOREGROUND_GREEN, # cyan + (37,): FOREGROUND_WHITE, # white + (39,): FOREGROUND_WHITE, # reset + } + attr = esctable.get(esc, FOREGROUND_WHITE) + if bold: + attr |= FOREGROUND_INTENSITY + STD_OUTPUT_HANDLE = -11 + STD_ERROR_HANDLE = -12 + if file is sys.stderr: + handle = GetStdHandle(STD_ERROR_HANDLE) + else: + handle = GetStdHandle(STD_OUTPUT_HANDLE) + oldcolors = GetConsoleInfo(handle).wAttributes + attr |= (oldcolors & 0x0f0) + SetConsoleTextAttribute(handle, attr) + while len(text) > 32768: + file.write(text[:32768]) + text = text[32768:] + if text: + file.write(text) + SetConsoleTextAttribute(handle, oldcolors) + else: + file.write(text) + + if flush: + file.flush() + +def should_do_markup(file): + if os.environ.get('PY_COLORS') == '1': + return True + if os.environ.get('PY_COLORS') == '0': + return False + return hasattr(file, 'isatty') and file.isatty() \ + and os.environ.get('TERM') != 'dumb' \ + and not (sys.platform.startswith('java') and os._name == 'nt') + +class TerminalWriter(object): + _esctable = dict(black=30, red=31, green=32, yellow=33, + blue=34, purple=35, cyan=36, white=37, + Black=40, Red=41, Green=42, Yellow=43, + Blue=44, Purple=45, Cyan=46, White=47, + bold=1, light=2, blink=5, invert=7) + + # XXX deprecate stringio argument + def __init__(self, file=None, stringio=False, encoding=None): + if file is None: + if stringio: + self.stringio = file = py.io.TextIO() + else: + file = py.std.sys.stdout + elif py.builtin.callable(file) and not ( + hasattr(file, "write") and hasattr(file, "flush")): + file = WriteFile(file, encoding=encoding) + if hasattr(file, "isatty") and file.isatty() and colorama: + file = colorama.AnsiToWin32(file).stream + self.encoding = encoding or getattr(file, 'encoding', "utf-8") + self._file = file + self.hasmarkup = should_do_markup(file) + self._lastlen = 0 + + @property + def fullwidth(self): + if hasattr(self, '_terminal_width'): + return self._terminal_width + return get_terminal_width() + + @fullwidth.setter + def fullwidth(self, value): + self._terminal_width = value + + def _escaped(self, text, esc): + if esc and self.hasmarkup: + text = (''.join(['\x1b[%sm' % cod for cod in esc]) + + text +'\x1b[0m') + return text + + def markup(self, text, **kw): + esc = [] + for name in kw: + if name not in self._esctable: + raise ValueError("unknown markup: %r" %(name,)) + if kw[name]: + esc.append(self._esctable[name]) + return self._escaped(text, tuple(esc)) + + def sep(self, sepchar, title=None, fullwidth=None, **kw): + if fullwidth is None: + fullwidth = self.fullwidth + # the goal is to have the line be as long as possible + # under the condition that len(line) <= fullwidth + if sys.platform == "win32": + # if we print in the last column on windows we are on a + # new line but there is no way to verify/neutralize this + # (we may not know the exact line width) + # so let's be defensive to avoid empty lines in the output + fullwidth -= 1 + if title is not None: + # we want 2 + 2*len(fill) + len(title) <= fullwidth + # i.e. 2 + 2*len(sepchar)*N + len(title) <= fullwidth + # 2*len(sepchar)*N <= fullwidth - len(title) - 2 + # N <= (fullwidth - len(title) - 2) // (2*len(sepchar)) + N = (fullwidth - len(title) - 2) // (2*len(sepchar)) + fill = sepchar * N + line = "%s %s %s" % (fill, title, fill) + else: + # we want len(sepchar)*N <= fullwidth + # i.e. N <= fullwidth // len(sepchar) + line = sepchar * (fullwidth // len(sepchar)) + # in some situations there is room for an extra sepchar at the right, + # in particular if we consider that with a sepchar like "_ " the + # trailing space is not important at the end of the line + if len(line) + len(sepchar.rstrip()) <= fullwidth: + line += sepchar.rstrip() + + self.line(line, **kw) + + def write(self, msg, **kw): + if msg: + if not isinstance(msg, (bytes, text)): + msg = text(msg) + if self.hasmarkup and kw: + markupmsg = self.markup(msg, **kw) + else: + markupmsg = msg + write_out(self._file, markupmsg) + + def line(self, s='', **kw): + self.write(s, **kw) + self._checkfill(s) + self.write('\n') + + def reline(self, line, **kw): + if not self.hasmarkup: + raise ValueError("cannot use rewrite-line without terminal") + self.write(line, **kw) + self._checkfill(line) + self.write('\r') + self._lastlen = len(line) + + def _checkfill(self, line): + diff2last = self._lastlen - len(line) + if diff2last > 0: + self.write(" " * diff2last) + +class Win32ConsoleWriter(TerminalWriter): + def write(self, msg, **kw): + if msg: + if not isinstance(msg, (bytes, text)): + msg = text(msg) + oldcolors = None + if self.hasmarkup and kw: + handle = GetStdHandle(STD_OUTPUT_HANDLE) + oldcolors = GetConsoleInfo(handle).wAttributes + default_bg = oldcolors & 0x00F0 + attr = default_bg + if kw.pop('bold', False): + attr |= FOREGROUND_INTENSITY + + if kw.pop('red', False): + attr |= FOREGROUND_RED + elif kw.pop('blue', False): + attr |= FOREGROUND_BLUE + elif kw.pop('green', False): + attr |= FOREGROUND_GREEN + elif kw.pop('yellow', False): + attr |= FOREGROUND_GREEN|FOREGROUND_RED + else: + attr |= oldcolors & 0x0007 + + SetConsoleTextAttribute(handle, attr) + write_out(self._file, msg) + if oldcolors: + SetConsoleTextAttribute(handle, oldcolors) + +class WriteFile(object): + def __init__(self, writemethod, encoding=None): + self.encoding = encoding + self._writemethod = writemethod + + def write(self, data): + if self.encoding: + data = data.encode(self.encoding, "replace") + self._writemethod(data) + + def flush(self): + return + + +if win32_and_ctypes: + TerminalWriter = Win32ConsoleWriter + import ctypes + from ctypes import wintypes + + # ctypes access to the Windows console + STD_OUTPUT_HANDLE = -11 + STD_ERROR_HANDLE = -12 + FOREGROUND_BLACK = 0x0000 # black text + FOREGROUND_BLUE = 0x0001 # text color contains blue. + FOREGROUND_GREEN = 0x0002 # text color contains green. + FOREGROUND_RED = 0x0004 # text color contains red. + FOREGROUND_WHITE = 0x0007 + FOREGROUND_INTENSITY = 0x0008 # text color is intensified. + BACKGROUND_BLACK = 0x0000 # background color black + BACKGROUND_BLUE = 0x0010 # background color contains blue. + BACKGROUND_GREEN = 0x0020 # background color contains green. + BACKGROUND_RED = 0x0040 # background color contains red. + BACKGROUND_WHITE = 0x0070 + BACKGROUND_INTENSITY = 0x0080 # background color is intensified. + + SHORT = ctypes.c_short + class COORD(ctypes.Structure): + _fields_ = [('X', SHORT), + ('Y', SHORT)] + class SMALL_RECT(ctypes.Structure): + _fields_ = [('Left', SHORT), + ('Top', SHORT), + ('Right', SHORT), + ('Bottom', SHORT)] + class CONSOLE_SCREEN_BUFFER_INFO(ctypes.Structure): + _fields_ = [('dwSize', COORD), + ('dwCursorPosition', COORD), + ('wAttributes', wintypes.WORD), + ('srWindow', SMALL_RECT), + ('dwMaximumWindowSize', COORD)] + + _GetStdHandle = ctypes.windll.kernel32.GetStdHandle + _GetStdHandle.argtypes = [wintypes.DWORD] + _GetStdHandle.restype = wintypes.HANDLE + def GetStdHandle(kind): + return _GetStdHandle(kind) + + SetConsoleTextAttribute = ctypes.windll.kernel32.SetConsoleTextAttribute + SetConsoleTextAttribute.argtypes = [wintypes.HANDLE, wintypes.WORD] + SetConsoleTextAttribute.restype = wintypes.BOOL + + _GetConsoleScreenBufferInfo = \ + ctypes.windll.kernel32.GetConsoleScreenBufferInfo + _GetConsoleScreenBufferInfo.argtypes = [wintypes.HANDLE, + ctypes.POINTER(CONSOLE_SCREEN_BUFFER_INFO)] + _GetConsoleScreenBufferInfo.restype = wintypes.BOOL + def GetConsoleInfo(handle): + info = CONSOLE_SCREEN_BUFFER_INFO() + _GetConsoleScreenBufferInfo(handle, ctypes.byref(info)) + return info + + def _getdimensions(): + handle = GetStdHandle(STD_OUTPUT_HANDLE) + info = GetConsoleInfo(handle) + # Substract one from the width, otherwise the cursor wraps + # and the ending \n causes an empty line to display. + return info.dwSize.Y, info.dwSize.X - 1 + +def write_out(fil, msg): + # XXX sometimes "msg" is of type bytes, sometimes text which + # complicates the situation. Should we try to enforce unicode? + try: + # on py27 and above writing out to sys.stdout with an encoding + # should usually work for unicode messages (if the encoding is + # capable of it) + fil.write(msg) + except UnicodeEncodeError: + # on py26 it might not work because stdout expects bytes + if fil.encoding: + try: + fil.write(msg.encode(fil.encoding)) + except UnicodeEncodeError: + # it might still fail if the encoding is not capable + pass + else: + fil.flush() + return + # fallback: escape all unicode characters + msg = msg.encode("unicode-escape").decode("ascii") + fil.write(msg) + fil.flush() diff --git a/lib/spack/external/pytest-fallback/py/_log/__init__.py b/lib/spack/external/pytest-fallback/py/_log/__init__.py new file mode 100644 index 0000000000..fad62e960d --- /dev/null +++ b/lib/spack/external/pytest-fallback/py/_log/__init__.py @@ -0,0 +1,2 @@ +""" logging API ('producers' and 'consumers' connected via keywords) """ + diff --git a/lib/spack/external/pytest-fallback/py/_log/log.py b/lib/spack/external/pytest-fallback/py/_log/log.py new file mode 100644 index 0000000000..ce47e8c754 --- /dev/null +++ b/lib/spack/external/pytest-fallback/py/_log/log.py @@ -0,0 +1,186 @@ +""" +basic logging functionality based on a producer/consumer scheme. + +XXX implement this API: (maybe put it into slogger.py?) + + log = Logger( + info=py.log.STDOUT, + debug=py.log.STDOUT, + command=None) + log.info("hello", "world") + log.command("hello", "world") + + log = Logger(info=Logger(something=...), + debug=py.log.STDOUT, + command=None) +""" +import py, sys + +class Message(object): + def __init__(self, keywords, args): + self.keywords = keywords + self.args = args + + def content(self): + return " ".join(map(str, self.args)) + + def prefix(self): + return "[%s] " % (":".join(self.keywords)) + + def __str__(self): + return self.prefix() + self.content() + + +class Producer(object): + """ (deprecated) Log producer API which sends messages to be logged + to a 'consumer' object, which then prints them to stdout, + stderr, files, etc. Used extensively by PyPy-1.1. + """ + + Message = Message # to allow later customization + keywords2consumer = {} + + def __init__(self, keywords, keywordmapper=None, **kw): + if hasattr(keywords, 'split'): + keywords = tuple(keywords.split()) + self._keywords = keywords + if keywordmapper is None: + keywordmapper = default_keywordmapper + self._keywordmapper = keywordmapper + + def __repr__(self): + return "" % ":".join(self._keywords) + + def __getattr__(self, name): + if '_' in name: + raise AttributeError(name) + producer = self.__class__(self._keywords + (name,)) + setattr(self, name, producer) + return producer + + def __call__(self, *args): + """ write a message to the appropriate consumer(s) """ + func = self._keywordmapper.getconsumer(self._keywords) + if func is not None: + func(self.Message(self._keywords, args)) + +class KeywordMapper: + def __init__(self): + self.keywords2consumer = {} + + def getstate(self): + return self.keywords2consumer.copy() + def setstate(self, state): + self.keywords2consumer.clear() + self.keywords2consumer.update(state) + + def getconsumer(self, keywords): + """ return a consumer matching the given keywords. + + tries to find the most suitable consumer by walking, starting from + the back, the list of keywords, the first consumer matching a + keyword is returned (falling back to py.log.default) + """ + for i in range(len(keywords), 0, -1): + try: + return self.keywords2consumer[keywords[:i]] + except KeyError: + continue + return self.keywords2consumer.get('default', default_consumer) + + def setconsumer(self, keywords, consumer): + """ set a consumer for a set of keywords. """ + # normalize to tuples + if isinstance(keywords, str): + keywords = tuple(filter(None, keywords.split())) + elif hasattr(keywords, '_keywords'): + keywords = keywords._keywords + elif not isinstance(keywords, tuple): + raise TypeError("key %r is not a string or tuple" % (keywords,)) + if consumer is not None and not py.builtin.callable(consumer): + if not hasattr(consumer, 'write'): + raise TypeError( + "%r should be None, callable or file-like" % (consumer,)) + consumer = File(consumer) + self.keywords2consumer[keywords] = consumer + +def default_consumer(msg): + """ the default consumer, prints the message to stdout (using 'print') """ + sys.stderr.write(str(msg)+"\n") + +default_keywordmapper = KeywordMapper() + +def setconsumer(keywords, consumer): + default_keywordmapper.setconsumer(keywords, consumer) + +def setstate(state): + default_keywordmapper.setstate(state) +def getstate(): + return default_keywordmapper.getstate() + +# +# Consumers +# + +class File(object): + """ log consumer wrapping a file(-like) object """ + def __init__(self, f): + assert hasattr(f, 'write') + #assert isinstance(f, file) or not hasattr(f, 'open') + self._file = f + + def __call__(self, msg): + """ write a message to the log """ + self._file.write(str(msg) + "\n") + if hasattr(self._file, 'flush'): + self._file.flush() + +class Path(object): + """ log consumer that opens and writes to a Path """ + def __init__(self, filename, append=False, + delayed_create=False, buffering=False): + self._append = append + self._filename = str(filename) + self._buffering = buffering + if not delayed_create: + self._openfile() + + def _openfile(self): + mode = self._append and 'a' or 'w' + f = open(self._filename, mode) + self._file = f + + def __call__(self, msg): + """ write a message to the log """ + if not hasattr(self, "_file"): + self._openfile() + self._file.write(str(msg) + "\n") + if not self._buffering: + self._file.flush() + +def STDOUT(msg): + """ consumer that writes to sys.stdout """ + sys.stdout.write(str(msg)+"\n") + +def STDERR(msg): + """ consumer that writes to sys.stderr """ + sys.stderr.write(str(msg)+"\n") + +class Syslog: + """ consumer that writes to the syslog daemon """ + + def __init__(self, priority = None): + if priority is None: + priority = self.LOG_INFO + self.priority = priority + + def __call__(self, msg): + """ write a message to the log """ + py.std.syslog.syslog(self.priority, str(msg)) + +for _prio in "EMERG ALERT CRIT ERR WARNING NOTICE INFO DEBUG".split(): + _prio = "LOG_" + _prio + try: + setattr(Syslog, _prio, getattr(py.std.syslog, _prio)) + except AttributeError: + pass diff --git a/lib/spack/external/pytest-fallback/py/_log/warning.py b/lib/spack/external/pytest-fallback/py/_log/warning.py new file mode 100644 index 0000000000..722e31e910 --- /dev/null +++ b/lib/spack/external/pytest-fallback/py/_log/warning.py @@ -0,0 +1,76 @@ +import py, sys + +class DeprecationWarning(DeprecationWarning): + def __init__(self, msg, path, lineno): + self.msg = msg + self.path = path + self.lineno = lineno + def __repr__(self): + return "%s:%d: %s" %(self.path, self.lineno+1, self.msg) + def __str__(self): + return self.msg + +def _apiwarn(startversion, msg, stacklevel=2, function=None): + # below is mostly COPIED from python2.4/warnings.py's def warn() + # Get context information + if isinstance(stacklevel, str): + frame = sys._getframe(1) + level = 1 + found = frame.f_code.co_filename.find(stacklevel) != -1 + while frame: + co = frame.f_code + if co.co_filename.find(stacklevel) == -1: + if found: + stacklevel = level + break + else: + found = True + level += 1 + frame = frame.f_back + else: + stacklevel = 1 + msg = "%s (since version %s)" %(msg, startversion) + warn(msg, stacklevel=stacklevel+1, function=function) + +def warn(msg, stacklevel=1, function=None): + if function is not None: + filename = py.std.inspect.getfile(function) + lineno = py.code.getrawcode(function).co_firstlineno + else: + try: + caller = sys._getframe(stacklevel) + except ValueError: + globals = sys.__dict__ + lineno = 1 + else: + globals = caller.f_globals + lineno = caller.f_lineno + if '__name__' in globals: + module = globals['__name__'] + else: + module = "" + filename = globals.get('__file__') + if filename: + fnl = filename.lower() + if fnl.endswith(".pyc") or fnl.endswith(".pyo"): + filename = filename[:-1] + elif fnl.endswith("$py.class"): + filename = filename.replace('$py.class', '.py') + else: + if module == "__main__": + try: + filename = sys.argv[0] + except AttributeError: + # embedded interpreters don't have sys.argv, see bug #839151 + filename = '__main__' + if not filename: + filename = module + path = py.path.local(filename) + warning = DeprecationWarning(msg, path, lineno) + py.std.warnings.warn_explicit(warning, category=Warning, + filename=str(warning.path), + lineno=warning.lineno, + registry=py.std.warnings.__dict__.setdefault( + "__warningsregistry__", {}) + ) + diff --git a/lib/spack/external/pytest-fallback/py/_path/__init__.py b/lib/spack/external/pytest-fallback/py/_path/__init__.py new file mode 100644 index 0000000000..51f3246f80 --- /dev/null +++ b/lib/spack/external/pytest-fallback/py/_path/__init__.py @@ -0,0 +1 @@ +""" unified file system api """ diff --git a/lib/spack/external/pytest-fallback/py/_path/cacheutil.py b/lib/spack/external/pytest-fallback/py/_path/cacheutil.py new file mode 100644 index 0000000000..9922504750 --- /dev/null +++ b/lib/spack/external/pytest-fallback/py/_path/cacheutil.py @@ -0,0 +1,114 @@ +""" +This module contains multithread-safe cache implementations. + +All Caches have + + getorbuild(key, builder) + delentry(key) + +methods and allow configuration when instantiating the cache class. +""" +from time import time as gettime + +class BasicCache(object): + def __init__(self, maxentries=128): + self.maxentries = maxentries + self.prunenum = int(maxentries - maxentries/8) + self._dict = {} + + def clear(self): + self._dict.clear() + + def _getentry(self, key): + return self._dict[key] + + def _putentry(self, key, entry): + self._prunelowestweight() + self._dict[key] = entry + + def delentry(self, key, raising=False): + try: + del self._dict[key] + except KeyError: + if raising: + raise + + def getorbuild(self, key, builder): + try: + entry = self._getentry(key) + except KeyError: + entry = self._build(key, builder) + self._putentry(key, entry) + return entry.value + + def _prunelowestweight(self): + """ prune out entries with lowest weight. """ + numentries = len(self._dict) + if numentries >= self.maxentries: + # evict according to entry's weight + items = [(entry.weight, key) + for key, entry in self._dict.items()] + items.sort() + index = numentries - self.prunenum + if index > 0: + for weight, key in items[:index]: + # in MT situations the element might be gone + self.delentry(key, raising=False) + +class BuildcostAccessCache(BasicCache): + """ A BuildTime/Access-counting cache implementation. + the weight of a value is computed as the product of + + num-accesses-of-a-value * time-to-build-the-value + + The values with the least such weights are evicted + if the cache maxentries threshold is superceded. + For implementation flexibility more than one object + might be evicted at a time. + """ + # time function to use for measuring build-times + + def _build(self, key, builder): + start = gettime() + val = builder() + end = gettime() + return WeightedCountingEntry(val, end-start) + + +class WeightedCountingEntry(object): + def __init__(self, value, oneweight): + self._value = value + self.weight = self._oneweight = oneweight + + def value(self): + self.weight += self._oneweight + return self._value + value = property(value) + +class AgingCache(BasicCache): + """ This cache prunes out cache entries that are too old. + """ + def __init__(self, maxentries=128, maxseconds=10.0): + super(AgingCache, self).__init__(maxentries) + self.maxseconds = maxseconds + + def _getentry(self, key): + entry = self._dict[key] + if entry.isexpired(): + self.delentry(key) + raise KeyError(key) + return entry + + def _build(self, key, builder): + val = builder() + entry = AgingEntry(val, gettime() + self.maxseconds) + return entry + +class AgingEntry(object): + def __init__(self, value, expirationtime): + self.value = value + self.weight = expirationtime + + def isexpired(self): + t = gettime() + return t >= self.weight diff --git a/lib/spack/external/pytest-fallback/py/_path/common.py b/lib/spack/external/pytest-fallback/py/_path/common.py new file mode 100644 index 0000000000..5512e51efe --- /dev/null +++ b/lib/spack/external/pytest-fallback/py/_path/common.py @@ -0,0 +1,445 @@ +""" +""" +import os, sys, posixpath +import fnmatch +import py + +# Moved from local.py. +iswin32 = sys.platform == "win32" or (getattr(os, '_name', False) == 'nt') + +try: + from os import fspath +except ImportError: + def fspath(path): + """ + Return the string representation of the path. + If str or bytes is passed in, it is returned unchanged. + This code comes from PEP 519, modified to support earlier versions of + python. + + This is required for python < 3.6. + """ + if isinstance(path, (py.builtin.text, py.builtin.bytes)): + return path + + # Work from the object's type to match method resolution of other magic + # methods. + path_type = type(path) + try: + return path_type.__fspath__(path) + except AttributeError: + if hasattr(path_type, '__fspath__'): + raise + try: + import pathlib + except ImportError: + pass + else: + if isinstance(path, pathlib.PurePath): + return py.builtin.text(path) + + raise TypeError("expected str, bytes or os.PathLike object, not " + + path_type.__name__) + +class Checkers: + _depend_on_existence = 'exists', 'link', 'dir', 'file' + + def __init__(self, path): + self.path = path + + def dir(self): + raise NotImplementedError + + def file(self): + raise NotImplementedError + + def dotfile(self): + return self.path.basename.startswith('.') + + def ext(self, arg): + if not arg.startswith('.'): + arg = '.' + arg + return self.path.ext == arg + + def exists(self): + raise NotImplementedError + + def basename(self, arg): + return self.path.basename == arg + + def basestarts(self, arg): + return self.path.basename.startswith(arg) + + def relto(self, arg): + return self.path.relto(arg) + + def fnmatch(self, arg): + return self.path.fnmatch(arg) + + def endswith(self, arg): + return str(self.path).endswith(arg) + + def _evaluate(self, kw): + for name, value in kw.items(): + invert = False + meth = None + try: + meth = getattr(self, name) + except AttributeError: + if name[:3] == 'not': + invert = True + try: + meth = getattr(self, name[3:]) + except AttributeError: + pass + if meth is None: + raise TypeError( + "no %r checker available for %r" % (name, self.path)) + try: + if py.code.getrawcode(meth).co_argcount > 1: + if (not meth(value)) ^ invert: + return False + else: + if bool(value) ^ bool(meth()) ^ invert: + return False + except (py.error.ENOENT, py.error.ENOTDIR, py.error.EBUSY): + # EBUSY feels not entirely correct, + # but its kind of necessary since ENOMEDIUM + # is not accessible in python + for name in self._depend_on_existence: + if name in kw: + if kw.get(name): + return False + name = 'not' + name + if name in kw: + if not kw.get(name): + return False + return True + +class NeverRaised(Exception): + pass + +class PathBase(object): + """ shared implementation for filesystem path objects.""" + Checkers = Checkers + + def __div__(self, other): + return self.join(fspath(other)) + __truediv__ = __div__ # py3k + + def basename(self): + """ basename part of path. """ + return self._getbyspec('basename')[0] + basename = property(basename, None, None, basename.__doc__) + + def dirname(self): + """ dirname part of path. """ + return self._getbyspec('dirname')[0] + dirname = property(dirname, None, None, dirname.__doc__) + + def purebasename(self): + """ pure base name of the path.""" + return self._getbyspec('purebasename')[0] + purebasename = property(purebasename, None, None, purebasename.__doc__) + + def ext(self): + """ extension of the path (including the '.').""" + return self._getbyspec('ext')[0] + ext = property(ext, None, None, ext.__doc__) + + def dirpath(self, *args, **kwargs): + """ return the directory path joined with any given path arguments. """ + return self.new(basename='').join(*args, **kwargs) + + def read_binary(self): + """ read and return a bytestring from reading the path. """ + with self.open('rb') as f: + return f.read() + + def read_text(self, encoding): + """ read and return a Unicode string from reading the path. """ + with self.open("r", encoding=encoding) as f: + return f.read() + + + def read(self, mode='r'): + """ read and return a bytestring from reading the path. """ + with self.open(mode) as f: + return f.read() + + def readlines(self, cr=1): + """ read and return a list of lines from the path. if cr is False, the +newline will be removed from the end of each line. """ + if sys.version_info < (3, ): + mode = 'rU' + else: # python 3 deprecates mode "U" in favor of "newline" option + mode = 'r' + + if not cr: + content = self.read(mode) + return content.split('\n') + else: + f = self.open(mode) + try: + return f.readlines() + finally: + f.close() + + def load(self): + """ (deprecated) return object unpickled from self.read() """ + f = self.open('rb') + try: + return py.error.checked_call(py.std.pickle.load, f) + finally: + f.close() + + def move(self, target): + """ move this path to target. """ + if target.relto(self): + raise py.error.EINVAL(target, + "cannot move path into a subdirectory of itself") + try: + self.rename(target) + except py.error.EXDEV: # invalid cross-device link + self.copy(target) + self.remove() + + def __repr__(self): + """ return a string representation of this path. """ + return repr(str(self)) + + def check(self, **kw): + """ check a path for existence and properties. + + Without arguments, return True if the path exists, otherwise False. + + valid checkers:: + + file=1 # is a file + file=0 # is not a file (may not even exist) + dir=1 # is a dir + link=1 # is a link + exists=1 # exists + + You can specify multiple checker definitions, for example:: + + path.check(file=1, link=1) # a link pointing to a file + """ + if not kw: + kw = {'exists' : 1} + return self.Checkers(self)._evaluate(kw) + + def fnmatch(self, pattern): + """return true if the basename/fullname matches the glob-'pattern'. + + valid pattern characters:: + + * matches everything + ? matches any single character + [seq] matches any character in seq + [!seq] matches any char not in seq + + If the pattern contains a path-separator then the full path + is used for pattern matching and a '*' is prepended to the + pattern. + + if the pattern doesn't contain a path-separator the pattern + is only matched against the basename. + """ + return FNMatcher(pattern)(self) + + def relto(self, relpath): + """ return a string which is the relative part of the path + to the given 'relpath'. + """ + if not isinstance(relpath, (str, PathBase)): + raise TypeError("%r: not a string or path object" %(relpath,)) + strrelpath = str(relpath) + if strrelpath and strrelpath[-1] != self.sep: + strrelpath += self.sep + #assert strrelpath[-1] == self.sep + #assert strrelpath[-2] != self.sep + strself = self.strpath + if sys.platform == "win32" or getattr(os, '_name', None) == 'nt': + if os.path.normcase(strself).startswith( + os.path.normcase(strrelpath)): + return strself[len(strrelpath):] + elif strself.startswith(strrelpath): + return strself[len(strrelpath):] + return "" + + def ensure_dir(self, *args): + """ ensure the path joined with args is a directory. """ + return self.ensure(*args, **{"dir": True}) + + def bestrelpath(self, dest): + """ return a string which is a relative path from self + (assumed to be a directory) to dest such that + self.join(bestrelpath) == dest and if not such + path can be determined return dest. + """ + try: + if self == dest: + return os.curdir + base = self.common(dest) + if not base: # can be the case on windows + return str(dest) + self2base = self.relto(base) + reldest = dest.relto(base) + if self2base: + n = self2base.count(self.sep) + 1 + else: + n = 0 + l = [os.pardir] * n + if reldest: + l.append(reldest) + target = dest.sep.join(l) + return target + except AttributeError: + return str(dest) + + def exists(self): + return self.check() + + def isdir(self): + return self.check(dir=1) + + def isfile(self): + return self.check(file=1) + + def parts(self, reverse=False): + """ return a root-first list of all ancestor directories + plus the path itself. + """ + current = self + l = [self] + while 1: + last = current + current = current.dirpath() + if last == current: + break + l.append(current) + if not reverse: + l.reverse() + return l + + def common(self, other): + """ return the common part shared with the other path + or None if there is no common part. + """ + last = None + for x, y in zip(self.parts(), other.parts()): + if x != y: + return last + last = x + return last + + def __add__(self, other): + """ return new path object with 'other' added to the basename""" + return self.new(basename=self.basename+str(other)) + + def __cmp__(self, other): + """ return sort value (-1, 0, +1). """ + try: + return cmp(self.strpath, other.strpath) + except AttributeError: + return cmp(str(self), str(other)) # self.path, other.path) + + def __lt__(self, other): + try: + return self.strpath < other.strpath + except AttributeError: + return str(self) < str(other) + + def visit(self, fil=None, rec=None, ignore=NeverRaised, bf=False, sort=False): + """ yields all paths below the current one + + fil is a filter (glob pattern or callable), if not matching the + path will not be yielded, defaulting to None (everything is + returned) + + rec is a filter (glob pattern or callable) that controls whether + a node is descended, defaulting to None + + ignore is an Exception class that is ignoredwhen calling dirlist() + on any of the paths (by default, all exceptions are reported) + + bf if True will cause a breadthfirst search instead of the + default depthfirst. Default: False + + sort if True will sort entries within each directory level. + """ + for x in Visitor(fil, rec, ignore, bf, sort).gen(self): + yield x + + def _sortlist(self, res, sort): + if sort: + if hasattr(sort, '__call__'): + res.sort(sort) + else: + res.sort() + + def samefile(self, other): + """ return True if other refers to the same stat object as self. """ + return self.strpath == str(other) + + def __fspath__(self): + return self.strpath + +class Visitor: + def __init__(self, fil, rec, ignore, bf, sort): + if isinstance(fil, py.builtin._basestring): + fil = FNMatcher(fil) + if isinstance(rec, py.builtin._basestring): + self.rec = FNMatcher(rec) + elif not hasattr(rec, '__call__') and rec: + self.rec = lambda path: True + else: + self.rec = rec + self.fil = fil + self.ignore = ignore + self.breadthfirst = bf + self.optsort = sort and sorted or (lambda x: x) + + def gen(self, path): + try: + entries = path.listdir() + except self.ignore: + return + rec = self.rec + dirs = self.optsort([p for p in entries + if p.check(dir=1) and (rec is None or rec(p))]) + if not self.breadthfirst: + for subdir in dirs: + for p in self.gen(subdir): + yield p + for p in self.optsort(entries): + if self.fil is None or self.fil(p): + yield p + if self.breadthfirst: + for subdir in dirs: + for p in self.gen(subdir): + yield p + +class FNMatcher: + def __init__(self, pattern): + self.pattern = pattern + + def __call__(self, path): + pattern = self.pattern + + if (pattern.find(path.sep) == -1 and + iswin32 and + pattern.find(posixpath.sep) != -1): + # Running on Windows, the pattern has no Windows path separators, + # and the pattern has one or more Posix path separators. Replace + # the Posix path separators with the Windows path separator. + pattern = pattern.replace(posixpath.sep, path.sep) + + if pattern.find(path.sep) == -1: + name = path.basename + else: + name = str(path) # path.strpath # XXX svn? + if not os.path.isabs(pattern): + pattern = '*' + path.sep + pattern + return fnmatch.fnmatch(name, pattern) diff --git a/lib/spack/external/pytest-fallback/py/_path/local.py b/lib/spack/external/pytest-fallback/py/_path/local.py new file mode 100644 index 0000000000..d2f16b993e --- /dev/null +++ b/lib/spack/external/pytest-fallback/py/_path/local.py @@ -0,0 +1,930 @@ +""" +local path implementation. +""" +from __future__ import with_statement + +from contextlib import contextmanager +import sys, os, re, atexit, io +import py +from py._path import common +from py._path.common import iswin32, fspath +from stat import S_ISLNK, S_ISDIR, S_ISREG + +from os.path import abspath, normpath, isabs, exists, isdir, isfile, islink, dirname + +if sys.version_info > (3,0): + def map_as_list(func, iter): + return list(map(func, iter)) +else: + map_as_list = map + +class Stat(object): + def __getattr__(self, name): + return getattr(self._osstatresult, "st_" + name) + + def __init__(self, path, osstatresult): + self.path = path + self._osstatresult = osstatresult + + @property + def owner(self): + if iswin32: + raise NotImplementedError("XXX win32") + import pwd + entry = py.error.checked_call(pwd.getpwuid, self.uid) + return entry[0] + + @property + def group(self): + """ return group name of file. """ + if iswin32: + raise NotImplementedError("XXX win32") + import grp + entry = py.error.checked_call(grp.getgrgid, self.gid) + return entry[0] + + def isdir(self): + return S_ISDIR(self._osstatresult.st_mode) + + def isfile(self): + return S_ISREG(self._osstatresult.st_mode) + + def islink(self): + st = self.path.lstat() + return S_ISLNK(self._osstatresult.st_mode) + +class PosixPath(common.PathBase): + def chown(self, user, group, rec=0): + """ change ownership to the given user and group. + user and group may be specified by a number or + by a name. if rec is True change ownership + recursively. + """ + uid = getuserid(user) + gid = getgroupid(group) + if rec: + for x in self.visit(rec=lambda x: x.check(link=0)): + if x.check(link=0): + py.error.checked_call(os.chown, str(x), uid, gid) + py.error.checked_call(os.chown, str(self), uid, gid) + + def readlink(self): + """ return value of a symbolic link. """ + return py.error.checked_call(os.readlink, self.strpath) + + def mklinkto(self, oldname): + """ posix style hard link to another name. """ + py.error.checked_call(os.link, str(oldname), str(self)) + + def mksymlinkto(self, value, absolute=1): + """ create a symbolic link with the given value (pointing to another name). """ + if absolute: + py.error.checked_call(os.symlink, str(value), self.strpath) + else: + base = self.common(value) + # with posix local paths '/' is always a common base + relsource = self.__class__(value).relto(base) + reldest = self.relto(base) + n = reldest.count(self.sep) + target = self.sep.join(('..', )*n + (relsource, )) + py.error.checked_call(os.symlink, target, self.strpath) + +def getuserid(user): + import pwd + if not isinstance(user, int): + user = pwd.getpwnam(user)[2] + return user + +def getgroupid(group): + import grp + if not isinstance(group, int): + group = grp.getgrnam(group)[2] + return group + +FSBase = not iswin32 and PosixPath or common.PathBase + +class LocalPath(FSBase): + """ object oriented interface to os.path and other local filesystem + related information. + """ + class ImportMismatchError(ImportError): + """ raised on pyimport() if there is a mismatch of __file__'s""" + + sep = os.sep + class Checkers(common.Checkers): + def _stat(self): + try: + return self._statcache + except AttributeError: + try: + self._statcache = self.path.stat() + except py.error.ELOOP: + self._statcache = self.path.lstat() + return self._statcache + + def dir(self): + return S_ISDIR(self._stat().mode) + + def file(self): + return S_ISREG(self._stat().mode) + + def exists(self): + return self._stat() + + def link(self): + st = self.path.lstat() + return S_ISLNK(st.mode) + + def __init__(self, path=None, expanduser=False): + """ Initialize and return a local Path instance. + + Path can be relative to the current directory. + If path is None it defaults to the current working directory. + If expanduser is True, tilde-expansion is performed. + Note that Path instances always carry an absolute path. + Note also that passing in a local path object will simply return + the exact same path object. Use new() to get a new copy. + """ + if path is None: + self.strpath = py.error.checked_call(os.getcwd) + else: + try: + path = fspath(path) + except TypeError: + raise ValueError("can only pass None, Path instances " + "or non-empty strings to LocalPath") + if expanduser: + path = os.path.expanduser(path) + self.strpath = abspath(path) + + def __hash__(self): + return hash(self.strpath) + + def __eq__(self, other): + s1 = fspath(self) + try: + s2 = fspath(other) + except TypeError: + return False + if iswin32: + s1 = s1.lower() + try: + s2 = s2.lower() + except AttributeError: + return False + return s1 == s2 + + def __ne__(self, other): + return not (self == other) + + def __lt__(self, other): + return fspath(self) < fspath(other) + + def __gt__(self, other): + return fspath(self) > fspath(other) + + def samefile(self, other): + """ return True if 'other' references the same file as 'self'. + """ + other = fspath(other) + if not isabs(other): + other = abspath(other) + if self == other: + return True + if iswin32: + return False # there is no samefile + return py.error.checked_call( + os.path.samefile, self.strpath, other) + + def remove(self, rec=1, ignore_errors=False): + """ remove a file or directory (or a directory tree if rec=1). + if ignore_errors is True, errors while removing directories will + be ignored. + """ + if self.check(dir=1, link=0): + if rec: + # force remove of readonly files on windows + if iswin32: + self.chmod(0o700, rec=1) + py.error.checked_call(py.std.shutil.rmtree, self.strpath, + ignore_errors=ignore_errors) + else: + py.error.checked_call(os.rmdir, self.strpath) + else: + if iswin32: + self.chmod(0o700) + py.error.checked_call(os.remove, self.strpath) + + def computehash(self, hashtype="md5", chunksize=524288): + """ return hexdigest of hashvalue for this file. """ + try: + try: + import hashlib as mod + except ImportError: + if hashtype == "sha1": + hashtype = "sha" + mod = __import__(hashtype) + hash = getattr(mod, hashtype)() + except (AttributeError, ImportError): + raise ValueError("Don't know how to compute %r hash" %(hashtype,)) + f = self.open('rb') + try: + while 1: + buf = f.read(chunksize) + if not buf: + return hash.hexdigest() + hash.update(buf) + finally: + f.close() + + def new(self, **kw): + """ create a modified version of this path. + the following keyword arguments modify various path parts:: + + a:/some/path/to/a/file.ext + xx drive + xxxxxxxxxxxxxxxxx dirname + xxxxxxxx basename + xxxx purebasename + xxx ext + """ + obj = object.__new__(self.__class__) + if not kw: + obj.strpath = self.strpath + return obj + drive, dirname, basename, purebasename,ext = self._getbyspec( + "drive,dirname,basename,purebasename,ext") + if 'basename' in kw: + if 'purebasename' in kw or 'ext' in kw: + raise ValueError("invalid specification %r" % kw) + else: + pb = kw.setdefault('purebasename', purebasename) + try: + ext = kw['ext'] + except KeyError: + pass + else: + if ext and not ext.startswith('.'): + ext = '.' + ext + kw['basename'] = pb + ext + + if ('dirname' in kw and not kw['dirname']): + kw['dirname'] = drive + else: + kw.setdefault('dirname', dirname) + kw.setdefault('sep', self.sep) + obj.strpath = normpath( + "%(dirname)s%(sep)s%(basename)s" % kw) + return obj + + def _getbyspec(self, spec): + """ see new for what 'spec' can be. """ + res = [] + parts = self.strpath.split(self.sep) + + args = filter(None, spec.split(',') ) + append = res.append + for name in args: + if name == 'drive': + append(parts[0]) + elif name == 'dirname': + append(self.sep.join(parts[:-1])) + else: + basename = parts[-1] + if name == 'basename': + append(basename) + else: + i = basename.rfind('.') + if i == -1: + purebasename, ext = basename, '' + else: + purebasename, ext = basename[:i], basename[i:] + if name == 'purebasename': + append(purebasename) + elif name == 'ext': + append(ext) + else: + raise ValueError("invalid part specification %r" % name) + return res + + def dirpath(self, *args, **kwargs): + """ return the directory path joined with any given path arguments. """ + if not kwargs: + path = object.__new__(self.__class__) + path.strpath = dirname(self.strpath) + if args: + path = path.join(*args) + return path + return super(LocalPath, self).dirpath(*args, **kwargs) + + def join(self, *args, **kwargs): + """ return a new path by appending all 'args' as path + components. if abs=1 is used restart from root if any + of the args is an absolute path. + """ + sep = self.sep + strargs = [fspath(arg) for arg in args] + strpath = self.strpath + if kwargs.get('abs'): + newargs = [] + for arg in reversed(strargs): + if isabs(arg): + strpath = arg + strargs = newargs + break + newargs.insert(0, arg) + for arg in strargs: + arg = arg.strip(sep) + if iswin32: + # allow unix style paths even on windows. + arg = arg.strip('/') + arg = arg.replace('/', sep) + strpath = strpath + sep + arg + obj = object.__new__(self.__class__) + obj.strpath = normpath(strpath) + return obj + + def open(self, mode='r', ensure=False, encoding=None): + """ return an opened file with the given mode. + + If ensure is True, create parent directories if needed. + """ + if ensure: + self.dirpath().ensure(dir=1) + if encoding: + return py.error.checked_call(io.open, self.strpath, mode, encoding=encoding) + return py.error.checked_call(open, self.strpath, mode) + + def _fastjoin(self, name): + child = object.__new__(self.__class__) + child.strpath = self.strpath + self.sep + name + return child + + def islink(self): + return islink(self.strpath) + + def check(self, **kw): + if not kw: + return exists(self.strpath) + if len(kw) == 1: + if "dir" in kw: + return not kw["dir"] ^ isdir(self.strpath) + if "file" in kw: + return not kw["file"] ^ isfile(self.strpath) + return super(LocalPath, self).check(**kw) + + _patternchars = set("*?[" + os.path.sep) + def listdir(self, fil=None, sort=None): + """ list directory contents, possibly filter by the given fil func + and possibly sorted. + """ + if fil is None and sort is None: + names = py.error.checked_call(os.listdir, self.strpath) + return map_as_list(self._fastjoin, names) + if isinstance(fil, py.builtin._basestring): + if not self._patternchars.intersection(fil): + child = self._fastjoin(fil) + if exists(child.strpath): + return [child] + return [] + fil = common.FNMatcher(fil) + names = py.error.checked_call(os.listdir, self.strpath) + res = [] + for name in names: + child = self._fastjoin(name) + if fil is None or fil(child): + res.append(child) + self._sortlist(res, sort) + return res + + def size(self): + """ return size of the underlying file object """ + return self.stat().size + + def mtime(self): + """ return last modification time of the path. """ + return self.stat().mtime + + def copy(self, target, mode=False, stat=False): + """ copy path to target. + + If mode is True, will copy copy permission from path to target. + If stat is True, copy permission, last modification + time, last access time, and flags from path to target. + """ + if self.check(file=1): + if target.check(dir=1): + target = target.join(self.basename) + assert self!=target + copychunked(self, target) + if mode: + copymode(self.strpath, target.strpath) + if stat: + copystat(self, target) + else: + def rec(p): + return p.check(link=0) + for x in self.visit(rec=rec): + relpath = x.relto(self) + newx = target.join(relpath) + newx.dirpath().ensure(dir=1) + if x.check(link=1): + newx.mksymlinkto(x.readlink()) + continue + elif x.check(file=1): + copychunked(x, newx) + elif x.check(dir=1): + newx.ensure(dir=1) + if mode: + copymode(x.strpath, newx.strpath) + if stat: + copystat(x, newx) + + def rename(self, target): + """ rename this path to target. """ + target = fspath(target) + return py.error.checked_call(os.rename, self.strpath, target) + + def dump(self, obj, bin=1): + """ pickle object into path location""" + f = self.open('wb') + try: + py.error.checked_call(py.std.pickle.dump, obj, f, bin) + finally: + f.close() + + def mkdir(self, *args): + """ create & return the directory joined with args. """ + p = self.join(*args) + py.error.checked_call(os.mkdir, fspath(p)) + return p + + def write_binary(self, data, ensure=False): + """ write binary data into path. If ensure is True create + missing parent directories. + """ + if ensure: + self.dirpath().ensure(dir=1) + with self.open('wb') as f: + f.write(data) + + def write_text(self, data, encoding, ensure=False): + """ write text data into path using the specified encoding. + If ensure is True create missing parent directories. + """ + if ensure: + self.dirpath().ensure(dir=1) + with self.open('w', encoding=encoding) as f: + f.write(data) + + def write(self, data, mode='w', ensure=False): + """ write data into path. If ensure is True create + missing parent directories. + """ + if ensure: + self.dirpath().ensure(dir=1) + if 'b' in mode: + if not py.builtin._isbytes(data): + raise ValueError("can only process bytes") + else: + if not py.builtin._istext(data): + if not py.builtin._isbytes(data): + data = str(data) + else: + data = py.builtin._totext(data, sys.getdefaultencoding()) + f = self.open(mode) + try: + f.write(data) + finally: + f.close() + + def _ensuredirs(self): + parent = self.dirpath() + if parent == self: + return self + if parent.check(dir=0): + parent._ensuredirs() + if self.check(dir=0): + try: + self.mkdir() + except py.error.EEXIST: + # race condition: file/dir created by another thread/process. + # complain if it is not a dir + if self.check(dir=0): + raise + return self + + def ensure(self, *args, **kwargs): + """ ensure that an args-joined path exists (by default as + a file). if you specify a keyword argument 'dir=True' + then the path is forced to be a directory path. + """ + p = self.join(*args) + if kwargs.get('dir', 0): + return p._ensuredirs() + else: + p.dirpath()._ensuredirs() + if not p.check(file=1): + p.open('w').close() + return p + + def stat(self, raising=True): + """ Return an os.stat() tuple. """ + if raising == True: + return Stat(self, py.error.checked_call(os.stat, self.strpath)) + try: + return Stat(self, os.stat(self.strpath)) + except KeyboardInterrupt: + raise + except Exception: + return None + + def lstat(self): + """ Return an os.lstat() tuple. """ + return Stat(self, py.error.checked_call(os.lstat, self.strpath)) + + def setmtime(self, mtime=None): + """ set modification time for the given path. if 'mtime' is None + (the default) then the file's mtime is set to current time. + + Note that the resolution for 'mtime' is platform dependent. + """ + if mtime is None: + return py.error.checked_call(os.utime, self.strpath, mtime) + try: + return py.error.checked_call(os.utime, self.strpath, (-1, mtime)) + except py.error.EINVAL: + return py.error.checked_call(os.utime, self.strpath, (self.atime(), mtime)) + + def chdir(self): + """ change directory to self and return old current directory """ + try: + old = self.__class__() + except py.error.ENOENT: + old = None + py.error.checked_call(os.chdir, self.strpath) + return old + + + @contextmanager + def as_cwd(self): + """ return context manager which changes to current dir during the + managed "with" context. On __enter__ it returns the old dir. + """ + old = self.chdir() + try: + yield old + finally: + old.chdir() + + def realpath(self): + """ return a new path which contains no symbolic links.""" + return self.__class__(os.path.realpath(self.strpath)) + + def atime(self): + """ return last access time of the path. """ + return self.stat().atime + + def __repr__(self): + return 'local(%r)' % self.strpath + + def __str__(self): + """ return string representation of the Path. """ + return self.strpath + + def chmod(self, mode, rec=0): + """ change permissions to the given mode. If mode is an + integer it directly encodes the os-specific modes. + if rec is True perform recursively. + """ + if not isinstance(mode, int): + raise TypeError("mode %r must be an integer" % (mode,)) + if rec: + for x in self.visit(rec=rec): + py.error.checked_call(os.chmod, str(x), mode) + py.error.checked_call(os.chmod, self.strpath, mode) + + def pypkgpath(self): + """ return the Python package path by looking for the last + directory upwards which still contains an __init__.py. + Return None if a pkgpath can not be determined. + """ + pkgpath = None + for parent in self.parts(reverse=True): + if parent.isdir(): + if not parent.join('__init__.py').exists(): + break + if not isimportable(parent.basename): + break + pkgpath = parent + return pkgpath + + def _ensuresyspath(self, ensuremode, path): + if ensuremode: + s = str(path) + if ensuremode == "append": + if s not in sys.path: + sys.path.append(s) + else: + if s != sys.path[0]: + sys.path.insert(0, s) + + def pyimport(self, modname=None, ensuresyspath=True): + """ return path as an imported python module. + + If modname is None, look for the containing package + and construct an according module name. + The module will be put/looked up in sys.modules. + if ensuresyspath is True then the root dir for importing + the file (taking __init__.py files into account) will + be prepended to sys.path if it isn't there already. + If ensuresyspath=="append" the root dir will be appended + if it isn't already contained in sys.path. + if ensuresyspath is False no modification of syspath happens. + """ + if not self.check(): + raise py.error.ENOENT(self) + + pkgpath = None + if modname is None: + pkgpath = self.pypkgpath() + if pkgpath is not None: + pkgroot = pkgpath.dirpath() + names = self.new(ext="").relto(pkgroot).split(self.sep) + if names[-1] == "__init__": + names.pop() + modname = ".".join(names) + else: + pkgroot = self.dirpath() + modname = self.purebasename + + self._ensuresyspath(ensuresyspath, pkgroot) + __import__(modname) + mod = sys.modules[modname] + if self.basename == "__init__.py": + return mod # we don't check anything as we might + # we in a namespace package ... too icky to check + modfile = mod.__file__ + if modfile[-4:] in ('.pyc', '.pyo'): + modfile = modfile[:-1] + elif modfile.endswith('$py.class'): + modfile = modfile[:-9] + '.py' + if modfile.endswith(os.path.sep + "__init__.py"): + if self.basename != "__init__.py": + modfile = modfile[:-12] + try: + issame = self.samefile(modfile) + except py.error.ENOENT: + issame = False + if not issame: + raise self.ImportMismatchError(modname, modfile, self) + return mod + else: + try: + return sys.modules[modname] + except KeyError: + # we have a custom modname, do a pseudo-import + mod = py.std.types.ModuleType(modname) + mod.__file__ = str(self) + sys.modules[modname] = mod + try: + py.builtin.execfile(str(self), mod.__dict__) + except: + del sys.modules[modname] + raise + return mod + + def sysexec(self, *argv, **popen_opts): + """ return stdout text from executing a system child process, + where the 'self' path points to executable. + The process is directly invoked and not through a system shell. + """ + from subprocess import Popen, PIPE + argv = map_as_list(str, argv) + popen_opts['stdout'] = popen_opts['stderr'] = PIPE + proc = Popen([str(self)] + argv, **popen_opts) + stdout, stderr = proc.communicate() + ret = proc.wait() + if py.builtin._isbytes(stdout): + stdout = py.builtin._totext(stdout, sys.getdefaultencoding()) + if ret != 0: + if py.builtin._isbytes(stderr): + stderr = py.builtin._totext(stderr, sys.getdefaultencoding()) + raise py.process.cmdexec.Error(ret, ret, str(self), + stdout, stderr,) + return stdout + + def sysfind(cls, name, checker=None, paths=None): + """ return a path object found by looking at the systems + underlying PATH specification. If the checker is not None + it will be invoked to filter matching paths. If a binary + cannot be found, None is returned + Note: This is probably not working on plain win32 systems + but may work on cygwin. + """ + if isabs(name): + p = py.path.local(name) + if p.check(file=1): + return p + else: + if paths is None: + if iswin32: + paths = py.std.os.environ['Path'].split(';') + if '' not in paths and '.' not in paths: + paths.append('.') + try: + systemroot = os.environ['SYSTEMROOT'] + except KeyError: + pass + else: + paths = [re.sub('%SystemRoot%', systemroot, path) + for path in paths] + else: + paths = py.std.os.environ['PATH'].split(':') + tryadd = [] + if iswin32: + tryadd += os.environ['PATHEXT'].split(os.pathsep) + tryadd.append("") + + for x in paths: + for addext in tryadd: + p = py.path.local(x).join(name, abs=True) + addext + try: + if p.check(file=1): + if checker: + if not checker(p): + continue + return p + except py.error.EACCES: + pass + return None + sysfind = classmethod(sysfind) + + def _gethomedir(cls): + try: + x = os.environ['HOME'] + except KeyError: + try: + x = os.environ["HOMEDRIVE"] + os.environ['HOMEPATH'] + except KeyError: + return None + return cls(x) + _gethomedir = classmethod(_gethomedir) + + #""" + #special class constructors for local filesystem paths + #""" + def get_temproot(cls): + """ return the system's temporary directory + (where tempfiles are usually created in) + """ + return py.path.local(py.std.tempfile.gettempdir()) + get_temproot = classmethod(get_temproot) + + def mkdtemp(cls, rootdir=None): + """ return a Path object pointing to a fresh new temporary directory + (which we created ourself). + """ + import tempfile + if rootdir is None: + rootdir = cls.get_temproot() + return cls(py.error.checked_call(tempfile.mkdtemp, dir=str(rootdir))) + mkdtemp = classmethod(mkdtemp) + + def make_numbered_dir(cls, prefix='session-', rootdir=None, keep=3, + lock_timeout = 172800): # two days + """ return unique directory with a number greater than the current + maximum one. The number is assumed to start directly after prefix. + if keep is true directories with a number less than (maxnum-keep) + will be removed. + """ + if rootdir is None: + rootdir = cls.get_temproot() + + nprefix = prefix.lower() + def parse_num(path): + """ parse the number out of a path (if it matches the prefix) """ + nbasename = path.basename.lower() + if nbasename.startswith(nprefix): + try: + return int(nbasename[len(nprefix):]) + except ValueError: + pass + + # compute the maximum number currently in use with the + # prefix + lastmax = None + while True: + maxnum = -1 + for path in rootdir.listdir(): + num = parse_num(path) + if num is not None: + maxnum = max(maxnum, num) + + # make the new directory + try: + udir = rootdir.mkdir(prefix + str(maxnum+1)) + except py.error.EEXIST: + # race condition: another thread/process created the dir + # in the meantime. Try counting again + if lastmax == maxnum: + raise + lastmax = maxnum + continue + break + + # put a .lock file in the new directory that will be removed at + # process exit + if lock_timeout: + lockfile = udir.join('.lock') + mypid = os.getpid() + if hasattr(lockfile, 'mksymlinkto'): + lockfile.mksymlinkto(str(mypid)) + else: + lockfile.write(str(mypid)) + def try_remove_lockfile(): + # in a fork() situation, only the last process should + # remove the .lock, otherwise the other processes run the + # risk of seeing their temporary dir disappear. For now + # we remove the .lock in the parent only (i.e. we assume + # that the children finish before the parent). + if os.getpid() != mypid: + return + try: + lockfile.remove() + except py.error.Error: + pass + atexit.register(try_remove_lockfile) + + # prune old directories + if keep: + for path in rootdir.listdir(): + num = parse_num(path) + if num is not None and num <= (maxnum - keep): + lf = path.join('.lock') + try: + t1 = lf.lstat().mtime + t2 = lockfile.lstat().mtime + if not lock_timeout or abs(t2-t1) < lock_timeout: + continue # skip directories still locked + except py.error.Error: + pass # assume that it means that there is no 'lf' + try: + path.remove(rec=1) + except KeyboardInterrupt: + raise + except: # this might be py.error.Error, WindowsError ... + pass + + # make link... + try: + username = os.environ['USER'] #linux, et al + except KeyError: + try: + username = os.environ['USERNAME'] #windows + except KeyError: + username = 'current' + + src = str(udir) + dest = src[:src.rfind('-')] + '-' + username + try: + os.unlink(dest) + except OSError: + pass + try: + os.symlink(src, dest) + except (OSError, AttributeError, NotImplementedError): + pass + + return udir + make_numbered_dir = classmethod(make_numbered_dir) + + +def copymode(src, dest): + """ copy permission from src to dst. """ + py.std.shutil.copymode(src, dest) + +def copystat(src, dest): + """ copy permission, last modification time, last access time, and flags from src to dst.""" + py.std.shutil.copystat(str(src), str(dest)) + +def copychunked(src, dest): + chunksize = 524288 # half a meg of bytes + fsrc = src.open('rb') + try: + fdest = dest.open('wb') + try: + while 1: + buf = fsrc.read(chunksize) + if not buf: + break + fdest.write(buf) + finally: + fdest.close() + finally: + fsrc.close() + +def isimportable(name): + if name and (name[0].isalpha() or name[0] == '_'): + name = name.replace("_", '') + return not name or name.isalnum() diff --git a/lib/spack/external/pytest-fallback/py/_path/svnurl.py b/lib/spack/external/pytest-fallback/py/_path/svnurl.py new file mode 100644 index 0000000000..6589a71d09 --- /dev/null +++ b/lib/spack/external/pytest-fallback/py/_path/svnurl.py @@ -0,0 +1,380 @@ +""" +module defining a subversion path object based on the external +command 'svn'. This modules aims to work with svn 1.3 and higher +but might also interact well with earlier versions. +""" + +import os, sys, time, re +import py +from py import path, process +from py._path import common +from py._path import svnwc as svncommon +from py._path.cacheutil import BuildcostAccessCache, AgingCache + +DEBUG=False + +class SvnCommandPath(svncommon.SvnPathBase): + """ path implementation that offers access to (possibly remote) subversion + repositories. """ + + _lsrevcache = BuildcostAccessCache(maxentries=128) + _lsnorevcache = AgingCache(maxentries=1000, maxseconds=60.0) + + def __new__(cls, path, rev=None, auth=None): + self = object.__new__(cls) + if isinstance(path, cls): + rev = path.rev + auth = path.auth + path = path.strpath + svncommon.checkbadchars(path) + path = path.rstrip('/') + self.strpath = path + self.rev = rev + self.auth = auth + return self + + def __repr__(self): + if self.rev == -1: + return 'svnurl(%r)' % self.strpath + else: + return 'svnurl(%r, %r)' % (self.strpath, self.rev) + + def _svnwithrev(self, cmd, *args): + """ execute an svn command, append our own url and revision """ + if self.rev is None: + return self._svnwrite(cmd, *args) + else: + args = ['-r', self.rev] + list(args) + return self._svnwrite(cmd, *args) + + def _svnwrite(self, cmd, *args): + """ execute an svn command, append our own url """ + l = ['svn %s' % cmd] + args = ['"%s"' % self._escape(item) for item in args] + l.extend(args) + l.append('"%s"' % self._encodedurl()) + # fixing the locale because we can't otherwise parse + string = " ".join(l) + if DEBUG: + print("execing %s" % string) + out = self._svncmdexecauth(string) + return out + + def _svncmdexecauth(self, cmd): + """ execute an svn command 'as is' """ + cmd = svncommon.fixlocale() + cmd + if self.auth is not None: + cmd += ' ' + self.auth.makecmdoptions() + return self._cmdexec(cmd) + + def _cmdexec(self, cmd): + try: + out = process.cmdexec(cmd) + except py.process.cmdexec.Error: + e = sys.exc_info()[1] + if (e.err.find('File Exists') != -1 or + e.err.find('File already exists') != -1): + raise py.error.EEXIST(self) + raise + return out + + def _svnpopenauth(self, cmd): + """ execute an svn command, return a pipe for reading stdin """ + cmd = svncommon.fixlocale() + cmd + if self.auth is not None: + cmd += ' ' + self.auth.makecmdoptions() + return self._popen(cmd) + + def _popen(self, cmd): + return os.popen(cmd) + + def _encodedurl(self): + return self._escape(self.strpath) + + def _norev_delentry(self, path): + auth = self.auth and self.auth.makecmdoptions() or None + self._lsnorevcache.delentry((str(path), auth)) + + def open(self, mode='r'): + """ return an opened file with the given mode. """ + if mode not in ("r", "rU",): + raise ValueError("mode %r not supported" % (mode,)) + assert self.check(file=1) # svn cat returns an empty file otherwise + if self.rev is None: + return self._svnpopenauth('svn cat "%s"' % ( + self._escape(self.strpath), )) + else: + return self._svnpopenauth('svn cat -r %s "%s"' % ( + self.rev, self._escape(self.strpath))) + + def dirpath(self, *args, **kwargs): + """ return the directory path of the current path joined + with any given path arguments. + """ + l = self.strpath.split(self.sep) + if len(l) < 4: + raise py.error.EINVAL(self, "base is not valid") + elif len(l) == 4: + return self.join(*args, **kwargs) + else: + return self.new(basename='').join(*args, **kwargs) + + # modifying methods (cache must be invalidated) + def mkdir(self, *args, **kwargs): + """ create & return the directory joined with args. + pass a 'msg' keyword argument to set the commit message. + """ + commit_msg = kwargs.get('msg', "mkdir by py lib invocation") + createpath = self.join(*args) + createpath._svnwrite('mkdir', '-m', commit_msg) + self._norev_delentry(createpath.dirpath()) + return createpath + + def copy(self, target, msg='copied by py lib invocation'): + """ copy path to target with checkin message msg.""" + if getattr(target, 'rev', None) is not None: + raise py.error.EINVAL(target, "revisions are immutable") + self._svncmdexecauth('svn copy -m "%s" "%s" "%s"' %(msg, + self._escape(self), self._escape(target))) + self._norev_delentry(target.dirpath()) + + def rename(self, target, msg="renamed by py lib invocation"): + """ rename this path to target with checkin message msg. """ + if getattr(self, 'rev', None) is not None: + raise py.error.EINVAL(self, "revisions are immutable") + self._svncmdexecauth('svn move -m "%s" --force "%s" "%s"' %( + msg, self._escape(self), self._escape(target))) + self._norev_delentry(self.dirpath()) + self._norev_delentry(self) + + def remove(self, rec=1, msg='removed by py lib invocation'): + """ remove a file or directory (or a directory tree if rec=1) with +checkin message msg.""" + if self.rev is not None: + raise py.error.EINVAL(self, "revisions are immutable") + self._svncmdexecauth('svn rm -m "%s" "%s"' %(msg, self._escape(self))) + self._norev_delentry(self.dirpath()) + + def export(self, topath): + """ export to a local path + + topath should not exist prior to calling this, returns a + py.path.local instance + """ + topath = py.path.local(topath) + args = ['"%s"' % (self._escape(self),), + '"%s"' % (self._escape(topath),)] + if self.rev is not None: + args = ['-r', str(self.rev)] + args + self._svncmdexecauth('svn export %s' % (' '.join(args),)) + return topath + + def ensure(self, *args, **kwargs): + """ ensure that an args-joined path exists (by default as + a file). If you specify a keyword argument 'dir=True' + then the path is forced to be a directory path. + """ + if getattr(self, 'rev', None) is not None: + raise py.error.EINVAL(self, "revisions are immutable") + target = self.join(*args) + dir = kwargs.get('dir', 0) + for x in target.parts(reverse=True): + if x.check(): + break + else: + raise py.error.ENOENT(target, "has not any valid base!") + if x == target: + if not x.check(dir=dir): + raise dir and py.error.ENOTDIR(x) or py.error.EISDIR(x) + return x + tocreate = target.relto(x) + basename = tocreate.split(self.sep, 1)[0] + tempdir = py.path.local.mkdtemp() + try: + tempdir.ensure(tocreate, dir=dir) + cmd = 'svn import -m "%s" "%s" "%s"' % ( + "ensure %s" % self._escape(tocreate), + self._escape(tempdir.join(basename)), + x.join(basename)._encodedurl()) + self._svncmdexecauth(cmd) + self._norev_delentry(x) + finally: + tempdir.remove() + return target + + # end of modifying methods + def _propget(self, name): + res = self._svnwithrev('propget', name) + return res[:-1] # strip trailing newline + + def _proplist(self): + res = self._svnwithrev('proplist') + lines = res.split('\n') + lines = [x.strip() for x in lines[1:]] + return svncommon.PropListDict(self, lines) + + def info(self): + """ return an Info structure with svn-provided information. """ + parent = self.dirpath() + nameinfo_seq = parent._listdir_nameinfo() + bn = self.basename + for name, info in nameinfo_seq: + if name == bn: + return info + raise py.error.ENOENT(self) + + + def _listdir_nameinfo(self): + """ return sequence of name-info directory entries of self """ + def builder(): + try: + res = self._svnwithrev('ls', '-v') + except process.cmdexec.Error: + e = sys.exc_info()[1] + if e.err.find('non-existent in that revision') != -1: + raise py.error.ENOENT(self, e.err) + elif e.err.find("E200009:") != -1: + raise py.error.ENOENT(self, e.err) + elif e.err.find('File not found') != -1: + raise py.error.ENOENT(self, e.err) + elif e.err.find('not part of a repository')!=-1: + raise py.error.ENOENT(self, e.err) + elif e.err.find('Unable to open')!=-1: + raise py.error.ENOENT(self, e.err) + elif e.err.lower().find('method not allowed')!=-1: + raise py.error.EACCES(self, e.err) + raise py.error.Error(e.err) + lines = res.split('\n') + nameinfo_seq = [] + for lsline in lines: + if lsline: + info = InfoSvnCommand(lsline) + if info._name != '.': # svn 1.5 produces '.' dirs, + nameinfo_seq.append((info._name, info)) + nameinfo_seq.sort() + return nameinfo_seq + auth = self.auth and self.auth.makecmdoptions() or None + if self.rev is not None: + return self._lsrevcache.getorbuild((self.strpath, self.rev, auth), + builder) + else: + return self._lsnorevcache.getorbuild((self.strpath, auth), + builder) + + def listdir(self, fil=None, sort=None): + """ list directory contents, possibly filter by the given fil func + and possibly sorted. + """ + if isinstance(fil, str): + fil = common.FNMatcher(fil) + nameinfo_seq = self._listdir_nameinfo() + if len(nameinfo_seq) == 1: + name, info = nameinfo_seq[0] + if name == self.basename and info.kind == 'file': + #if not self.check(dir=1): + raise py.error.ENOTDIR(self) + paths = [self.join(name) for (name, info) in nameinfo_seq] + if fil: + paths = [x for x in paths if fil(x)] + self._sortlist(paths, sort) + return paths + + + def log(self, rev_start=None, rev_end=1, verbose=False): + """ return a list of LogEntry instances for this path. +rev_start is the starting revision (defaulting to the first one). +rev_end is the last revision (defaulting to HEAD). +if verbose is True, then the LogEntry instances also know which files changed. +""" + assert self.check() #make it simpler for the pipe + rev_start = rev_start is None and "HEAD" or rev_start + rev_end = rev_end is None and "HEAD" or rev_end + + if rev_start == "HEAD" and rev_end == 1: + rev_opt = "" + else: + rev_opt = "-r %s:%s" % (rev_start, rev_end) + verbose_opt = verbose and "-v" or "" + xmlpipe = self._svnpopenauth('svn log --xml %s %s "%s"' % + (rev_opt, verbose_opt, self.strpath)) + from xml.dom import minidom + tree = minidom.parse(xmlpipe) + result = [] + for logentry in filter(None, tree.firstChild.childNodes): + if logentry.nodeType == logentry.ELEMENT_NODE: + result.append(svncommon.LogEntry(logentry)) + return result + +#01234567890123456789012345678901234567890123467 +# 2256 hpk 165 Nov 24 17:55 __init__.py +# XXX spotted by Guido, SVN 1.3.0 has different aligning, breaks the code!!! +# 1312 johnny 1627 May 05 14:32 test_decorators.py +# +class InfoSvnCommand: + # the '0?' part in the middle is an indication of whether the resource is + # locked, see 'svn help ls' + lspattern = re.compile( + r'^ *(?P\d+) +(?P.+?) +(0? *(?P\d+))? ' + r'*(?P\w+ +\d{2} +[\d:]+) +(?P.*)$') + def __init__(self, line): + # this is a typical line from 'svn ls http://...' + #_ 1127 jum 0 Jul 13 15:28 branch/ + match = self.lspattern.match(line) + data = match.groupdict() + self._name = data['file'] + if self._name[-1] == '/': + self._name = self._name[:-1] + self.kind = 'dir' + else: + self.kind = 'file' + #self.has_props = l.pop(0) == 'P' + self.created_rev = int(data['rev']) + self.last_author = data['author'] + self.size = data['size'] and int(data['size']) or 0 + self.mtime = parse_time_with_missing_year(data['date']) + self.time = self.mtime * 1000000 + + def __eq__(self, other): + return self.__dict__ == other.__dict__ + + +#____________________________________________________ +# +# helper functions +#____________________________________________________ +def parse_time_with_missing_year(timestr): + """ analyze the time part from a single line of "svn ls -v" + the svn output doesn't show the year makes the 'timestr' + ambigous. + """ + import calendar + t_now = time.gmtime() + + tparts = timestr.split() + month = time.strptime(tparts.pop(0), '%b')[1] + day = time.strptime(tparts.pop(0), '%d')[2] + last = tparts.pop(0) # year or hour:minute + try: + if ":" in last: + raise ValueError() + year = time.strptime(last, '%Y')[0] + hour = minute = 0 + except ValueError: + hour, minute = time.strptime(last, '%H:%M')[3:5] + year = t_now[0] + + t_result = (year, month, day, hour, minute, 0,0,0,0) + if t_result > t_now: + year -= 1 + t_result = (year, month, day, hour, minute, 0,0,0,0) + return calendar.timegm(t_result) + +class PathEntry: + def __init__(self, ppart): + self.strpath = ppart.firstChild.nodeValue.encode('UTF-8') + self.action = ppart.getAttribute('action').encode('UTF-8') + if self.action == 'A': + self.copyfrom_path = ppart.getAttribute('copyfrom-path').encode('UTF-8') + if self.copyfrom_path: + self.copyfrom_rev = int(ppart.getAttribute('copyfrom-rev')) + diff --git a/lib/spack/external/pytest-fallback/py/_path/svnwc.py b/lib/spack/external/pytest-fallback/py/_path/svnwc.py new file mode 100644 index 0000000000..992223c04a --- /dev/null +++ b/lib/spack/external/pytest-fallback/py/_path/svnwc.py @@ -0,0 +1,1240 @@ +""" +svn-Command based Implementation of a Subversion WorkingCopy Path. + + SvnWCCommandPath is the main class. + +""" + +import os, sys, time, re, calendar +import py +import subprocess +from py._path import common + +#----------------------------------------------------------- +# Caching latest repository revision and repo-paths +# (getting them is slow with the current implementations) +# +# XXX make mt-safe +#----------------------------------------------------------- + +class cache: + proplist = {} + info = {} + entries = {} + prop = {} + +class RepoEntry: + def __init__(self, url, rev, timestamp): + self.url = url + self.rev = rev + self.timestamp = timestamp + + def __str__(self): + return "repo: %s;%s %s" %(self.url, self.rev, self.timestamp) + +class RepoCache: + """ The Repocache manages discovered repository paths + and their revisions. If inside a timeout the cache + will even return the revision of the root. + """ + timeout = 20 # seconds after which we forget that we know the last revision + + def __init__(self): + self.repos = [] + + def clear(self): + self.repos = [] + + def put(self, url, rev, timestamp=None): + if rev is None: + return + if timestamp is None: + timestamp = time.time() + + for entry in self.repos: + if url == entry.url: + entry.timestamp = timestamp + entry.rev = rev + #print "set repo", entry + break + else: + entry = RepoEntry(url, rev, timestamp) + self.repos.append(entry) + #print "appended repo", entry + + def get(self, url): + now = time.time() + for entry in self.repos: + if url.startswith(entry.url): + if now < entry.timestamp + self.timeout: + #print "returning immediate Etrny", entry + return entry.url, entry.rev + return entry.url, -1 + return url, -1 + +repositories = RepoCache() + + +# svn support code + +ALLOWED_CHARS = "_ -/\\=$.~+%" #add characters as necessary when tested +if sys.platform == "win32": + ALLOWED_CHARS += ":" +ALLOWED_CHARS_HOST = ALLOWED_CHARS + '@:' + +def _getsvnversion(ver=[]): + try: + return ver[0] + except IndexError: + v = py.process.cmdexec("svn -q --version") + v.strip() + v = '.'.join(v.split('.')[:2]) + ver.append(v) + return v + +def _escape_helper(text): + text = str(text) + if py.std.sys.platform != 'win32': + text = str(text).replace('$', '\\$') + return text + +def _check_for_bad_chars(text, allowed_chars=ALLOWED_CHARS): + for c in str(text): + if c.isalnum(): + continue + if c in allowed_chars: + continue + return True + return False + +def checkbadchars(url): + # (hpk) not quite sure about the exact purpose, guido w.? + proto, uri = url.split("://", 1) + if proto != "file": + host, uripath = uri.split('/', 1) + # only check for bad chars in the non-protocol parts + if (_check_for_bad_chars(host, ALLOWED_CHARS_HOST) \ + or _check_for_bad_chars(uripath, ALLOWED_CHARS)): + raise ValueError("bad char in %r" % (url, )) + + +#_______________________________________________________________ + +class SvnPathBase(common.PathBase): + """ Base implementation for SvnPath implementations. """ + sep = '/' + + def _geturl(self): + return self.strpath + url = property(_geturl, None, None, "url of this svn-path.") + + def __str__(self): + """ return a string representation (including rev-number) """ + return self.strpath + + def __hash__(self): + return hash(self.strpath) + + def new(self, **kw): + """ create a modified version of this path. A 'rev' argument + indicates a new revision. + the following keyword arguments modify various path parts:: + + http://host.com/repo/path/file.ext + |-----------------------| dirname + |------| basename + |--| purebasename + |--| ext + """ + obj = object.__new__(self.__class__) + obj.rev = kw.get('rev', self.rev) + obj.auth = kw.get('auth', self.auth) + dirname, basename, purebasename, ext = self._getbyspec( + "dirname,basename,purebasename,ext") + if 'basename' in kw: + if 'purebasename' in kw or 'ext' in kw: + raise ValueError("invalid specification %r" % kw) + else: + pb = kw.setdefault('purebasename', purebasename) + ext = kw.setdefault('ext', ext) + if ext and not ext.startswith('.'): + ext = '.' + ext + kw['basename'] = pb + ext + + kw.setdefault('dirname', dirname) + kw.setdefault('sep', self.sep) + if kw['basename']: + obj.strpath = "%(dirname)s%(sep)s%(basename)s" % kw + else: + obj.strpath = "%(dirname)s" % kw + return obj + + def _getbyspec(self, spec): + """ get specified parts of the path. 'arg' is a string + with comma separated path parts. The parts are returned + in exactly the order of the specification. + + you may specify the following parts: + + http://host.com/repo/path/file.ext + |-----------------------| dirname + |------| basename + |--| purebasename + |--| ext + """ + res = [] + parts = self.strpath.split(self.sep) + for name in spec.split(','): + name = name.strip() + if name == 'dirname': + res.append(self.sep.join(parts[:-1])) + elif name == 'basename': + res.append(parts[-1]) + else: + basename = parts[-1] + i = basename.rfind('.') + if i == -1: + purebasename, ext = basename, '' + else: + purebasename, ext = basename[:i], basename[i:] + if name == 'purebasename': + res.append(purebasename) + elif name == 'ext': + res.append(ext) + else: + raise NameError("Don't know part %r" % name) + return res + + def __eq__(self, other): + """ return true if path and rev attributes each match """ + return (str(self) == str(other) and + (self.rev == other.rev or self.rev == other.rev)) + + def __ne__(self, other): + return not self == other + + def join(self, *args): + """ return a new Path (with the same revision) which is composed + of the self Path followed by 'args' path components. + """ + if not args: + return self + + args = tuple([arg.strip(self.sep) for arg in args]) + parts = (self.strpath, ) + args + newpath = self.__class__(self.sep.join(parts), self.rev, self.auth) + return newpath + + def propget(self, name): + """ return the content of the given property. """ + value = self._propget(name) + return value + + def proplist(self): + """ list all property names. """ + content = self._proplist() + return content + + def size(self): + """ Return the size of the file content of the Path. """ + return self.info().size + + def mtime(self): + """ Return the last modification time of the file. """ + return self.info().mtime + + # shared help methods + + def _escape(self, cmd): + return _escape_helper(cmd) + + + #def _childmaxrev(self): + # """ return maximum revision number of childs (or self.rev if no childs) """ + # rev = self.rev + # for name, info in self._listdir_nameinfo(): + # rev = max(rev, info.created_rev) + # return rev + + #def _getlatestrevision(self): + # """ return latest repo-revision for this path. """ + # url = self.strpath + # path = self.__class__(url, None) + # + # # we need a long walk to find the root-repo and revision + # while 1: + # try: + # rev = max(rev, path._childmaxrev()) + # previous = path + # path = path.dirpath() + # except (IOError, process.cmdexec.Error): + # break + # if rev is None: + # raise IOError, "could not determine newest repo revision for %s" % self + # return rev + + class Checkers(common.Checkers): + def dir(self): + try: + return self.path.info().kind == 'dir' + except py.error.Error: + return self._listdirworks() + + def _listdirworks(self): + try: + self.path.listdir() + except py.error.ENOENT: + return False + else: + return True + + def file(self): + try: + return self.path.info().kind == 'file' + except py.error.ENOENT: + return False + + def exists(self): + try: + return self.path.info() + except py.error.ENOENT: + return self._listdirworks() + +def parse_apr_time(timestr): + i = timestr.rfind('.') + if i == -1: + raise ValueError("could not parse %s" % timestr) + timestr = timestr[:i] + parsedtime = time.strptime(timestr, "%Y-%m-%dT%H:%M:%S") + return time.mktime(parsedtime) + +class PropListDict(dict): + """ a Dictionary which fetches values (InfoSvnCommand instances) lazily""" + def __init__(self, path, keynames): + dict.__init__(self, [(x, None) for x in keynames]) + self.path = path + + def __getitem__(self, key): + value = dict.__getitem__(self, key) + if value is None: + value = self.path.propget(key) + dict.__setitem__(self, key, value) + return value + +def fixlocale(): + if sys.platform != 'win32': + return 'LC_ALL=C ' + return '' + +# some nasty chunk of code to solve path and url conversion and quoting issues +ILLEGAL_CHARS = '* | \\ / : < > ? \t \n \x0b \x0c \r'.split(' ') +if os.sep in ILLEGAL_CHARS: + ILLEGAL_CHARS.remove(os.sep) +ISWINDOWS = sys.platform == 'win32' +_reg_allow_disk = re.compile(r'^([a-z]\:\\)?[^:]+$', re.I) +def _check_path(path): + illegal = ILLEGAL_CHARS[:] + sp = path.strpath + if ISWINDOWS: + illegal.remove(':') + if not _reg_allow_disk.match(sp): + raise ValueError('path may not contain a colon (:)') + for char in sp: + if char not in string.printable or char in illegal: + raise ValueError('illegal character %r in path' % (char,)) + +def path_to_fspath(path, addat=True): + _check_path(path) + sp = path.strpath + if addat and path.rev != -1: + sp = '%s@%s' % (sp, path.rev) + elif addat: + sp = '%s@HEAD' % (sp,) + return sp + +def url_from_path(path): + fspath = path_to_fspath(path, False) + quote = py.std.urllib.quote + if ISWINDOWS: + match = _reg_allow_disk.match(fspath) + fspath = fspath.replace('\\', '/') + if match.group(1): + fspath = '/%s%s' % (match.group(1).replace('\\', '/'), + quote(fspath[len(match.group(1)):])) + else: + fspath = quote(fspath) + else: + fspath = quote(fspath) + if path.rev != -1: + fspath = '%s@%s' % (fspath, path.rev) + else: + fspath = '%s@HEAD' % (fspath,) + return 'file://%s' % (fspath,) + +class SvnAuth(object): + """ container for auth information for Subversion """ + def __init__(self, username, password, cache_auth=True, interactive=True): + self.username = username + self.password = password + self.cache_auth = cache_auth + self.interactive = interactive + + def makecmdoptions(self): + uname = self.username.replace('"', '\\"') + passwd = self.password.replace('"', '\\"') + ret = [] + if uname: + ret.append('--username="%s"' % (uname,)) + if passwd: + ret.append('--password="%s"' % (passwd,)) + if not self.cache_auth: + ret.append('--no-auth-cache') + if not self.interactive: + ret.append('--non-interactive') + return ' '.join(ret) + + def __str__(self): + return "" %(self.username,) + +rex_blame = re.compile(r'\s*(\d+)\s*(\S+) (.*)') + +class SvnWCCommandPath(common.PathBase): + """ path implementation offering access/modification to svn working copies. + It has methods similar to the functions in os.path and similar to the + commands of the svn client. + """ + sep = os.sep + + def __new__(cls, wcpath=None, auth=None): + self = object.__new__(cls) + if isinstance(wcpath, cls): + if wcpath.__class__ == cls: + return wcpath + wcpath = wcpath.localpath + if _check_for_bad_chars(str(wcpath), + ALLOWED_CHARS): + raise ValueError("bad char in wcpath %s" % (wcpath, )) + self.localpath = py.path.local(wcpath) + self.auth = auth + return self + + strpath = property(lambda x: str(x.localpath), None, None, "string path") + rev = property(lambda x: x.info(usecache=0).rev, None, None, "revision") + + def __eq__(self, other): + return self.localpath == getattr(other, 'localpath', None) + + def _geturl(self): + if getattr(self, '_url', None) is None: + info = self.info() + self._url = info.url #SvnPath(info.url, info.rev) + assert isinstance(self._url, py.builtin._basestring) + return self._url + + url = property(_geturl, None, None, "url of this WC item") + + def _escape(self, cmd): + return _escape_helper(cmd) + + def dump(self, obj): + """ pickle object into path location""" + return self.localpath.dump(obj) + + def svnurl(self): + """ return current SvnPath for this WC-item. """ + info = self.info() + return py.path.svnurl(info.url) + + def __repr__(self): + return "svnwc(%r)" % (self.strpath) # , self._url) + + def __str__(self): + return str(self.localpath) + + def _makeauthoptions(self): + if self.auth is None: + return '' + return self.auth.makecmdoptions() + + def _authsvn(self, cmd, args=None): + args = args and list(args) or [] + args.append(self._makeauthoptions()) + return self._svn(cmd, *args) + + def _svn(self, cmd, *args): + l = ['svn %s' % cmd] + args = [self._escape(item) for item in args] + l.extend(args) + l.append('"%s"' % self._escape(self.strpath)) + # try fixing the locale because we can't otherwise parse + string = fixlocale() + " ".join(l) + try: + try: + key = 'LC_MESSAGES' + hold = os.environ.get(key) + os.environ[key] = 'C' + out = py.process.cmdexec(string) + finally: + if hold: + os.environ[key] = hold + else: + del os.environ[key] + except py.process.cmdexec.Error: + e = sys.exc_info()[1] + strerr = e.err.lower() + if strerr.find('not found') != -1: + raise py.error.ENOENT(self) + elif strerr.find("E200009:") != -1: + raise py.error.ENOENT(self) + if (strerr.find('file exists') != -1 or + strerr.find('file already exists') != -1 or + strerr.find('w150002:') != -1 or + strerr.find("can't create directory") != -1): + raise py.error.EEXIST(strerr) #self) + raise + return out + + def switch(self, url): + """ switch to given URL. """ + self._authsvn('switch', [url]) + + def checkout(self, url=None, rev=None): + """ checkout from url to local wcpath. """ + args = [] + if url is None: + url = self.url + if rev is None or rev == -1: + if (py.std.sys.platform != 'win32' and + _getsvnversion() == '1.3'): + url += "@HEAD" + else: + if _getsvnversion() == '1.3': + url += "@%d" % rev + else: + args.append('-r' + str(rev)) + args.append(url) + self._authsvn('co', args) + + def update(self, rev='HEAD', interactive=True): + """ update working copy item to given revision. (None -> HEAD). """ + opts = ['-r', rev] + if not interactive: + opts.append("--non-interactive") + self._authsvn('up', opts) + + def write(self, content, mode='w'): + """ write content into local filesystem wc. """ + self.localpath.write(content, mode) + + def dirpath(self, *args): + """ return the directory Path of the current Path. """ + return self.__class__(self.localpath.dirpath(*args), auth=self.auth) + + def _ensuredirs(self): + parent = self.dirpath() + if parent.check(dir=0): + parent._ensuredirs() + if self.check(dir=0): + self.mkdir() + return self + + def ensure(self, *args, **kwargs): + """ ensure that an args-joined path exists (by default as + a file). if you specify a keyword argument 'directory=True' + then the path is forced to be a directory path. + """ + p = self.join(*args) + if p.check(): + if p.check(versioned=False): + p.add() + return p + if kwargs.get('dir', 0): + return p._ensuredirs() + parent = p.dirpath() + parent._ensuredirs() + p.write("") + p.add() + return p + + def mkdir(self, *args): + """ create & return the directory joined with args. """ + if args: + return self.join(*args).mkdir() + else: + self._svn('mkdir') + return self + + def add(self): + """ add ourself to svn """ + self._svn('add') + + def remove(self, rec=1, force=1): + """ remove a file or a directory tree. 'rec'ursive is + ignored and considered always true (because of + underlying svn semantics. + """ + assert rec, "svn cannot remove non-recursively" + if not self.check(versioned=True): + # not added to svn (anymore?), just remove + py.path.local(self).remove() + return + flags = [] + if force: + flags.append('--force') + self._svn('remove', *flags) + + def copy(self, target): + """ copy path to target.""" + py.process.cmdexec("svn copy %s %s" %(str(self), str(target))) + + def rename(self, target): + """ rename this path to target. """ + py.process.cmdexec("svn move --force %s %s" %(str(self), str(target))) + + def lock(self): + """ set a lock (exclusive) on the resource """ + out = self._authsvn('lock').strip() + if not out: + # warning or error, raise exception + raise ValueError("unknown error in svn lock command") + + def unlock(self): + """ unset a previously set lock """ + out = self._authsvn('unlock').strip() + if out.startswith('svn:'): + # warning or error, raise exception + raise Exception(out[4:]) + + def cleanup(self): + """ remove any locks from the resource """ + # XXX should be fixed properly!!! + try: + self.unlock() + except: + pass + + def status(self, updates=0, rec=0, externals=0): + """ return (collective) Status object for this file. """ + # http://svnbook.red-bean.com/book.html#svn-ch-3-sect-4.3.1 + # 2201 2192 jum test + # XXX + if externals: + raise ValueError("XXX cannot perform status() " + "on external items yet") + else: + #1.2 supports: externals = '--ignore-externals' + externals = '' + if rec: + rec= '' + else: + rec = '--non-recursive' + + # XXX does not work on all subversion versions + #if not externals: + # externals = '--ignore-externals' + + if updates: + updates = '-u' + else: + updates = '' + + try: + cmd = 'status -v --xml --no-ignore %s %s %s' % ( + updates, rec, externals) + out = self._authsvn(cmd) + except py.process.cmdexec.Error: + cmd = 'status -v --no-ignore %s %s %s' % ( + updates, rec, externals) + out = self._authsvn(cmd) + rootstatus = WCStatus(self).fromstring(out, self) + else: + rootstatus = XMLWCStatus(self).fromstring(out, self) + return rootstatus + + def diff(self, rev=None): + """ return a diff of the current path against revision rev (defaulting + to the last one). + """ + args = [] + if rev is not None: + args.append("-r %d" % rev) + out = self._authsvn('diff', args) + return out + + def blame(self): + """ return a list of tuples of three elements: + (revision, commiter, line) + """ + out = self._svn('blame') + result = [] + blamelines = out.splitlines() + reallines = py.path.svnurl(self.url).readlines() + for i, (blameline, line) in enumerate( + zip(blamelines, reallines)): + m = rex_blame.match(blameline) + if not m: + raise ValueError("output line %r of svn blame does not match " + "expected format" % (line, )) + rev, name, _ = m.groups() + result.append((int(rev), name, line)) + return result + + _rex_commit = re.compile(r'.*Committed revision (\d+)\.$', re.DOTALL) + def commit(self, msg='', rec=1): + """ commit with support for non-recursive commits """ + # XXX i guess escaping should be done better here?!? + cmd = 'commit -m "%s" --force-log' % (msg.replace('"', '\\"'),) + if not rec: + cmd += ' -N' + out = self._authsvn(cmd) + try: + del cache.info[self] + except KeyError: + pass + if out: + m = self._rex_commit.match(out) + return int(m.group(1)) + + def propset(self, name, value, *args): + """ set property name to value on this path. """ + d = py.path.local.mkdtemp() + try: + p = d.join('value') + p.write(value) + self._svn('propset', name, '--file', str(p), *args) + finally: + d.remove() + + def propget(self, name): + """ get property name on this path. """ + res = self._svn('propget', name) + return res[:-1] # strip trailing newline + + def propdel(self, name): + """ delete property name on this path. """ + res = self._svn('propdel', name) + return res[:-1] # strip trailing newline + + def proplist(self, rec=0): + """ return a mapping of property names to property values. +If rec is True, then return a dictionary mapping sub-paths to such mappings. +""" + if rec: + res = self._svn('proplist -R') + return make_recursive_propdict(self, res) + else: + res = self._svn('proplist') + lines = res.split('\n') + lines = [x.strip() for x in lines[1:]] + return PropListDict(self, lines) + + def revert(self, rec=0): + """ revert the local changes of this path. if rec is True, do so +recursively. """ + if rec: + result = self._svn('revert -R') + else: + result = self._svn('revert') + return result + + def new(self, **kw): + """ create a modified version of this path. A 'rev' argument + indicates a new revision. + the following keyword arguments modify various path parts: + + http://host.com/repo/path/file.ext + |-----------------------| dirname + |------| basename + |--| purebasename + |--| ext + """ + if kw: + localpath = self.localpath.new(**kw) + else: + localpath = self.localpath + return self.__class__(localpath, auth=self.auth) + + def join(self, *args, **kwargs): + """ return a new Path (with the same revision) which is composed + of the self Path followed by 'args' path components. + """ + if not args: + return self + localpath = self.localpath.join(*args, **kwargs) + return self.__class__(localpath, auth=self.auth) + + def info(self, usecache=1): + """ return an Info structure with svn-provided information. """ + info = usecache and cache.info.get(self) + if not info: + try: + output = self._svn('info') + except py.process.cmdexec.Error: + e = sys.exc_info()[1] + if e.err.find('Path is not a working copy directory') != -1: + raise py.error.ENOENT(self, e.err) + elif e.err.find("is not under version control") != -1: + raise py.error.ENOENT(self, e.err) + raise + # XXX SVN 1.3 has output on stderr instead of stdout (while it does + # return 0!), so a bit nasty, but we assume no output is output + # to stderr... + if (output.strip() == '' or + output.lower().find('not a versioned resource') != -1): + raise py.error.ENOENT(self, output) + info = InfoSvnWCCommand(output) + + # Can't reliably compare on Windows without access to win32api + if py.std.sys.platform != 'win32': + if info.path != self.localpath: + raise py.error.ENOENT(self, "not a versioned resource:" + + " %s != %s" % (info.path, self.localpath)) + cache.info[self] = info + return info + + def listdir(self, fil=None, sort=None): + """ return a sequence of Paths. + + listdir will return either a tuple or a list of paths + depending on implementation choices. + """ + if isinstance(fil, str): + fil = common.FNMatcher(fil) + # XXX unify argument naming with LocalPath.listdir + def notsvn(path): + return path.basename != '.svn' + + paths = [] + for localpath in self.localpath.listdir(notsvn): + p = self.__class__(localpath, auth=self.auth) + if notsvn(p) and (not fil or fil(p)): + paths.append(p) + self._sortlist(paths, sort) + return paths + + def open(self, mode='r'): + """ return an opened file with the given mode. """ + return open(self.strpath, mode) + + def _getbyspec(self, spec): + return self.localpath._getbyspec(spec) + + class Checkers(py.path.local.Checkers): + def __init__(self, path): + self.svnwcpath = path + self.path = path.localpath + def versioned(self): + try: + s = self.svnwcpath.info() + except (py.error.ENOENT, py.error.EEXIST): + return False + except py.process.cmdexec.Error: + e = sys.exc_info()[1] + if e.err.find('is not a working copy')!=-1: + return False + if e.err.lower().find('not a versioned resource') != -1: + return False + raise + else: + return True + + def log(self, rev_start=None, rev_end=1, verbose=False): + """ return a list of LogEntry instances for this path. +rev_start is the starting revision (defaulting to the first one). +rev_end is the last revision (defaulting to HEAD). +if verbose is True, then the LogEntry instances also know which files changed. +""" + assert self.check() # make it simpler for the pipe + rev_start = rev_start is None and "HEAD" or rev_start + rev_end = rev_end is None and "HEAD" or rev_end + if rev_start == "HEAD" and rev_end == 1: + rev_opt = "" + else: + rev_opt = "-r %s:%s" % (rev_start, rev_end) + verbose_opt = verbose and "-v" or "" + locale_env = fixlocale() + # some blather on stderr + auth_opt = self._makeauthoptions() + #stdin, stdout, stderr = os.popen3(locale_env + + # 'svn log --xml %s %s %s "%s"' % ( + # rev_opt, verbose_opt, auth_opt, + # self.strpath)) + cmd = locale_env + 'svn log --xml %s %s %s "%s"' % ( + rev_opt, verbose_opt, auth_opt, self.strpath) + + popen = subprocess.Popen(cmd, + stdout=subprocess.PIPE, + stderr=subprocess.PIPE, + shell=True, + ) + stdout, stderr = popen.communicate() + stdout = py.builtin._totext(stdout, sys.getdefaultencoding()) + minidom,ExpatError = importxml() + try: + tree = minidom.parseString(stdout) + except ExpatError: + raise ValueError('no such revision') + result = [] + for logentry in filter(None, tree.firstChild.childNodes): + if logentry.nodeType == logentry.ELEMENT_NODE: + result.append(LogEntry(logentry)) + return result + + def size(self): + """ Return the size of the file content of the Path. """ + return self.info().size + + def mtime(self): + """ Return the last modification time of the file. """ + return self.info().mtime + + def __hash__(self): + return hash((self.strpath, self.__class__, self.auth)) + + +class WCStatus: + attrnames = ('modified','added', 'conflict', 'unchanged', 'external', + 'deleted', 'prop_modified', 'unknown', 'update_available', + 'incomplete', 'kindmismatch', 'ignored', 'locked', 'replaced' + ) + + def __init__(self, wcpath, rev=None, modrev=None, author=None): + self.wcpath = wcpath + self.rev = rev + self.modrev = modrev + self.author = author + + for name in self.attrnames: + setattr(self, name, []) + + def allpath(self, sort=True, **kw): + d = {} + for name in self.attrnames: + if name not in kw or kw[name]: + for path in getattr(self, name): + d[path] = 1 + l = d.keys() + if sort: + l.sort() + return l + + # XXX a bit scary to assume there's always 2 spaces between username and + # path, however with win32 allowing spaces in user names there doesn't + # seem to be a more solid approach :( + _rex_status = re.compile(r'\s+(\d+|-)\s+(\S+)\s+(.+?)\s{2,}(.*)') + + def fromstring(data, rootwcpath, rev=None, modrev=None, author=None): + """ return a new WCStatus object from data 's' + """ + rootstatus = WCStatus(rootwcpath, rev, modrev, author) + update_rev = None + for line in data.split('\n'): + if not line.strip(): + continue + #print "processing %r" % line + flags, rest = line[:8], line[8:] + # first column + c0,c1,c2,c3,c4,c5,x6,c7 = flags + #if '*' in line: + # print "flags", repr(flags), "rest", repr(rest) + + if c0 in '?XI': + fn = line.split(None, 1)[1] + if c0 == '?': + wcpath = rootwcpath.join(fn, abs=1) + rootstatus.unknown.append(wcpath) + elif c0 == 'X': + wcpath = rootwcpath.__class__( + rootwcpath.localpath.join(fn, abs=1), + auth=rootwcpath.auth) + rootstatus.external.append(wcpath) + elif c0 == 'I': + wcpath = rootwcpath.join(fn, abs=1) + rootstatus.ignored.append(wcpath) + + continue + + #elif c0 in '~!' or c4 == 'S': + # raise NotImplementedError("received flag %r" % c0) + + m = WCStatus._rex_status.match(rest) + if not m: + if c7 == '*': + fn = rest.strip() + wcpath = rootwcpath.join(fn, abs=1) + rootstatus.update_available.append(wcpath) + continue + if line.lower().find('against revision:')!=-1: + update_rev = int(rest.split(':')[1].strip()) + continue + if line.lower().find('status on external') > -1: + # XXX not sure what to do here... perhaps we want to + # store some state instead of just continuing, as right + # now it makes the top-level external get added twice + # (once as external, once as 'normal' unchanged item) + # because of the way SVN presents external items + continue + # keep trying + raise ValueError("could not parse line %r" % line) + else: + rev, modrev, author, fn = m.groups() + wcpath = rootwcpath.join(fn, abs=1) + #assert wcpath.check() + if c0 == 'M': + assert wcpath.check(file=1), "didn't expect a directory with changed content here" + rootstatus.modified.append(wcpath) + elif c0 == 'A' or c3 == '+' : + rootstatus.added.append(wcpath) + elif c0 == 'D': + rootstatus.deleted.append(wcpath) + elif c0 == 'C': + rootstatus.conflict.append(wcpath) + elif c0 == '~': + rootstatus.kindmismatch.append(wcpath) + elif c0 == '!': + rootstatus.incomplete.append(wcpath) + elif c0 == 'R': + rootstatus.replaced.append(wcpath) + elif not c0.strip(): + rootstatus.unchanged.append(wcpath) + else: + raise NotImplementedError("received flag %r" % c0) + + if c1 == 'M': + rootstatus.prop_modified.append(wcpath) + # XXX do we cover all client versions here? + if c2 == 'L' or c5 == 'K': + rootstatus.locked.append(wcpath) + if c7 == '*': + rootstatus.update_available.append(wcpath) + + if wcpath == rootwcpath: + rootstatus.rev = rev + rootstatus.modrev = modrev + rootstatus.author = author + if update_rev: + rootstatus.update_rev = update_rev + continue + return rootstatus + fromstring = staticmethod(fromstring) + +class XMLWCStatus(WCStatus): + def fromstring(data, rootwcpath, rev=None, modrev=None, author=None): + """ parse 'data' (XML string as outputted by svn st) into a status obj + """ + # XXX for externals, the path is shown twice: once + # with external information, and once with full info as if + # the item was a normal non-external... the current way of + # dealing with this issue is by ignoring it - this does make + # externals appear as external items as well as 'normal', + # unchanged ones in the status object so this is far from ideal + rootstatus = WCStatus(rootwcpath, rev, modrev, author) + update_rev = None + minidom, ExpatError = importxml() + try: + doc = minidom.parseString(data) + except ExpatError: + e = sys.exc_info()[1] + raise ValueError(str(e)) + urevels = doc.getElementsByTagName('against') + if urevels: + rootstatus.update_rev = urevels[-1].getAttribute('revision') + for entryel in doc.getElementsByTagName('entry'): + path = entryel.getAttribute('path') + statusel = entryel.getElementsByTagName('wc-status')[0] + itemstatus = statusel.getAttribute('item') + + if itemstatus == 'unversioned': + wcpath = rootwcpath.join(path, abs=1) + rootstatus.unknown.append(wcpath) + continue + elif itemstatus == 'external': + wcpath = rootwcpath.__class__( + rootwcpath.localpath.join(path, abs=1), + auth=rootwcpath.auth) + rootstatus.external.append(wcpath) + continue + elif itemstatus == 'ignored': + wcpath = rootwcpath.join(path, abs=1) + rootstatus.ignored.append(wcpath) + continue + elif itemstatus == 'incomplete': + wcpath = rootwcpath.join(path, abs=1) + rootstatus.incomplete.append(wcpath) + continue + + rev = statusel.getAttribute('revision') + if itemstatus == 'added' or itemstatus == 'none': + rev = '0' + modrev = '?' + author = '?' + date = '' + elif itemstatus == "replaced": + pass + else: + #print entryel.toxml() + commitel = entryel.getElementsByTagName('commit')[0] + if commitel: + modrev = commitel.getAttribute('revision') + author = '' + author_els = commitel.getElementsByTagName('author') + if author_els: + for c in author_els[0].childNodes: + author += c.nodeValue + date = '' + for c in commitel.getElementsByTagName('date')[0]\ + .childNodes: + date += c.nodeValue + + wcpath = rootwcpath.join(path, abs=1) + + assert itemstatus != 'modified' or wcpath.check(file=1), ( + 'did\'t expect a directory with changed content here') + + itemattrname = { + 'normal': 'unchanged', + 'unversioned': 'unknown', + 'conflicted': 'conflict', + 'none': 'added', + }.get(itemstatus, itemstatus) + + attr = getattr(rootstatus, itemattrname) + attr.append(wcpath) + + propsstatus = statusel.getAttribute('props') + if propsstatus not in ('none', 'normal'): + rootstatus.prop_modified.append(wcpath) + + if wcpath == rootwcpath: + rootstatus.rev = rev + rootstatus.modrev = modrev + rootstatus.author = author + rootstatus.date = date + + # handle repos-status element (remote info) + rstatusels = entryel.getElementsByTagName('repos-status') + if rstatusels: + rstatusel = rstatusels[0] + ritemstatus = rstatusel.getAttribute('item') + if ritemstatus in ('added', 'modified'): + rootstatus.update_available.append(wcpath) + + lockels = entryel.getElementsByTagName('lock') + if len(lockels): + rootstatus.locked.append(wcpath) + + return rootstatus + fromstring = staticmethod(fromstring) + +class InfoSvnWCCommand: + def __init__(self, output): + # Path: test + # URL: http://codespeak.net/svn/std.path/trunk/dist/std.path/test + # Repository UUID: fd0d7bf2-dfb6-0310-8d31-b7ecfe96aada + # Revision: 2151 + # Node Kind: directory + # Schedule: normal + # Last Changed Author: hpk + # Last Changed Rev: 2100 + # Last Changed Date: 2003-10-27 20:43:14 +0100 (Mon, 27 Oct 2003) + # Properties Last Updated: 2003-11-03 14:47:48 +0100 (Mon, 03 Nov 2003) + + d = {} + for line in output.split('\n'): + if not line.strip(): + continue + key, value = line.split(':', 1) + key = key.lower().replace(' ', '') + value = value.strip() + d[key] = value + try: + self.url = d['url'] + except KeyError: + raise ValueError("Not a versioned resource") + #raise ValueError, "Not a versioned resource %r" % path + self.kind = d['nodekind'] == 'directory' and 'dir' or d['nodekind'] + try: + self.rev = int(d['revision']) + except KeyError: + self.rev = None + + self.path = py.path.local(d['path']) + self.size = self.path.size() + if 'lastchangedrev' in d: + self.created_rev = int(d['lastchangedrev']) + if 'lastchangedauthor' in d: + self.last_author = d['lastchangedauthor'] + if 'lastchangeddate' in d: + self.mtime = parse_wcinfotime(d['lastchangeddate']) + self.time = self.mtime * 1000000 + + def __eq__(self, other): + return self.__dict__ == other.__dict__ + +def parse_wcinfotime(timestr): + """ Returns seconds since epoch, UTC. """ + # example: 2003-10-27 20:43:14 +0100 (Mon, 27 Oct 2003) + m = re.match(r'(\d+-\d+-\d+ \d+:\d+:\d+) ([+-]\d+) .*', timestr) + if not m: + raise ValueError("timestring %r does not match" % timestr) + timestr, timezone = m.groups() + # do not handle timezone specially, return value should be UTC + parsedtime = time.strptime(timestr, "%Y-%m-%d %H:%M:%S") + return calendar.timegm(parsedtime) + +def make_recursive_propdict(wcroot, + output, + rex = re.compile("Properties on '(.*)':")): + """ Return a dictionary of path->PropListDict mappings. """ + lines = [x for x in output.split('\n') if x] + pdict = {} + while lines: + line = lines.pop(0) + m = rex.match(line) + if not m: + raise ValueError("could not parse propget-line: %r" % line) + path = m.groups()[0] + wcpath = wcroot.join(path, abs=1) + propnames = [] + while lines and lines[0].startswith(' '): + propname = lines.pop(0).strip() + propnames.append(propname) + assert propnames, "must have found properties!" + pdict[wcpath] = PropListDict(wcpath, propnames) + return pdict + + +def importxml(cache=[]): + if cache: + return cache + from xml.dom import minidom + from xml.parsers.expat import ExpatError + cache.extend([minidom, ExpatError]) + return cache + +class LogEntry: + def __init__(self, logentry): + self.rev = int(logentry.getAttribute('revision')) + for lpart in filter(None, logentry.childNodes): + if lpart.nodeType == lpart.ELEMENT_NODE: + if lpart.nodeName == 'author': + self.author = lpart.firstChild.nodeValue + elif lpart.nodeName == 'msg': + if lpart.firstChild: + self.msg = lpart.firstChild.nodeValue + else: + self.msg = '' + elif lpart.nodeName == 'date': + #2003-07-29T20:05:11.598637Z + timestr = lpart.firstChild.nodeValue + self.date = parse_apr_time(timestr) + elif lpart.nodeName == 'paths': + self.strpaths = [] + for ppart in filter(None, lpart.childNodes): + if ppart.nodeType == ppart.ELEMENT_NODE: + self.strpaths.append(PathEntry(ppart)) + def __repr__(self): + return '' % ( + self.rev, self.author, self.date) + + diff --git a/lib/spack/external/pytest-fallback/py/_process/__init__.py b/lib/spack/external/pytest-fallback/py/_process/__init__.py new file mode 100644 index 0000000000..86c714ad1a --- /dev/null +++ b/lib/spack/external/pytest-fallback/py/_process/__init__.py @@ -0,0 +1 @@ +""" high-level sub-process handling """ diff --git a/lib/spack/external/pytest-fallback/py/_process/cmdexec.py b/lib/spack/external/pytest-fallback/py/_process/cmdexec.py new file mode 100644 index 0000000000..f83a249402 --- /dev/null +++ b/lib/spack/external/pytest-fallback/py/_process/cmdexec.py @@ -0,0 +1,49 @@ +import sys +import subprocess +import py +from subprocess import Popen, PIPE + +def cmdexec(cmd): + """ return unicode output of executing 'cmd' in a separate process. + + raise cmdexec.Error exeception if the command failed. + the exception will provide an 'err' attribute containing + the error-output from the command. + if the subprocess module does not provide a proper encoding/unicode strings + sys.getdefaultencoding() will be used, if that does not exist, 'UTF-8'. + """ + process = subprocess.Popen(cmd, shell=True, + universal_newlines=True, + stdout=subprocess.PIPE, stderr=subprocess.PIPE) + out, err = process.communicate() + if sys.version_info[0] < 3: # on py3 we get unicode strings, on py2 not + try: + default_encoding = sys.getdefaultencoding() # jython may not have it + except AttributeError: + default_encoding = sys.stdout.encoding or 'UTF-8' + out = unicode(out, process.stdout.encoding or default_encoding) + err = unicode(err, process.stderr.encoding or default_encoding) + status = process.poll() + if status: + raise ExecutionFailed(status, status, cmd, out, err) + return out + +class ExecutionFailed(py.error.Error): + def __init__(self, status, systemstatus, cmd, out, err): + Exception.__init__(self) + self.status = status + self.systemstatus = systemstatus + self.cmd = cmd + self.err = err + self.out = out + + def __str__(self): + return "ExecutionFailed: %d %s\n%s" %(self.status, self.cmd, self.err) + +# export the exception under the name 'py.process.cmdexec.Error' +cmdexec.Error = ExecutionFailed +try: + ExecutionFailed.__module__ = 'py.process.cmdexec' + ExecutionFailed.__name__ = 'Error' +except (AttributeError, TypeError): + pass diff --git a/lib/spack/external/pytest-fallback/py/_process/forkedfunc.py b/lib/spack/external/pytest-fallback/py/_process/forkedfunc.py new file mode 100644 index 0000000000..1c28530688 --- /dev/null +++ b/lib/spack/external/pytest-fallback/py/_process/forkedfunc.py @@ -0,0 +1,120 @@ + +""" + ForkedFunc provides a way to run a function in a forked process + and get at its return value, stdout and stderr output as well + as signals and exitstatusus. +""" + +import py +import os +import sys +import marshal + + +def get_unbuffered_io(fd, filename): + f = open(str(filename), "w") + if fd != f.fileno(): + os.dup2(f.fileno(), fd) + class AutoFlush: + def write(self, data): + f.write(data) + f.flush() + def __getattr__(self, name): + return getattr(f, name) + return AutoFlush() + + +class ForkedFunc: + EXITSTATUS_EXCEPTION = 3 + + + def __init__(self, fun, args=None, kwargs=None, nice_level=0, + child_on_start=None, child_on_exit=None): + if args is None: + args = [] + if kwargs is None: + kwargs = {} + self.fun = fun + self.args = args + self.kwargs = kwargs + self.tempdir = tempdir = py.path.local.mkdtemp() + self.RETVAL = tempdir.ensure('retval') + self.STDOUT = tempdir.ensure('stdout') + self.STDERR = tempdir.ensure('stderr') + + pid = os.fork() + if pid: # in parent process + self.pid = pid + else: # in child process + self.pid = None + self._child(nice_level, child_on_start, child_on_exit) + + def _child(self, nice_level, child_on_start, child_on_exit): + # right now we need to call a function, but first we need to + # map all IO that might happen + sys.stdout = stdout = get_unbuffered_io(1, self.STDOUT) + sys.stderr = stderr = get_unbuffered_io(2, self.STDERR) + retvalf = self.RETVAL.open("wb") + EXITSTATUS = 0 + try: + if nice_level: + os.nice(nice_level) + try: + if child_on_start is not None: + child_on_start() + retval = self.fun(*self.args, **self.kwargs) + retvalf.write(marshal.dumps(retval)) + if child_on_exit is not None: + child_on_exit() + except: + excinfo = py.code.ExceptionInfo() + stderr.write(str(excinfo._getreprcrash())) + EXITSTATUS = self.EXITSTATUS_EXCEPTION + finally: + stdout.close() + stderr.close() + retvalf.close() + os.close(1) + os.close(2) + os._exit(EXITSTATUS) + + def waitfinish(self, waiter=os.waitpid): + pid, systemstatus = waiter(self.pid, 0) + if systemstatus: + if os.WIFSIGNALED(systemstatus): + exitstatus = os.WTERMSIG(systemstatus) + 128 + else: + exitstatus = os.WEXITSTATUS(systemstatus) + else: + exitstatus = 0 + signal = systemstatus & 0x7f + if not exitstatus and not signal: + retval = self.RETVAL.open('rb') + try: + retval_data = retval.read() + finally: + retval.close() + retval = marshal.loads(retval_data) + else: + retval = None + stdout = self.STDOUT.read() + stderr = self.STDERR.read() + self._removetemp() + return Result(exitstatus, signal, retval, stdout, stderr) + + def _removetemp(self): + if self.tempdir.check(): + self.tempdir.remove() + + def __del__(self): + if self.pid is not None: # only clean up in main process + self._removetemp() + + +class Result(object): + def __init__(self, exitstatus, signal, retval, stdout, stderr): + self.exitstatus = exitstatus + self.signal = signal + self.retval = retval + self.out = stdout + self.err = stderr diff --git a/lib/spack/external/pytest-fallback/py/_process/killproc.py b/lib/spack/external/pytest-fallback/py/_process/killproc.py new file mode 100644 index 0000000000..18e8310b5f --- /dev/null +++ b/lib/spack/external/pytest-fallback/py/_process/killproc.py @@ -0,0 +1,23 @@ +import py +import os, sys + +if sys.platform == "win32" or getattr(os, '_name', '') == 'nt': + try: + import ctypes + except ImportError: + def dokill(pid): + py.process.cmdexec("taskkill /F /PID %d" %(pid,)) + else: + def dokill(pid): + PROCESS_TERMINATE = 1 + handle = ctypes.windll.kernel32.OpenProcess( + PROCESS_TERMINATE, False, pid) + ctypes.windll.kernel32.TerminateProcess(handle, -1) + ctypes.windll.kernel32.CloseHandle(handle) +else: + def dokill(pid): + os.kill(pid, 15) + +def kill(pid): + """ kill process by id. """ + dokill(pid) diff --git a/lib/spack/external/pytest-fallback/py/_std.py b/lib/spack/external/pytest-fallback/py/_std.py new file mode 100644 index 0000000000..97a9853323 --- /dev/null +++ b/lib/spack/external/pytest-fallback/py/_std.py @@ -0,0 +1,18 @@ +import sys + +class Std(object): + """ makes top-level python modules available as an attribute, + importing them on first access. + """ + + def __init__(self): + self.__dict__ = sys.modules + + def __getattr__(self, name): + try: + m = __import__(name) + except ImportError: + raise AttributeError("py.std: could not import %s" % name) + return m + +std = Std() diff --git a/lib/spack/external/pytest-fallback/py/_xmlgen.py b/lib/spack/external/pytest-fallback/py/_xmlgen.py new file mode 100644 index 0000000000..1c83545884 --- /dev/null +++ b/lib/spack/external/pytest-fallback/py/_xmlgen.py @@ -0,0 +1,255 @@ +""" +module for generating and serializing xml and html structures +by using simple python objects. + +(c) holger krekel, holger at merlinux eu. 2009 +""" +import sys, re + +if sys.version_info >= (3,0): + def u(s): + return s + def unicode(x, errors=None): + if hasattr(x, '__unicode__'): + return x.__unicode__() + return str(x) +else: + def u(s): + return unicode(s) + unicode = unicode + + +class NamespaceMetaclass(type): + def __getattr__(self, name): + if name[:1] == '_': + raise AttributeError(name) + if self == Namespace: + raise ValueError("Namespace class is abstract") + tagspec = self.__tagspec__ + if tagspec is not None and name not in tagspec: + raise AttributeError(name) + classattr = {} + if self.__stickyname__: + classattr['xmlname'] = name + cls = type(name, (self.__tagclass__,), classattr) + setattr(self, name, cls) + return cls + +class Tag(list): + class Attr(object): + def __init__(self, **kwargs): + self.__dict__.update(kwargs) + + def __init__(self, *args, **kwargs): + super(Tag, self).__init__(args) + self.attr = self.Attr(**kwargs) + + def __unicode__(self): + return self.unicode(indent=0) + __str__ = __unicode__ + + def unicode(self, indent=2): + l = [] + SimpleUnicodeVisitor(l.append, indent).visit(self) + return u("").join(l) + + def __repr__(self): + name = self.__class__.__name__ + return "<%r tag object %d>" % (name, id(self)) + +Namespace = NamespaceMetaclass('Namespace', (object, ), { + '__tagspec__': None, + '__tagclass__': Tag, + '__stickyname__': False, +}) + +class HtmlTag(Tag): + def unicode(self, indent=2): + l = [] + HtmlVisitor(l.append, indent, shortempty=False).visit(self) + return u("").join(l) + +# exported plain html namespace +class html(Namespace): + __tagclass__ = HtmlTag + __stickyname__ = True + __tagspec__ = dict([(x,1) for x in ( + 'a,abbr,acronym,address,applet,area,article,aside,audio,b,' + 'base,basefont,bdi,bdo,big,blink,blockquote,body,br,button,' + 'canvas,caption,center,cite,code,col,colgroup,command,comment,' + 'datalist,dd,del,details,dfn,dir,div,dl,dt,em,embed,' + 'fieldset,figcaption,figure,footer,font,form,frame,frameset,h1,' + 'h2,h3,h4,h5,h6,head,header,hgroup,hr,html,i,iframe,img,input,' + 'ins,isindex,kbd,keygen,label,legend,li,link,listing,map,mark,' + 'marquee,menu,meta,meter,multicol,nav,nobr,noembed,noframes,' + 'noscript,object,ol,optgroup,option,output,p,param,pre,progress,' + 'q,rp,rt,ruby,s,samp,script,section,select,small,source,span,' + 'strike,strong,style,sub,summary,sup,table,tbody,td,textarea,' + 'tfoot,th,thead,time,title,tr,track,tt,u,ul,xmp,var,video,wbr' + ).split(',') if x]) + + class Style(object): + def __init__(self, **kw): + for x, y in kw.items(): + x = x.replace('_', '-') + setattr(self, x, y) + + +class raw(object): + """just a box that can contain a unicode string that will be + included directly in the output""" + def __init__(self, uniobj): + self.uniobj = uniobj + +class SimpleUnicodeVisitor(object): + """ recursive visitor to write unicode. """ + def __init__(self, write, indent=0, curindent=0, shortempty=True): + self.write = write + self.cache = {} + self.visited = {} # for detection of recursion + self.indent = indent + self.curindent = curindent + self.parents = [] + self.shortempty = shortempty # short empty tags or not + + def visit(self, node): + """ dispatcher on node's class/bases name. """ + cls = node.__class__ + try: + visitmethod = self.cache[cls] + except KeyError: + for subclass in cls.__mro__: + visitmethod = getattr(self, subclass.__name__, None) + if visitmethod is not None: + break + else: + visitmethod = self.__object + self.cache[cls] = visitmethod + visitmethod(node) + + # the default fallback handler is marked private + # to avoid clashes with the tag name object + def __object(self, obj): + #self.write(obj) + self.write(escape(unicode(obj))) + + def raw(self, obj): + self.write(obj.uniobj) + + def list(self, obj): + assert id(obj) not in self.visited + self.visited[id(obj)] = 1 + for elem in obj: + self.visit(elem) + + def Tag(self, tag): + assert id(tag) not in self.visited + try: + tag.parent = self.parents[-1] + except IndexError: + tag.parent = None + self.visited[id(tag)] = 1 + tagname = getattr(tag, 'xmlname', tag.__class__.__name__) + if self.curindent and not self._isinline(tagname): + self.write("\n" + u(' ') * self.curindent) + if tag: + self.curindent += self.indent + self.write(u('<%s%s>') % (tagname, self.attributes(tag))) + self.parents.append(tag) + for x in tag: + self.visit(x) + self.parents.pop() + self.write(u('') % tagname) + self.curindent -= self.indent + else: + nameattr = tagname+self.attributes(tag) + if self._issingleton(tagname): + self.write(u('<%s/>') % (nameattr,)) + else: + self.write(u('<%s>') % (nameattr, tagname)) + + def attributes(self, tag): + # serialize attributes + attrlist = dir(tag.attr) + attrlist.sort() + l = [] + for name in attrlist: + res = self.repr_attribute(tag.attr, name) + if res is not None: + l.append(res) + l.extend(self.getstyle(tag)) + return u("").join(l) + + def repr_attribute(self, attrs, name): + if name[:2] != '__': + value = getattr(attrs, name) + if name.endswith('_'): + name = name[:-1] + if isinstance(value, raw): + insert = value.uniobj + else: + insert = escape(unicode(value)) + return ' %s="%s"' % (name, insert) + + def getstyle(self, tag): + """ return attribute list suitable for styling. """ + try: + styledict = tag.style.__dict__ + except AttributeError: + return [] + else: + stylelist = [x+': ' + y for x,y in styledict.items()] + return [u(' style="%s"') % u('; ').join(stylelist)] + + def _issingleton(self, tagname): + """can (and will) be overridden in subclasses""" + return self.shortempty + + def _isinline(self, tagname): + """can (and will) be overridden in subclasses""" + return False + +class HtmlVisitor(SimpleUnicodeVisitor): + + single = dict([(x, 1) for x in + ('br,img,area,param,col,hr,meta,link,base,' + 'input,frame').split(',')]) + inline = dict([(x, 1) for x in + ('a abbr acronym b basefont bdo big br cite code dfn em font ' + 'i img input kbd label q s samp select small span strike ' + 'strong sub sup textarea tt u var'.split(' '))]) + + def repr_attribute(self, attrs, name): + if name == 'class_': + value = getattr(attrs, name) + if value is None: + return + return super(HtmlVisitor, self).repr_attribute(attrs, name) + + def _issingleton(self, tagname): + return tagname in self.single + + def _isinline(self, tagname): + return tagname in self.inline + + +class _escape: + def __init__(self): + self.escape = { + u('"') : u('"'), u('<') : u('<'), u('>') : u('>'), + u('&') : u('&'), u("'") : u('''), + } + self.charef_rex = re.compile(u("|").join(self.escape.keys())) + + def _replacer(self, match): + return self.escape[match.group(0)] + + def __call__(self, ustring): + """ xml-escape the given unicode string. """ + try: + ustring = unicode(ustring) + except UnicodeDecodeError: + ustring = unicode(ustring, 'utf-8', errors='replace') + return self.charef_rex.sub(self._replacer, ustring) + +escape = _escape() diff --git a/lib/spack/external/pytest-fallback/py/test.py b/lib/spack/external/pytest-fallback/py/test.py new file mode 100644 index 0000000000..aa5beb1789 --- /dev/null +++ b/lib/spack/external/pytest-fallback/py/test.py @@ -0,0 +1,10 @@ +import sys +if __name__ == '__main__': + import pytest + sys.exit(pytest.main()) +else: + import sys, pytest + sys.modules['py.test'] = pytest + +# for more API entry points see the 'tests' definition +# in __init__.py diff --git a/lib/spack/external/pytest-fallback/pytest.py b/lib/spack/external/pytest-fallback/pytest.py new file mode 100644 index 0000000000..6e124db418 --- /dev/null +++ b/lib/spack/external/pytest-fallback/pytest.py @@ -0,0 +1,100 @@ +# The MIT License (MIT) +# +# Copyright (c) 2004-2017 Holger Krekel and others +# +# Permission is hereby granted, free of charge, to any person obtaining a copy of +# this software and associated documentation files (the "Software"), to deal in +# the Software without restriction, including without limitation the rights to +# use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies +# of the Software, and to permit persons to whom the Software is furnished to do +# so, subject to the following conditions: +# +# The above copyright notice and this permission notice shall be included in all +# copies or substantial portions of the Software. +# +# THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +# IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +# FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +# AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +# LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +# OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE +# SOFTWARE. + +# PYTHON_ARGCOMPLETE_OK +""" +pytest: unit and functional testing with Python. +""" + + +# else we are imported + +from _pytest.config import ( + main, UsageError, _preloadplugins, cmdline, + hookspec, hookimpl +) +from _pytest.fixtures import fixture, yield_fixture +from _pytest.assertion import register_assert_rewrite +from _pytest.freeze_support import freeze_includes +from _pytest import __version__ +from _pytest.debugging import pytestPDB as __pytestPDB +from _pytest.recwarn import warns, deprecated_call +from _pytest.outcomes import fail, skip, importorskip, exit, xfail +from _pytest.mark import MARK_GEN as mark, param +from _pytest.main import Item, Collector, File, Session +from _pytest.fixtures import fillfixtures as _fillfuncargs +from _pytest.python import ( + Module, Class, Instance, Function, Generator, +) + +from _pytest.python_api import approx, raises + +set_trace = __pytestPDB.set_trace + +__all__ = [ + 'main', + 'UsageError', + 'cmdline', + 'hookspec', + 'hookimpl', + '__version__', + 'register_assert_rewrite', + 'freeze_includes', + 'set_trace', + 'warns', + 'deprecated_call', + 'fixture', + 'yield_fixture', + 'fail', + 'skip', + 'xfail', + 'importorskip', + 'exit', + 'mark', + 'param', + 'approx', + '_fillfuncargs', + + 'Item', + 'File', + 'Collector', + 'Session', + 'Module', + 'Class', + 'Instance', + 'Function', + 'Generator', + 'raises', + + +] + +if __name__ == '__main__': + # if run as a script or by 'python -m pytest' + # we trigger the below "else" condition by the following import + import pytest + raise SystemExit(pytest.main()) +else: + + from _pytest.compat import _setup_collect_fakemodule + _preloadplugins() # to populate pytest.* namespace so help(pytest) works + _setup_collect_fakemodule() diff --git a/lib/spack/external/pytest.py b/lib/spack/external/pytest.py deleted file mode 100644 index 6e124db418..0000000000 --- a/lib/spack/external/pytest.py +++ /dev/null @@ -1,100 +0,0 @@ -# The MIT License (MIT) -# -# Copyright (c) 2004-2017 Holger Krekel and others -# -# Permission is hereby granted, free of charge, to any person obtaining a copy of -# this software and associated documentation files (the "Software"), to deal in -# the Software without restriction, including without limitation the rights to -# use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies -# of the Software, and to permit persons to whom the Software is furnished to do -# so, subject to the following conditions: -# -# The above copyright notice and this permission notice shall be included in all -# copies or substantial portions of the Software. -# -# THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR -# IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, -# FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE -# AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER -# LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, -# OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE -# SOFTWARE. - -# PYTHON_ARGCOMPLETE_OK -""" -pytest: unit and functional testing with Python. -""" - - -# else we are imported - -from _pytest.config import ( - main, UsageError, _preloadplugins, cmdline, - hookspec, hookimpl -) -from _pytest.fixtures import fixture, yield_fixture -from _pytest.assertion import register_assert_rewrite -from _pytest.freeze_support import freeze_includes -from _pytest import __version__ -from _pytest.debugging import pytestPDB as __pytestPDB -from _pytest.recwarn import warns, deprecated_call -from _pytest.outcomes import fail, skip, importorskip, exit, xfail -from _pytest.mark import MARK_GEN as mark, param -from _pytest.main import Item, Collector, File, Session -from _pytest.fixtures import fillfixtures as _fillfuncargs -from _pytest.python import ( - Module, Class, Instance, Function, Generator, -) - -from _pytest.python_api import approx, raises - -set_trace = __pytestPDB.set_trace - -__all__ = [ - 'main', - 'UsageError', - 'cmdline', - 'hookspec', - 'hookimpl', - '__version__', - 'register_assert_rewrite', - 'freeze_includes', - 'set_trace', - 'warns', - 'deprecated_call', - 'fixture', - 'yield_fixture', - 'fail', - 'skip', - 'xfail', - 'importorskip', - 'exit', - 'mark', - 'param', - 'approx', - '_fillfuncargs', - - 'Item', - 'File', - 'Collector', - 'Session', - 'Module', - 'Class', - 'Instance', - 'Function', - 'Generator', - 'raises', - - -] - -if __name__ == '__main__': - # if run as a script or by 'python -m pytest' - # we trigger the below "else" condition by the following import - import pytest - raise SystemExit(pytest.main()) -else: - - from _pytest.compat import _setup_collect_fakemodule - _preloadplugins() # to populate pytest.* namespace so help(pytest) works - _setup_collect_fakemodule() diff --git a/lib/spack/spack/cmd/unit_test.py b/lib/spack/spack/cmd/unit_test.py index ce4e2cbdbb..0f117f2d7a 100644 --- a/lib/spack/spack/cmd/unit_test.py +++ b/lib/spack/spack/cmd/unit_test.py @@ -7,14 +7,19 @@ from __future__ import division, print_function import argparse import collections +import os.path import re import sys -import pytest +try: + import pytest +except ImportError: + pytest = None # type: ignore + from six import StringIO +import llnl.util.filesystem import llnl.util.tty.color as color -from llnl.util.filesystem import working_dir from llnl.util.tty.colify import colify import spack.paths @@ -67,7 +72,25 @@ def setup_parser(subparser): def do_list(args, extra_args): """Print a lists of tests than what pytest offers.""" - # Run test collection and get the tree out. + def colorize(c, prefix): + if isinstance(prefix, tuple): + return "::".join( + color.colorize("@%s{%s}" % (c, p)) + for p in prefix if p != "()" + ) + return color.colorize("@%s{%s}" % (c, prefix)) + + # To list the files we just need to inspect the filesystem, + # which doesn't need to wait for pytest collection and doesn't + # require parsing pytest output + files = llnl.util.filesystem.find( + root=spack.paths.test_path, files='*.py', recursive=True + ) + files = [ + os.path.relpath(f, start=spack.paths.spack_root) + for f in files if not f.endswith(('conftest.py', '__init__.py')) + ] + old_output = sys.stdout try: sys.stdout = output = StringIO() @@ -76,12 +99,13 @@ def do_list(args, extra_args): sys.stdout = old_output lines = output.getvalue().split('\n') - tests = collections.defaultdict(lambda: set()) - prefix = [] + tests = collections.defaultdict(set) # collect tests into sections + node_regexp = re.compile(r"(\s*)<([^ ]*) ['\"]?([^']*)['\"]?>") + key_parts, name_parts = [], [] for line in lines: - match = re.match(r"(\s*)<([^ ]*) '([^']*)'", line) + match = node_regexp.match(line) if not match: continue indent, nodetype, name = match.groups() @@ -90,25 +114,31 @@ def do_list(args, extra_args): if "[" in name: name = name[:name.index("[")] - depth = len(indent) // 2 - - if nodetype.endswith("Function"): - key = tuple(prefix) - tests[key].add(name) - else: - prefix = prefix[:depth] - prefix.append(name) - - def colorize(c, prefix): - if isinstance(prefix, tuple): - return "::".join( - color.colorize("@%s{%s}" % (c, p)) - for p in prefix if p != "()" - ) - return color.colorize("@%s{%s}" % (c, prefix)) + len_indent = len(indent) + if os.path.isabs(name): + name = os.path.relpath(name, start=spack.paths.spack_root) + + item = (len_indent, name, nodetype) + + # Reduce the parts to the scopes that are of interest + name_parts = [x for x in name_parts if x[0] < len_indent] + key_parts = [x for x in key_parts if x[0] < len_indent] + + # From version 3.X to version 6.X the output format + # changed a lot in pytest, and probably will change + # in the future - so this manipulation might be fragile + if nodetype.lower() == 'function': + name_parts.append(item) + key_end = os.path.join(*[x[1] for x in key_parts]) + key = next(f for f in files if f.endswith(key_end)) + tests[key].add(tuple(x[1] for x in name_parts)) + elif nodetype.lower() == 'class': + name_parts.append(item) + elif nodetype.lower() in ('package', 'module'): + key_parts.append(item) if args.list == "list": - files = set(prefix[0] for prefix in tests) + files = set(tests.keys()) color_files = [colorize("B", file) for file in sorted(files)] colify(color_files) @@ -144,6 +174,14 @@ def add_back_pytest_args(args, unknown_args): def unit_test(parser, args, unknown_args): + global pytest + if pytest is None: + vendored_pytest_dir = os.path.join( + spack.paths.external_path, 'pytest-fallback' + ) + sys.path.append(vendored_pytest_dir) + import pytest + if args.pytest_help: # make the pytest.main help output more accurate sys.argv[0] = 'spack unit-test' @@ -161,7 +199,7 @@ def unit_test(parser, args, unknown_args): pytest_root = spack.extensions.path_for_extension(target, *extensions) # pytest.ini lives in the root of the spack repository. - with working_dir(pytest_root): + with llnl.util.filesystem.working_dir(pytest_root): if args.list: do_list(args, pytest_args) return diff --git a/lib/spack/spack/test/cmd/unit_test.py b/lib/spack/spack/test/cmd/unit_test.py index 1a273ff244..9811bdbfbd 100644 --- a/lib/spack/spack/test/cmd/unit_test.py +++ b/lib/spack/spack/test/cmd/unit_test.py @@ -22,7 +22,10 @@ def test_list_with_pytest_arg(): def test_list_with_keywords(): - output = spack_test('--list', '-k', 'cmd/unit_test.py') + # Here we removed querying with a "/" to separate directories + # since the behavior is inconsistent across different pytest + # versions, see https://stackoverflow.com/a/48814787/771663 + output = spack_test('--list', '-k', 'unit_test.py') assert output.strip() == cmd_test_py diff --git a/lib/spack/spack/test/conftest.py b/lib/spack/spack/test/conftest.py index 9a6dc0b13b..d502cf1db1 100644 --- a/lib/spack/spack/test/conftest.py +++ b/lib/spack/spack/test/conftest.py @@ -430,8 +430,14 @@ def _skip_if_missing_executables(request): """Permits to mark tests with 'require_executables' and skip the tests if the executables passed as arguments are not found. """ - if request.node.get_marker('requires_executables'): - required_execs = request.node.get_marker('requires_executables').args + if hasattr(request.node, 'get_marker'): + # TODO: Remove the deprecated API as soon as we drop support for Python 2.6 + marker = request.node.get_marker('requires_executables') + else: + marker = request.node.get_closest_marker('requires_executables') + + if marker: + required_execs = marker.args missing_execs = [ x for x in required_execs if spack.util.executable.which(x) is None ] @@ -1453,7 +1459,7 @@ def invalid_spec(request): return request.param -@pytest.fixture("module") +@pytest.fixture(scope='module') def mock_test_repo(tmpdir_factory): """Create an empty repository.""" repo_namespace = 'mock_test_repo' -- cgit v1.2.3-70-g09d2